|
Server : Apache/2.4.18 (Ubuntu) System : Linux canvaswebdesign 3.13.0-71-generic #114-Ubuntu SMP Tue Dec 1 02:34:22 UTC 2015 x86_64 User : oppastar ( 1041) PHP Version : 7.0.33-0ubuntu0.16.04.15 Disable Function : pcntl_alarm,pcntl_fork,pcntl_waitpid,pcntl_wait,pcntl_wifexited,pcntl_wifstopped,pcntl_wifsignaled,pcntl_wifcontinued,pcntl_wexitstatus,pcntl_wtermsig,pcntl_wstopsig,pcntl_signal,pcntl_signal_dispatch,pcntl_get_last_error,pcntl_strerror,pcntl_sigprocmask,pcntl_sigwaitinfo,pcntl_sigtimedwait,pcntl_exec,pcntl_getpriority,pcntl_setpriority, Directory : /proc/self/root/var/www/serbaantik.com/public_html/theme/sofa/ |
Upload File : |
!(function (t) {
function e(i) {
if (n[i]) return n[i].exports
var o = (n[i] = { i: i, l: false, exports: {} })
return t[i].call(o.exports, o, o.exports, e), (o.l = true), o.exports
}
var n = {}
return (
(e.m = t),
(e.c = n),
(e.d = function (t, n, getter) {
if (!e.o(t, n))
Object.defineProperty(t, n, {
configurable: false,
enumerable: true,
get: getter,
})
}),
(e.n = function (t) {
var getter =
t && t.__esModule
? function e() {
return t['default']
}
: function e() {
return t
}
return e.d(getter, 'a', getter), getter
}),
(e.o = function (t, e) {
return Object.prototype.hasOwnProperty.call(t, e)
}),
(e.p = '/Content/BundledScripts/'),
e((e.s = 12533))
)
})({
116: function (t, e, n) {
'use strict'
function i() {
throw new Error('setTimeout has not been defined')
}
function o() {
throw new Error('clearTimeout has not been defined')
}
function a(t) {
if (p === setTimeout) return setTimeout(t, 0)
if ((p === i || !p) && setTimeout)
return (p = setTimeout), setTimeout(t, 0)
try {
return p(t, 0)
} catch (e) {
try {
return p.call(null, t, 0)
} catch (e) {
return p.call(this, t, 0)
}
}
}
function s(t) {
if (m === clearTimeout) return clearTimeout(t)
if ((m === o || !m) && clearTimeout)
return (m = clearTimeout), clearTimeout(t)
try {
return m(t)
} catch (e) {
try {
return m.call(null, t)
} catch (e) {
return m.call(this, t)
}
}
}
function u() {
if (v && y) {
if (((v = false), y.length)) g = y.concat(g)
else w = -1
if (g.length) l()
}
}
function l() {
if (!v) {
var t = a(u)
v = true
for (var e = g.length; e; ) {
for (y = g, g = []; ++w < e; ) if (y) y[w].run()
;(w = -1), (e = g.length)
}
;(y = null), (v = false), s(t)
}
}
function c(t, e) {
;(this.fun = t), (this.array = e)
}
function f() {}
var h = (t.exports = {}),
p,
m
!(function () {
try {
if ('function' == typeof setTimeout) p = setTimeout
else p = i
} catch (t) {
p = i
}
try {
if ('function' == typeof clearTimeout) m = clearTimeout
else m = o
} catch (t) {
m = o
}
})()
var g = [],
v = false,
y,
w = -1
;(h.nextTick = function (t) {
var e = new Array(arguments.length - 1)
if (arguments.length > 1)
for (var n = 1; n < arguments.length; n++) e[n - 1] = arguments[n]
if ((g.push(new c(t, e)), 1 === g.length && !v)) a(l)
}),
(c.prototype.run = function () {
this.fun.apply(null, this.array)
}),
(h.title = 'browser'),
(h.browser = true),
(h.env = {}),
(h.argv = []),
(h.version = ''),
(h.versions = {}),
(h.on = f),
(h.addListener = f),
(h.once = f),
(h.off = f),
(h.removeListener = f),
(h.removeAllListeners = f),
(h.emit = f),
(h.prependListener = f),
(h.prependOnceListener = f),
(h.listeners = function (t) {
return []
}),
(h.binding = function (t) {
throw new Error('process.binding is not supported')
}),
(h.cwd = function () {
return '/'
}),
(h.chdir = function (t) {
throw new Error('process.chdir is not supported')
}),
(h.umask = function () {
return 0
})
},
12533: function (t, e, n) {
'use strict'
n(12534), n(12623)
},
12534: function (t, e, n) {
'use strict'
n(12535)
},
12535: function (t, e, n) {
'use strict'
n(12536),
n(12537),
n(513),
n(12538),
n(12539),
n(12541),
n(12542),
n(12543),
n(12544),
n(916),
n(934),
n(12545),
n(12553),
n(12554),
n(12556),
n(12558),
n(12559),
n(12560),
n(12561),
n(289),
n(12562),
n(12571),
n(12572),
n(12574),
n(12575),
n(12577),
n(12581),
n(12582),
n(12584),
n(12585),
n(12586),
n(12587),
n(956),
n(12588),
n(12589),
n(12590),
n(12591),
n(12592),
n(12593),
n(12594),
n(12596),
n(12597),
n(12600),
n(12601),
n(12602),
n(12604),
n(12606),
n(12607),
n(12616),
n(12617),
n(12618)
},
12536: function (t, e, n) {
'use strict'
function i() {
if (window && document && 'complete' !== document.readyState) {
var t = document.body
if (
t &&
t.classList &&
'function' == typeof t.classList.add &&
'function' == typeof t.classList.remove &&
'function' == typeof t.appendChild &&
'function' == typeof document.createElement &&
'function' == typeof window.addEventListener
) {
var e = 'u-disable-duration'
t.classList.add(e)
var styleNode = document.createElement('style')
;(styleNode.innerHTML =
'.u-disable-duration * {transition-duration: 0s !important;}'),
t.appendChild(styleNode),
window.addEventListener('load', function () {
t.classList.remove(e)
})
}
}
}
i()
},
12537: function (t, e, n) {
'use strict'
if (!('CSS' in window)) window.CSS = {}
if (!('supports' in window.CSS))
'use strict',
(window.CSS._cacheSupports = {}),
(window.CSS.supports = function (t, e) {
function n(t, e) {
var style = document.createElement('div').style
if (void 0 === e) {
var n = function (t, e) {
var n = t.split(e)
if (n.length > 1)
return n
.map(function (t, index, e) {
return index % 2 == 0 ? t + e[index + 1] : ''
})
.filter(Boolean)
},
i = n(t, /([)])\s*or\s*([(])/gi)
if (i)
return i.some(function (t) {
return window.CSS.supports(t)
})
var o = n(t, /([)])\s*and\s*([(])/gi)
if (o)
return o.every(function (t) {
return window.CSS.supports(t)
})
style.cssText = t.replace('(', '').replace(/[)]$/, '')
} else style.cssText = t + ':' + e
return !!style.length
}
var i = [t, e].toString()
if (i in window.CSS._cacheSupports)
return window.CSS._cacheSupports[i]
else return (window.CSS._cacheSupports[i] = n(t, e))
})
},
12538: function (t, e, n) {
'use strict'
function i(t) {
if (
((this.prevMode = ''),
(this.resizeTimeout = 50),
(this.sheet = {
XS: 340,
SM: 540,
MD: 720,
LG: 940,
XL: 1140,
XXL: 1320,
}),
(this.mediaMax = { XS: 575, SM: 767, MD: 991, LG: 1199 }),
(this.modes = ['XL', 'LG', 'MD', 'SM', 'XS']),
(this.defaultMode = 'XL'),
document.body.classList.contains('u-xxl-mode'))
)
(this.mediaMax.XXL = 1399),
(this.defaultMode = 'XXL'),
this.modes.splice(0, 0, 'XXL')
;(this._handlers = []),
this.modes.forEach(function (t) {
var e = document.body.style.getPropertyValue(
'--theme-sheet-width-' + t.toLowerCase()
)
if (((e = parseFloat(e)), Number.isFinite(e))) this.sheet[t] = e
}, this),
this.init(t || [])
}
var ResponsiveMenu = n(935),
o = n(17)
Object.defineProperty(i.prototype, 'mode', {
get: function () {
var t =
(document.documentElement || document.body).clientWidth ||
window.innerWidth
if (this.scrolbar)
document.documentElement.setAttribute('style', 'overflow-y:hidden'),
(t =
(document.documentElement || document.body).clientWidth ||
window.innerWidth),
document.documentElement.removeAttribute('style')
for (var e in this.mediaMax)
if (this.mediaMax.hasOwnProperty(e))
if (t <= this.mediaMax[e]) return e
return this.defaultMode
},
}),
(i.prototype.init = function init(t) {
o(
function () {
this.update(true),
(this.scrolbar = !!(
document.body &&
document.body.clientWidth !== document.body.scrollWidth
))
}.bind(this)
),
o(window).on(
'resize',
function () {
this.update(true)
}.bind(this)
),
t.forEach(function (t) {
this._handlers.push(new t(this))
}, this)
var e = new CustomEvent('np.responsive.init', {
detail: { prevMode: this.prevMode, mode: this.mode },
})
document.dispatchEvent(e), this.update()
}),
(i.prototype.update = function update(t) {
var e = function () {
var t = this.mode
if (t !== this.prevMode || this.getContentWidth() < this.sheet[t]) {
this._handlers.forEach(function (t) {
if ('function' == typeof t.onResponsiveBefore)
t.onResponsiveBefore()
}),
this.responsiveClass(o('html')),
this._handlers.forEach(function (t) {
if ('function' == typeof t.onResponsiveAfter)
t.onResponsiveAfter()
})
var e = new CustomEvent('np.responsive.changed', {
detail: { prevMode: this.prevMode, mode: t },
})
document.dispatchEvent(e), (this.prevMode = t)
}
this._handlers.forEach(function (t) {
if ('function' == typeof t.onResponsiveResize)
t.onResponsiveResize()
})
}.bind(this)
if (t)
clearTimeout(this._timeoutId),
(this._timeoutId = setTimeout(e, this.resizeTimeout))
else e()
}),
(i.prototype.responsiveClass = function t(e) {
var removeList = Object.keys(this.sheet)
.map(function (t) {
return 'u-responsive-' + t.toLowerCase()
})
.join(' ')
e.removeClass(removeList),
e.addClass('u-responsive-' + this.mode.toLowerCase())
}),
(i.prototype.getContentWidth = function () {
return o('.u-body section:first').parent().width()
}),
o(function () {
;(window._responsive = new i([ResponsiveMenu])),
o(document).on(
'click',
'[data-href]:not(.u-back-to-top), [data-post-link]',
function (t) {
if (!t.isDefaultPrevented()) {
var e = o(this),
url = e.attr('data-href') || e.attr('data-post-link'),
n = e.attr('data-target') || '',
i =
o(e).parents('body').find('header') &&
o(e).parents('body').find('header').hasClass('u-sticky'),
a =
url &&
(url.startsWith('#') ||
(url.indexOf('#') > -1 &&
url.indexOf(window.location.href.split('#')[0]) > -1))
if (i && a && window._npScrollAnchor) {
var s = url.split('#')[1] || '',
u = o('#' + s)
if (u.length) window._npScrollAnchor.scroll(u)
} else if (n) window.open(url, n)
else
try {
window.location.href = url
} catch (t) {
console.warn('Incorrect url: ' + url)
}
}
}
)
})
},
12539: function (t, e, n) {
'use strict'
function i() {
return {
submit: function (t) {
t.preventDefault(), t.stopPropagation()
var form = m(this)
form.find('input[type="submit"]').prop('disabled', true)
var url = form.attr('action'),
e = form.attr('source'),
n = form.attr('method') || 'POST',
i = ''
if (
(h(form),
('email' === e || 'customphp' === e) &&
'true' === form.attr('redirect'))
)
i =
form.attr('redirect-url') &&
!m.isNumeric(form.attr('redirect-url'))
? form.attr('redirect-url')
: form.attr('redirect-address')
if (
'email' === e &&
!m(form).find('input[name="npspec-referer"]').length
)
m(form).append(
'<input type="hidden" name="npspec-referer" value="' +
window.location.href +
'">'
)
var o = document.location && document.location.protocol,
u
if (
navigator.userAgent &&
navigator.userAgent.match(/firefox|fxios/i) &&
'file:' === o
)
FormMessage.showError(
form,
'The page is opened as a file on disk and sending emails is not supported.\n' +
'Sending emails works only for pages opened from the domain.'
)
else {
var services = form.find('input[name="formServices"]'),
l = Const.formActionUrl + 'v2/form/process',
c = url === l
if (services.length)
s(form, {
url: l,
method: 'POST',
redirectAddress: i,
showSuccess: c,
success: function () {
if (!c) a(form, { url: url, method: n, redirectAddress: i })
},
})
else a(form, { url: url, method: n, redirectAddress: i })
}
},
click: function (t) {
t.preventDefault(),
t.stopPropagation(),
m(this).find('.u-form-send-success').hide(),
m(this).find('.u-form-send-error').hide()
var form = m(this).closest('form')
if ((o(form), !g.signatureValidation(form)))
return (
FormMessage.showError(form, 'The Signature field is required'),
void 0
)
if (!c(form))
return (
FormMessage.showError(form, 'The File field is required'), void 0
)
if (!f(form))
return (
FormMessage.showError(
form,
'Unable to submit the contact form. Please accept the cookie consent for the correct recaptcha functioning.'
),
void 0
)
else
return (
g.addSignatureFiles(form),
form.find('input[type="submit"]').click(),
void 0
)
},
}
}
function o(form) {
form.find('.u-form-checkbox-group').each(function () {
var t = m(this),
e = t.find('input'),
n = e.length,
i = n > 0 ? e[0] : null,
o
if (e.attr('required') || t.attr('data-required')) {
e.removeAttr('required'), t.attr('data-required', 'required')
for (var a = false, s = 0; s < n; s++)
if (e[s].checked) {
a = true
break
}
var u = !a ? 'At least one checkbox must be selected.' : ''
i.setCustomValidity(u)
}
})
}
function a(form, t) {
if (/list-manage[1-9]?.com/i.test(t.url)) return u(form, t.url), void 0
s(form, {
url: t.url,
method: t.method,
redirectAddress: t.redirectAddress,
success: l,
showSuccess: true,
})
}
function s(form, t) {
var e = function () {
m.ajax({
type: t.method,
url: t.url,
data: new FormData(form[0]),
dataType: 'json',
processData: false,
contentType: false,
})
.done(function (data, e) {
if (
(data && (data.success || data.ok)) ||
(!data && 'success' === e)
) {
if (t.showSuccess) FormMessage.showSuccess(form)
if (t.redirectAddress)
setTimeout(function () {
window.location.replace(t.redirectAddress)
}, 2e3)
else t.success(form)
} else (data = data || {}), FormMessage.showError(form, data.error, data.errorId, data.email)
})
.fail(function () {
FormMessage.showError(form)
})
}
if (void 0 !== window.recaptchaObject)
window.recaptchaObject.executeContact(e)
else e()
}
function u(form, url) {
var t = form.find('input[name=name]').val(),
email = form.find('input[name=email]').val(),
data = { Email: email, EMAIL: email }
if (t) (data.Name = t), (data.FNAME = t)
var e = form.find('input, textarea')
m.each(e, function (index, t) {
var e = m(t).attr('name'),
n = m(t).val()
if (e && n) data[e.toUpperCase()] = n
})
var n =
(url = url.replace('/post?', '/post-json?') + '&c=?').indexOf('u=') + 2
n = url.substring(n, url.indexOf('&', n))
var i = url.indexOf('id=') + 3
;(i = url.substring(i, url.indexOf('&', i))),
(data['b_' + n + '_' + i] = ''),
m
.ajax({ url: url, data: data, dataType: 'jsonp' })
.done(function (t) {
var e
if ('success' === t.result || /already/.test(t.msg))
FormMessage.showSuccess(form), l(form)
else FormMessage.showError(form, t.msg)
})
.fail(function () {
FormMessage.showError(form)
})
}
function l(form) {
var dialog = new Dialog(form)
setTimeout(function () {
dialog.close()
}, 2e3)
}
function c(form) {
var t = form.find('input[type="file"][required]')
if (!t.length) return true
else
return t.toArray().every(function (input) {
return input.files.length
})
}
function f(form) {
var t = form.hasClass('u-form-custom-backend'),
e = form.find('input[name="recaptchaResponse"]'),
n = form.parents('body').find('.u-cookies-consent'),
i =
document.cookie && document.cookie.indexOf('u-gdpr-cookie=true') > -1
if (t) return true
if (n.length && e.length && !i) return false
else return true
}
function h(form) {
var t
form.find('input[type=tel]').each(function () {
var t = m(this),
e = t.parents('.iti').find('.iti__selected-flag').attr('title') || ''
t.val(e + ' ' + t.val())
})
}
function p(form) {
var services
if (form.find('input[name="formServices"]').length) {
var t = Const.formActionUrl + 'v2/form/process',
e = form.attr('action') === t
s(form, {
url: t,
method: 'POST',
redirectAddress: '',
showSuccess: e,
success: function () {},
})
}
}
var m = n(17),
Dialog = n(286),
g = n(12540),
FormMessage = n(3537),
Const = n(3538)
m(function () {
var form = new i()
;(window.serviceRequest = p),
m(
'form.u-form-vertical:not(.u-form-custom-backend), form.u-form-horizontal:not(.u-form-custom-backend)'
).submit(form.submit),
m('.u-form .u-btn-submit').click(form.click)
}),
(window.MailChimpForm = i)
},
12540: function (t, e, n) {
'use strict'
function i(t) {
var e = JSON.parse(t.getAttribute('data-canvas-default-options') || '{}')
a(t, e)
}
function o(t) {
var e,
n = t.clone().get(0),
i = JSON.parse(n.getAttribute('data-canvas-default-options') || '{}')
return a(n, i), n.toDataURL()
}
function a(t, e) {
var n = t.getContext('2d')
n.clearRect(0, 0, e.width, e.height),
(n.lineWidth = e.lineWidth),
(n.strokeStyle = e.strokeStyle),
(n.fillStyle = e.fillStyle),
n.fillRect(0, 0, e.width, e.height),
n.beginPath(),
n.moveTo(e.signatureLine.startX, e.signatureLine.startY),
n.lineTo(e.signatureLine.endX, e.signatureLine.endY),
n.stroke()
}
function s(t, fileName) {
for (
var e = t.split(','),
n = e[0].match(/:(.*?);/)[1],
i = atob(e[1]),
o = i.length,
a = new Uint8Array(o);
o--;
)
a[o] = i.charCodeAt(o)
var s = new Blob([a], { type: n })
return new File([s], fileName)
}
var u = (t.exports = {})
;(u.signatureValidation = function t(form) {
var e = form.find('canvas'),
n,
data
if (!e.length) return true
if (!e.attr('data-required')) return true
else return o(e) !== e.get(0).toDataURL()
}),
(u.addSignatureFiles = function t(form) {
form.find('.u-form-signature canvas').each(function () {
var t = $(this).get(0),
e,
n = s(t.toDataURL(), 'signature.png'),
o = form.find('.u-form-signature-file')
if (o.length) o.remove()
var file = $(
'<input class="u-form-signature-file" style="display:none" type="file" name="file">'
)
form.append(file)
var a = new DataTransfer()
a.items.add(n), (file[0].files = a.files), i(t)
})
})
},
12541: function (t, e, n) {
'use strict'
var i = n(662).evaluate,
o = n(663)
$(function () {
function t(t) {
var form
$(t && t.target)
.closest('form')
.each(function (index, form) {
var t = new o(form).getScope()
$(form)
.find('[data-expression]')
.each(function () {
var e = $(this),
n = e.closest('.u-form-calc').find('.u-calc-input')
try {
var o = e.attr('data-expression'),
a = i(o, t)
e.text(a), n.val(a)
} catch (t) {
e.text(0), n.val(0)
}
})
})
}
$('body').on('input', 'input[type=number][name]', t),
$('body').on(
'change',
'input[type=range][name], input[type=radio][name], input[type=checkbox][name], select[name]',
t
)
})
},
12542: function (t, e, n) {
'use strict'
function i() {
$('.u-form input[type=file]').change(function () {
var form = $(this).closest('.u-form')
l(form), c(form)
})
}
function o() {
$('.u-form .u-upload-button').click(function (t) {
t.stopPropagation(),
t.preventDefault(),
$(this).closest('.u-form').find('input[type="file"]').click()
})
}
function a() {
$('.u-form').on('click', '.u-file-remove', function (t) {
t.stopPropagation(), t.preventDefault()
var e = $(this),
form = e.closest('.u-form'),
n = e.closest('.u-file-item'),
i = parseFloat(n.attr('data-i'))
if (Number.isFinite(i)) f(form, i), c(form)
})
}
function s() {
$('.u-form').on('reset', function () {
var form = $(this).closest('.u-form'),
input = form.find('input[type="file"]').get(0)
if (input) (input.files = new DataTransfer().files), c(form)
})
}
function u() {
$('.u-form input[type="file"]').each(function () {
var t = $(this),
e = t.attr('accept')
if (e in FormFileAccept) e = FormFileAccept[e]
t.attr('accept', e)
})
}
function l(form) {
var input = form.find('input[type="file"]').get(0),
t = []
if (input)
if (
(Array.from(input.files).forEach(function (file, e) {
if (file.size > h || e >= p) t.push({ i: e, name: file.name })
}),
t.length)
) {
f(
form,
t.map(function (t) {
return t.i
})
)
var e = '"{files}" file(s) size exceeds maximum limit.',
n = t
.map(function (t) {
return t.name
})
.join(', ')
FormMessage.showError(form, e.replace(/\{files\}/, n))
}
}
function c(form) {
form.find('.u-file-list .u-file-item:not(.u-file-template)').remove()
var input = form.find('input[type="file"]').get(0),
t = form.find('.u-file-template')
if (input)
Array.from(input.files).forEach(function (file, e) {
var n = t.clone()
n.removeClass('u-file-template'),
n.find('.u-file-name').text(file.name),
n.attr('data-i', e),
form.find('.u-file-list').append(n)
})
}
function f(form, index) {
var input = form.find('input[type="file"]').get(0),
t = new DataTransfer()
if (input) {
if (!Array.isArray(index)) index = [index]
Array.from(input.files).forEach(function (file, e) {
if (!index.includes(e)) t.items.add(file)
}),
(input.files = t.files)
}
}
var FormFileAccept = n(666),
FormMessage = n(3537),
h = 10 * 1024 * 1024,
p = 10
$(function () {
i(), o(), a(), s(), u()
})
},
12543: function (t, e, n) {
'use strict'
function i(el) {
var video
el.find('.u-video .embed-responsive-item').each(function () {
if (this.matches('video')) this.pause()
else if (this.matches('iframe')) {
var t = this.getAttribute('src') || this.getAttribute('data-src')
this.setAttribute('src', t.replace(/autoplay=1?/gi, ''))
}
})
}
function o(t) {
var video
;(t.hasClass('u-video') ? t : t.find('.u-video'))
.find('.embed-responsive-item[data-autoplay]')
.each(function () {
a(s(this).closest('.u-video'))
})
}
function a(video) {
if (!video.closest('.u-dialog-block:not(.u-dialog-open)').length) {
var t = video.find('iframe'),
e = t.attr('data-src') || t.attr('src'),
n = video.find('video')
if (e)
video.addClass('active'),
(e += (-1 === e.indexOf('?') ? '?' : '&') + 'autoplay=1'),
t.attr('src', e)
else if (n.length) {
video.addClass('active')
var i = n[0]
if (i.paused) i.play()
else i.pause()
}
}
}
var s = n(17)
s(document).on('click', '.u-video-poster, .u-video video', function (t) {
var e, video
t.preventDefault(), a(s(this).closest('.u-video'))
}),
s(function () {
s(
'.u-video-background .u-video-poster, .u-video-background .u-video video'
).each(function () {
a(s(this).closest('.u-video'))
}),
s(
'.u-video .embed-responsive-item:not(.lazyloading, .lazyloaded) + .u-video-poster'
).each(function () {
var t = this.getAttribute('data-src')
if (t) this.style.backgroundImage = 'url(' + t + ')'
o(s(this).closest('.u-video'))
})
}),
s(document).on('opened.np.dialog', '.u-dialog-block', function (t) {
o(s(t.currentTarget))
}),
s(document).on('closed.np.dialog', '.u-dialog-block', function (t) {
i(s(t.currentTarget))
})
},
12544: function (t, e, n) {
'use strict'
function i(t) {
;(this._audioElement = t.querySelector('audio')),
(this._playButton = t.querySelector('.player-play-btn')),
(this._playIcon = this._playButton.querySelector('.player-icon-play')),
(this._pauseIcon =
this._playButton.querySelector('.player-icon-pause')),
(this._progress = t.querySelector('.u-player-progress')),
(this._playerCurrentTime = t.querySelector('.player-time-current')),
(this._progressFilled = t.querySelector('.u-player-progress-filled')),
(this._progressFilled.style.flexBasis = 'auto'),
(this._playerDuration = t.querySelector('.player-time-duration')),
(this._mousedown = false)
}
var o = n(17)
;(i.prototype.build = function t() {
this.setTimes(), this.initPlayerEvents(), this.initProgressEvents()
}),
(i.prototype.initProgressEvents = function t() {
this._progress.addEventListener('click', this.scrub.bind(this)),
this._progress.addEventListener(
'mousemove',
function (t) {
if (this._mousedown) this.scrub(t)
}.bind(this)
),
this._progress.addEventListener('mousedown', function () {
this._mousedown = true
}),
this._progress.addEventListener('mouseup', function () {
this._mousedown = false
})
}),
(i.prototype.initPlayerEvents = function t() {
this._audioElement.addEventListener(
'timeupdate',
function () {
this.progressUpdate(), this.setTimes()
}.bind(this)
),
this._audioElement.addEventListener(
'loadedmetadata',
function () {
this.setTimes()
}.bind(this)
),
this._playButton.addEventListener(
'click',
function () {
if ('false' === this._playButton.dataset.playing) {
var t = this._audioElement.play()
if (void 0 !== t)
t.then(
function () {
;(this._playButton.dataset.playing = 'true'),
this._playIcon.classList.add('u-hidden'),
this._pauseIcon.classList.remove('u-hidden')
}.bind(this)
).catch(function () {})
} else if ('true' === this._playButton.dataset.playing)
this._audioElement.pause(),
(this._playButton.dataset.playing = 'false'),
this._pauseIcon.classList.add('u-hidden'),
this._playIcon.classList.remove('u-hidden')
}.bind(this)
),
this._audioElement.addEventListener(
'ended',
function () {
;(this._playButton.dataset.playing = 'false'),
this._pauseIcon.classList.add('u-hidden'),
this._playIcon.classList.remove('u-hidden'),
(this._progressFilled.style.flexBasis = '0%'),
(this._audioElement.currentTime = 0)
}.bind(this)
)
}),
(i.prototype.progressUpdate = function t() {
var e =
(this._audioElement.currentTime / this._audioElement.duration) * 100
this._progressFilled.style.flexBasis = e + '%'
}),
(i.prototype.scrub = function t(e) {
this._audioElement.currentTime =
(e.offsetX / this._progress.offsetWidth) * this._audioElement.duration
}),
(i.prototype.setTimes = function t() {
if (this._audioElement.duration) {
var e = new Date(1e3 * this._audioElement.currentTime)
this._playerCurrentTime.textContent = e
.toISOString()
.substring(14, 19)
var n = new Date(1e3 * this._audioElement.duration)
this._playerDuration.textContent = n.toISOString().substring(14, 19)
}
}),
o(window).on('load', function () {
o('.u-audio').each(function () {
var t
new i(o(this).get(0)).build()
})
})
},
12545: function (t, e, n) {
'use strict'
var i = n(17),
o = n(12546)
i(function () {
new o().init()
})
},
12546: function (t, e, n) {
'use strict'
function i() {
;(this.galleries = null),
(this._pswpElement = null),
(this._listeners = []),
(this._onItemClick = this.onItemClick.bind(this))
}
var Utils = n(12547),
o = n(12548),
a = n(12549),
s = n(12550),
u = n(17),
l = n(12551),
c = n(12552)
;(t.exports = i),
Object.defineProperty(i.prototype, 'pswpElement', {
get: function () {
if (!this._pswpElement) this._pswpElement = u('.pswp')[0]
if (!this._pswpElement) {
var t = u(a.PSWP_TEMPLATE).appendTo('.u-body')
this._pswpElement = t[0]
}
return this._pswpElement
},
}),
(i.prototype.init = function () {
this.initGallery(), this.subscribe(), this.checkHashUrl()
}),
(i.prototype.initGallery = function () {
var t = {}
u(a.LIGHTBOX_SELECTOR).each(function (t) {
u(this).attr('data-pswp-uid', t + 1)
}),
u(a.GALLERY_ITEM_SELECTOR).each(function () {
var e = this.closest(a.LIGHTBOX_SELECTOR)
if (e && this !== e) {
var n = e.getAttribute('data-pswp-uid'),
gallery = t[n]
if (!gallery) gallery = { dom: e, items: [] }
this.setAttribute('data-pswp-item-id', gallery.items.length),
this.setAttribute('data-gallery-uid', n),
gallery.items.push(this),
(t[n] = gallery)
}
}),
(this.galleries = t)
}),
(i.prototype.subscribe = function () {
for (var t = Object.keys(this.galleries), e = 0; e < t.length; e++)
for (
var id = t[e], gallery = this.galleries[id], n = 0;
n < gallery.items.length;
n++
) {
var i = gallery.items[n]
u(i).on('click', this._onItemClick)
}
}),
(i.prototype.onItemClick = function (t) {
var e = t.currentTarget
if (!e.matches('[data-href]')) {
t.preventDefault(), t.stopPropagation(), (t.returnValue = false)
var index = e.getAttribute('data-pswp-item-id'),
n = e.getAttribute('data-gallery-uid'),
gallery = this.galleries[n]
if (gallery && index >= 0) this.openOnClick(index, gallery)
}
}),
(i.prototype.listen = function (t, e) {
this._listeners.push({ event: t, func: e })
}),
(i.prototype.checkHashUrl = function () {
var t = Utils.parseHash()
if (t.pid && t.gid) this.openFromUrl(t.pid, this.galleries[t.gid])
}),
(i.prototype.openOnClick = function (index, gallery) {
var t = gallery.dom.getAttribute('data-pswp-uid')
o.gallery(
gallery,
function (items) {
var e = this.buildOptions(t, items)
;(e.index = parseFloat(index)),
(e.showPreviews =
gallery.dom.classList.contains('u-product-control')),
this.showPswp(items, e)
},
this
)
}),
(i.prototype.openFromUrl = function (index, gallery) {
var t = gallery.dom.getAttribute('data-pswp-uid')
o.gallery(
gallery,
function (items) {
var e = this.buildOptions(t, items)
if (
((e.showAnimationDuration = 0),
(e.index = parseFloat(index) - 1),
(e.showPreviews =
gallery.dom.classList.contains('u-product-control')),
e.galleryPIDs)
)
for (var n = 0; n < items.length; n++)
if (items[n].pid == index) {
e.index = n
break
}
this.showPswp(items, e)
},
this
)
}),
(i.prototype.showPswp = function (items, t) {
if (Number.isFinite(t.index)) {
var e = new l(this.pswpElement, c, items, t)
s.init(e, t),
this._listeners.forEach(function (t) {
e.listen(t.event, t.func)
}),
e.init()
}
}),
(i.prototype.buildOptions = function (t, items) {
var e
return {
galleryUID: t,
getThumbBoundsFn: function (index) {
var t = window.pageYOffset || document.documentElement.scrollTop,
rect = items[index].el.getBoundingClientRect()
return { x: rect.left, y: rect.top + t, w: rect.width }
},
addCaptionHTMLFn: function (t, e, n) {
if (n) return (e.children[0].innerHTML = '<br><br>'), true
if (!t.title) return (e.children[0].innerHTML = ''), false
var html = t.title
if (t.desc) html += '<br><small>' + t.desc + '</small>'
return (e.children[0].innerHTML = html), true
},
showHideOpacity: true,
history: window.location === window.parent.location,
}
}),
(window.Lightbox = i)
},
12547: function (t, e, n) {
'use strict'
var Utils
;(t.exports = {}).parseHash = function t() {
var hash = window.location.hash.substring(1),
e = {}
if (hash.length < 5) return e
for (var n = hash.split('&'), i = 0; i < n.length; i++)
if (n[i]) {
var o = n[i].split('=')
if (!(o.length < 2)) e[o[0]] = o[1]
}
if (e.gid) e.gid = parseInt(e.gid, 10)
return e
}
},
12548: function (t, e, n) {
'use strict'
function i(t) {
return new Promise(function (e, n) {
if (t.is('.u-background-effect ~ .u-container-layout'))
i(
t.prev('.u-background-effect').find('.u-background-effect-image')
).then(function (t) {
e(t)
}, n)
else if (t.is('img')) {
var a =
t[0].naturalWidth ||
t.attr('data-image-width') ||
t.attr('imgwidth') ||
t.width(),
s =
t[0].naturalHeight ||
t.attr('data-image-height') ||
t.attr('imgheight') ||
t.height()
e({
el: t[0],
src: t.attr('src'),
msrc: t.attr('src'),
w: parseFloat(a),
h: parseFloat(s),
})
} else if (t.is('.u-video'))
e({ el: t[0], html: t.find('.u-background-video').get(0).outerHTML })
else if (t.is('.u-gallery-item'))
i(t.find('.u-back-slide')).then(function (t) {
e(t)
}, n)
else if (t.is('.u-back-slide'))
i(t.find('.u-back-image')).then(function (n) {
var i = t.siblings('.u-over-slide'),
o = t.closest('.u-gallery').is('.u-layout-thumbnails')
if (i.length && !o)
(n.title = i.find('.u-gallery-heading').html()),
(n.desc = i.find('.u-gallery-text').html())
e(n)
}, n)
else
o(t).then(function (n) {
e({ el: t[0], src: n.src, msrc: n.src, w: n.width, h: n.height })
}, n)
})
}
function o(t) {
var e = t.css('background-image'),
n = e.match(/url\(['"]?(.+?)['"]?\)/)
return new Promise(function (t, i) {
if (n) {
var o = new Image()
;(o.onload = t.bind(null, o)),
(o.onerror = o.onabort = i),
(o.src = n[1])
} else i(new Error('Invalid source: ' + e))
})
}
var a = n(17),
s
;(t.exports = {}).gallery = function gallery(gallery, t, e) {
e = e || null
var n = gallery.items.map(function (t) {
return i((t = a(t)))
})
Promise.all(n).then(t.bind(e), console.log)
}
},
12549: function (t, e, n) {
'use strict'
var i = (t.exports = {})
;(i.LIGHTBOX_SELECTOR = '.u-lightbox'),
(i.GALLERY_ITEM_SELECTOR = [
'.u-image:not(.u-carousel-thumbnail-image):not(.u-background-effect-image)',
'.u-gallery-item',
'.u-background-effect ~ .u-container-layout',
].join(', ')),
(i.PSWP_TEMPLATE =
'<div class="pswp" tabindex="-1" role="dialog" aria-hidden="true">\n' +
' <div class="pswp__bg"></div>\n' +
' <div class="pswp__scroll-wrap">\n' +
' <div class="pswp__container">\n' +
' <div class="pswp__item"></div>\n' +
' <div class="pswp__item"></div>\n' +
' <div class="pswp__item"></div>\n' +
' </div>\n' +
' <div class="pswp__ui pswp__ui--hidden">\n' +
' <div class="pswp__top-bar">\n ' +
' <div class="pswp__counter"></div>\n' +
' <button class="pswp__button pswp__button--close" title="Close (Esc)"></button>\n' +
' <button class="pswp__button pswp__button--share" title="Share"></button>\n' +
' <button class="pswp__button pswp__button--fs" title="Toggle fullscreen"></button>\n' +
' <button class="pswp__button pswp__button--zoom" title="Zoom in/out"></button>\n' +
' <div class="pswp__preloader">\n' +
' <div class="pswp__preloader__icn">\n' +
' <div class="pswp__preloader__cut">\n' +
' <div class="pswp__preloader__donut"></div>\n' +
' </div>\n' +
' </div>\n' +
' </div>\n' +
' </div>\n' +
' <div class="pswp__share-modal pswp__share-modal--hidden pswp__single-tap">\n' +
' <div class="pswp__share-tooltip"></div>\n' +
' </div>\n' +
' <button class="pswp__button pswp__button--arrow--left" title="Previous (arrow left)"></button>\n' +
' <button class="pswp__button pswp__button--arrow--right" title="Next (arrow right)"></button>\n' +
' <div class="pswp__previews" data-previews="data-previews" style="display: none"></div>' +
' <div class="pswp__caption">\n' +
' <div class="pswp__caption__center"></div>\n' +
' </div>\n' +
' </div>\n' +
' </div>\n' +
'</div>')
},
12550: function (t, e, n) {
'use strict'
function i(gallery, selector) {
var t = gallery.scrollWrap,
e = t.querySelector(selector),
n
;(t.querySelector('.pswp__caption').style.display = 'none'),
(e.style.display = '')
}
function o(gallery, selector) {
var t = gallery.scrollWrap,
e = t.querySelector(selector),
n
;(t.querySelector('.pswp__caption').style.display = ''),
(e.style.display = 'none')
}
function add(gallery, selector) {
var t = gallery.scrollWrap,
items = gallery.items,
e = t.querySelector(selector)
items.forEach(function (t) {
var preview = t.msrc,
n = document.createElement('img')
n.setAttribute('src', preview),
n.addEventListener('click', function () {
gallery.goTo(items.indexOf(t))
}),
e.appendChild(n)
})
}
function remove(gallery, selector) {
var t, e
gallery.scrollWrap.querySelector(selector).innerHTML = ''
}
function a(gallery, selector) {
var t = gallery.scrollWrap,
e,
preview = gallery.currItem.msrc,
n,
i
t.querySelector(selector)
.querySelectorAll('img')
.forEach(function (t) {
var e,
n = 'active'
if (t.getAttribute('src') === preview)
t.classList.add(n), t.scrollIntoView({ behavior: 'smooth' })
else t.classList.remove(n)
})
}
var s
t.exports.init = function init(gallery, t) {
var e = false
gallery.listen('gettingData', function () {
if (!e) {
if (((e = true), t.showPreviews)) i(gallery, '[data-previews]')
else o(gallery, '[data-previews]')
add(gallery, '[data-previews]')
}
}),
gallery.listen('close', function () {
remove(gallery, '[data-previews]')
}),
gallery.listen('afterChange', function () {
a(gallery, '[data-previews]')
})
}
},
12551: function (t, e, n) {
'use strict'
var i, o
/*! PhotoSwipe - v4.1.3 - 2019-01-08
* http://photoswipe.com
* Copyright (c) 2019 Dmitry Semenov; */ !(function (a, factory) {
if (true)
!(
void 0 !==
(o = 'function' == typeof (i = factory) ? i.call(e, n, e, t) : i) &&
(t.exports = o)
)
else if ('object' == typeof e) t.exports = factory()
else a.PhotoSwipe = factory()
})(this, function () {
var t = function (template, t, items, e) {
var n = {
features: null,
bind: function (t, type, e, n) {
var i = (n ? 'remove' : 'add') + 'EventListener'
type = type.split(' ')
for (var o = 0; o < type.length; o++)
if (type[o]) t[i](type[o], e, false)
},
isArray: function (t) {
return t instanceof Array
},
createEl: function (t, e) {
var el = document.createElement(e || 'div')
if (t) el.className = t
return el
},
getScrollY: function () {
var t = window.pageYOffset
return void 0 !== t ? t : document.documentElement.scrollTop
},
unbind: function (t, type, e) {
n.bind(t, type, e, true)
},
removeClass: function (el, t) {
var e = new RegExp('(\\s|^)' + t + '(\\s|$)')
el.className = el.className
.replace(e, ' ')
.replace(/^\s\s*/, '')
.replace(/\s\s*$/, '')
},
addClass: function (el, t) {
if (!n.hasClass(el, t))
el.className += (el.className ? ' ' : '') + t
},
hasClass: function (el, t) {
return (
el.className &&
new RegExp('(^|\\s)' + t + '(\\s|$)').test(el.className)
)
},
getChildByClass: function (t, e) {
for (var i = t.firstChild; i; ) {
if (n.hasClass(i, e)) return i
i = i.nextSibling
}
},
arraySearch: function (t, e, n) {
for (var i = t.length; i--; ) if (t[i][n] === e) return i
return -1
},
extend: function (t, e, n) {
for (var i in e)
if (e.hasOwnProperty(i)) {
if (n && t.hasOwnProperty(i)) continue
t[i] = e[i]
}
},
easing: {
sine: {
out: function (t) {
return Math.sin(t * (Math.PI / 2))
},
inOut: function (t) {
return -(Math.cos(Math.PI * t) - 1) / 2
},
},
cubic: {
out: function (t) {
return --t * t * t + 1
},
},
},
detectFeatures: function () {
if (n.features) return n.features
var t,
e = n.createEl().style,
i = '',
o = {}
if (
((o.oldIE = document.all && !document.addEventListener),
(o.touch = 'ontouchstart' in window),
window.requestAnimationFrame)
)
(o.raf = window.requestAnimationFrame),
(o.caf = window.cancelAnimationFrame)
if (
((o.pointerEvent =
!!window.PointerEvent || navigator.msPointerEnabled),
!o.pointerEvent)
) {
var a = navigator.userAgent
if (/iP(hone|od)/.test(navigator.platform)) {
var s = navigator.appVersion.match(/OS (\d+)_(\d+)_?(\d+)?/)
if (s && s.length > 0)
if ((s = parseInt(s[1], 10)) >= 1 && s < 8)
o.isOldIOSPhone = true
}
var u = a.match(/Android\s([0-9\.]*)/),
l = u ? u[1] : 0
if ((l = parseFloat(l)) >= 1) {
if (l < 4.4) o.isOldAndroid = true
o.androidVersion = l
}
o.isMobileOpera = /opera mini|opera mobi/i.test(a)
}
for (
var c = ['transform', 'perspective', 'animationName'],
f = ['', 'webkit', 'Moz', 'ms', 'O'],
h,
p,
m = 0;
m < 4;
m++
) {
i = f[m]
for (var g = 0; g < 3; g++)
if (
((h = c[g]),
(p = i + (i ? h.charAt(0).toUpperCase() + h.slice(1) : h)),
!o[h] && p in e)
)
o[h] = p
if (i && !o.raf)
if (
((i = i.toLowerCase()),
(o.raf = window[i + 'RequestAnimationFrame']),
o.raf)
)
o.caf =
window[i + 'CancelAnimationFrame'] ||
window[i + 'CancelRequestAnimationFrame']
}
if (!o.raf) {
var v = 0
;(o.raf = function (t) {
var e = new Date().getTime(),
n = Math.max(0, 16 - (e - v)),
id = window.setTimeout(function () {
t(e + n)
}, n)
return (v = e + n), id
}),
(o.caf = function (id) {
clearTimeout(id)
})
}
return (
(o.svg =
!!document.createElementNS &&
!!document.createElementNS('http://www.w3.org/2000/svg', 'svg')
.createSVGRect),
(n.features = o),
o
)
},
}
if ((n.detectFeatures(), n.features.oldIE))
n.bind = function (t, type, e, n) {
type = type.split(' ')
for (
var i = (n ? 'detach' : 'attach') + 'Event',
o,
a = function () {
e.handleEvent.call(e)
},
s = 0;
s < type.length;
s++
)
if ((o = type[s]))
if ('object' == typeof e && e.handleEvent) {
if (!n) e['oldIE' + o] = a
else if (!e['oldIE' + o]) return false
t[i]('on' + o, e['oldIE' + o])
} else t[i]('on' + o, e)
}
var i = this,
o = 25,
a = 3,
s = {
allowPanToNext: true,
spacing: 0.12,
bgOpacity: 1,
mouseUsed: false,
loop: true,
pinchToClose: true,
closeOnScroll: true,
closeOnVerticalDrag: true,
verticalDragRange: 0.75,
hideAnimationDuration: 333,
showAnimationDuration: 333,
showHideOpacity: false,
focus: true,
escKey: true,
arrowKeys: true,
mainScrollEndFriction: 0.35,
panEndFriction: 0.35,
isClickableElement: function (el) {
return 'A' === el.tagName
},
getDoubleTapZoom: function (t, e) {
if (t) return 1
else return e.initialZoomLevel < 0.7 ? 1 : 1.33
},
maxSpreadZoom: 1.33,
modal: true,
scaleMode: 'fit',
}
n.extend(s, e)
var u = function () {
return { x: 0, y: 0 }
},
l,
c,
f,
h,
p,
m,
g = { x: 0, y: 0 },
v = { x: 0, y: 0 },
y = { x: 0, y: 0 },
w,
b,
C,
S = {},
x,
A,
_,
T,
E,
I,
k = 0,
M = {},
L = { x: 0, y: 0 },
P,
O,
B = 0,
F,
N,
U,
z,
H,
$,
Y = true,
W,
V = [],
G,
j,
K,
Z,
X,
J,
tt,
nt = {},
rt = false,
ot,
at = function (t, e) {
n.extend(i, e.publicMethods), V.push(t)
},
st = function (index) {
var t = wn()
if (index > t - 1) return index - t
else if (index < 0) return t + index
return index
},
ut = {},
lt = function (t, e) {
if (!ut[t]) ut[t] = []
return ut[t].push(e)
},
ct = function (t) {
var e = ut[t]
if (e) {
var n = Array.prototype.slice.call(arguments)
n.shift()
for (var o = 0; o < e.length; o++) e[o].apply(i, n)
}
},
ft = function () {
return new Date().getTime()
},
dt = function (t) {
;(Le = t), (i.bg.style.opacity = t * s.bgOpacity)
},
ht = function (t, e, n, o, a) {
if (!rt || (a && a !== i.currItem))
o /= a ? a.fitRatio : i.currItem.fitRatio
t[H] = _ + e + 'px, ' + n + 'px' + T + ' scale(' + o + ')'
},
pt = function (t) {
if (xe) {
if (t)
if (x > i.currItem.fitRatio) {
if (!rt) En(i.currItem, false, true), (rt = true)
} else if (rt) En(i.currItem), (rt = false)
ht(xe, y.x, y.y, x)
}
},
mt = function (t) {
if (t.container)
ht(
t.container.style,
t.initialPosition.x,
t.initialPosition.y,
t.initialZoomLevel,
t
)
},
gt = function (t, e) {
e[H] = _ + t + 'px, 0px' + T
},
vt = function (t, e) {
if (!s.loop && e) {
var n = h + (L.x * k - t) / L.x,
i = Math.round(t - Se.x)
if ((n < 0 && i > 0) || (n >= wn() - 1 && i < 0))
t = Se.x + i * s.mainScrollEndFriction
}
;(Se.x = t), gt(t, p)
},
yt = function (t, e) {
var n = _e[t] - M[t]
return v[t] + g[t] + n - n * (e / A)
},
wt = function (t, e) {
if (((t.x = e.x), (t.y = e.y), e.id)) t.id = e.id
},
bt = function (t) {
;(t.x = Math.round(t.x)), (t.y = Math.round(t.y))
},
Ct = null,
St = function () {
if (Ct)
n.unbind(document, 'mousemove', St),
n.addClass(template, 'pswp--has_mouse'),
(s.mouseUsed = true),
ct('mouseUsed')
Ct = setTimeout(function () {
Ct = null
}, 100)
},
xt = function () {
if ((n.bind(document, 'keydown', i), tt.transform))
n.bind(i.scrollWrap, 'click', i)
if (!s.mouseUsed) n.bind(document, 'mousemove', St)
n.bind(window, 'resize scroll orientationchange', i),
ct('bindEvents')
},
At = function () {
if (
(n.unbind(window, 'resize scroll orientationchange', i),
n.unbind(window, 'scroll', C.scroll),
n.unbind(document, 'keydown', i),
n.unbind(document, 'mousemove', St),
tt.transform)
)
n.unbind(i.scrollWrap, 'click', i)
if (ue) n.unbind(window, w, i)
clearTimeout(ot), ct('unbindEvents')
},
_t = function (t, update) {
var e = xn(i.currItem, S, t)
if (update) Ce = e
return e
},
Tt = function (t) {
if (!t) t = i.currItem
return t.initialZoomLevel
},
Dt = function (t) {
if (!t) t = i.currItem
return t.w > 0 ? s.maxSpreadZoom : 1
},
kt = function (t, e, n, o) {
if (o === i.currItem.initialZoomLevel)
return (n[t] = i.currItem.initialPosition[t]), true
else if (((n[t] = yt(t, o)), n[t] > e.min[t]))
return (n[t] = e.min[t]), true
else if (n[t] < e.max[t]) return (n[t] = e.max[t]), true
return false
},
Mt = function () {
if (H) {
var t = tt.perspective && !W
return (
(_ = 'translate' + (t ? '3d(' : '(')),
(T = tt.perspective ? ', 0px)' : ')'),
void 0
)
}
;(H = 'left'),
n.addClass(template, 'pswp--ie'),
(gt = function (t, e) {
e.left = t + 'px'
}),
(mt = function (t) {
var e = t.fitRatio > 1 ? 1 : t.fitRatio,
n = t.container.style,
i = e * t.w,
o = e * t.h
;(n.width = i + 'px'),
(n.height = o + 'px'),
(n.left = t.initialPosition.x + 'px'),
(n.top = t.initialPosition.y + 'px')
}),
(pt = function () {
if (xe) {
var t = xe,
e = i.currItem,
n = e.fitRatio > 1 ? 1 : e.fitRatio,
o = n * e.w,
a = n * e.h
;(t.width = o + 'px'),
(t.height = a + 'px'),
(t.left = y.x + 'px'),
(t.top = y.y + 'px')
}
})
},
Lt = function (t) {
var e = ''
if (s.escKey && 27 === t.keyCode) e = 'close'
else if (s.arrowKeys)
if (37 === t.keyCode) e = 'prev'
else if (39 === t.keyCode) e = 'next'
if (e)
if (!(t.ctrlKey || t.altKey || t.shiftKey || t.metaKey)) {
if (t.preventDefault) t.preventDefault()
else t.returnValue = false
i[e]()
}
},
Pt = function (t) {
if (t)
if (fe || ce || Ae || ie) t.preventDefault(), t.stopPropagation()
},
Ot = function () {
i.setScrollOffset(0, n.getScrollY())
},
Bt = {},
Rt = 0,
Ft = function (t) {
if (Bt[t]) {
if (Bt[t].raf) j(Bt[t].raf)
Rt--, delete Bt[t]
}
},
Nt = function (t) {
if (Bt[t]) Ft(t)
if (!Bt[t]) Rt++, (Bt[t] = {})
},
Ut = function () {
for (var t in Bt) if (Bt.hasOwnProperty(t)) Ft(t)
},
qt = function (t, e, n, d, i, o, a) {
var s = ft(),
u
Nt(t)
var l = function () {
if (Bt[t]) {
if ((u = ft() - s) >= d) {
if ((Ft(t), o(n), a)) a()
return
}
o((n - e) * i(u / d) + e), (Bt[t].raf = G(l))
}
}
l()
},
zt = {
shout: ct,
listen: lt,
viewportSize: S,
options: s,
isMainScrollAnimating: function () {
return Ae
},
getZoomLevel: function () {
return x
},
getCurrentIndex: function () {
return h
},
isDragging: function () {
return ue
},
isZooming: function () {
return ye
},
setScrollOffset: function (t, e) {
;(M.x = t), (J = M.y = e), ct('updateScrollOffset', M)
},
applyZoomPan: function (t, e, n, i) {
;(y.x = e), (y.y = n), (x = t), pt(i)
},
init: function () {
if (!l && !c) {
var e
;(i.framework = n),
(i.template = template),
(i.bg = n.getChildByClass(template, 'pswp__bg')),
(K = template.className),
(l = true),
(tt = n.detectFeatures()),
(G = tt.raf),
(j = tt.caf),
(H = tt.transform),
(X = tt.oldIE),
(i.scrollWrap = n.getChildByClass(
template,
'pswp__scroll-wrap'
)),
(i.container = n.getChildByClass(
i.scrollWrap,
'pswp__container'
)),
(p = i.container.style),
(i.itemHolders = P =
[
{ el: i.container.children[0], wrap: 0, index: -1 },
{ el: i.container.children[1], wrap: 0, index: -1 },
{ el: i.container.children[2], wrap: 0, index: -1 },
]),
(P[0].el.style.display = P[2].el.style.display = 'none'),
Mt(),
(C = {
resize: i.updateSize,
orientationchange: function () {
clearTimeout(ot),
(ot = setTimeout(function () {
if (S.x !== i.scrollWrap.clientWidth) i.updateSize()
}, 500))
},
scroll: Ot,
keydown: Lt,
click: Pt,
})
var o = tt.isOldIOSPhone || tt.isOldAndroid || tt.isMobileOpera
if (!tt.animationName || !tt.transform || o)
s.showAnimationDuration = s.hideAnimationDuration = 0
for (e = 0; e < V.length; e++) i['init' + V[e]]()
if (t) {
var u
;(i.ui = new t(i, n)).init()
}
if (
(ct('firstUpdate'),
(h = h || s.index || 0),
isNaN(h) || h < 0 || h >= wn())
)
h = 0
if (((i.currItem = yn(h)), tt.isOldIOSPhone || tt.isOldAndroid))
Y = false
if ((template.setAttribute('aria-hidden', 'false'), s.modal))
if (!Y)
(template.style.position = 'absolute'),
(template.style.top = n.getScrollY() + 'px')
else template.style.position = 'fixed'
if (void 0 === J) ct('initialLayout'), (J = Z = n.getScrollY())
var f = 'pswp--open '
if (s.mainClass) f += s.mainClass + ' '
if (s.showHideOpacity) f += 'pswp--animate_opacity '
for (
f += W ? 'pswp--touch' : 'pswp--notouch',
f += tt.animationName ? ' pswp--css_animation' : '',
f += tt.svg ? ' pswp--svg' : '',
n.addClass(template, f),
i.updateSize(),
m = -1,
B = null,
e = 0;
e < a;
e++
)
gt((e + m) * L.x, P[e].el.style)
if (!X) n.bind(i.scrollWrap, b, i)
if (
(lt('initialZoomInEnd', function () {
if (
(i.setContent(P[0], h - 1),
i.setContent(P[2], h + 1),
(P[0].el.style.display = P[2].el.style.display = 'block'),
s.focus)
)
template.focus()
xt()
}),
i.setContent(P[1], h),
i.updateCurrItem(),
ct('afterInit'),
!Y)
)
E = setInterval(function () {
if (!Rt && !ue && !ye && x === i.currItem.initialZoomLevel)
i.updateSize()
}, 1e3)
n.addClass(template, 'pswp--visible')
}
},
close: function () {
if (l)
(l = false),
(c = true),
ct('close'),
At(),
fn(i.currItem, null, true, i.destroy)
},
destroy: function () {
if ((ct('destroy'), cn)) clearTimeout(cn)
if (
(template.setAttribute('aria-hidden', 'true'),
(template.className = K),
E)
)
clearInterval(E)
n.unbind(i.scrollWrap, b, i),
n.unbind(window, 'scroll', i),
Fe(),
Ut(),
(ut = null)
},
panTo: function (t, e, n) {
if (!n) {
if (t > Ce.min.x) t = Ce.min.x
else if (t < Ce.max.x) t = Ce.max.x
if (e > Ce.min.y) e = Ce.min.y
else if (e < Ce.max.y) e = Ce.max.y
}
;(y.x = t), (y.y = e), pt()
},
handleEvent: function (t) {
if (((t = t || window.event), C[t.type])) C[t.type](t)
},
goTo: function (index) {
var diff = (index = st(index)) - h
;(B = diff),
(h = index),
(i.currItem = yn(h)),
(k -= diff),
vt(L.x * k),
Ut(),
(Ae = false),
i.updateCurrItem()
},
next: function () {
i.goTo(h + 1)
},
prev: function () {
i.goTo(h - 1)
},
updateCurrZoomItem: function (t) {
if (t) ct('beforeChange', 0)
if (P[1].el.children.length) {
var e = P[1].el.children[0]
if (n.hasClass(e, 'pswp__zoom-wrap')) xe = e.style
else xe = null
} else xe = null
if (
((Ce = i.currItem.bounds),
(A = x = i.currItem.initialZoomLevel),
(y.x = Ce.center.x),
(y.y = Ce.center.y),
t)
)
ct('afterChange')
},
invalidateCurrItems: function () {
I = true
for (var t = 0; t < a; t++)
if (P[t].item) P[t].item.needsUpdate = true
},
updateCurrItem: function (t) {
if (0 !== B) {
var e = Math.abs(B),
n
if (!(t && e < 2)) {
if (
((i.currItem = yn(h)),
(rt = false),
ct('beforeChange', B),
e >= a)
)
(m += B + (B > 0 ? -a : a)), (e = a)
for (var o = 0; o < e; o++)
if (B > 0)
(n = P.shift()),
(P[a - 1] = n),
m++,
gt((m + 2) * L.x, n.el.style),
i.setContent(n, h - e + o + 1 + 1)
else
(n = P.pop()),
P.unshift(n),
m--,
gt(m * L.x, n.el.style),
i.setContent(n, h + e - o - 1 - 1)
if (xe && 1 === Math.abs(B)) {
var s = yn(O)
if (s.initialZoomLevel !== x) xn(s, S), En(s), mt(s)
}
;(B = 0), i.updateCurrZoomItem(), (O = h), ct('afterChange')
}
}
},
updateSize: function (t) {
if (!Y && s.modal) {
var e = n.getScrollY()
if (J !== e) (template.style.top = e + 'px'), (J = e)
if (
!t &&
nt.x === window.innerWidth &&
nt.y === window.innerHeight
)
return
;(nt.x = window.innerWidth),
(nt.y = window.innerHeight),
(template.style.height = nt.y + 'px')
}
if (
((S.x = i.scrollWrap.clientWidth),
(S.y = i.scrollWrap.clientHeight),
Ot(),
(L.x = S.x + Math.round(S.x * s.spacing)),
(L.y = S.y),
vt(L.x * k),
ct('beforeResize'),
void 0 !== m)
) {
for (var o, u, l, c = 0; c < a; c++) {
if (
((o = P[c]),
gt((c + m) * L.x, o.el.style),
(l = h + c - 1),
s.loop && wn() > 2)
)
l = st(l)
if ((u = yn(l)) && (I || u.needsUpdate || !u.bounds)) {
if ((i.cleanSlide(u), i.setContent(o, l), 1 === c))
(i.currItem = u), i.updateCurrZoomItem(true)
u.needsUpdate = false
} else if (-1 === o.index && l >= 0) i.setContent(o, l)
if (u && u.container) xn(u, S), En(u), mt(u)
}
I = false
}
if (
((A = x = i.currItem.initialZoomLevel),
(Ce = i.currItem.bounds))
)
(y.x = Ce.center.x), (y.y = Ce.center.y), pt(true)
ct('resize')
},
zoomTo: function (t, e, i, o, a) {
if (e)
(A = x),
(_e.x = Math.abs(e.x) - y.x),
(_e.y = Math.abs(e.y) - y.y),
wt(v, y)
var s = _t(t, false),
u = {}
kt('x', s, u, t), kt('y', s, u, t)
var l = x,
c = y.x,
f = y.y
bt(u)
var h = function (e) {
if (1 === e) (x = t), (y.x = u.x), (y.y = u.y)
else
(x = (t - l) * e + l),
(y.x = (u.x - c) * e + c),
(y.y = (u.y - f) * e + f)
if (a) a(e)
pt(1 === e)
}
if (i) qt('customZoomTo', 0, 1, i, o || n.easing.sine.inOut, h)
else h(1)
},
},
Ht = 30,
$t = 10,
Yt,
Wt,
Vt = {},
Gt = {},
jt = {},
Kt = {},
Zt = {},
Xt = [],
Jt = {},
Qt,
te = [],
ee = {},
ne,
ie,
re,
oe = 0,
ae = { x: 0, y: 0 },
se = 0,
ue,
le,
ce,
fe,
pe,
ge,
ve,
ye,
we,
be,
Ce,
Se = { x: 0, y: 0 },
xe,
Ae,
_e = { x: 0, y: 0 },
Te = { x: 0, y: 0 },
Ee,
Ie,
ke,
Le,
Pe,
Oe = function (t, e) {
return t.x === e.x && t.y === e.y
},
Be = function (t, e) {
return Math.abs(t.x - e.x) < o && Math.abs(t.y - e.y) < o
},
Re = function (t, e) {
return (
(ee.x = Math.abs(t.x - e.x)),
(ee.y = Math.abs(t.y - e.y)),
Math.sqrt(ee.x * ee.x + ee.y * ee.y)
)
},
Fe = function () {
if (pe) j(pe), (pe = null)
},
Ne = function () {
if (ue) (pe = G(Ne)), nn()
},
Ue = function () {
return !('fit' === s.scaleMode && x === i.currItem.initialZoomLevel)
},
qe = function (el, t) {
if (!el || el === document) return false
if (
el.getAttribute('class') &&
el.getAttribute('class').indexOf('pswp__scroll-wrap') > -1
)
return false
if (t(el)) return el
else return qe(el.parentNode, t)
},
ze = {},
$e = function (t, e) {
return (
(ze.prevent = !qe(t.target, s.isClickableElement)),
ct('preventDragEvent', t, e, ze),
ze.prevent
)
},
Ye = function (t, e) {
return (e.x = t.pageX), (e.y = t.pageY), (e.id = t.identifier), e
},
We = function (t, e, n) {
;(n.x = 0.5 * (t.x + e.x)), (n.y = 0.5 * (t.y + e.y))
},
Ve = function (t, e, n) {
if (t - Wt > 50) {
var i = te.length > 2 ? te.shift() : {}
;(i.x = e), (i.y = n), te.push(i), (Wt = t)
}
},
Ge = function () {
var t = y.y - i.currItem.initialPosition.y
return 1 - Math.abs(t / (S.y / 2))
},
je = {},
Ke = {},
Ze = [],
Xe,
Je = function (t) {
for (; Ze.length > 0; ) Ze.pop()
if (!$)
if (t.type.indexOf('touch') > -1) {
if (t.touches && t.touches.length > 0)
if (((Ze[0] = Ye(t.touches[0], je)), t.touches.length > 1))
Ze[1] = Ye(t.touches[1], Ke)
} else
(je.x = t.pageX), (je.y = t.pageY), (je.id = ''), (Ze[0] = je)
else
(Xe = 0),
Xt.forEach(function (t) {
if (0 === Xe) Ze[0] = t
else if (1 === Xe) Ze[1] = t
Xe++
})
return Ze
},
Qe = function (t, e) {
var n,
o = 0,
a = y[t] + e[t],
u,
l = e[t] > 0,
c = Se.x + e.x,
f = Se.x - Jt.x,
h,
p
if (a > Ce.min[t] || a < Ce.max[t]) n = s.panEndFriction
else n = 1
if (
((a = y[t] + e[t] * n),
s.allowPanToNext || x === i.currItem.initialZoomLevel)
) {
if (!xe) p = c
else if ('h' === Ee && 'x' === t && !ce)
if (l) {
if (a > Ce.min[t])
(n = s.panEndFriction),
(o = Ce.min[t] - a),
(u = Ce.min[t] - v[t])
if ((u <= 0 || f < 0) && wn() > 1) {
if (((p = c), f < 0 && c > Jt.x)) p = Jt.x
} else if (Ce.min.x !== Ce.max.x) h = a
} else {
if (a < Ce.max[t])
(n = s.panEndFriction),
(o = a - Ce.max[t]),
(u = v[t] - Ce.max[t])
if ((u <= 0 || f > 0) && wn() > 1) {
if (((p = c), f > 0 && c < Jt.x)) p = Jt.x
} else if (Ce.min.x !== Ce.max.x) h = a
}
if ('x' === t) {
if (void 0 !== p)
if ((vt(p, true), p === Jt.x)) ge = false
else ge = true
if (Ce.min.x !== Ce.max.x)
if (void 0 !== h) y.x = h
else if (!ge) y.x += e.x * n
return void 0 !== p
}
}
if (!Ae) if (!ge) if (x > i.currItem.fitRatio) y[t] += e[t] * n
},
tn = function (t) {
if (!('mousedown' === t.type && t.button > 0)) {
if (gn) return t.preventDefault(), void 0
if (!re || 'mousedown' !== t.type) {
if ($e(t, true)) t.preventDefault()
if ((ct('pointerDown'), $)) {
var e = n.arraySearch(Xt, t.pointerId, 'id')
if (e < 0) e = Xt.length
Xt[e] = { x: t.pageX, y: t.pageY, id: t.pointerId }
}
var o = Je(t),
a = o.length
if (((ve = null), Ut(), !ue || 1 === a))
(ue = Ie = true),
n.bind(window, w, i),
(ne = Pe = ke = ie = ge = fe = le = ce = false),
(Ee = null),
ct('firstTouchStart', o),
wt(v, y),
(g.x = g.y = 0),
wt(Kt, o[0]),
wt(Zt, Kt),
(Jt.x = L.x * k),
(te = [{ x: Kt.x, y: Kt.y }]),
(Wt = Yt = ft()),
_t(x, true),
Fe(),
Ne()
if (!ye && a > 1 && !Ae && !ge)
(A = x),
(ce = false),
(ye = le = true),
(g.y = g.x = 0),
wt(v, y),
wt(Vt, o[0]),
wt(Gt, o[1]),
We(Vt, Gt, Te),
(_e.x = Math.abs(Te.x) - y.x),
(_e.y = Math.abs(Te.y) - y.y),
(we = be = Re(Vt, Gt))
}
}
},
en = function (t) {
if ((t.preventDefault(), $)) {
var e = n.arraySearch(Xt, t.pointerId, 'id')
if (e > -1) {
var i = Xt[e]
;(i.x = t.pageX), (i.y = t.pageY)
}
}
if (ue) {
var o = Je(t)
if (!Ee && !fe && !ye)
if (Se.x !== L.x * k) Ee = 'h'
else {
var diff = Math.abs(o[0].x - Kt.x) - Math.abs(o[0].y - Kt.y)
if (Math.abs(diff) >= $t)
(Ee = diff > 0 ? 'h' : 'v'), (ve = o)
}
else ve = o
}
},
nn = function () {
if (ve) {
var t = ve.length
if (0 !== t)
if (
(wt(Vt, ve[0]),
(jt.x = Vt.x - Kt.x),
(jt.y = Vt.y - Kt.y),
ye && t > 1)
) {
if (
((Kt.x = Vt.x),
(Kt.y = Vt.y),
!jt.x && !jt.y && Oe(ve[1], Gt))
)
return
if ((wt(Gt, ve[1]), !ce))
(ce = true), ct('zoomGestureStarted')
var e = Re(Vt, Gt),
n = un(e)
if (
n >
i.currItem.initialZoomLevel +
i.currItem.initialZoomLevel / 15
)
Pe = true
var o = 1,
a = Tt(),
u = Dt()
if (n < a)
if (
s.pinchToClose &&
!Pe &&
A <= i.currItem.initialZoomLevel
) {
var l,
c = 1 - (a - n) / (a / 1.2)
dt(c), ct('onPinchClose', c), (ke = true)
} else {
if ((o = (a - n) / a) > 1) o = 1
n = a - o * (a / 3)
}
else if (n > u) {
if ((o = (n - u) / (6 * a)) > 1) o = 1
n = u + o * a
}
if (o < 0) o = 0
;(we = e),
We(Vt, Gt, ae),
(g.x += ae.x - Te.x),
(g.y += ae.y - Te.y),
wt(Te, ae),
(y.x = yt('x', n)),
(y.y = yt('y', n)),
(ne = n > x),
(x = n),
pt()
} else {
if (!Ee) return
if (Ie) {
if (((Ie = false), Math.abs(jt.x) >= $t))
jt.x -= ve[0].x - Zt.x
if (Math.abs(jt.y) >= $t) jt.y -= ve[0].y - Zt.y
}
if (((Kt.x = Vt.x), (Kt.y = Vt.y), 0 === jt.x && 0 === jt.y))
return
if ('v' === Ee && s.closeOnVerticalDrag)
if (!Ue()) {
;(g.y += jt.y), (y.y += jt.y)
var f = Ge()
return (
(ie = true),
ct('onVerticalDrag', f),
dt(f),
pt(),
void 0
)
}
var h
if (
(Ve(ft(), Vt.x, Vt.y),
(fe = true),
(Ce = i.currItem.bounds),
!Qe('x', jt))
)
Qe('y', jt), bt(y), pt()
}
}
},
rn = function (t) {
if (tt.isOldAndroid) {
if (re && 'mouseup' === t.type) return
if (t.type.indexOf('touch') > -1)
clearTimeout(re),
(re = setTimeout(function () {
re = 0
}, 600))
}
if ((ct('pointerUp'), $e(t, false))) t.preventDefault()
var e
if ($) {
var o = n.arraySearch(Xt, t.pointerId, 'id')
if (o > -1)
if (((e = Xt.splice(o, 1)[0]), navigator.msPointerEnabled)) {
var a = { 4: 'mouse', 2: 'touch', 3: 'pen' }
if (((e.type = a[t.pointerType]), !e.type))
e.type = t.pointerType || 'mouse'
} else e.type = t.pointerType || 'mouse'
}
var u = Je(t),
l,
c = u.length
if ('mouseup' === t.type) c = 0
if (2 === c) return (ve = null), true
if (1 === c) wt(Zt, u[0])
if (0 === c && !Ee && !Ae) {
if (!e)
if ('mouseup' === t.type)
e = { x: t.pageX, y: t.pageY, type: 'mouse' }
else if (t.changedTouches && t.changedTouches[0])
e = {
x: t.changedTouches[0].pageX,
y: t.changedTouches[0].pageY,
type: 'touch',
}
ct('touchRelease', t, e)
}
var f = -1
if (0 === c)
if (((ue = false), n.unbind(window, w, i), Fe(), ye)) f = 0
else if (-1 !== se) f = ft() - se
if (((se = 1 === c ? ft() : -1), -1 !== f && f < 150)) l = 'zoom'
else l = 'swipe'
if (ye && c < 2) {
if (((ye = false), 1 === c)) l = 'zoomPointerUp'
ct('zoomGestureEnded')
}
if (((ve = null), fe || ce || Ae || ie)) {
if ((Ut(), !Qt)) Qt = on()
if ((Qt.calculateSwipeSpeed('x'), !ie)) {
if ((ge || Ae) && 0 === c) {
var h
if (sn(l, Qt)) return
l = 'zoomPointerUp'
}
if (!Ae) {
if ('swipe' !== l) return ln(), void 0
if (!ge && x > i.currItem.fitRatio) an(Qt)
}
} else {
var p
if (Ge() < s.verticalDragRange) i.close()
else {
var m = y.y,
g = Le
qt(
'verticalDrag',
0,
1,
300,
n.easing.cubic.out,
function (t) {
;(y.y = (i.currItem.initialPosition.y - m) * t + m),
dt((1 - g) * t + g),
pt()
}
),
ct('onVerticalDrag', 1)
}
}
}
},
on = function () {
var t,
e,
i = {
lastFlickOffset: {},
lastFlickDist: {},
lastFlickSpeed: {},
slowDownRatio: {},
slowDownRatioReverse: {},
speedDecelerationRatio: {},
speedDecelerationRatioAbs: {},
distanceOffset: {},
backAnimDestination: {},
backAnimStarted: {},
calculateSwipeSpeed: function (n) {
if (te.length > 1)
(t = ft() - Wt + 50), (e = te[te.length - 2][n])
else (t = ft() - Yt), (e = Zt[n])
if (
((i.lastFlickOffset[n] = Kt[n] - e),
(i.lastFlickDist[n] = Math.abs(i.lastFlickOffset[n])),
i.lastFlickDist[n] > 20)
)
i.lastFlickSpeed[n] = i.lastFlickOffset[n] / t
else i.lastFlickSpeed[n] = 0
if (Math.abs(i.lastFlickSpeed[n]) < 0.1)
i.lastFlickSpeed[n] = 0
;(i.slowDownRatio[n] = 0.95),
(i.slowDownRatioReverse[n] = 1 - i.slowDownRatio[n]),
(i.speedDecelerationRatio[n] = 1)
},
calculateOverBoundsAnimOffset: function (t, e) {
if (!i.backAnimStarted[t]) {
if (y[t] > Ce.min[t]) i.backAnimDestination[t] = Ce.min[t]
else if (y[t] < Ce.max[t])
i.backAnimDestination[t] = Ce.max[t]
if (void 0 !== i.backAnimDestination[t])
if (
((i.slowDownRatio[t] = 0.7),
(i.slowDownRatioReverse[t] = 1 - i.slowDownRatio[t]),
i.speedDecelerationRatioAbs[t] < 0.05)
)
(i.lastFlickSpeed[t] = 0),
(i.backAnimStarted[t] = true),
qt(
'bounceZoomPan' + t,
y[t],
i.backAnimDestination[t],
e || 300,
n.easing.sine.out,
function (e) {
;(y[t] = e), pt()
}
)
}
},
calculateAnimOffset: function (t) {
if (!i.backAnimStarted[t])
(i.speedDecelerationRatio[t] =
i.speedDecelerationRatio[t] *
(i.slowDownRatio[t] +
i.slowDownRatioReverse[t] -
(i.slowDownRatioReverse[t] * i.timeDiff) / 10)),
(i.speedDecelerationRatioAbs[t] = Math.abs(
i.lastFlickSpeed[t] * i.speedDecelerationRatio[t]
)),
(i.distanceOffset[t] =
i.lastFlickSpeed[t] *
i.speedDecelerationRatio[t] *
i.timeDiff),
(y[t] += i.distanceOffset[t])
},
panAnimLoop: function () {
if (Bt.zoomPan)
if (
((Bt.zoomPan.raf = G(i.panAnimLoop)),
(i.now = ft()),
(i.timeDiff = i.now - i.lastNow),
(i.lastNow = i.now),
i.calculateAnimOffset('x'),
i.calculateAnimOffset('y'),
pt(),
i.calculateOverBoundsAnimOffset('x'),
i.calculateOverBoundsAnimOffset('y'),
i.speedDecelerationRatioAbs.x < 0.05 &&
i.speedDecelerationRatioAbs.y < 0.05)
)
return (
(y.x = Math.round(y.x)),
(y.y = Math.round(y.y)),
pt(),
Ft('zoomPan'),
void 0
)
},
}
return i
},
an = function (t) {
if (
(t.calculateSwipeSpeed('y'),
(Ce = i.currItem.bounds),
(t.backAnimDestination = {}),
(t.backAnimStarted = {}),
Math.abs(t.lastFlickSpeed.x) <= 0.05 &&
Math.abs(t.lastFlickSpeed.y) <= 0.05)
)
return (
(t.speedDecelerationRatioAbs.x = t.speedDecelerationRatioAbs.y =
0),
t.calculateOverBoundsAnimOffset('x'),
t.calculateOverBoundsAnimOffset('y'),
true
)
Nt('zoomPan'), (t.lastNow = ft()), t.panAnimLoop()
},
sn = function (t, e) {
var o, a, u
if (!Ae) oe = h
if ('swipe' === t) {
var l = Kt.x - Zt.x,
c = e.lastFlickDist.x < 10
if (l > Ht && (c || e.lastFlickOffset.x > 20)) a = -1
else if (l < -Ht && (c || e.lastFlickOffset.x < -20)) a = 1
}
if (a) {
if ((h += a) < 0) (h = s.loop ? wn() - 1 : 0), (u = true)
else if (h >= wn()) (h = s.loop ? 0 : wn() - 1), (u = true)
if (!u || s.loop) (B += a), (k -= a), (o = true)
}
var f = L.x * k,
p = Math.abs(f - Se.x),
m
if (!o && f > Se.x != e.lastFlickSpeed.x > 0) m = 333
else
(m =
Math.abs(e.lastFlickSpeed.x) > 0
? p / Math.abs(e.lastFlickSpeed.x)
: 333),
(m = Math.min(m, 400)),
(m = Math.max(m, 250))
if (oe === h) o = false
if (
((Ae = true),
ct('mainScrollAnimStart'),
qt('mainScroll', Se.x, f, m, n.easing.cubic.out, vt, function () {
if ((Ut(), (Ae = false), (oe = -1), o || oe !== h))
i.updateCurrItem()
ct('mainScrollAnimComplete')
}),
o)
)
i.updateCurrItem(true)
return o
},
un = function (t) {
return (1 / be) * t * A
},
ln = function () {
var t = x,
e = Tt(),
o = Dt()
if (x < e) t = e
else if (x > o) t = o
var a = 1,
s,
u = Le
if (ke && !ne && !Pe && x < e) return i.close(), true
if (ke)
s = function (t) {
dt((a - u) * t + u)
}
return i.zoomTo(t, 0, 200, n.easing.cubic.out, s), true
}
at('Gestures', {
publicMethods: {
initGestures: function () {
var t = function (t, e, move, n, i) {
if (((F = t + e), (N = t + move), (U = t + n), i)) z = t + i
else z = ''
}
if (($ = tt.pointerEvent) && tt.touch) tt.touch = false
if ($)
if (navigator.msPointerEnabled)
t('MSPointer', 'Down', 'Move', 'Up', 'Cancel')
else t('pointer', 'down', 'move', 'up', 'cancel')
else if (tt.touch)
t('touch', 'start', 'move', 'end', 'cancel'), (W = true)
else t('mouse', 'down', 'move', 'up')
if (((w = N + ' ' + U + ' ' + z), (b = F), $ && !W))
W =
navigator.maxTouchPoints > 1 || navigator.msMaxTouchPoints > 1
if (
((i.likelyTouchDevice = W),
(C[F] = tn),
(C[N] = en),
(C[U] = rn),
z)
)
C[z] = C[U]
if (tt.touch)
(b += ' mousedown'),
(w += ' mousemove mouseup'),
(C.mousedown = C[F]),
(C.mousemove = C[N]),
(C.mouseup = C[U])
if (!W) s.allowPanToNext = false
},
},
})
var cn,
fn = function (t, e, o, a) {
if (cn) clearTimeout(cn)
var u
if (((gn = true), (mn = true), t.initialLayout))
(u = t.initialLayout), (t.initialLayout = null)
else u = s.getThumbBoundsFn && s.getThumbBoundsFn(h)
var l = o ? s.hideAnimationDuration : s.showAnimationDuration,
c = function () {
if ((Ft('initialZoom'), !o)) {
if ((dt(1), e)) e.style.display = 'block'
n.addClass(template, 'pswp--animated-in'),
ct('initialZoom' + (o ? 'OutEnd' : 'InEnd'))
} else
i.template.removeAttribute('style'),
i.bg.removeAttribute('style')
if (a) a()
gn = false
}
if (l && u && void 0 !== u.x) {
var p
;(function () {
var e = f,
a =
!i.currItem.src || i.currItem.loadError || s.showHideOpacity
if (t.miniImg)
t.miniImg.style.webkitBackfaceVisibility = 'hidden'
if (!o)
(x = u.w / t.w),
(y.x = u.x),
(y.y = u.y - Z),
(i[a ? 'template' : 'bg'].style.opacity = 0.001),
pt()
if ((Nt('initialZoom'), o && !e))
n.removeClass(template, 'pswp--animated-in')
if (a)
if (o)
n[(e ? 'remove' : 'add') + 'Class'](
template,
'pswp--animate_opacity'
)
else
setTimeout(function () {
n.addClass(template, 'pswp--animate_opacity')
}, 30)
cn = setTimeout(
function () {
if ((ct('initialZoom' + (o ? 'Out' : 'In')), !o)) {
if (
((x = t.initialZoomLevel),
wt(y, t.initialPosition),
pt(),
dt(1),
a)
)
template.style.opacity = 1
else dt(1)
cn = setTimeout(c, l + 20)
} else {
var i = u.w / t.w,
s = { x: y.x, y: y.y },
f = x,
h = Le,
p = function (t) {
if (1 === t) (x = i), (y.x = u.x), (y.y = u.y - J)
else
(x = (i - f) * t + f),
(y.x = (u.x - s.x) * t + s.x),
(y.y = (u.y - J - s.y) * t + s.y)
if ((pt(), a)) template.style.opacity = 1 - t
else dt(h - t * h)
}
if (e)
qt('initialZoom', 0, 1, l, n.easing.cubic.out, p, c)
else p(1), (cn = setTimeout(c, l + 20))
}
},
o ? 25 : 90
)
})()
} else if (
(ct('initialZoom' + (o ? 'Out' : 'In')),
(x = t.initialZoomLevel),
wt(y, t.initialPosition),
pt(),
(template.style.opacity = o ? 0 : 1),
dt(1),
l)
)
setTimeout(function () {
c()
}, l)
else c()
},
dn,
hn = {},
pn = [],
mn,
gn,
vn = {
index: 0,
errorMsg:
'<div class="pswp__error-msg"><a href="%url%" target="_blank">The image</a> could not be loaded.</div>',
forceProgressiveLoading: false,
preload: [1, 1],
getNumItemsFn: function () {
return dn.length
},
},
yn,
wn,
bn,
Cn = function () {
return {
center: { x: 0, y: 0 },
max: { x: 0, y: 0 },
min: { x: 0, y: 0 },
}
},
Sn = function (t, e, n) {
var i = t.bounds
;(i.center.x = Math.round((hn.x - e) / 2)),
(i.center.y = Math.round((hn.y - n) / 2) + t.vGap.top),
(i.max.x = e > hn.x ? Math.round(hn.x - e) : i.center.x),
(i.max.y =
n > hn.y ? Math.round(hn.y - n) + t.vGap.top : i.center.y),
(i.min.x = e > hn.x ? 0 : i.center.x),
(i.min.y = n > hn.y ? t.vGap.top : i.center.y)
},
xn = function (t, e, n) {
if (t.src && !t.loadError) {
var i = !n
if (i) {
if (!t.vGap) t.vGap = { top: 0, bottom: 0 }
ct('parseVerticalMargin', t)
}
if (
((hn.x = e.x), (hn.y = e.y - t.vGap.top - t.vGap.bottom), i)
) {
var o = hn.x / t.w,
a = hn.y / t.h
t.fitRatio = o < a ? o : a
var u = s.scaleMode
if ('orig' === u) n = 1
else if ('fit' === u) n = t.fitRatio
if (n > 1) n = 1
if (((t.initialZoomLevel = n), !t.bounds))
t.bounds = {
center: { x: 0, y: 0 },
max: { x: 0, y: 0 },
min: { x: 0, y: 0 },
}
}
if (!n) return
if ((Sn(t, t.w * n, t.h * n), i && n === t.initialZoomLevel))
t.initialPosition = t.bounds.center
return t.bounds
} else
return (
(t.w = t.h = 0),
(t.initialZoomLevel = t.fitRatio = 1),
(t.bounds = {
center: { x: 0, y: 0 },
max: { x: 0, y: 0 },
min: { x: 0, y: 0 },
}),
(t.initialPosition = t.bounds.center),
t.bounds
)
},
An = function (index, t, e, n, o, a) {
if (!t.loadError)
if (n)
if (
((t.imageAppended = true),
En(t, n, t === i.currItem && rt),
e.appendChild(n),
a)
)
setTimeout(function () {
if (t && t.loaded && t.placeholder)
(t.placeholder.style.display = 'none'),
(t.placeholder = null)
}, 500)
},
_n = function (t) {
;(t.loading = true), (t.loaded = false)
var e = (t.img = n.createEl('pswp__img', 'img')),
i = function () {
if (((t.loading = false), (t.loaded = true), t.loadComplete))
t.loadComplete(t)
else t.img = null
;(e.onload = e.onerror = null), (e = null)
}
return (
(e.onload = i),
(e.onerror = function () {
;(t.loadError = true), i()
}),
(e.src = t.src),
e
)
},
Tn = function (t, e) {
if (t.src && t.loadError && t.container) {
if (e) t.container.innerHTML = ''
return (
(t.container.innerHTML = s.errorMsg.replace('%url%', t.src)),
true
)
}
},
En = function (t, e, n) {
if (t.src) {
if (!e) e = t.container.lastChild
var i = n ? t.w : Math.round(t.w * t.fitRatio),
o = n ? t.h : Math.round(t.h * t.fitRatio)
if (t.placeholder && !t.loaded)
(t.placeholder.style.width = i + 'px'),
(t.placeholder.style.height = o + 'px')
;(e.style.width = i + 'px'), (e.style.height = o + 'px')
}
},
In = function () {
if (pn.length) {
for (var t, e = 0; e < pn.length; e++)
if ((t = pn[e]).holder.index === t.index)
An(
t.index,
t.item,
t.baseDiv,
t.img,
false,
t.clearPlaceholder
)
pn = []
}
}
at('Controller', {
publicMethods: {
lazyLoadItem: function (index) {
index = st(index)
var t = yn(index)
if (t && ((!t.loaded && !t.loading) || I))
if ((ct('gettingData', index, t), t.src)) _n(t)
},
initController: function () {
if (
(n.extend(s, vn, true),
(i.items = dn = items),
(yn = i.getItemAt),
(wn = s.getNumItemsFn),
(bn = s.loop),
wn() < 3)
)
s.loop = false
lt('beforeChange', function (diff) {
var t = s.preload,
e = null === diff ? true : diff >= 0,
n = Math.min(t[0], wn()),
o = Math.min(t[1], wn()),
a
for (a = 1; a <= (e ? o : n); a++) i.lazyLoadItem(h + a)
for (a = 1; a <= (e ? n : o); a++) i.lazyLoadItem(h - a)
}),
lt('initialLayout', function () {
i.currItem.initialLayout =
s.getThumbBoundsFn && s.getThumbBoundsFn(h)
}),
lt('mainScrollAnimComplete', In),
lt('initialZoomInEnd', In),
lt('destroy', function () {
for (var t, e = 0; e < dn.length; e++) {
if ((t = dn[e]).container) t.container = null
if (t.placeholder) t.placeholder = null
if (t.img) t.img = null
if (t.preloader) t.preloader = null
if (t.loadError) t.loaded = t.loadError = false
}
pn = null
})
},
getItemAt: function (index) {
if (index >= 0) return void 0 !== dn[index] ? dn[index] : false
else return false
},
allowProgressiveImg: function () {
return (
s.forceProgressiveLoading ||
!W ||
s.mouseUsed ||
screen.width > 1200
)
},
setContent: function (t, index) {
if (s.loop) index = st(index)
var e = i.getItemAt(t.index)
if (e) e.container = null
var o = i.getItemAt(index),
a
if (!o) return (t.el.innerHTML = ''), void 0
ct('gettingData', index, o), (t.index = index), (t.item = o)
var u = (o.container = n.createEl('pswp__zoom-wrap'))
if (!o.src && o.html)
if (o.html.tagName) u.appendChild(o.html)
else u.innerHTML = o.html
if ((Tn(o), xn(o, S), o.src && !o.loadError && !o.loaded)) {
if (
((o.loadComplete = function (e) {
if (l) {
if (t && t.index === index) {
if (Tn(e, true)) {
if (
((e.loadComplete = e.img = null),
xn(e, S),
mt(e),
t.index === h)
)
i.updateCurrZoomItem()
return
}
if (!e.imageAppended)
if (tt.transform && (Ae || gn))
pn.push({
item: e,
baseDiv: u,
img: e.img,
index: index,
holder: t,
clearPlaceholder: true,
})
else An(index, e, u, e.img, Ae || gn, true)
else if (!gn && e.placeholder)
(e.placeholder.style.display = 'none'),
(e.placeholder = null)
}
;(e.loadComplete = null),
(e.img = null),
ct('imageLoadComplete', index, e)
}
}),
n.features.transform)
) {
var c = 'pswp__img pswp__img--placeholder'
c += o.msrc ? '' : ' pswp__img--placeholder--blank'
var placeholder = n.createEl(c, o.msrc ? 'img' : '')
if (o.msrc) placeholder.src = o.msrc
En(o, placeholder),
u.appendChild(placeholder),
(o.placeholder = placeholder)
}
if (!o.loading) _n(o)
if (i.allowProgressiveImg())
if (!mn && tt.transform)
pn.push({
item: o,
baseDiv: u,
img: o.img,
index: index,
holder: t,
})
else An(index, o, u, o.img, true, true)
} else if (o.src && !o.loadError)
((a = n.createEl('pswp__img', 'img')).style.opacity = 1),
(a.src = o.src),
En(o, a),
An(index, o, u, a, true)
if (!mn && index === h) (xe = u.style), fn(o, a || o.img)
else mt(o)
;(t.el.innerHTML = ''), t.el.appendChild(u)
},
cleanSlide: function (t) {
if (t.img) t.img.onload = t.img.onerror = null
t.loaded = t.loading = t.img = t.imageAppended = false
},
},
})
var Dn,
kn = {},
Mn = function (t, e, n) {
var i = document.createEvent('CustomEvent'),
o = {
origEvent: t,
target: t.target,
releasePoint: e,
pointerType: n || 'touch',
}
i.initCustomEvent('pswpTap', true, true, o),
t.target.dispatchEvent(i)
},
Ln
at('Tap', {
publicMethods: {
initTap: function () {
lt('firstTouchStart', i.onTapStart),
lt('touchRelease', i.onTapRelease),
lt('destroy', function () {
;(kn = {}), (Dn = null)
})
},
onTapStart: function (t) {
if (t.length > 1) clearTimeout(Dn), (Dn = null)
},
onTapRelease: function (t, e) {
if (e)
if (!fe && !le && !Rt) {
var i = e,
o
if (Dn)
if ((clearTimeout(Dn), (Dn = null), Be(i, kn)))
return ct('doubleTap', i), void 0
if ('mouse' === e.type) return Mn(t, e, 'mouse'), void 0
if (
'BUTTON' === t.target.tagName.toUpperCase() ||
n.hasClass(t.target, 'pswp__single-tap')
)
return Mn(t, e), void 0
wt(kn, i),
(Dn = setTimeout(function () {
Mn(t, e), (Dn = null)
}, 300))
}
},
},
}),
at('DesktopZoom', {
publicMethods: {
initDesktopZoom: function () {
if (!X)
if (W)
lt('mouseUsed', function () {
i.setupDesktopZoom()
})
else i.setupDesktopZoom(true)
},
setupDesktopZoom: function (t) {
Ln = {}
var events = 'wheel mousewheel DOMMouseScroll'
lt('bindEvents', function () {
n.bind(template, events, i.handleMouseWheel)
}),
lt('unbindEvents', function () {
if (Ln) n.unbind(template, events, i.handleMouseWheel)
}),
(i.mouseZoomedIn = false)
var e,
o = function () {
if (i.mouseZoomedIn)
n.removeClass(template, 'pswp--zoomed-in'),
(i.mouseZoomedIn = false)
if (x < 1) n.addClass(template, 'pswp--zoom-allowed')
else n.removeClass(template, 'pswp--zoom-allowed')
a()
},
a = function () {
if (e)
n.removeClass(template, 'pswp--dragging'), (e = false)
}
if (
(lt('resize', o),
lt('afterChange', o),
lt('pointerDown', function () {
if (i.mouseZoomedIn)
(e = true), n.addClass(template, 'pswp--dragging')
}),
lt('pointerUp', a),
!t)
)
o()
},
handleMouseWheel: function (t) {
if (x <= i.currItem.fitRatio) {
if (s.modal)
if (!s.closeOnScroll || Rt || ue) t.preventDefault()
else if (H && Math.abs(t.deltaY) > 2) (f = true), i.close()
return true
}
if ((t.stopPropagation(), (Ln.x = 0), 'deltaX' in t))
if (1 === t.deltaMode)
(Ln.x = 18 * t.deltaX), (Ln.y = 18 * t.deltaY)
else (Ln.x = t.deltaX), (Ln.y = t.deltaY)
else if ('wheelDelta' in t) {
if (t.wheelDeltaX) Ln.x = -0.16 * t.wheelDeltaX
if (t.wheelDeltaY) Ln.y = -0.16 * t.wheelDeltaY
else Ln.y = -0.16 * t.wheelDelta
} else if ('detail' in t) Ln.y = t.detail
else return
_t(x, true)
var e = y.x - Ln.x,
n = y.y - Ln.y
if (
s.modal ||
(e <= Ce.min.x &&
e >= Ce.max.x &&
n <= Ce.min.y &&
n >= Ce.max.y)
)
t.preventDefault()
i.panTo(e, n)
},
toggleDesktopZoom: function (t) {
t = t || { x: S.x / 2 + M.x, y: S.y / 2 + M.y }
var e = s.getDoubleTapZoom(true, i.currItem),
o = x === e
;(i.mouseZoomedIn = !o),
i.zoomTo(o ? i.currItem.initialZoomLevel : e, t, 333),
n[(!o ? 'add' : 'remove') + 'Class'](
template,
'pswp--zoomed-in'
)
},
},
})
var Pn = { history: true, galleryUID: 1 },
On,
Bn,
Rn,
Fn,
Nn,
Un,
qn,
zn,
Hn,
$n,
Yn,
Wn,
Vn = function () {
return Yn.hash.substring(1)
},
Gn = function () {
if (On) clearTimeout(On)
if (Rn) clearTimeout(Rn)
},
jn = function () {
var hash = Vn(),
t = {}
if (hash.length < 5) return t
var e,
n = hash.split('&')
for (e = 0; e < n.length; e++)
if (n[e]) {
var i = n[e].split('=')
if (!(i.length < 2)) t[i[0]] = i[1]
}
if (s.galleryPIDs) {
var o = t.pid
for (t.pid = 0, e = 0; e < dn.length; e++)
if (dn[e].pid === o) {
t.pid = e
break
}
} else t.pid = parseInt(t.pid, 10) - 1
if (t.pid < 0) t.pid = 0
return t
},
Kn = function () {
if (Rn) clearTimeout(Rn)
if (Rt || ue) return (Rn = setTimeout(Kn, 500)), void 0
if (Fn) clearTimeout(Bn)
else Fn = true
var t = h + 1,
e = yn(h)
if (e.hasOwnProperty('pid')) t = e.pid
var n = qn + '&' + 'gid=' + s.galleryUID + '&' + 'pid=' + t
if (!zn) if (-1 === Yn.hash.indexOf(n)) $n = true
var i = Yn.href.split('#')[0] + '#' + n
if (Wn) {
if ('#' + n !== window.location.hash)
history[zn ? 'replaceState' : 'pushState'](
'',
document.title,
i
)
} else if (zn) Yn.replace(i)
else Yn.hash = n
;(zn = true),
(Bn = setTimeout(function () {
Fn = false
}, 60))
}
at('History', {
publicMethods: {
initHistory: function () {
if ((n.extend(s, Pn, true), s.history)) {
if (
((Yn = window.location),
($n = false),
(Hn = false),
(zn = false),
(qn = Vn()),
(Wn = 'pushState' in history),
qn.indexOf('gid=') > -1)
)
qn = (qn = qn.split('&gid=')[0]).split('?gid=')[0]
lt('afterChange', i.updateURL),
lt('unbindEvents', function () {
n.unbind(window, 'hashchange', i.onHashChange)
})
var t = function () {
if (((Un = true), !Hn))
if ($n) history.back()
else if (qn) Yn.hash = qn
else if (Wn)
history.pushState(
'',
document.title,
Yn.pathname + Yn.search
)
else Yn.hash = ''
Gn()
}
lt('unbindEvents', function () {
if (f) t()
}),
lt('destroy', function () {
if (!Un) t()
}),
lt('firstUpdate', function () {
h = jn().pid
})
var index = qn.indexOf('pid=')
if (index > -1)
if ('&' === (qn = qn.substring(0, index)).slice(-1))
qn = qn.slice(0, -1)
setTimeout(function () {
if (l) n.bind(window, 'hashchange', i.onHashChange)
}, 40)
}
},
onHashChange: function () {
if (Vn() === qn) return (Hn = true), i.close(), void 0
if (!Fn) (Nn = true), i.goTo(jn().pid), (Nn = false)
},
updateURL: function () {
if ((Gn(), !Nn))
if (!zn) Kn()
else On = setTimeout(Kn, 800)
},
},
}),
n.extend(i, zt)
}
return t
})
},
12552: function (t, e, n) {
'use strict'
var i, o
/*! PhotoSwipe Default UI - 4.1.3 - 2019-01-08
* http://photoswipe.com
* Copyright (c) 2019 Dmitry Semenov; */ !(function (a, factory) {
if (true)
!(
void 0 !==
(o = 'function' == typeof (i = factory) ? i.call(e, n, e, t) : i) &&
(t.exports = o)
)
else if ('object' == typeof e) t.exports = factory()
else a.PhotoSwipeUI_Default = factory()
})(this, function () {
var t
return function (t, e) {
var n = this,
i = false,
o = true,
a,
s,
u,
l,
c,
f,
h,
p = true,
m,
g,
v,
y,
w,
b,
C,
S,
x = {
barsSize: { top: 44, bottom: 'auto' },
closeElClasses: ['item', 'caption', 'zoom-wrap', 'ui', 'top-bar'],
timeToIdle: 4e3,
timeToIdleOutside: 1e3,
loadingIndicatorDelay: 1e3,
addCaptionHTMLFn: function (t, e) {
if (!t.title) return (e.children[0].innerHTML = ''), false
else return (e.children[0].innerHTML = t.title), true
},
closeEl: true,
captionEl: true,
fullscreenEl: true,
zoomEl: true,
shareEl: true,
counterEl: true,
arrowEl: true,
preloaderEl: true,
tapToClose: false,
tapToToggleControls: true,
clickToCloseNonZoomable: true,
shareButtons: [
{
id: 'facebook',
label: 'Share on Facebook',
url: 'https://www.facebook.com/sharer/sharer.php?u={{url}}',
},
{
id: 'twitter',
label: 'Tweet',
url: 'https://twitter.com/intent/tweet?text={{text}}&url={{url}}',
},
{
id: 'pinterest',
label: 'Pin it',
url:
'http://www.pinterest.com/pin/create/button/' +
'?url={{url}}&media={{image_url}}&description={{text}}',
},
{
id: 'download',
label: 'Download image',
url: '{{raw_image_url}}',
download: true,
},
],
getImageURLForShare: function () {
return t.currItem.src || ''
},
getPageURLForShare: function () {
return window.location.href
},
getTextForShare: function () {
return t.currItem.title || ''
},
indexIndicatorSep: ' / ',
fitControlsWidth: 1200,
},
A,
_,
T = function (t) {
if (A) return true
if (((t = t || window.event), S.timeToIdle && S.mouseUsed && !g))
z()
for (
var n,
i,
o = (t.target || t.srcElement).getAttribute('class') || '',
a,
s = 0;
s < K.length;
s++
)
if ((i = K[s]).onTap && o.indexOf('pswp__' + i.name) > -1)
i.onTap(), (a = true)
if (a) {
if (t.stopPropagation) t.stopPropagation()
A = true
var u = e.features.isOldAndroid ? 600 : 30
_ = setTimeout(function () {
A = false
}, u)
}
},
E = function () {
return (
!t.likelyTouchDevice ||
S.mouseUsed ||
screen.width > S.fitControlsWidth
)
},
I = function (el, t, add) {
e[(add ? 'add' : 'remove') + 'Class'](el, 'pswp__' + t)
},
k = function () {
var t = 1 === S.getNumItemsFn()
if (t !== C) I(s, 'ui--one-slide', t), (C = t)
},
M = function () {
I(h, 'share-modal--hidden', p)
},
L = function () {
if (!(p = !p))
M(),
setTimeout(function () {
if (!p) e.addClass(h, 'pswp__share-modal--fade-in')
}, 30)
else
e.removeClass(h, 'pswp__share-modal--fade-in'),
setTimeout(function () {
if (p) M()
}, 300)
if (!p) O()
return false
},
P = function (e) {
var n = (e = e || window.event).target || e.srcElement
if ((t.shout('shareLinkClick', e, n), !n.href)) return false
if (n.hasAttribute('download')) return true
if (
(window.open(
n.href,
'pswp_share',
'scrollbars=yes,resizable=yes,toolbar=no,' +
'location=yes,width=550,height=420,top=100,left=' +
(window.screen ? Math.round(screen.width / 2 - 275) : 100)
),
!p)
)
L()
return false
},
O = function () {
for (
var t = '', e, n, i, o, a, s = 0;
s < S.shareButtons.length;
s++
)
if (
((e = S.shareButtons[s]),
(i = S.getImageURLForShare(e)),
(o = S.getPageURLForShare(e)),
(a = S.getTextForShare(e)),
(t +=
'<a href="' +
(n = e.url
.replace('{{url}}', encodeURIComponent(o))
.replace('{{image_url}}', encodeURIComponent(i))
.replace('{{raw_image_url}}', i)
.replace('{{text}}', encodeURIComponent(a))) +
'" target="_blank" ' +
'class="pswp__share--' +
e.id +
'"' +
(e.download ? 'download' : '') +
'>' +
e.label +
'</a>'),
S.parseShareButtonOut)
)
t = S.parseShareButtonOut(e, t)
;(h.children[0].innerHTML = t), (h.children[0].onclick = P)
},
B = function (t) {
for (var n = 0; n < S.closeElClasses.length; n++)
if (e.hasClass(t, 'pswp__' + S.closeElClasses[n])) return true
},
F,
N,
U = 0,
z = function () {
if ((clearTimeout(N), (U = 0), g)) n.setIdle(false)
},
H = function (t) {
var e = (t = t ? t : window.event).relatedTarget || t.toElement
if (!e || 'HTML' === e.nodeName)
clearTimeout(N),
(N = setTimeout(function () {
n.setIdle(true)
}, S.timeToIdleOutside))
},
$ = function () {
if (S.fullscreenEl && !e.features.isOldAndroid) {
if (!a) a = n.getFullscreenAPI()
if (a)
e.bind(document, a.eventK, n.updateFullscreen),
n.updateFullscreen(),
e.addClass(t.template, 'pswp--supports-fs')
else e.removeClass(t.template, 'pswp--supports-fs')
}
},
Y = function () {
if (S.preloaderEl)
W(true),
v('beforeChange', function () {
clearTimeout(b),
(b = setTimeout(function () {
if (t.currItem && t.currItem.loading) {
if (
!t.allowProgressiveImg() ||
(t.currItem.img && !t.currItem.img.naturalWidth)
)
W(false)
} else W(true)
}, S.loadingIndicatorDelay))
}),
v('imageLoadComplete', function (index, e) {
if (t.currItem === e) W(true)
})
},
W = function (t) {
if (w !== t) I(y, 'preloader--active', !t), (w = t)
},
V = function (t) {
var n = t.vGap
if (E()) {
var i = S.barsSize
if (S.captionEl && 'auto' === i.bottom) {
if (!l)
(l = e.createEl(
'pswp__caption pswp__caption--fake'
)).appendChild(e.createEl('pswp__caption__center')),
s.insertBefore(l, u),
e.addClass(s, 'pswp__ui--fit')
if (S.addCaptionHTMLFn(t, l, true)) {
var o = l.clientHeight
n.bottom = parseInt(o, 10) || 44
} else n.bottom = i.top
} else n.bottom = 'auto' === i.bottom ? 0 : i.bottom
n.top = i.top
} else n.top = n.bottom = 0
},
G = function () {
if (S.timeToIdle)
v('mouseUsed', function () {
e.bind(document, 'mousemove', z),
e.bind(document, 'mouseout', H),
(F = setInterval(function () {
if (2 === ++U) n.setIdle(true)
}, S.timeToIdle / 2))
})
},
j = function () {
var t
v('onVerticalDrag', function (t) {
if (o && t < 0.95) n.hideControls()
else if (!o && t >= 0.95) n.showControls()
}),
v('onPinchClose', function (e) {
if (o && e < 0.9) n.hideControls(), (t = true)
else if (t && !o && e > 0.9) n.showControls()
}),
v('zoomGestureEnded', function () {
if ((t = false) && !o) n.showControls()
})
},
K = [
{
name: 'caption',
option: 'captionEl',
onInit: function (el) {
u = el
},
},
{
name: 'share-modal',
option: 'shareEl',
onInit: function (el) {
h = el
},
onTap: function () {
L()
},
},
{
name: 'button--share',
option: 'shareEl',
onInit: function (el) {
f = el
},
onTap: function () {
L()
},
},
{
name: 'button--zoom',
option: 'zoomEl',
onTap: t.toggleDesktopZoom,
},
{
name: 'counter',
option: 'counterEl',
onInit: function (el) {
c = el
},
},
{ name: 'button--close', option: 'closeEl', onTap: t.close },
{ name: 'button--arrow--left', option: 'arrowEl', onTap: t.prev },
{ name: 'button--arrow--right', option: 'arrowEl', onTap: t.next },
{
name: 'button--fs',
option: 'fullscreenEl',
onTap: function () {
if (a.isFullscreen()) a.exit()
else a.enter()
},
},
{
name: 'preloader',
option: 'preloaderEl',
onInit: function (el) {
y = el
},
},
],
Z = function () {
var t,
n,
i,
o = function (o) {
if (o)
for (var a = o.length, s = 0; s < a; s++) {
;(t = o[s]), (n = t.className)
for (var u = 0; u < K.length; u++)
if (((i = K[u]), n.indexOf('pswp__' + i.name) > -1))
if (S[i.option]) {
if (
(e.removeClass(t, 'pswp__element--disabled'),
i.onInit)
)
i.onInit(t)
} else e.addClass(t, 'pswp__element--disabled')
}
}
o(s.children)
var a = e.getChildByClass(s, 'pswp__top-bar')
if (a) o(a.children)
}
;(n.init = function () {
if (
(e.extend(t.options, x, true),
(S = t.options),
(s = e.getChildByClass(t.scrollWrap, 'pswp__ui')),
(v = t.listen),
j(),
v('beforeChange', n.update),
v('doubleTap', function (e) {
var n = t.currItem.initialZoomLevel
if (t.getZoomLevel() !== n) t.zoomTo(n, e, 333)
else t.zoomTo(S.getDoubleTapZoom(false, t.currItem), e, 333)
}),
v('preventDragEvent', function (t, e, n) {
var i = t.target || t.srcElement
if (
i &&
i.getAttribute('class') &&
t.type.indexOf('mouse') > -1 &&
(i.getAttribute('class').indexOf('__caption') > 0 ||
/(SMALL|STRONG|EM)/i.test(i.tagName))
)
n.prevent = false
}),
v('bindEvents', function () {
if (
(e.bind(s, 'pswpTap click', T),
e.bind(t.scrollWrap, 'pswpTap', n.onGlobalTap),
!t.likelyTouchDevice)
)
e.bind(t.scrollWrap, 'mouseover', n.onMouseOver)
}),
v('unbindEvents', function () {
if (!p) L()
if (F) clearInterval(F)
if (
(e.unbind(document, 'mouseout', H),
e.unbind(document, 'mousemove', z),
e.unbind(s, 'pswpTap click', T),
e.unbind(t.scrollWrap, 'pswpTap', n.onGlobalTap),
e.unbind(t.scrollWrap, 'mouseover', n.onMouseOver),
a)
) {
if (
(e.unbind(document, a.eventK, n.updateFullscreen),
a.isFullscreen())
)
(S.hideAnimationDuration = 0), a.exit()
a = null
}
}),
v('destroy', function () {
if (S.captionEl) {
if (l) s.removeChild(l)
e.removeClass(u, 'pswp__caption--empty')
}
if (h) h.children[0].onclick = null
e.removeClass(s, 'pswp__ui--over-close'),
e.addClass(s, 'pswp__ui--hidden'),
n.setIdle(false)
}),
!S.showAnimationDuration)
)
e.removeClass(s, 'pswp__ui--hidden')
if (
(v('initialZoomIn', function () {
if (S.showAnimationDuration) e.removeClass(s, 'pswp__ui--hidden')
}),
v('initialZoomOut', function () {
e.addClass(s, 'pswp__ui--hidden')
}),
v('parseVerticalMargin', V),
Z(),
S.shareEl && f && h)
)
p = true
k(), G(), $(), Y()
}),
(n.setIdle = function (t) {
;(g = t), I(s, 'ui--idle', t)
}),
(n.update = function () {
if (o && t.currItem) {
if ((n.updateIndexIndicator(), S.captionEl))
S.addCaptionHTMLFn(t.currItem, u),
I(u, 'caption--empty', !t.currItem.title)
i = true
} else i = false
if (!p) L()
k()
}),
(n.updateFullscreen = function (n) {
if (n)
setTimeout(function () {
t.setScrollOffset(0, e.getScrollY())
}, 50)
e[(a.isFullscreen() ? 'add' : 'remove') + 'Class'](
t.template,
'pswp--fs'
)
}),
(n.updateIndexIndicator = function () {
if (S.counterEl)
c.innerHTML =
t.getCurrentIndex() +
1 +
S.indexIndicatorSep +
S.getNumItemsFn()
}),
(n.onGlobalTap = function (i) {
var a = (i = i || window.event).target || i.srcElement
if (!A)
if (i.detail && 'mouse' === i.detail.pointerType) {
if (B(a)) return t.close(), void 0
if (e.hasClass(a, 'pswp__img'))
if (
1 === t.getZoomLevel() &&
t.getZoomLevel() <= t.currItem.fitRatio
) {
if (S.clickToCloseNonZoomable) t.close()
} else t.toggleDesktopZoom(i.detail.releasePoint)
} else {
if (S.tapToToggleControls)
if (o) n.hideControls()
else n.showControls()
if (S.tapToClose && (e.hasClass(a, 'pswp__img') || B(a)))
return t.close(), void 0
}
}),
(n.onMouseOver = function (t) {
var e = (t = t || window.event).target || t.srcElement
I(s, 'ui--over-close', B(e))
}),
(n.hideControls = function () {
e.addClass(s, 'pswp__ui--hidden'), (o = false)
}),
(n.showControls = function () {
if (((o = true), !i)) n.update()
e.removeClass(s, 'pswp__ui--hidden')
}),
(n.supportsFullscreen = function () {
var d = document
return !!(
d.exitFullscreen ||
d.mozCancelFullScreen ||
d.webkitExitFullscreen ||
d.msExitFullscreen
)
}),
(n.getFullscreenAPI = function () {
var e = document.documentElement,
n,
i = 'fullscreenchange'
if (e.requestFullscreen)
n = {
enterK: 'requestFullscreen',
exitK: 'exitFullscreen',
elementK: 'fullscreenElement',
eventK: i,
}
else if (e.mozRequestFullScreen)
n = {
enterK: 'mozRequestFullScreen',
exitK: 'mozCancelFullScreen',
elementK: 'mozFullScreenElement',
eventK: 'moz' + i,
}
else if (e.webkitRequestFullscreen)
n = {
enterK: 'webkitRequestFullscreen',
exitK: 'webkitExitFullscreen',
elementK: 'webkitFullscreenElement',
eventK: 'webkit' + i,
}
else if (e.msRequestFullscreen)
n = {
enterK: 'msRequestFullscreen',
exitK: 'msExitFullscreen',
elementK: 'msFullscreenElement',
eventK: 'MSFullscreenChange',
}
if (n)
(n.enter = function () {
if (
((m = S.closeOnScroll),
(S.closeOnScroll = false),
'webkitRequestFullscreen' === this.enterK)
)
t.template[this.enterK](Element.ALLOW_KEYBOARD_INPUT)
else return t.template[this.enterK]()
}),
(n.exit = function () {
return (S.closeOnScroll = m), document[this.exitK]()
}),
(n.isFullscreen = function () {
return document[this.elementK]
})
return n
})
}
})
},
12553: function (t, e, n) {
'use strict'
var i = n(17)
if (!window.Utility) window.Utility = {}
;(Utility.decodeJsonAttribute = function (t) {
return JSON.parse(decodeURIComponent(atob(t)))
}),
i(window.loadMapsContent)
},
12554: function (t, e, n) {
'use strict'
n(12555)
var i = n(17),
Utils
if (n(3539).animationsEnabled())
i(window).on('load', function () {
var t
if (
!/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(
navigator.userAgent || navigator.vendor || window.opera
)
) {
var items = i('.u-parallax')
if (items.length > 0) {
items.each(function () {
var t = i(this)
if (
(t.css('background-attachment', 'fixed'),
t.hasClass('u-shading'))
)
t.attr(
'data-bottom-top',
'background-position: 50% 0, 50% 0vh;'
),
t.attr(
'data-top-bottom',
'background-position: 50% 0, 50% -20vh'
)
else
t.attr('data-bottom-top', 'background-position: 50% 0vh;'),
t.attr('data-top-bottom', 'background-position: 50% -20vh')
})
var e = { forceHeight: false }
skrollr.init(e)
}
}
})
},
12555: function (t, e) {
var e = void 0,
t = void 0
;(function () {
/*!
* skrollr core
*
* Alexander Prinzhorn - https://github.com/Prinzhorn/skrollr
*
* Free to use under terms of MIT license
*/
!(function (e, n, i) {
'use strict'
function o(t) {
if (
((c = n.documentElement),
(f = n.body),
X(),
(Mt = this),
(Nt = (t = t || {}).constants || {}),
t.easing)
)
for (var i in t.easing) nt[i] = t.easing[i]
if (
((Jt = t.edgeStrategy || 'set'),
(Ot = {
beforerender: t.beforerender,
render: t.render,
keyframe: t.keyframe,
}),
(Bt = false !== t.forceHeight))
)
Ft = t.scale || 1
if (
((Ut = t.mobileDeceleration || E),
(Gt = false !== t.smoothScrolling),
(jt = t.smoothScrollingDuration || k),
(Kt = { targetTop: Mt.getScrollTop() }),
(Qt = (
t.mobileCheck ||
function () {
return /Android|iPhone|iPad|iPod|BlackBerry/i.test(
navigator.userAgent || navigator.vendor || e.opera
)
}
)()))
) {
if ((Pt = n.getElementById(t.skrollrBody || I))) mt()
rt(), At(c, [C, A], [S])
} else At(c, [C, x], [S])
Mt.refresh(),
gt(e, 'resize orientationchange', function () {
var t = c.clientWidth,
e = c.clientHeight
if (e !== Yt || t !== $t) (Yt = e), ($t = t), (Wt = true)
})
var o = J()
return (
!(function t() {
st(), (ie = o(t))
})(),
Mt
)
}
var a = {
get: function () {
return Mt
},
init: function (t) {
return Mt || new o(t)
},
VERSION: '0.6.30',
},
s = Object.prototype.hasOwnProperty,
u = e.Math,
l = e.getComputedStyle,
c,
f,
h = 'touchstart',
p = 'touchmove',
m = 'touchcancel',
g = 'touchend',
v = 'skrollable',
y = v + '-before',
w = v + '-between',
b = v + '-after',
C = 'skrollr',
S = 'no-' + C,
x = C + '-desktop',
A = C + '-mobile',
_ = 'linear',
T = 1e3,
E = 0.004,
I = 'skrollr-body',
k = 200,
M = 'start',
L = 'end',
P = 'center',
O = 'bottom',
B = '___skrollable_id',
F = /^(?:input|textarea|button|select)$/i,
N = /^\s+|\s+$/g,
U =
/^data(?:-(_\w+))?(?:-?(-?\d*\.?\d+p?))?(?:-?(start|end|top|center|bottom))?(?:-?(top|center|bottom))?$/,
z = /\s*(@?[\w\-\[\]]+)\s*:\s*(.+?)\s*(?:;|$)/gi,
H = /^(@?[a-z\-]+)\[(\w+)\]$/,
$ = /-([a-z0-9_])/g,
Y = function (t, e) {
return e.toUpperCase()
},
W = /[\-+]?[\d]*\.?[\d]+/g,
V = /\{\?\}/g,
G = /rgba?\(\s*-?\d+\s*,\s*-?\d+\s*,\s*-?\d+/g,
j = /[a-z\-]+-gradient/g,
K = '',
Z = '',
X = function () {
var t = /^(?:O|Moz|webkit|ms)|(?:-(?:o|moz|webkit|ms)-)/
if (l) {
var style = l(f, null)
for (var e in style)
if ((K = e.match(t) || (+e == e && style[e].match(t)))) break
if (!K) return (K = Z = ''), void 0
if ('-' === (K = K[0]).slice(0, 1))
(Z = K),
(K = {
'-webkit-': 'webkit',
'-moz-': 'Moz',
'-ms-': 'ms',
'-o-': 'O',
}[K])
else Z = '-' + K.toLowerCase() + '-'
}
},
J = function () {
var t =
e.requestAnimationFrame ||
e[K.toLowerCase() + 'RequestAnimationFrame'],
n = Dt()
if (Qt || !t)
t = function (t) {
var i = Dt() - n,
o = u.max(0, 1e3 / 60 - i)
return e.setTimeout(function () {
;(n = Dt()), t()
}, o)
}
return t
},
tt = function () {
var t =
e.cancelAnimationFrame ||
e[K.toLowerCase() + 'CancelAnimationFrame']
if (Qt || !t)
t = function (t) {
return e.clearTimeout(t)
}
return t
},
nt = {
begin: function () {
return 0
},
end: function () {
return 1
},
linear: function (t) {
return t
},
quadratic: function (t) {
return t * t
},
cubic: function (t) {
return t * t * t
},
swing: function (t) {
return -u.cos(t * u.PI) / 2 + 0.5
},
sqrt: function (t) {
return u.sqrt(t)
},
outCubic: function (t) {
return u.pow(t - 1, 3) + 1
},
bounce: function (t) {
var e
if (t <= 0.5083) e = 3
else if (t <= 0.8489) e = 9
else if (t <= 0.96208) e = 27
else if (t <= 0.99981) e = 91
else return 1
return 1 - u.abs((3 * u.cos(t * e * 1.028)) / e)
},
}
;(o.prototype.refresh = function (t) {
var e,
o,
a = false
if (t === i)
(a = true), (Lt = []), (Xt = 0), (t = n.getElementsByTagName('*'))
else if (t.length === i) t = [t]
for (e = 0, o = t.length; e < o; e++) {
var el = t[e],
s = el,
u = [],
l = Gt,
c = Jt,
f = false
if (a && B in el) delete el[B]
if (el.attributes) {
for (var h = 0, p = el.attributes.length; h < p; h++) {
var m = el.attributes[h]
if ('data-anchor-target' !== m.name)
if ('data-smooth-scrolling' !== m.name)
if ('data-edge-strategy' !== m.name)
if ('data-emit-events' !== m.name) {
var g = m.name.match(U)
if (null !== g) {
var y = {
props: m.value,
element: el,
eventType: m.name.replace($, Y),
}
u.push(y)
var w = g[1]
if (w) y.constant = w.substr(1)
var b = g[2]
if (/p$/.test(b))
(y.isPercentage = true),
(y.offset = (0 | b.slice(0, -1)) / 100)
else y.offset = 0 | b
var C = g[3],
S = g[4] || C
if (!C || C === M || C === L) {
if (((y.mode = 'absolute'), C === L)) y.isEnd = true
else if (!y.isPercentage) y.offset = y.offset * Ft
} else (y.mode = 'relative'), (y.anchors = [C, S])
}
} else f = true
else c = m.value
else l = 'off' !== m.value
else if (null === (s = n.querySelector(m.value)))
throw 'Unable to find anchor target "' + m.value + '"'
}
if (u.length) {
var x, A, id
if (!a && B in el)
(id = el[B]), (x = Lt[id].styleAttr), (A = Lt[id].classAttr)
else (id = el[B] = Xt++), (x = el.style.cssText), (A = xt(el))
;(Lt[id] = {
element: el,
styleAttr: x,
classAttr: A,
anchorTarget: s,
keyFrames: u,
smoothScrolling: l,
edgeStrategy: c,
emitEvents: f,
lastFrameIndex: -1,
}),
At(el, [v], [])
}
}
}
for (bt(), e = 0, o = t.length; e < o; e++) {
var sk = Lt[t[e][B]]
if (sk !== i) ut(sk), ct(sk)
}
return Mt
}),
(o.prototype.relativeToAbsolute = function (t, e, n) {
var i = c.clientHeight,
o = t.getBoundingClientRect(),
a = o.top,
s = o.bottom - o.top
if (e === O) a -= i
else if (e === P) a -= i / 2
if (n === O) a += s
else if (n === P) a += s / 2
return ((a += Mt.getScrollTop()) + 0.5) | 0
}),
(o.prototype.animateTo = function (t, e) {
e = e || {}
var n = Dt(),
o = Mt.getScrollTop(),
a = e.duration === i ? T : e.duration
if (
!(Vt = {
startTop: o,
topDiff: t - o,
targetTop: t,
duration: a,
startTime: n,
endTime: n + a,
easing: nt[e.easing || _],
done: e.done,
}).topDiff
) {
if (Vt.done) Vt.done.call(Mt, false)
Vt = i
}
return Mt
}),
(o.prototype.stopAnimateTo = function () {
if (Vt && Vt.done) Vt.done.call(Mt, true)
Vt = i
}),
(o.prototype.isAnimatingTo = function () {
return !!Vt
}),
(o.prototype.isMobile = function () {
return Qt
}),
(o.prototype.setScrollTop = function (t, n) {
if (((Zt = true === n), Qt)) te = u.min(u.max(t, 0), Rt)
else e.scrollTo(0, t)
return Mt
}),
(o.prototype.getScrollTop = function () {
if (Qt) return te
else return e.pageYOffset || c.scrollTop || f.scrollTop || 0
}),
(o.prototype.getMaxScrollTop = function () {
return Rt
}),
(o.prototype.on = function (t, e) {
return (Ot[t] = e), Mt
}),
(o.prototype.off = function (t) {
return delete Ot[t], Mt
}),
(o.prototype.destroy = function () {
var t
tt()(ie), yt(), At(c, [S], [C, x, A])
for (var e = 0, n = Lt.length; e < n; e++) pt(Lt[e].element)
if (
((c.style.overflow = f.style.overflow = ''),
(c.style.height = f.style.height = ''),
Pt)
)
a.setStyle(Pt, 'transform', 'none')
;(Mt = i),
(Pt = i),
(Ot = i),
(Bt = i),
(Rt = 0),
(Ft = 1),
(Nt = i),
(Ut = i),
(qt = 'down'),
(zt = -1),
($t = 0),
(Yt = 0),
(Wt = false),
(Vt = i),
(Gt = i),
(jt = i),
(Kt = i),
(Zt = i),
(Xt = 0),
(Jt = i),
(Qt = false),
(te = 0),
(ee = i)
})
var rt = function () {
var t, o, a, s, l, v, y, w, b, C, S, x
gt(c, [h, p, m, g].join(' '), function (e) {
var c = e.changedTouches[0]
for (s = e.target; 3 === s.nodeType; ) s = s.parentNode
if (
((l = c.clientY),
(v = c.clientX),
(C = e.timeStamp),
!F.test(s.tagName))
)
e.preventDefault()
switch (e.type) {
case h:
if (t) t.blur()
Mt.stopAnimateTo(), (t = s), (o = y = l), (a = v), (b = C)
break
case p:
if (F.test(s.tagName) && n.activeElement !== s)
e.preventDefault()
;(w = l - y),
(x = C - S),
Mt.setScrollTop(te - w, true),
(y = l),
(S = C)
break
default:
case m:
case g:
var f = o - l,
A = a - v,
_
if (A * A + f * f < 49) {
if (!F.test(t.tagName)) {
t.focus()
var T = n.createEvent('MouseEvents')
T.initMouseEvent(
'click',
true,
true,
e.view,
1,
c.screenX,
c.screenY,
c.clientX,
c.clientY,
e.ctrlKey,
e.altKey,
e.shiftKey,
e.metaKey,
0,
null
),
t.dispatchEvent(T)
}
return
}
t = i
var E = w / x
E = u.max(u.min(E, 3), -3)
var I = u.abs(E / Ut),
k = E * I + 0.5 * Ut * I * I,
M = Mt.getScrollTop() - k,
L = 0
if (M > Rt) (L = (Rt - M) / k), (M = Rt)
else if (M < 0) (L = -M / k), (M = 0)
;(I *= 1 - L),
Mt.animateTo((M + 0.5) | 0, {
easing: 'outCubic',
duration: I,
})
break
}
}),
e.scrollTo(0, 0),
(c.style.overflow = f.style.overflow = 'hidden')
},
ot = function () {
var t = c.clientHeight,
e = Ct(),
n,
i,
o,
a,
s,
l,
f,
h,
p,
m,
g
for (h = 0, p = Lt.length; h < p; h++)
for (
i = (n = Lt[h]).element,
o = n.anchorTarget,
s = 0,
l = (a = n.keyFrames).length;
s < l;
s++
) {
if (
((m = (f = a[s]).offset),
(g = e[f.constant] || 0),
(f.frame = m),
f.isPercentage)
)
(m *= t), (f.frame = m)
if ('relative' === f.mode)
pt(i),
(f.frame =
Mt.relativeToAbsolute(o, f.anchors[0], f.anchors[1]) - m),
pt(i, true)
if (((f.frame += g), Bt))
if (!f.isEnd && f.frame > Rt) Rt = f.frame
}
for (Rt = u.max(Rt, St()), h = 0, p = Lt.length; h < p; h++) {
for (s = 0, l = (a = (n = Lt[h]).keyFrames).length; s < l; s++)
if (((g = e[(f = a[s]).constant] || 0), f.isEnd))
f.frame = Rt - f.offset + g
n.keyFrames.sort(kt)
}
},
at = function (t, e) {
for (var n = 0, i = Lt.length; n < i; n++) {
var o = Lt[n],
u = o.element,
l = o.smoothScrolling ? t : e,
c = o.keyFrames,
f = c.length,
h = c[0],
p = c[c.length - 1],
m = l < h.frame,
g = l > p.frame,
C = m ? h : p,
S = o.emitEvents,
x = o.lastFrameIndex,
A,
_
if (m || g) {
if ((m && -1 === o.edge) || (g && 1 === o.edge)) continue
if (m) {
if ((At(u, [y], [b, w]), S && x > -1))
wt(u, h.eventType, qt), (o.lastFrameIndex = -1)
} else if ((At(u, [b], [y, w]), S && x < f))
wt(u, p.eventType, qt), (o.lastFrameIndex = f)
switch (((o.edge = m ? -1 : 1), o.edgeStrategy)) {
case 'reset':
pt(u)
continue
case 'ease':
l = C.frame
break
default:
case 'set':
var props = C.props
for (A in props)
if (s.call(props, A))
if (((_ = ht(props[A].value)), 0 === A.indexOf('@')))
u.setAttribute(A.substr(1), _)
else a.setStyle(u, A, _)
continue
}
} else if (0 !== o.edge) At(u, [v, w], [y, b]), (o.edge = 0)
for (var T = 0; T < f - 1; T++)
if (l >= c[T].frame && l <= c[T + 1].frame) {
var E = c[T],
I = c[T + 1]
for (A in E.props)
if (s.call(E.props, A)) {
var k = (l - E.frame) / (I.frame - E.frame)
if (
((k = E.props[A].easing(k)),
(_ = dt(E.props[A].value, I.props[A].value, k)),
(_ = ht(_)),
0 === A.indexOf('@'))
)
u.setAttribute(A.substr(1), _)
else a.setStyle(u, A, _)
}
if (S)
if (x !== T) {
if ('down' === qt) wt(u, E.eventType, qt)
else wt(u, I.eventType, qt)
o.lastFrameIndex = T
}
break
}
}
},
st = function () {
if (Wt) (Wt = false), bt()
var t = Mt.getScrollTop(),
e,
n = Dt(),
o
if (Vt) {
if (n >= Vt.endTime) (t = Vt.targetTop), (e = Vt.done), (Vt = i)
else
(o = Vt.easing((n - Vt.startTime) / Vt.duration)),
(t = (Vt.startTop + o * Vt.topDiff) | 0)
Mt.setScrollTop(t, true)
} else if (!Zt) {
var s
if (Kt.targetTop - t)
Kt = {
startTop: zt,
topDiff: t - zt,
targetTop: t,
startTime: Ht,
endTime: Ht + jt,
}
if (n <= Kt.endTime)
(o = nt.sqrt((n - Kt.startTime) / jt)),
(t = (Kt.startTop + o * Kt.topDiff) | 0)
}
if (Zt || zt !== t) {
Zt = false
var u = {
curTop: t,
lastTop: zt,
maxTop: Rt,
direction: (qt = t > zt ? 'down' : t < zt ? 'up' : qt),
},
l
if (false !== (Ot.beforerender && Ot.beforerender.call(Mt, u))) {
if ((at(t, Mt.getScrollTop()), Qt && Pt))
a.setStyle(
Pt,
'transform',
'translate(0, ' + -te + 'px) ' + ee
)
if (((zt = t), Ot.render)) Ot.render.call(Mt, u)
}
if (e) e.call(Mt, false)
}
Ht = n
},
ut = function (t) {
for (var e = 0, n = t.keyFrames.length; e < n; e++) {
for (
var i = t.keyFrames[e], o, a, s, props = {}, u;
null !== (u = z.exec(i.props));
) {
if (((s = u[1]), (a = u[2]), null !== (o = s.match(H))))
(s = o[1]), (o = o[2])
else o = _
;(a = a.indexOf('!') ? lt(a) : [a.slice(1)]),
(props[s] = { value: a, easing: nt[o] })
}
i.props = props
}
},
lt = function (t) {
var e = []
if (
((G.lastIndex = 0),
(t = t.replace(G, function (t) {
return t.replace(W, function (t) {
return (t / 255) * 100 + '%'
})
})),
Z)
)
(j.lastIndex = 0),
(t = t.replace(j, function (t) {
return Z + t
}))
return (
(t = t.replace(W, function (t) {
return e.push(+t), '{?}'
})),
e.unshift(t),
e
)
},
ct = function (sk) {
var t = {},
e,
n
for (e = 0, n = sk.keyFrames.length; e < n; e++)
ft(sk.keyFrames[e], t)
for (t = {}, e = sk.keyFrames.length - 1; e >= 0; e--)
ft(sk.keyFrames[e], t)
},
ft = function (t, e) {
var n
for (n in e) if (!s.call(t.props, n)) t.props[n] = e[n]
for (n in t.props) e[n] = t.props[n]
},
dt = function (t, e, n) {
var i,
o = t.length
if (o !== e.length)
throw (
'Can\'t interpolate between "' + t[0] + '" and "' + e[0] + '"'
)
var a = [t[0]]
for (i = 1; i < o; i++) a[i] = t[i] + (e[i] - t[i]) * n
return a
},
ht = function (t) {
var e = 1
return (
(V.lastIndex = 0),
t[0].replace(V, function () {
return t[e++]
})
)
},
pt = function (t, e) {
for (var n, i, o = 0, a = (t = [].concat(t)).length; o < a; o++)
if (((i = t[o]), (n = Lt[i[B]])))
if (e)
(i.style.cssText = n.dirtyStyleAttr), At(i, n.dirtyClassAttr)
else
(n.dirtyStyleAttr = i.style.cssText),
(n.dirtyClassAttr = xt(i)),
(i.style.cssText = n.styleAttr),
At(i, n.classAttr)
},
mt = function () {
;(ee = 'translateZ(0)'), a.setStyle(Pt, 'transform', ee)
var t = l(Pt),
e = t.getPropertyValue('transform'),
n = t.getPropertyValue(Z + 'transform'),
i
if (!((e && 'none' !== e) || (n && 'none' !== n))) ee = ''
}
a.setStyle = function (el, t, e) {
var style = el.style
if ('zIndex' === (t = t.replace($, Y).replace('-', '')))
if (isNaN(e)) style[t] = e
else style[t] = '' + (0 | e)
else if ('float' === t) style.styleFloat = style.cssFloat = e
else
try {
if (K) style[K + t.slice(0, 1).toUpperCase() + t.slice(1)] = e
style[t] = e
} catch (t) {}
}
var gt = (a.addEvent = function (t, names, n) {
for (
var i = function (t) {
if (!(t = t || e.event).target) t.target = t.srcElement
if (!t.preventDefault)
t.preventDefault = function () {
;(t.returnValue = false), (t.defaultPrevented = true)
}
return n.call(this, t)
},
o,
a = 0,
s = (names = names.split(' ')).length;
a < s;
a++
) {
if (((o = names[a]), t.addEventListener))
t.addEventListener(o, n, false)
else t.attachEvent('on' + o, i)
ne.push({ element: t, name: o, listener: n })
}
}),
vt = (a.removeEvent = function (t, names, e) {
for (var n = 0, i = (names = names.split(' ')).length; n < i; n++)
if (t.removeEventListener)
t.removeEventListener(names[n], e, false)
else t.detachEvent('on' + names[n], e)
}),
yt = function () {
for (var t, e = 0, n = ne.length; e < n; e++)
(t = ne[e]), vt(t.element, t.name, t.listener)
ne = []
},
wt = function (t, e, n) {
if (Ot.keyframe) Ot.keyframe.call(Mt, t, e, n)
},
bt = function () {
var t = Mt.getScrollTop()
if (((Rt = 0), Bt && !Qt)) f.style.height = ''
if ((ot(), Bt && !Qt)) f.style.height = Rt + c.clientHeight + 'px'
if (Qt) Mt.setScrollTop(u.min(Mt.getScrollTop(), Rt))
else Mt.setScrollTop(t, true)
Zt = true
},
Ct = function () {
var t = c.clientHeight,
copy = {},
e,
n
for (e in Nt) {
if ('function' == typeof (n = Nt[e])) n = n.call(Mt)
else if (/p$/.test(n)) n = (n.slice(0, -1) / 100) * t
copy[e] = n
}
return copy
},
St = function () {
var t = 0,
e
if (Pt) t = u.max(Pt.offsetHeight, Pt.scrollHeight)
return (
(e = u.max(
t,
f.scrollHeight,
f.offsetHeight,
c.scrollHeight,
c.offsetHeight,
c.clientHeight
)) - c.clientHeight
)
},
xt = function (t) {
var n = 'className'
if (e.SVGElement && t instanceof e.SVGElement)
(t = t[n]), (n = 'baseVal')
return t[n]
},
At = function (t, add, remove) {
var n = 'className'
if (e.SVGElement && t instanceof e.SVGElement)
(t = t[n]), (n = 'baseVal')
if (remove === i) return (t[n] = add), void 0
for (var o = t[n], a = 0, s = remove.length; a < s; a++)
o = Tt(o).replace(Tt(remove[a]), ' ')
o = _t(o)
for (var u = 0, l = add.length; u < l; u++)
if (-1 === Tt(o).indexOf(Tt(add[u]))) o += ' ' + add[u]
t[n] = _t(o)
},
_t = function (t) {
return t.replace(N, '')
},
Tt = function (t) {
return ' ' + t + ' '
},
Dt =
Date.now ||
function () {
return +new Date()
},
kt = function (t, e) {
return t.frame - e.frame
},
Mt,
Lt,
Pt,
Ot,
Bt,
Rt = 0,
Ft = 1,
Nt,
Ut,
qt = 'down',
zt = -1,
Ht = Dt(),
$t = 0,
Yt = 0,
Wt = false,
Vt,
Gt,
jt,
Kt,
Zt,
Xt = 0,
Jt,
Qt = false,
te = 0,
ee,
ne = [],
ie
if ('function' == typeof define && define.amd)
define([], function () {
return a
})
else if (void 0 !== t && t.exports) t.exports = a
else e.skrollr = a
})(window, document)
}).call(window)
},
12556: function (t, e, n) {
'use strict'
function i(t) {
this.initialize(t)
}
function o(t) {
if (!window.getComputedStyle) return null
var transform = getComputedStyle(t).transform,
e = /matrix\(([^)]+)\)/.exec(transform)
if (!e || e.length < 2) return null
if ((e = e[1].split(',')).length < 6) return null
else
return {
a: parseFloat(e[0], 10),
b: parseFloat(e[1], 10),
c: parseFloat(e[2], 10),
d: parseFloat(e[3], 10),
tx: parseFloat(e[4], 10),
ty: parseFloat(e[5], 10),
}
}
function a(t, e, n, i) {
var a = o(e),
s = 0,
u = 0,
l,
c
if (a && !isNaN(a.tx)) s = a.tx
if (a && !isNaN(a.ty)) u = a.ty
if ('horizontal' === n) (l = t.innerWidth()), (c = s)
else (l = t.innerHeight()), (c = u)
return Math.ceil(l * i + c)
}
function s(t) {
if (!t && !t.element) return false
var e = t.element.getAttribute('data-animation-name')
if (e && 'slidein' === e.toLowerCase()) return true
else return false
}
function u(t) {
if (!s(t)) return t
var e = t.offset
if ('string' == typeof e)
if (((e = parseFloat(e)), t.offset.indexOf('%') > -1)) e /= 100
return (
((t = $.extend({}, t)).offset = function () {
return a(this.context, this.element, this.axis, e)
}),
t
)
}
n(12557),
(i.prototype.initialize = function t(e) {
if (!this.waypoint)
if (e && e.element && 'function' == typeof e.handler)
(e = u(e)), (this.waypoint = new Waypoint(e))
}),
(i.prototype.destroy = function t() {
if (this.waypoint) this.waypoint.destroy(), (this.waypoint = null)
}),
(window.WaypointAdapter = i)
},
12557: function (t, e) {
var e = void 0,
t = void 0
;(function () {
/*!
Waypoints - 4.0.1
Copyright © 2011-2016 Caleb Troughton
Licensed under the MIT license.
https://github.com/imakewebthings/waypoints/blob/master/licenses.txt
*/
!(function () {
'use strict'
function t(i) {
if (!i) throw new Error('No options passed to Waypoint constructor')
if (!i.element)
throw new Error('No element option passed to Waypoint constructor')
if (!i.handler)
throw new Error('No handler option passed to Waypoint constructor')
if (
((this.key = 'waypoint-' + e),
(this.options = t.Adapter.extend({}, t.defaults, i)),
(this.element = this.options.element),
(this.adapter = new t.Adapter(this.element)),
(this.callback = i.handler),
(this.axis = this.options.horizontal ? 'horizontal' : 'vertical'),
(this.enabled = this.options.enabled),
(this.triggerPoint = null),
(this.group = t.Group.findOrCreate({
name: this.options.group,
axis: this.axis,
})),
(this.context = t.Context.findOrCreateByElement(
this.options.context
)),
t.offsetAliases[this.options.offset])
)
this.options.offset = t.offsetAliases[this.options.offset]
this.group.add(this),
this.context.add(this),
(n[this.key] = this),
(e += 1)
}
var e = 0,
n = {}
;(t.prototype.queueTrigger = function (t) {
this.group.queueTrigger(this, t)
}),
(t.prototype.trigger = function (t) {
if (this.enabled) if (this.callback) this.callback.apply(this, t)
}),
(t.prototype.destroy = function () {
this.context.remove(this),
this.group.remove(this),
delete n[this.key]
}),
(t.prototype.disable = function () {
return (this.enabled = false), this
}),
(t.prototype.enable = function () {
return this.context.refresh(), (this.enabled = true), this
}),
(t.prototype.next = function () {
return this.group.next(this)
}),
(t.prototype.previous = function () {
return this.group.previous(this)
}),
(t.invokeAll = function (t) {
var e = []
for (var i in n) e.push(n[i])
for (var o = 0, a = e.length; o < a; o++) e[o][t]()
}),
(t.destroyAll = function () {
t.invokeAll('destroy')
}),
(t.disableAll = function () {
t.invokeAll('disable')
}),
(t.enableAll = function () {
for (var e in (t.Context.refreshAll(), n)) n[e].enabled = true
return this
}),
(t.refreshAll = function () {
t.Context.refreshAll()
}),
(t.viewportHeight = function () {
return window.innerHeight || document.documentElement.clientHeight
}),
(t.viewportWidth = function () {
return document.documentElement.clientWidth
}),
(t.adapters = []),
(t.defaults = {
context: window,
continuous: true,
enabled: true,
group: 'default',
horizontal: false,
offset: 0,
}),
(t.offsetAliases = {
'bottom-in-view': function () {
return this.context.innerHeight() - this.adapter.outerHeight()
},
'right-in-view': function () {
return this.context.innerWidth() - this.adapter.outerWidth()
},
}),
(window.Waypoint = t)
})(),
(function () {
'use strict'
function t(t) {
window.setTimeout(t, 1e3 / 60)
}
function e(t) {
if (
((this.element = t),
(this.Adapter = o.Adapter),
(this.adapter = new this.Adapter(t)),
(this.key = 'waypoint-context-' + n),
(this.didScroll = false),
(this.didResize = false),
(this.oldScroll = {
x: this.adapter.scrollLeft(),
y: this.adapter.scrollTop(),
}),
(this.waypoints = { vertical: {}, horizontal: {} }),
(t.waypointContextKey = this.key),
(i[t.waypointContextKey] = this),
(n += 1),
!o.windowContext)
)
(o.windowContext = true), (o.windowContext = new e(window))
this.createThrottledScrollHandler(),
this.createThrottledResizeHandler()
}
var n = 0,
i = {},
o = window.Waypoint,
a = window.onload
;(e.prototype.add = function (t) {
var e = t.options.horizontal ? 'horizontal' : 'vertical'
;(this.waypoints[e][t.key] = t), this.refresh()
}),
(e.prototype.checkEmpty = function () {
var t = this.Adapter.isEmptyObject(this.waypoints.horizontal),
e = this.Adapter.isEmptyObject(this.waypoints.vertical),
n = this.element == this.element.window
if (t && e && !n)
this.adapter.off('.waypoints'), delete i[this.key]
}),
(e.prototype.createThrottledResizeHandler = function () {
function t() {
e.handleResize(), (e.didResize = false)
}
var e = this
this.adapter.on('resize.waypoints', function () {
if (!e.didResize)
(e.didResize = true), o.requestAnimationFrame(t)
})
}),
(e.prototype.createThrottledScrollHandler = function () {
function t() {
e.handleScroll(), (e.didScroll = false)
}
var e = this
this.adapter.on('scroll.waypoints', function () {
if (!e.didScroll || o.isTouch)
(e.didScroll = true), o.requestAnimationFrame(t)
})
}),
(e.prototype.handleResize = function () {
o.Context.refreshAll()
}),
(e.prototype.handleScroll = function () {
var t = {},
e = {
horizontal: {
newScroll: this.adapter.scrollLeft(),
oldScroll: this.oldScroll.x,
forward: 'right',
backward: 'left',
},
vertical: {
newScroll: this.adapter.scrollTop(),
oldScroll: this.oldScroll.y,
forward: 'down',
backward: 'up',
},
}
for (var n in e) {
var i = e[n],
o,
a = i.newScroll > i.oldScroll ? i.forward : i.backward
for (var s in this.waypoints[n]) {
var u = this.waypoints[n][s]
if (null !== u.triggerPoint) {
var l = i.oldScroll < u.triggerPoint,
c = i.newScroll >= u.triggerPoint,
f,
h
if ((l && c) || (!l && !c))
u.queueTrigger(a), (t[u.group.id] = u.group)
}
}
}
for (var p in t) t[p].flushTriggers()
this.oldScroll = {
x: e.horizontal.newScroll,
y: e.vertical.newScroll,
}
}),
(e.prototype.innerHeight = function () {
if (this.element == this.element.window) return o.viewportHeight()
else return this.adapter.innerHeight()
}),
(e.prototype.remove = function (t) {
delete this.waypoints[t.axis][t.key], this.checkEmpty()
}),
(e.prototype.innerWidth = function () {
if (this.element == this.element.window) return o.viewportWidth()
else return this.adapter.innerWidth()
}),
(e.prototype.destroy = function () {
var t = []
for (var e in this.waypoints)
for (var n in this.waypoints[e]) t.push(this.waypoints[e][n])
for (var i = 0, o = t.length; i < o; i++) t[i].destroy()
}),
(e.prototype.refresh = function () {
var t = this.element == this.element.window,
e = t ? void 0 : this.adapter.offset(),
n = {},
i
for (var a in (this.handleScroll(),
(i = {
horizontal: {
contextOffset: t ? 0 : e.left,
contextScroll: t ? 0 : this.oldScroll.x,
contextDimension: this.innerWidth(),
oldScroll: this.oldScroll.x,
forward: 'right',
backward: 'left',
offsetProp: 'left',
},
vertical: {
contextOffset: t ? 0 : e.top,
contextScroll: t ? 0 : this.oldScroll.y,
contextDimension: this.innerHeight(),
oldScroll: this.oldScroll.y,
forward: 'down',
backward: 'up',
offsetProp: 'top',
},
}))) {
var s = i[a]
for (var u in this.waypoints[a]) {
var l = this.waypoints[a][u],
c = l.options.offset,
f = l.triggerPoint,
h = 0,
p = null == f,
m,
g,
v,
y,
w
if (l.element !== l.element.window)
h = l.adapter.offset()[s.offsetProp]
if ('function' == typeof c) c = c.apply(l)
else if ('string' == typeof c)
if (
((c = parseFloat(c)), l.options.offset.indexOf('%') > -1)
)
c = Math.ceil((s.contextDimension * c) / 100)
if (
((m = s.contextScroll - s.contextOffset),
(l.triggerPoint = Math.floor(h + m - c)),
(g = f < s.oldScroll),
(v = l.triggerPoint >= s.oldScroll),
(w = !g && !v),
!p && (y = g && v))
)
l.queueTrigger(s.backward), (n[l.group.id] = l.group)
else if (!p && w)
l.queueTrigger(s.forward), (n[l.group.id] = l.group)
else if (p && s.oldScroll >= l.triggerPoint)
l.queueTrigger(s.forward), (n[l.group.id] = l.group)
}
}
return (
o.requestAnimationFrame(function () {
for (var t in n) n[t].flushTriggers()
}),
this
)
}),
(e.findOrCreateByElement = function (t) {
return e.findByElement(t) || new e(t)
}),
(e.refreshAll = function () {
for (var t in i) i[t].refresh()
}),
(e.findByElement = function (t) {
return i[t.waypointContextKey]
}),
(window.onload = function () {
if (a) a()
e.refreshAll()
}),
(o.requestAnimationFrame = function (e) {
var n
;(
window.requestAnimationFrame ||
window.mozRequestAnimationFrame ||
window.webkitRequestAnimationFrame ||
t
).call(window, e)
}),
(o.Context = e)
})(),
(function () {
'use strict'
function t(t, e) {
return t.triggerPoint - e.triggerPoint
}
function e(t, e) {
return e.triggerPoint - t.triggerPoint
}
function Group(t) {
;(this.name = t.name),
(this.axis = t.axis),
(this.id = this.name + '-' + this.axis),
(this.waypoints = []),
this.clearTriggerQueues(),
(n[this.axis][this.name] = this)
}
var n = { vertical: {}, horizontal: {} },
i = window.Waypoint
;(Group.prototype.add = function (t) {
this.waypoints.push(t)
}),
(Group.prototype.clearTriggerQueues = function () {
this.triggerQueues = { up: [], down: [], left: [], right: [] }
}),
(Group.prototype.flushTriggers = function () {
for (var n in this.triggerQueues) {
var i = this.triggerQueues[n],
o = 'up' === n || 'left' === n
i.sort(o ? e : t)
for (var a = 0, s = i.length; a < s; a += 1) {
var u = i[a]
if (u.options.continuous || a === i.length - 1) u.trigger([n])
}
}
this.clearTriggerQueues()
}),
(Group.prototype.next = function (e) {
this.waypoints.sort(t)
var index = i.Adapter.inArray(e, this.waypoints),
n
return index === this.waypoints.length - 1
? null
: this.waypoints[index + 1]
}),
(Group.prototype.previous = function (e) {
this.waypoints.sort(t)
var index = i.Adapter.inArray(e, this.waypoints)
return index ? this.waypoints[index - 1] : null
}),
(Group.prototype.queueTrigger = function (t, e) {
this.triggerQueues[e].push(t)
}),
(Group.prototype.remove = function (t) {
var index = i.Adapter.inArray(t, this.waypoints)
if (index > -1) this.waypoints.splice(index, 1)
}),
(Group.prototype.first = function () {
return this.waypoints[0]
}),
(Group.prototype.last = function () {
return this.waypoints[this.waypoints.length - 1]
}),
(Group.findOrCreate = function (t) {
return n[t.axis][t.name] || new Group(t)
}),
(i.Group = Group)
})(),
(function () {
'use strict'
function t(t) {
return t === t.window
}
function e(e) {
if (t(e)) return e
else return e.defaultView
}
function n(t) {
;(this.element = t), (this.handlers = {})
}
var i = window.Waypoint
;(n.prototype.innerHeight = function () {
var e
return t(this.element)
? this.element.innerHeight
: this.element.clientHeight
}),
(n.prototype.innerWidth = function () {
var e
return t(this.element)
? this.element.innerWidth
: this.element.clientWidth
}),
(n.prototype.off = function (t, e) {
function n(t, e, n) {
for (var i = 0, o = e.length - 1; i < o; i++) {
var a = e[i]
if (!n || n === a) t.removeEventListener(a)
}
}
var i = t.split('.'),
o = i[0],
a = i[1],
s = this.element
if (a && this.handlers[a] && o)
n(s, this.handlers[a][o], e), (this.handlers[a][o] = [])
else if (o)
for (var u in this.handlers)
n(s, this.handlers[u][o] || [], e), (this.handlers[u][o] = [])
else if (a && this.handlers[a]) {
for (var type in this.handlers[a])
n(s, this.handlers[a][type], e)
this.handlers[a] = {}
}
}),
(n.prototype.offset = function () {
if (!this.element.ownerDocument) return null
var t = this.element.ownerDocument.documentElement,
n = e(this.element.ownerDocument),
rect = { top: 0, left: 0 }
if (this.element.getBoundingClientRect)
rect = this.element.getBoundingClientRect()
return {
top: rect.top + n.pageYOffset - t.clientTop,
left: rect.left + n.pageXOffset - t.clientLeft,
}
}),
(n.prototype.on = function (t, e) {
var n = t.split('.'),
i = n[0],
o = n[1] || '__default',
a = (this.handlers[o] = this.handlers[o] || {}),
s
;(a[i] = a[i] || []).push(e), this.element.addEventListener(i, e)
}),
(n.prototype.outerHeight = function (e) {
var n = this.innerHeight(),
i
if (e && !t(this.element))
(i = window.getComputedStyle(this.element)),
(n += parseInt(i.marginTop, 10)),
(n += parseInt(i.marginBottom, 10))
return n
}),
(n.prototype.outerWidth = function (e) {
var n = this.innerWidth(),
i
if (e && !t(this.element))
(i = window.getComputedStyle(this.element)),
(n += parseInt(i.marginLeft, 10)),
(n += parseInt(i.marginRight, 10))
return n
}),
(n.prototype.scrollLeft = function () {
var t = e(this.element)
return t ? t.pageXOffset : this.element.scrollLeft
}),
(n.prototype.scrollTop = function () {
var t = e(this.element)
return t ? t.pageYOffset : this.element.scrollTop
}),
(n.extend = function () {
function merge(t, e) {
if ('object' == typeof t && 'object' == typeof e)
for (var n in e) if (e.hasOwnProperty(n)) t[n] = e[n]
return t
}
for (
var t = Array.prototype.slice.call(arguments),
e = 1,
n = t.length;
e < n;
e++
)
merge(t[0], t[e])
return t[0]
}),
(n.inArray = function (t, e, n) {
return null == e ? -1 : e.indexOf(t, n)
}),
(n.isEmptyObject = function (t) {
for (var e in t) return false
return true
}),
i.adapters.push({ name: 'noframework', Adapter: n }),
(i.Adapter = n)
})()
}).call(window)
},
12558: function (t, e, n) {
'use strict'
var i = n(17)
i(document).ready(function () {
function t(t) {
return e() ? 0 : n(t)
}
function e() {
return a.hasClass('u-overlap')
}
function n(t) {
var rect
return t[0].getBoundingClientRect().height
}
var o = i('header.u-sticky')
if (
o.length &&
!o.closest('.u-overlap').length &&
!CSS.supports('position', 'sticky') &&
!CSS.supports('position', '-webkit-sticky')
) {
o.css('width', '100%')
var update = function () {
o.each(function () {
var t = i(this),
e = t.height(),
n = t.data('additionalMargin') || 0
if (e !== n) {
t.data('additionalMargin', e)
var o = t
do {
o = o.next()
} while (o.length > 0 && 'none' === o.css('display'))
o.css(
'margin-top',
parseFloat(o.css('margin-top')) - n + e + 'px'
)
}
})
}
update(), i(window).load(update), i(window).resize(update)
}
var a = i('.u-body')
if (a.hasClass('u-overlap-transparent'))
a.data('overlap-transparent', true)
if (a.hasClass('u-overlap-contrast')) a.data('overlap-contrast', true)
i(window).scroll(function e() {
i('header.u-sticky').each(function () {
var e = i(this),
n = e.nextAll(':visible:first')
if (n.length) {
var o = n.offset().top,
s = e.offset().top,
u,
l = s + t(e) > o,
c
if ((a.toggleClass('u-sticky-fixed', l), s > o))
a.addClass('u-sticky-scroll'),
a.removeClass('u-overlap-transparent u-overlap-contrast')
else
a.toggleClass(
'u-overlap-transparent',
!!a.data('overlap-transparent')
),
a.toggleClass(
'u-overlap-contrast',
!!a.data('overlap-contrast')
),
a.removeClass('u-sticky-scroll')
}
})
})
})
},
12559: function (t, e, n) {
'use strict'
function i(t) {
function e() {
c = []
var e = o('html').scrollTop()
t.each(function () {
var rect = this.getBoundingClientRect()
c.push({ height: rect.height, top: rect.top + e })
})
}
function n(index) {
for (var e = 0, n = 0; n < index; n++) {
var i
if (t.eq(n).hasClass(f)) {
var rect
e += (c[n] || {}).height || 0
}
}
return e
}
function i() {
l.refresh()
}
function a() {
clearTimeout(p),
(p = setTimeout(function () {
for (var n = 0; n < t.length; n++) {
var i
u(t.eq(n))
}
e(), l.refresh()
}, 25))
}
function s(t, e, n) {
if (!(t = o(t)).hasClass(f)) {
var i = o('<div></div>')
i.addClass(h),
i.css('height', e + 'px'),
t.after(i),
t.addClass(f),
t.css('top', n + 'px')
}
}
function u(t) {
;(t = o(t)).nextAll('.' + h).remove(),
t.removeClass(f),
t.css('top', '')
}
var l = {},
c = [],
f = 'u-sticky-fixed',
h = 'u-sticky-placeholder',
p = null
return (
(l.init = function init() {
o(window).on('scroll', i), o(window).on('resize', a), e()
}),
(l.destroy = function t() {
o(window).off('scroll', i), o(window).off('resize', a)
}),
(l.refresh = function e() {
var i = document.documentElement.scrollTop || document.body.scrollTop
t.each(function (t, el) {
var e = n(t)
if (i + e > c[t].top) s(el, c[t].height, e)
else u(el)
})
}),
l
)
}
var o = n(17)
o(window).on('load', function () {
var t,
sticky = i(o('.u-section-row.u-sticky'))
sticky.init(), sticky.refresh()
}),
(window._npStickyStack = i)
},
12560: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
i('.u-nav-container .u-nav-link').each(function () {
window._npInitMenuLink(i(this))
}),
i('.u-nav-container-collapse .u-nav-link').each(function () {
window._npInitMenuLink(i(this), true)
})
}),
(window._npInitMenuLink = function t(e, n) {
var o = i('body'),
a = /\/?#.*?$/,
s = o.attr('data-home-page-name'),
homePage = o.attr('data-home-page'),
pageTitle = i('title').text().trim(),
nav = e.closest('.u-menu'),
u = nav.attr('data-submenu-level') || 'on-click',
l = nav.is('.u-menu-mega'),
c = e.attr('href') || '',
f = (e[0].href || '').replace(a, ''),
h = c.replace(a, ''),
p = s || pageTitle,
m = e.text().trim(),
hash = c.replace(/^[^#]+/, ''),
g = f.split('.').slice(0, -1).join('.'),
pageName = h.replace('.html', ''),
v = new RegExp(pageName + '_[\\s\\S]+?.html', 'gm'),
y = hash && i(hash).length,
w = h && window.location.href.toString() === f && !y,
b = h && window.location.href.toString() === g && !y,
C = h && window.location.href.toString().search(v) > -1,
S =
h && hash && window.location.href.toString().search(h + hash) > -1,
x,
A,
_
if (
w ||
b ||
C ||
S ||
(m && p === m) ||
(!y && homePage && h === homePage)
) {
var T = e
if (!l || n) T = e.parents('.u-nav-item').children('.u-nav-link')
if ((T.addClass('active'), 'with-reload' === u && n))
T.siblings('.u-nav-popup')
.addClass('open')
.css('max-height', 'none')
}
})
},
12561: function (t, e, n) {
'use strict'
var i = n(17),
o
if (
'Microsoft Internet Explorer' === navigator.appName ||
!!(
navigator.userAgent.match(/Trident/) ||
navigator.userAgent.match(/rv:11/)
) ||
(void 0 !== i.browser && 1 === i.browser.msie)
)
i(function () {
i('.u-social-icons, .u-language').each(function (t, e) {
var n = i(e),
size = n.css('height')
n.find('.u-svg-link').css('width', size)
})
})
},
12562: function (t, e, n) {
'use strict'
var Animation = n(12563),
i = n(273)
n(594), n(12567), (window.uAnimation = new Animation(i.instance()).init())
},
12563: function (t, e, n) {
'use strict'
function Animation(factory) {
;(this.factory = factory),
(this.animationElements = null),
(this.animationEvents = []),
(this._section = null),
(this._sliderNode = null),
(this._slideNumber = null),
(this._slideEvent = null),
(this._animationInfo = null),
(this._animation = null),
(this._subscribeQueue = []),
(this.status = 'loading'),
(this._onDOMContentLoaded = this._onDOMContentLoaded.bind(this)),
(this._onLoadingComplete = this._onLoadingComplete.bind(this))
}
function i(t) {
var e =
window.requestAnimationFrame ||
window.mozRequestAnimationFrame ||
window.webkitRequestAnimationFrame ||
window.msRequestAnimationFrame
if (!e) return t(), void 0
e.apply(window, arguments)
}
function o(t) {
return 'string' == typeof t.name && -1 !== m.indexOf(t.name.toLowerCase())
}
function a(t) {
return (
'string' == typeof t.direction &&
-1 !== g.indexOf(t.direction.toLowerCase())
)
}
function s(section, t) {
if (t && t.length)
if (u())
for (var e = 0; e < t.length; e++)
if (a(t[e]) || o(t[e])) {
section.style.overflow = 'hidden'
break
}
}
function u() {
return /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(
navigator.userAgent || navigator.vendor || window.opera
)
}
var l = n(379),
c = n(380),
f = n(12564),
h = n(12565),
p = n(12566)
;(Animation.utils = l),
(Animation.prototype.init = function init() {
if ('loading' !== document.readyState)
return this._onDOMContentLoaded(), void 0
else
return (
document.addEventListener(
'DOMContentLoaded',
this._onDOMContentLoaded
),
this
)
}),
(Animation.prototype.start = function t() {
var e = this._subscribeQueue
i(function () {
e.forEach(function (el) {
if (el.event && el.animation) el.event.subscribe(el.animation)
}),
(e.length = 0)
})
}),
(Animation.prototype.visitSection = function t(e) {
if (e.classList.contains('u-carousel'))
return this.visitSlider(e), void 0
;(this._section = e),
this._visitElementsInContentSlider(e),
this._visitElementsNotInSlider(e),
(this._section = null)
}),
(Animation.prototype._visitElementsInContentSlider = function (t) {
for (
var e = t.querySelectorAll('.u-carousel'), n = 0;
n < e.length;
n++
)
this.visitSlider(e[n])
}),
(Animation.prototype._visitElementsNotInSlider = function (t) {
for (
var e = [], n = t.querySelectorAll('[data-animation-name]'), o = 0;
o < n.length;
o++
) {
var a = n[o]
if (
a.closest &&
null === a.closest('.u-carousel') &&
a.getAttribute('data-animation-name')
)
this.visitAnimatedElement(a),
e.push(this._animationInfo),
this._subscribeQueue.push({
animation: this._animation,
event: f,
}),
i(this._animation.init.bind(this._animation))
}
s(t, e)
}),
(Animation.prototype.visitSlider = function t(e) {
this._sliderNode = e
for (
var n = e.querySelectorAll('.u-carousel-item'), i = 0;
i < n.length;
i++
)
(this._slideNumber = i), this.visitSlide(n[i])
}),
(Animation.prototype.visitSlide = function t(e) {
var n = e.querySelectorAll('[data-animation-name]'),
i = []
this._slideEvent = new h(this._sliderNode, e, this._slideNumber)
for (var o = 0; o < n.length; o++)
if (n[o].getAttribute('data-animation-name'))
this.visitAnimatedElement(n[o]),
i.push(this._animationInfo),
this._animation.init(),
this._slideEvent.animations.push(this._animation)
this._slideEvent.init(), s(e, i)
}),
(Animation.prototype.visitAnimatedElement = function t(e) {
;(this._animationInfo = new c(e, this._section)),
(this._animation = this.factory.createAnimation(this._animationInfo)),
this.animationElements.push(this._animation)
}),
(Animation.prototype._onDOMContentLoaded = function () {
if (
((this.status = 'DOMContentLoaded'),
document.removeEventListener(
'DOMContentLoaded',
this._onDOMContentLoaded
),
!this.animationElements)
) {
;(this.animationElements = []), this.factory.setHint(p)
var sections = $('section, header, footer'),
length = sections.length
if (
(sections.each(
function (index, t) {
if ((this.visitSection(t), !--length))
this.factory.setHint(null)
}.bind(this)
),
'interactive' !== document.readyState)
)
return this._onLoadingComplete(), void 0
window.addEventListener('load', this._onLoadingComplete)
}
}),
(Animation.prototype._onLoadingComplete = function () {
;(this.status = 'complete'),
window.removeEventListener('load', this._onLoadingComplete),
this.start()
})
var m = ['lightspeedin', 'flipin', 'flipout'],
g = ['right', 'downright', 'upright']
;(t.exports = Animation), (window.Animation = Animation)
},
12564: function (t, e, n) {
'use strict'
function i(animation) {
if (
(animation.start(),
!animation.isInOutAnimation() && !animation.info.infinite)
) {
var t = animation.info.duration,
e = animation.info.delay
setTimeout(function () {
animation.clear()
}, t + e)
}
}
function o(animation) {
if (animation.isInOutAnimation()) animation.startOut()
}
function a(animation) {
return (
animation.info &&
0 === animation.info.animationOut &&
animation.info.element.classList.contains('animated-once')
)
}
var s = {
subscribe: function t(animation) {
var e = (animation && animation.info) || {},
n = e.section || e.element
animation.info.eventObject = new WaypointAdapter({
element: n,
handler: function (t) {
if (animation)
if ('up' === t || a(animation)) return o(animation), void 0
else return i(animation), void 0
},
offset: '70%',
})
},
}
;(t.exports = s), (window.AnimationEventScroll = s)
},
12565: function (t, e, n) {
'use strict'
function i(carousel, slide, t) {
;(this.carousel = $(carousel)),
(this.slide = $(slide)),
(this.slideNum = t),
(this.animations = []),
(this._delays = []),
(this._autoplayPaused = false),
(this._handleSlide = o.bind(this)),
(this._handleSlid = a.bind(this))
}
function o(t) {
if (t) if (t.from === this.slideNum) this.slideOut(t)
}
function a(t) {
if (t && t.to === this.slideNum)
this.pauseAutoplayWhileInAnimation(), this.startInAnimation()
}
;(i.prototype.init = function init() {
if (
($(this.carousel).on('u-slide.bs.u-carousel', this._handleSlide),
$(this.carousel).on('slid.bs.u-carousel', this._handleSlid),
this.slide.is('.u-active'))
) {
if (this._isAutoplayOnStart()) this.pauseAutoplayWhileInAnimation()
this.startInAnimation()
}
}),
(i.prototype.deinit = function t() {
$(this.carousel).off('slid.bs.u-carousel', this._handleSlid),
$(this.carousel).off('u-slide.bs.u-carousel', this._handleSlide)
}),
(i.prototype.resetAnimations = function t() {
for (var e = 0; e < this.animations.length; e++)
if (this.animations[e].reset) this.animations[e].reset()
}),
(i.prototype.pauseAutoplayWhileInAnimation = function t() {
var e = this.countMaxInAnimationTime()
if (e > 0)
this._pauseAutoplay(),
this._delay(
e,
function () {
this._continueAutoplay(), this._clearDelays()
}.bind(this)
)
}),
(i.prototype.startInAnimation = function t() {
this.animations.forEach(
function (animation) {
animation.start()
}.bind(this)
)
}),
(i.prototype.needOutAnimation = function t() {
for (var e = 0, length = this.animations.length; e < length; e++)
if (
this.animations[e].needOutAnimation &&
this.animations[e].needOutAnimation()
)
return true
return false
}),
(i.prototype.startOutAnimations = function t() {
for (var e = 0; e < this.animations.length; e++)
if (this.animations[e].startOut) this.animations[e].startOut()
}),
(i.prototype.countMaxOutAnimationTime = function t() {
if (!this.animations || !this.animations.length) return 0
var e = this.animations.map(function (animation) {
return animation.getOutTime()
})
return Math.max.apply(null, e)
}),
(i.prototype.countMaxInAnimationTime = function t() {
if (!this.animations || !this.animations.length) return 0
var e = this.animations.map(function (animation) {
return animation.getTime()
})
return Math.max.apply(null, e)
}),
(i.prototype.slideOut = function t(e) {
if (this._delays.length > 0) this._cancelDelays()
if ((this._continueAutoplay(), !this.needOutAnimation()))
return this.resetAnimations(), void 0
e.preventDefault()
var n = this.countMaxOutAnimationTime(),
i = 'number' == typeof e.to ? e.to : null,
o = e.direction
setTimeout(
function () {
if ((this.resetAnimations(), null !== i))
return $(e.target)['u-carousel'](i), void 0
if ('left' === o) return $(e.target)['u-carousel']('next'), void 0
if ('right' === o) $(e.target)['u-carousel']('prev')
}.bind(this),
n
),
this.startOutAnimations()
}),
(i.prototype._delay = function t(e, n) {
this._delays.push(
setTimeout(function () {
n()
}, e)
)
}),
(i.prototype._cancelDelays = function t() {
this._delays.forEach(function (id) {
clearTimeout(id)
}),
(this._delays.length = 0)
}),
(i.prototype._clearDelays = function t() {
this._delays.length = 0
}),
(i.prototype._isAutoplayOnStart = function t() {
var e = this.carousel.attr('data-u-ride')
if (!e) return false
else return 'carousel' === (e = e.toLowerCase())
}),
(i.prototype._pauseAutoplay = function t() {
this.carousel['u-carousel']('pause'), (this._autoplayPaused = true)
}),
(i.prototype._continueAutoplay = function t() {
if (this._autoplayPaused)
this.carousel['u-carousel']('cycle'), (this._autoplayPaused = false)
}),
(t.exports = i),
(window.AnimationEventSlider = i)
},
12566: function (t, e, n) {
'use strict'
function i(t) {
var e = []
if (-1 !== a.indexOf(t.name) || t.direction) e.push('transform')
if (-1 !== s.indexOf(t.name)) e.push('opacity')
if (-1 !== u.indexOf(t.name)) e.push('contents')
if (0 === e.length) e.push('auto')
return e.join(', ')
}
var o = {},
a = [
'bounce',
'headShake',
'heartBeat',
'jello',
'pulse',
'rubberBand',
'shake',
'swing',
'tada',
'wobble',
'bounceIn',
'flip',
'flipInX',
'flipInY',
'flipOutX',
'flipOutY',
'lightSpeedIn',
'rotateIn',
'slideIn',
'hinge',
'jackInTheBox',
'rollIn',
'zoomIn',
'customAnimationIn',
'customAnimationOut',
],
s = [
'flash',
'bounceIn',
'fadeIn',
'flipInX',
'flipInY',
'flipOutX',
'flipOutY',
'lightSpeedIn',
'rotateIn',
'hinge',
'jackInTheBox',
'rollIn',
'zoomIn',
'customAnimationIn',
'customAnimationOut',
],
u = ['counter']
;(o.hintBrowser = function t(e) {
if (e && e.element) e.element.style.willChange = i(e)
}),
(o.removeHint = function t(e) {
e.element.style.willChange = 'auto'
}),
(t.exports = o),
(window.WillChangeHint = o)
},
12567: function (t, e, n) {
'use strict'
var i = n(12568),
Utils
if (n(3539).animationsEnabled())
document.addEventListener(
'np.responsive.init',
function (t) {
setTimeout(function () {
var e
new i(t.detail && t.detail.mode).subscribe()
}, 0)
}.bind(this),
false
)
},
12568: function (t, e, n) {
'use strict'
function i(t) {
;(this.mode = t || 'XL'),
(this.animations = []),
(this._responsiveListener = this.responsiveListener.bind(this)),
(this._prevState = {}),
(this._app = { raf: null })
}
t.exports = i
var o = n(12569)
;(i.prototype.subscribe = function () {
;(this.animations = this.initTimeline()),
document.addEventListener(
'np.responsive.changed',
this._responsiveListener,
false
)
var t = this._app,
e = this.render.bind(this)
!(function n() {
e(), (t.raf = requestAnimationFrame(n))
})()
}),
(i.prototype.destroy = function () {
cancelAnimationFrame(this._app.raf),
document.removeEventListener(
'np.responsive.changed',
this._responsiveListener,
false
),
(this.animations = null)
}),
(i.prototype.responsiveListener = function (t) {
if (t.detail && this.mode !== t.detail.mode)
(this.mode = t.detail.mode), (this.animations = this.initTimeline())
}),
(i.prototype.initTimeline = function () {
this._prevState = {}
var t = document.body.querySelectorAll('[data-custom-animation]')
return Array.from(t).reduce(
function (t, el) {
var e = el.getAttribute('data-custom-animation'),
n
if (!e) return t
try {
n = JSON.parse(e)
} catch (t) {
n = null
}
if (n) (n.animation = new o(el, n.animation, this.mode)), t.push(n)
return t
}.bind(this),
[]
)
}),
(i.prototype.render = function () {
var t = this.getGlobal()
if (this._prevState.scrollY !== t.scrollY)
this.animations.forEach(function (e) {
e.animation.setGlobal(t), e.animation.calc(), e.animation.apply()
}),
(this._prevState = t)
}),
(i.prototype.getGlobal = function () {
var t =
Math.max(
document.documentElement.clientHeight || 0,
window.innerHeight || 0
) || 1,
e = Math.max(0, window.scrollY),
n = document.documentElement.scrollHeight || 1,
i
return {
vh: t,
scrollY: e,
scrollHeight: n,
scrollHeightRelative: n / t,
}
}),
(window.ScrollTimeline = i)
},
12569: function (t, e, n) {
'use strict'
function i(t, animation, e) {
;(this.dom = t),
(this.mode = e),
(this.animation = animation || {}),
this.initSteps(),
(this.state = null),
(this.global = null)
}
var o = n(12570),
a = n(590)
t.exports = i
var s = 'before',
u = 'start',
l = 'end',
c = 'top',
f = 'middle',
h = 'bottom'
Object.defineProperty(i.prototype, 'currentAnimation', {
get: function () {
return this.animation[this.mode] || {}
},
}),
Object.defineProperty(i.prototype, 'steps', {
get: function () {
return this.currentAnimation.steps || []
},
}),
(i.prototype.initSteps = function () {
var t = this.dom.getBoundingClientRect(),
e
;(this.domWidth = t.width || 0),
(this.domHeight = t.height || 0),
(this.domTop = t.top + Math.max(0, window.scrollY)),
window._responsive.modes.forEach(function (t, index) {
var animation = this.animation[t],
n = !animation || !animation.steps.length
if (n && index > 0)
return (
(animation = JSON.parse(JSON.stringify(e))),
(this.animation[t] = animation),
void 0
)
if (n && 'XXL' === t)
(animation = JSON.parse(JSON.stringify(this.animation.XL || {}))),
(this.animation[t] = animation)
var i = animation.steps || [],
o = 0
i.forEach(function (t, e) {
var n = parseFloat(t.dist) || 0,
i = parseFloat(t.skip) || 0
;(t.dist = n),
(t.skip = i),
(t.index = e),
(t.start = o),
(t.end = o + n + i),
(o = t.end)
}),
(e = animation)
}, this)
}),
(i.prototype.setGlobal = function (t) {
this.global = t
}),
(i.prototype.calc = function () {
if (
((this.state = o.create(this.dom)),
!this.currentAnimation.hidden && (this.domHeight || this.domWidth))
) {
var t = this.getGlobalProgress()
this.steps.forEach(function (e) {
var n = s
if (t >= e.start && t < e.end) n = u
else if (t >= e.end) n = l
else if (t < e.start) n = s
this.calcStep(n, e, t)
}, this)
}
}),
(i.prototype.getGlobalProgress = function () {
var t = this.currentAnimation.start || {},
e = t.at || h,
n = parseFloat(t.off) || 0,
i = this.domTop,
o
if (e === c && this.domTop < 0) i += -this.domTop
if (e === f) {
if (this.domTop < this.global.vh / 2)
i += this.global.vh / 2 - this.domTop
i -= this.global.vh / 2
}
if (e === h) {
if (this.domTop < this.global.vh) i += this.global.vh - this.domTop
i -= this.global.vh
}
return (
((this.global.scrollY + n - i) * this.global.scrollHeightRelative) /
this.global.scrollHeight
)
}),
(i.prototype.calcStep = function (t, e, n) {
;(this.state.willChange = t !== l),
this.calcStepPropertyToggle(t, e, 'sticky', true),
this.calcStepPropertyToggle(t, e, 'fixed'),
this.calcFixed(t, e, n)
var i = this.getStepProgress(t, e, n)
if (!(i < 0))
(this.state.mx += (e.mx - this.state.mx) * i),
(this.state.my += (e.my - this.state.my) * i),
(this.state.op += (e.op - this.state.op) * i),
(this.state.sx += (e.sx - this.state.sx) * i),
(this.state.sy += (e.sy - this.state.sy) * i),
(this.state.rot += (e.rot - this.state.rot) * i),
(this.state.bgy += (e.bgy - this.state.bgy) * i),
(this.state.blur += (e.blur - this.state.blur) * i)
}),
(i.prototype.getStepProgress = function (t, e, n) {
if (t === s) return 0
if (t === l) return 1
var i = e.skip || 0
return (n - e.start - i) / (e.end - e.start - i)
}),
(i.prototype.calcStepPropertyToggle = function (t, e, n, i) {
if (e[n])
if (!(t === s && this.state[n] && e.index > 0))
if (t === u) this.state[n] = true
else if (t === l) this.state[n] = i ? e[n] : false
}),
(i.prototype.calcFixed = function (t, e, n) {
var i = e.skip || 0
if (!e.fixed)
return (
(this.state._unfixedDist += this.global.vh * (e.dist + i)), void 0
)
if (t === u)
this.state._fixedDist = this.global.vh * n - this.state._unfixedDist
else if (t === l) this.state._fixedDist += this.global.vh * (e.dist + i)
}),
(i.prototype.apply = function () {
if (this.state) a.apply(this.dom, this.state)
}),
(window.StepAnimation = i)
},
12570: function (t, e, n) {
'use strict'
var i = t.exports
;(i.create = function (t) {
var e = 1,
n = (t.getAttribute('class') || '').match(/u-opacity-(\d+)/)
if (n) e = parseFloat(n[1]) / 100
if (!Number.isFinite(e)) e = 1
return {
blur: 0,
sticky: false,
fixed: false,
_fixedDist: 0,
_unfixedDist: 0,
mx: 0,
my: 0,
op: e,
rot: 0,
sx: 1,
sy: 1,
bgy: 0,
}
}),
(window.StepAnimationState = i)
},
12571: function (t, e, n) {
'use strict'
function i() {}
function o(t, props) {
document.body.classList.add('u-scrollspy-prevent'),
t.animate(props, {
done: function () {
document.body.classList.remove('u-scrollspy-prevent')
},
})
}
var a = n(17)
;(i.prototype.scroll = function (t) {
var e = 1,
n = a('.u-section-row.u-sticky, header.u-sticky')
.toArray()
.reduce(function (t, el) {
return t + (a(el).outerHeight(true) || 0) - e
}, 0)
o(a('html, body'), { scrollTop: t.offset().top - n })
}),
(i.prototype.scrollTop = function () {
o(a('html, body'), { scrollTop: 0 })
}),
(i.prototype.update = function (t) {
var e = 'string' == typeof t ? t : a(t.currentTarget).attr('href')
if ((e = (e || '').replace(/^[^#]+/, '')).match(/^#[\d\w-_]+$/i)) {
var n = a(e)
if (n.length) {
if (t.preventDefault) t.preventDefault()
this.scroll(n)
}
}
}),
(window._npScrollAnchor = new i()),
a(window).on('load', function () {
window._npScrollAnchor.update(window.location.hash),
a('body').on(
'click',
'a:not([data-u-slide], [data-u-slide-to], [data-toggle], .u-tab-link, .u-quantity-button)',
function (t) {
if (!a(this).is('.u-dialog-link'))
window._npScrollAnchor.update(t), a(this).blur()
}
),
a('body').on('click', '.u-back-to-top', function () {
window._npScrollAnchor.scrollTop()
})
})
},
12572: function (t, e, n) {
'use strict'
var i = n(17),
o = n(12573),
a = 'u-gdpr-cookie',
s = 'u-cookies-consent',
u = 'u-button-confirm',
l = 'u-button-decline',
c = '_u_GDPRConfirmCode'
i(function () {
function t() {
var t = f(),
n = f()
e('sessionId', t, 0.5 / 24), e('userId', n, 365)
}
function e(t, e, n) {
if (!o.get(t)) o.set(t, e, { expires: n, secure: true })
}
function n() {
function t() {
return Math.floor(65536 * (1 + Math.random()))
.toString(16)
.substring(1)
}
return (
t() + t() + '-' + t() + '-' + t() + '-' + t() + '-' + t() + t() + t()
)
}
function f() {
if (
crypto &&
'function' == typeof crypto.getRandomValues &&
'function' == typeof window.Uint8Array
) {
var t = new window.Uint8Array(16),
guid
crypto.getRandomValues(t),
(t[6] = (15 & t[6]) | 64),
(t[8] = (63 & t[8]) | 128)
for (var e = [], i = '', o = 0; o < t.length; o++) {
if ((i = t[o].toString(16)).length < 2) i = '0' + i
e.push(i)
}
return (
e.slice(0, 4).join('') +
'-' +
e.slice(4, 6).join('') +
'-' +
e.slice(6, 8).join('') +
'-' +
e.slice(8, 10).join('') +
'-' +
e.slice(10).join('')
)
}
return n()
}
var h = i('.' + s),
p
if (!h.length) return t(), void 0
try {
p = o.get(a)
} catch (t) {
p = false
}
var m = window[c] || function () {}
if (!p)
h.addClass('show'),
h.find('.' + u).on('click', function (e) {
e.preventDefault(),
t(),
o.set(a, true, { expires: 365, secure: true }),
h.removeClass('show'),
m()
}),
h.find('.' + l).on('click', function (t) {
t.preventDefault(),
o.set(a, false, { expires: 365, secure: false }),
h.removeClass('show')
})
else if ('true' === p) t(), m()
})
},
12573: function (t, e, n) {
'use strict'
var i, o
/*!
* JavaScript Cookie v2.2.1
* https://github.com/js-cookie/js-cookie
*
* Copyright 2006, 2015 Klaus Hartl & Fagner Brack
* Released under the MIT license
*/ !(function (factory) {
var a
if (true)
!(
void 0 !==
(o = 'function' == typeof (i = factory) ? i.call(e, n, e, t) : i) &&
(t.exports = o)
),
(a = true)
if (true) (t.exports = factory()), (a = true)
if (!a) {
var s = window.Cookies,
u = (window.Cookies = factory())
u.noConflict = function () {
return (window.Cookies = s), u
}
}
})(function () {
function t() {
for (var t = 0, e = {}; t < arguments.length; t++) {
var n = arguments[t]
for (var i in n) e[i] = n[i]
}
return e
}
function e(t) {
return t.replace(/(%[0-9A-Z]{2})+/g, decodeURIComponent)
}
function init(n) {
function i() {}
function o(e, o, a) {
if ('undefined' != typeof document) {
if (
'number' == typeof (a = t({ path: '/' }, i.defaults, a)).expires
)
a.expires = new Date(1 * new Date() + 864e5 * a.expires)
a.expires = a.expires ? a.expires.toUTCString() : ''
try {
var s = JSON.stringify(o)
if (/^[\{\[]/.test(s)) o = s
} catch (t) {}
;(o = n.write
? n.write(o, e)
: encodeURIComponent(String(o)).replace(
/%(23|24|26|2B|3A|3C|3E|3D|2F|3F|40|5B|5D|5E|60|7B|7D|7C)/g,
decodeURIComponent
)),
(e = encodeURIComponent(String(e))
.replace(/%(23|24|26|2B|5E|60|7C)/g, decodeURIComponent)
.replace(/[\(\)]/g, escape))
var u = ''
for (var l in a)
if (a[l])
if (((u += '; ' + l), true !== a[l]))
u += '=' + a[l].split(';')[0]
return (document.cookie = e + '=' + o + u)
}
}
function a(t, i) {
if ('undefined' != typeof document) {
for (
var o = {},
a = document.cookie ? document.cookie.split('; ') : [],
s = 0;
s < a.length;
s++
) {
var u = a[s].split('='),
l = u.slice(1).join('=')
if (!i && '"' === l.charAt(0)) l = l.slice(1, -1)
try {
var c = e(u[0])
if (((l = (n.read || n)(l, c) || e(l)), i))
try {
l = JSON.parse(l)
} catch (t) {}
if (((o[c] = l), t === c)) break
} catch (t) {}
}
return t ? o[t] : o
}
}
return (
(i.set = o),
(i.get = function (t) {
return a(t, false)
}),
(i.getJSON = function (t) {
return a(t, true)
}),
(i.remove = function (e, n) {
o(e, '', t(n, { expires: -1 }))
}),
(i.defaults = {}),
(i.withConverter = init),
i
)
}
return init(function () {})
})
},
12574: function (t, e, n) {
'use strict'
$(function () {
var selector = '.u-back-to-top'
$(selector).hide(),
$(window).scroll(function () {
if ($(this).scrollTop() > 100)
$(selector).fadeIn().css('display', 'block')
else $(selector).fadeOut()
})
})
},
12575: function (t, e, n) {
'use strict'
var i = n(17),
o = n(12576)
;(window._npScrollSpyInit = function () {
var t = '.u-menu .u-nav-container .u-nav-link[href*="#"]',
e = '.u-menu .u-nav-container-collapse .u-nav-link[href*="#"]',
n
if (document.querySelectorAll(t).length)
try {
o(t, {
nested: true,
offset: function () {
var t, e
return (i('.u-header.u-sticky').outerHeight(true) || 0) + 1
},
}),
o(e, {
nested: true,
offset: function () {
return i('.u-header.u-sticky').outerHeight(true) || 0
},
})
} catch (t) {
console.warn('ScrollSpy: has no items')
}
}),
document.addEventListener(
'gumshoeActivate',
function (t) {
var link
t.detail.link.classList.add('active')
},
false
),
document.addEventListener(
'gumshoeDeactivate',
function (t) {
var link
t.detail.link.classList.remove('active')
},
false
),
i(function () {
window._npScrollSpyInit()
})
},
12576: function (t, e, n) {
'use strict'
;(function (n) {
var i, o
/*!
* gumshoejs v5.1.2
* A simple, framework-agnostic scrollspy script.
* (c) 2019 Chris Ferdinandi
* MIT License
* http://github.com/cferdinandi/gumshoe
*/ !(function (n, factory) {
if (true)
!(
void 0 !==
(o = function () {
return factory(n)
}.apply(e, (i = []))) && (t.exports = o)
)
else if ('object' == typeof e) t.exports = factory(n)
else n.Gumshoe = factory(n)
})(
void 0 !== n ? n : 'undefined' != typeof window ? window : this,
function (t) {
var e = {
navClass: 'active',
contentClass: 'active',
nested: false,
nestedClass: 'active',
offset: 0,
reflow: false,
events: true,
},
n = function () {
var t = {}
return (
Array.prototype.forEach.call(arguments, function (e) {
for (var n in e) if (e.hasOwnProperty(n)) t[n] = e[n]
}),
t
)
},
i = function (type, t, e) {
if (e.settings.events) {
var n = new CustomEvent(type, {
bubbles: true,
cancelable: true,
detail: e,
})
t.dispatchEvent(n)
}
},
o = function (t) {
var e = 0
if (t.offsetParent)
for (; t; ) (e += t.offsetTop), (t = t.offsetParent)
return e >= 0 ? e : 0
},
a = function (t) {
if (t)
t.sort(function (t, e) {
var n, i
if (o(t.content) < o(e.content)) return -1
else return 1
})
},
s = function (settings) {
if ('function' == typeof settings.offset)
return parseFloat(settings.offset())
else return parseFloat(settings.offset)
},
u = function () {
return Math.max(
document.body.scrollHeight,
document.documentElement.scrollHeight,
document.body.offsetHeight,
document.documentElement.offsetHeight,
document.body.clientHeight,
document.documentElement.clientHeight
)
},
l = function (e, settings, n) {
var i = e.getBoundingClientRect(),
o = s(settings)
if (n)
return (
parseInt(i.bottom, 10) <
(t.innerHeight || document.documentElement.clientHeight)
)
else return parseInt(i.top, 10) <= o
},
c = function () {
if (t.innerHeight + t.pageYOffset >= u()) return true
else return false
},
f = function (t, settings) {
if (c() && l(t.content, settings, true)) return true
else return false
},
h = function (t, settings) {
if (t.length) {
var e = t[t.length - 1]
if (f(e, settings)) return e
for (var n = t.length - 1; n >= 0; n--)
if (l(t[n].content, settings)) return t[n]
}
},
p = function (nav, settings) {
if (settings.nested && nav.parentNode) {
var t = nav.parentNode.closest('li')
if (t) t.classList.remove(settings.nestedClass), p(t, settings)
}
},
m = function (items, settings) {
if (items) {
var t = items.nav.closest('li')
if (t)
t.classList.remove(settings.navClass),
items.content.classList.remove(settings.contentClass),
p(t, settings),
i('gumshoeDeactivate', t, {
link: items.nav,
content: items.content,
settings: settings,
})
}
},
g = function (nav, settings) {
if (settings.nested) {
var t = nav.parentNode.closest('li')
if (t) t.classList.add(settings.nestedClass), g(t, settings)
}
},
v = function (items, settings) {
if (items) {
var t = items.nav.closest('li')
if (t)
t.classList.add(settings.navClass),
items.content.classList.add(settings.contentClass),
g(t, settings),
i('gumshoeActivate', t, {
link: items.nav,
content: items.content,
settings: settings,
})
}
},
y
return function (selector, i) {
var o = {},
s,
u,
l,
c,
settings
;(o.setup = function () {
;(s = document.querySelectorAll(selector)),
(u = []),
Array.prototype.forEach.call(s, function (t) {
var content = document.getElementById(
decodeURIComponent(t.hash.substr(1))
)
if (content) u.push({ nav: t, content: content })
}),
a(u)
}),
(o.detect = function () {
if (!document.body.classList.contains('u-scrollspy-prevent')) {
var t = h(u, settings)
if (t) {
if (!l || t.content !== l.content)
m(l, settings), v(t, settings), (l = t)
} else if (l) m(l, settings), (l = null)
}
})
var f = function () {
if (c) t.cancelAnimationFrame(c)
c = t.requestAnimationFrame(o.detect)
},
p = function () {
if (c) t.cancelAnimationFrame(c)
c = t.requestAnimationFrame(function () {
a(u), o.detect()
})
},
init
return (
(o.destroy = function () {
if (l) m(l, settings)
if (
(t.removeEventListener('scroll', f, false), settings.reflow)
)
t.removeEventListener('resize', p, false)
;(u = null),
(s = null),
(l = null),
(c = null),
(settings = null)
}),
(function () {
if (
((settings = n(e, i || {})),
o.setup(),
o.detect(),
t.addEventListener('scroll', f, false),
settings.reflow)
)
t.addEventListener('resize', p, false)
})(),
o
)
}
}
)
}).call(e, n(60))
},
12577: function (t, e, n) {
'use strict'
var i = n(17),
Filter = n(12578),
o = n(12580),
HorizontalLayoutSlider = n(410)
i(window).on('load', function () {
setTimeout(function () {
i('.u-gallery').removeClass('u-no-transition'),
i('.u-layout-horizontal').each(function () {
var gallery = i(this),
slider = new HorizontalLayoutSlider(gallery, true)
gallery.children('.u-gallery-nav').click(function (t) {
t.preventDefault()
var e = i(t.currentTarget)
slider.navigate(e)
})
})
}, 250)
}),
i(function () {
var t
i('body').on('mouseenter', '.u-gallery.u-no-transition', function () {
i(this).closest('.u-gallery').removeClass('u-no-transition')
}),
new o([
'.u-gallery.u-product-zoom.u-layout-thumbnails',
'.u-gallery.u-product-zoom.u-layout-carousel',
]).init(),
Filter.init()
})
},
12578: function (t, e, n) {
'use strict'
var i = n(17),
GalleryLayout = n(12579),
Filter
t.exports.init = function () {
var filter = i('.u-gallery-filter')
filter.on('click', '.u-filter-item', function (t) {
t.preventDefault()
var gallery = filter.closest('.u-gallery'),
e = gallery.find('.u-gallery-item'),
n = i(t.currentTarget),
o = GalleryLayout.init(gallery)
filter.find('.active').removeClass('active'), n.addClass('active')
var a = n.text().trim(),
s = n.index()
e.each(function () {
var galleryItem = i(this),
t
if (galleryItem.attr('data-category') === a || 0 === s)
galleryItem.removeClass('hide'), galleryItem.addClass('show')
else galleryItem.removeClass('show'), galleryItem.addClass('hide')
}),
o.updateHeight()
})
}
},
12579: function (t, e, n) {
'use strict'
function GalleryLayout(gallery) {
;(this.columnsRegEx = /repeat\((\d+),\s*auto\)/i),
(this.columnsSplitRegEx = /\s+/),
(this.gallery = gallery),
(this.inner = gallery.find('.u-gallery-inner')),
(this.controls = gallery.find('.u-gallery-controls'))
}
;(t.exports = GalleryLayout),
(GalleryLayout.init = function (gallery) {
var model = new GalleryLayout(gallery)
return model.init(), model.updateHeight(), model
}),
(GalleryLayout.prototype.init = function () {
var t = this.inner.css('grid-template-columns') || '',
e = t.match(this.columnsRegEx)
if (e) this.columns = parseFloat(e[1])
else this.columns = t.split(this.columnsSplitRegEx).length
if (!this.columns) this.columns = 1
;(this.allItems = this.inner.find('.u-gallery-item')),
(this.allRows = Math.ceil(this.allItems.length / this.columns)),
this._updateState()
var n = this.inner.height(),
i = parseFloat(this.inner.css('gap')) || 0,
o = this.visibleRows > 0 ? i * (this.visibleRows - 1) : 0
this.rowHeight = (n - o) / this.visibleRows
}),
(GalleryLayout.prototype._updateState = function () {
;(this.visibleItems = this.allItems.filter(':not(.hide)')),
(this.visibleRows = Math.ceil(
this.visibleItems.length / this.columns
))
}),
(GalleryLayout.prototype.updateHeight = function () {
if ((this._updateState(), this.visibleRows)) {
var t = parseFloat(this.gallery.css('gap')) || 0,
e = parseFloat(this.inner.css('gap')) || 0,
n = this.controls.height() + t,
i = this.visibleRows > 0 ? e * (this.visibleRows - 1) : 0,
o = n + this.rowHeight * this.visibleRows + i
this.gallery.css('height', o + 'px')
}
})
},
12580: function (t, e, n) {
'use strict'
function i(t) {
this.galleryZoomSelector = t
}
function o(t) {
var e = t.currentTarget,
n,
i = u(e).closest('.u-gallery-item').data('zoom_click'),
o = e.getBoundingClientRect(),
a = e.querySelector('img'),
s = t.clientX,
l = t.clientY,
c = t.originalEvent.changedTouches
if (!i && !c) {
u(e).addClass('hover')
var f = s - o.x,
h = l - o.y
requestAnimationFrame(function () {
var t = f * (1 - a.offsetWidth / e.offsetWidth),
n = h * (1 - a.offsetHeight / e.offsetHeight)
;(a.style.left = t + 'px'), (a.style.top = n + 'px')
})
}
}
function a(t) {
var e = u(t.currentTarget),
n
u(e).removeClass('hover'),
u(e).closest('.u-gallery-item').data('zoom_click')
}
function s(t) {
var e = u(t.currentTarget)
u(e).removeClass('hover')
}
var u = n(17)
;(t.exports = i),
(i.prototype.init = function () {
var t = this.galleryZoomSelector
.map(function (selector) {
return selector + ' .u-back-slide'
})
.join(', '),
e = this.galleryZoomSelector
.map(function (selector) {
return selector + ' .u-back-image'
})
.join(', ')
u('body').on('mousedown touchstart', t, a),
u('body').on('mousemove touchmove', t, o),
u('body').on('click mouseup mouseout touchend touchcancel', t, s),
u(e).each(function (t, e) {
var url = e.getAttribute('src')
u(e)
.parent()
.css('background-image', 'url(' + url + ')')
})
}),
(window.ImageZoom = i)
},
12581: function (t, e, n) {
'use strict'
var i = n(17),
TabsControl = n(276)
;(window._npTabsInit = function () {
function t(t) {
t.preventDefault(), t.stopPropagation()
var link = i(t.currentTarget),
tabsControl
new TabsControl(link).show()
}
i('body').on('click', '.u-tab-link', t)
}),
i(function () {
window._npTabsInit()
})
},
12582: function (t, e, n) {
'use strict'
var i = n(12583)
;(window._npLazyImages = {
setup: function () {
;(window.lazySizesConfig = window.lazySizesConfig || {}),
(window.lazySizesConfig.init = false),
document.addEventListener('lazybeforeunveil', function (t) {
var el = t.target
if (el.matches('video')) {
var e = el.getAttribute('data-src'),
n = el.querySelector('source')
if (n && e) n.setAttribute('src', e)
} else {
var i = el.getAttribute('data-bg')
if (i) {
var list = cssBgParser.parseElementStyle(getComputedStyle(el))
if (list.backgrounds.length) list.backgrounds[0].color = ''
list.backgrounds.push(new cssBgParser.Background({ image: i })),
(el.style.backgroundImage = list.toString('image'))
}
}
})
},
init: function () {
i.init()
},
}),
window._npLazyImages.setup(),
$(function () {
window._npLazyImages.init()
})
},
12583: function (t, e, n) {
'use strict'
!(function (e, factory) {
var n = factory(e, e.document, Date)
if (((e.lazySizes = n), 'object' == typeof t && t.exports)) t.exports = n
})('undefined' != typeof window ? window : {}, function t(e, n, Date) {
var i, o
if (
(!(function () {
var t,
n = {
lazyClass: 'lazyload',
loadedClass: 'lazyloaded',
loadingClass: 'lazyloading',
preloadClass: 'lazypreload',
errorClass: 'lazyerror',
autosizesClass: 'lazyautosizes',
srcAttr: 'data-src',
srcsetAttr: 'data-srcset',
sizesAttr: 'data-sizes',
minSize: 40,
customMedia: {},
init: true,
expFactor: 1.5,
hFac: 0.8,
loadMode: 2,
loadHidden: true,
ricTimeout: 0,
throttleDelay: 125,
}
for (t in ((o = e.lazySizesConfig || e.lazysizesConfig || {}), n))
if (!(t in o)) o[t] = n[t]
})(),
!n || !n.getElementsByClassName)
)
return { init: function () {}, cfg: o, noSupport: true }
var a = n.documentElement,
s = e.HTMLPictureElement,
u = 'addEventListener',
l = 'getAttribute',
c = e[u].bind(e),
f = e.setTimeout,
h = e.requestAnimationFrame || f,
p = e.requestIdleCallback,
m = /^picture$/i,
g = ['load', 'error', 'lazyincluded', '_lazyloaded'],
v = {},
y = Array.prototype.forEach,
w = function (t, e) {
if (!v[e]) v[e] = new RegExp('(\\s|^)' + e + '(\\s|$)')
return v[e].test(t[l]('class') || '') && v[e]
},
b = function (t, e) {
if (!w(t, e))
t.setAttribute('class', (t[l]('class') || '').trim() + ' ' + e)
},
C = function (t, e) {
var n
if ((n = w(t, e)))
t.setAttribute('class', (t[l]('class') || '').replace(n, ' '))
},
S = function (t, e, add) {
var n = add ? u : 'removeEventListener'
if (add) S(t, e)
g.forEach(function (i) {
t[n](i, e)
})
},
x = function (t, e, o, a, s) {
var u = n.createEvent('Event')
if (!o) o = {}
return (
(o.instance = i),
u.initEvent(e, !a, !s),
(u.detail = o),
t.dispatchEvent(u),
u
)
},
A = function (el, t) {
var n
if (!s && (n = e.picturefill || o.pf)) {
if (t && t.src && !el[l]('srcset')) el.setAttribute('srcset', t.src)
n({ reevaluate: true, elements: [el] })
} else if (t && t.src) el.src = t.src
},
_ = function (t, style) {
return (getComputedStyle(t, null) || {})[style]
},
T = function (t, e, n) {
for (
n = n || t.offsetWidth;
n < o.minSize && e && !t._lazysizesWidth;
)
(n = e.offsetWidth), (e = e.parentNode)
return n
},
E =
((L = []),
(P = M = []),
(B = function (t, e) {
if (I && !e) t.apply(this, arguments)
else if ((P.push(t), !k)) (k = true), (n.hidden ? f : h)(O)
}),
(B._lsFlush = O =
function () {
var t = P
for (P = M.length ? L : M, I = true, k = false; t.length; )
t.shift()()
I = false
}),
B),
I,
k,
M,
L,
P,
O,
B,
F = function (t, simple) {
return simple
? function () {
E(t)
}
: function () {
var e = this,
n = arguments
E(function () {
t.apply(e, n)
})
}
},
N = function (t) {
var e,
n = 0,
i = o.throttleDelay,
a = o.ricTimeout,
s = function () {
;(e = false), (n = Date.now()), t()
},
u =
p && a > 49
? function () {
if ((p(s, { timeout: a }), a !== o.ricTimeout))
a = o.ricTimeout
}
: F(function () {
f(s)
}, true)
return function (t) {
var o
if ((t = true === t)) a = 33
if (!e) {
if (((e = true), (o = i - (Date.now() - n)) < 0)) o = 0
if (t || o < 9) u()
else f(u, o)
}
}
},
U = function (t) {
var e,
n,
i = 99,
o = function () {
;(e = null), t()
},
a = function () {
var t = Date.now() - n
if (t < i) f(a, i - t)
else (p || o)(o)
}
return function () {
if (((n = Date.now()), !e)) e = f(a, i)
}
},
loader =
((tt = /^img$/i),
(nt = /^iframe$/i),
(rt = 'onscroll' in e && !/(gle|ing)bot/.test(navigator.userAgent)),
(ot = 0),
(at = 0),
(st = 0),
(ut = -1),
(lt = function (t) {
if ((st--, !t || st < 0 || !t.target)) st = 0
}),
(ct = function (t) {
if (null == J) J = 'hidden' == _(n.body, 'visibility')
return (
J ||
!(
'hidden' == _(t.parentNode, 'visibility') &&
'hidden' == _(t, 'visibility')
)
)
}),
(ft = function (t, e) {
var i,
o = t,
visible = ct(t)
for (
j -= e, X += e, K -= e, Z += e;
visible && (o = o.offsetParent) && o != n.body && o != a;
)
if (
(visible = (_(o, 'opacity') || 1) > 0) &&
'visible' != _(o, 'overflow')
)
(i = o.getBoundingClientRect()),
(visible =
Z > i.left &&
K < i.right &&
X > i.top - 1 &&
j < i.bottom + 1)
return visible
}),
(ht = N(
(dt = function () {
var t,
e,
rect,
s,
u,
c,
f,
h,
p,
m,
g,
v,
y = i.elements
if ((Y = o.loadMode) && st < 8 && (t = y.length)) {
for (e = 0, ut++; e < t; e++)
if (y[e] && !y[e]._lazyRace)
if (
!(!rt || (i.prematureUnveil && i.prematureUnveil(y[e])))
) {
if (!(h = y[e][l]('data-expand')) || !(c = 1 * h)) c = at
if (!m)
if (
((m =
!o.expand || o.expand < 1
? a.clientHeight > 500 && a.clientWidth > 500
? 500
: 370
: o.expand),
(i._defEx = m),
(g = m * o.expFactor),
(v = o.hFac),
(J = null),
at < g && st < 1 && ut > 2 && Y > 2 && !n.hidden)
)
(at = g), (ut = 0)
else if (Y > 1 && ut > 1 && st < 6) at = m
else at = ot
if (p !== c)
(V = innerWidth + c * v),
(G = innerHeight + c),
(f = -1 * c),
(p = c)
if (
((rect = y[e].getBoundingClientRect()),
(X = rect.bottom) >= f &&
(j = rect.top) <= G &&
(Z = rect.right) >= f * v &&
(K = rect.left) <= V &&
(X || Z || K || j) &&
(o.loadHidden || ct(y[e])) &&
((H && st < 3 && !h && (Y < 3 || ut < 4)) ||
ft(y[e], c)))
) {
if ((bt(y[e]), (u = true), st > 9)) break
} else if (
!u &&
H &&
!s &&
st < 4 &&
ut < 4 &&
Y > 2 &&
(z[0] || o.preloadAfterLoad) &&
(z[0] ||
(!h &&
(X ||
Z ||
K ||
j ||
'auto' != y[e][l](o.sizesAttr))))
)
s = z[0] || y[e]
} else bt(y[e])
if (s && !u) bt(s)
}
})
)),
(mt = F(
(pt = function (t) {
var e = t.target
if (e._lazyCache) return delete e._lazyCache, void 0
lt(t),
b(e, o.loadedClass),
C(e, o.loadingClass),
S(e, gt),
x(e, 'lazyloaded')
})
)),
(gt = function (t) {
mt({ target: t.target })
}),
(vt = function (t, e) {
try {
t.contentWindow.location.replace(e)
} catch (n) {
t.src = e
}
}),
(yt = function (t) {
var e,
n = t[l](o.srcsetAttr)
if ((e = o.customMedia[t[l]('data-media') || t[l]('media')]))
t.setAttribute('media', e)
if (n) t.setAttribute('srcset', n)
}),
(wt = F(function (t, e, n, i, a) {
var s, u, c, h, p, g
if (!(p = x(t, 'lazybeforeunveil', e)).defaultPrevented) {
if (i)
if (n) b(t, o.autosizesClass)
else t.setAttribute('sizes', i)
if (((u = t[l](o.srcsetAttr)), (s = t[l](o.srcAttr)), a))
h = (c = t.parentNode) && m.test(c.nodeName || '')
if (
((g = e.firesLoad || ('src' in t && (u || s || h))),
(p = { target: t }),
b(t, o.loadingClass),
g)
)
clearTimeout($), ($ = f(lt, 2500)), S(t, gt, true)
if (h) y.call(c.getElementsByTagName('source'), yt)
if (u) t.setAttribute('srcset', u)
else if (s && !h)
if (nt.test(t.nodeName)) vt(t, s)
else t.src = s
if (a && (u || h)) A(t, { src: s })
}
if (t._lazyRace) delete t._lazyRace
C(t, o.lazyClass),
E(function () {
var e = t.complete && t.naturalWidth > 1
if (!g || e) {
if (e) b(t, 'ls-is-cached')
pt(p),
(t._lazyCache = true),
f(function () {
if ('_lazyCache' in t) delete t._lazyCache
}, 9)
}
if ('lazy' == t.loading) st--
}, true)
})),
(bt = function (t) {
if (!t._lazyRace) {
var e,
n = tt.test(t.nodeName),
i = n && (t[l](o.sizesAttr) || t[l]('sizes')),
a = 'auto' == i
if (
(!a && H) ||
!n ||
(!t[l]('src') && !t.srcset) ||
t.complete ||
w(t, o.errorClass) ||
!w(t, o.lazyClass)
) {
if (((e = x(t, 'lazyunveilread').detail), a))
At.updateElem(t, true, t.offsetWidth)
;(t._lazyRace = true), st++, wt(t, e, a, i, n)
}
}
}),
(Ct = U(function () {
;(o.loadMode = 3), ht()
})),
(xt = function () {
if (!H) {
if (Date.now() - W < 999) return f(xt, 999), void 0
;(H = true), (o.loadMode = 3), ht(), c('scroll', St, true)
}
}),
{
_: function () {
if (
((W = Date.now()),
(i.elements = n.getElementsByClassName(o.lazyClass)),
(z = n.getElementsByClassName(
o.lazyClass + ' ' + o.preloadClass
)),
c('scroll', ht, true),
c('resize', ht, true),
c('pageshow', function (t) {
if (t.persisted) {
var e = n.querySelectorAll('.' + o.loadingClass)
if (e.length && e.forEach)
h(function () {
e.forEach(function (t) {
if (t.complete) bt(t)
})
})
}
}),
e.MutationObserver)
)
new MutationObserver(ht).observe(a, {
childList: true,
subtree: true,
attributes: true,
})
else
a[u]('DOMNodeInserted', ht, true),
a[u]('DOMAttrModified', ht, true),
setInterval(ht, 999)
if (
(c('hashchange', ht, true),
[
'focus',
'mouseover',
'click',
'load',
'transitionend',
'animationend',
].forEach(function (t) {
n[u](t, ht, true)
}),
/d$|^c/.test(n.readyState))
)
xt()
else c('load', xt), n[u]('DOMContentLoaded', ht), f(xt, 2e4)
if (i.elements.length) dt(), E._lsFlush()
else ht()
},
checkElems: ht,
unveil: bt,
_aLSL: (St = function () {
if (3 == o.loadMode) o.loadMode = 2
Ct()
}),
}),
z,
H,
$,
Y,
W,
V,
G,
j,
K,
Z,
X,
J,
tt,
nt,
rt,
ot,
at,
st,
ut,
lt,
ct,
ft,
dt,
ht,
pt,
mt,
gt,
vt,
yt,
wt,
bt,
Ct,
St,
xt,
At =
((Tt = F(function (t, e, n, i) {
var o, a, s
if (
((t._lazysizesWidth = i),
(i += 'px'),
t.setAttribute('sizes', i),
m.test(e.nodeName || ''))
)
for (
a = 0, s = (o = e.getElementsByTagName('source')).length;
a < s;
a++
)
o[a].setAttribute('sizes', i)
if (!n.detail.dataAttr) A(t, n.detail)
})),
(Dt = function (t, e, n) {
var i,
o = t.parentNode
if (o)
if (
((n = T(t, o, n)),
!(i = x(t, 'lazybeforesizes', { width: n, dataAttr: !!e }))
.defaultPrevented)
)
if ((n = i.detail.width) && n !== t._lazysizesWidth)
Tt(t, o, i, n)
}),
{
_: function () {
;(_t = n.getElementsByClassName(o.autosizesClass)),
c('resize', Mt)
},
checkElems: (Mt = U(function () {
var t,
e = _t.length
if (e) for (t = 0; t < e; t++) Dt(_t[t])
})),
updateElem: Dt,
}),
_t,
Tt,
Dt,
kt,
Mt,
init = function () {
if (!init.i && n.getElementsByClassName)
(init.i = true), At._(), loader._()
}
return (
f(function () {
if (o.init) init()
}),
(i = {
cfg: o,
autoSizer: At,
loader: loader,
init: init,
uP: A,
aC: b,
rC: C,
hC: w,
fire: x,
gW: T,
rAF: E,
})
)
})
},
12584: function (t, e, n) {
'use strict'
var i = n(17),
Dialog = n(286)
;(window._npDialogsInit = function () {
function t(t) {
var dialog = o(t)
if (dialog)
if ((t.preventDefault(), t.stopPropagation(), !e(t))) dialog.open()
}
function e(t) {
return i(t.currentTarget).hasClass('disabled')
}
function n(t) {
var dialog
t.preventDefault(), t.stopPropagation(), o(t).close()
}
function o(t) {
var link = i(t.currentTarget),
e = link.attr('href') || link.attr('data-href'),
n
try {
n = i(e)
} catch (t) {
return null
}
return (n = n.length ? n : link), new Dialog(n, link)
}
function a() {
return new Dialog(i('[data-dialog-show-on="page_exit"]'))
}
function s() {
return new Dialog(i('[data-dialog-show-on="timer"]'))
}
function u(t) {
if (
t.clientY < 50 &&
null == t.relatedTarget &&
'select' !== t.target.nodeName.toLowerCase()
) {
var dialog
a().open(function () {
document.removeEventListener('mouseout', u)
})
}
}
function l() {
var dialog = s()
setTimeout(function () {
dialog.open()
}, dialog.getInterval())
}
function c(t) {
var e = i(t.currentTarget)
setTimeout(function () {
new Dialog(e).close()
})
}
i('body').on('click', '.u-dialog-link', t),
i('body').on('click', '.u-shopping-cart[href^="#"]', t),
i('body').on('click', '.u-dialog-close-button', n),
i('body').on(
'click',
'.u-dialog .u-btn:not(.u-btn-step):not(.u-stripe-button)',
c
),
document.addEventListener('mouseout', u),
l()
}),
i(function () {
window._npDialogsInit()
})
},
12585: function (t, e, n) {
'use strict'
var i = n(17),
CountdownUpdater = n(275)
i(window).on('load', function () {
function update() {
t.each(function (t, el) {
var countdownUpdater
new CountdownUpdater(i(el)).startUpdate('runtime')
})
}
var t = CountdownUpdater.findAll()
if (t.length) update()
})
},
12586: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
i(document).on('click', '.u-quantity-input a', function (t) {
var e
t.preventDefault()
var n = i(this),
o = n.siblings('input')
if (n.hasClass('minus'))
(e = (e = parseFloat(o.val()) - 1) < 1 ? 1 : e), o.val(e)
if (n.hasClass('plus')) (e = parseFloat(o.val()) + 1), o.val(e)
n
.siblings('.minus')
.addBack('.minus')
.toggleClass('disabled', 1 === e),
o.change()
})
})
},
12587: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
i('.u-show-second-image').each(function () {
var t
i(this)
.find('.u-repeater-item')
.each(function () {
var repeaterItem = i(this),
image = repeaterItem
.find('.u-image:not(.u-product-second-image, a)')
.eq(0)
if (repeaterItem.hasClass('u-image')) image = repeaterItem
var t = repeaterItem.find('.u-product-second-image')
if (t.length) {
var e = t.attr('src'),
n = t.attr('srcset'),
o = image.clone(),
a = image.clone()
if ('IMG' === image.get(0).tagName)
if ((a.attr('src', e), n)) a.attr('srcset', n)
else o.removeAttr('srcset'), a.removeAttr('srcset')
else a.get(0).style.backgroundImage = "url('" + e + "')"
var s = i('<div class="u-product-second-image-wrapper"/>')
s.append(o), s.append(a), image.replaceWith(s)
}
})
})
})
},
12588: function (t, e, n) {
'use strict'
var i = n(17),
Accordion = n(224)
;(window._npAccordionInit = function () {
function t(t) {
t.preventDefault(), t.stopPropagation()
var link = i(t.currentTarget),
accordion
new Accordion(link).show()
}
i('body').on('click', '.u-accordion-link', t)
}),
i(function () {
window._npAccordionInit()
})
},
12589: function (t, e, n) {
'use strict'
function i(t) {
var form = l(this),
password = form.find('input[name=password]').val() || '',
e = form.find('input[name=password_hash]')
if (e.length) {
var hash = u.create().update(password).digest().toHex()
return e.val(hash), void 0
}
t.preventDefault(),
t.stopPropagation(),
a(password, function () {
s(form)
})
}
function o() {
a(localStorage.getItem(c)), l('#password-redirect-style').remove()
}
function a(password, t) {
if (password) {
var e = l('body'),
n = e.attr('data-salt'),
i = e.attr('data-salted-password'),
hash = u.create().update(password).digest().toHex(),
o = u
.create()
.update(password + n)
.digest()
.toHex(),
homePage,
url = (e.attr('data-home-page') || window.location.pathname).replace(
/\.html(\?[\s\S]*)?$/,
'_' + hash + '.html$1'
)
if (o === i)
localStorage.setItem(c, password), window.location.replace(url)
else if ('function' == typeof t) t()
}
}
function s(form) {
var t = form.find('.u-form-send-error')
t.show(),
setTimeout(function () {
t.hide()
}, 2e3)
}
var u = n(264),
l = n(17),
c = 'auth_key'
;(window.sha256 = u),
(window._npAuthInit = function () {
var form
l('.u-password-control form').submit(i)
}),
l(function () {
window._npAuthInit(), o()
})
},
12590: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
i('body').on('click', '.u-language-active', function (t) {
t.preventDefault()
})
})
},
12591: function (t, e, n) {
'use strict'
var FormRating = (t.exports = {}),
i = n(17),
o = '.u-form-rating-item:visible'
i(function () {
FormRating.init()
}),
(FormRating.selectStars = function t(e, n) {
var o = e.find('.u-active-icon'),
a = e.find('.u-passive-icon'),
s = o.length
o.hide(),
a.hide(),
i(o.toArray().slice(0, n)).show(),
i(a.toArray().slice(0, s - n)).show()
}),
(FormRating.onStarClick = function t(e) {
var n = i(e.currentTarget),
a = n.parents('.u-form-rating').find('input'),
s,
u = n.prevAll(o).length + 1,
l = a.val() + ''
if (u.toString() === l) return a.val(''), void 0
a.val(u)
}),
(FormRating.onStarHover = function t(e) {
var n = i(e.currentTarget),
a = n.prevAll(o)
FormRating.selectStars(n.parent(), a.length + 1)
}),
(FormRating.onLeave = function t(e) {
var n = i(e.currentTarget),
o,
a = n.find('input').val() || 0
FormRating.selectStars(n, a)
}),
(FormRating.init = function init() {
var t = '.u-form .u-form-rating .u-form-rating-item',
e = i('.u-form .u-form-rating')
FormRating.onLeave({ currentTarget: e }),
e.mouseleave(FormRating.onLeave),
i(t).hover(FormRating.onStarHover),
i(t).click(FormRating.onStarClick)
var n = e.find('input[type=hidden][required]')
if (n && n.length) n.addClass('u-input-hidden'), n.attr('type', 'text')
})
},
12592: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
i('body').on('click', '.u-form .u-gallery-item', function (t) {
if (!i(t.target).is('input, label')) {
var input = i(this).find('input')
input.prop('checked', !input.prop('checked'))
}
})
})
},
12593: function (t, e, n) {
'use strict'
function i(input) {
var t = parseFloat(input.prop('max')),
e = parseFloat(input.prop('min')),
n = parseFloat(input.prop('value')),
i = 0
if (n) i = (100 * (n - e)) / (t - e)
var formField = input.closest('.u-form-number')
if (formField.length)
formField[0].style.setProperty('--progress', i + '%')
}
function o(t, e) {
if (e.length && t.length)
e.prop('value', t.prop('value')), e.trigger('change')
}
function a(t) {
if (t.length) {
var e = t.prop('value')
t.closest('.u-input-row').attr('data-value', e)
}
}
var s = n(17)
s(function () {
var t = s('body')
t.on('input', '.u-form .u-form-number input[type="range"]', function () {
var input = s(this),
t = input.siblings('input')
if (t.length) o(input, t)
i(input), a(input)
}),
t.on(
'input',
'.u-form .u-form-number input[type="number"]',
function () {
var input = s(this),
t = input.siblings('input')
if (t.length) o(input, t), i(t)
a(input)
}
)
})
},
12594: function (t, e, n) {
'use strict'
function i(t, dependency) {
var e = [
'[name="' + dependency.field + '"]',
'[name="' + dependency.field + '[]"]',
].join(', '),
n = t.find(e)
if (!n.length) return false
if (!(dependency.condition in s)) return false
else return s[dependency.condition](n, dependency.value)
}
function o(t, e) {
if (e in u) u[e](t)
}
var FormDependency = t.exports,
a = n(17),
s = n(12595)
a(function () {
a('.u-form').each(function () {
FormDependency.process(a(this))
})
var t = function () {
FormDependency.process(a(this).closest('.u-form'))
}
a('body')
.on('input', '.u-form input[name], .u-form input[name]', t)
.on('change', '.u-form input[name], .u-form select[name]', t)
}),
(FormDependency.process = function t(e) {
e.find('[data-dependency]').each(function () {
var t = a(this),
dependency
try {
dependency = JSON.parse(t.attr('data-dependency'))[0]
} catch (t) {
dependency = null
}
if (dependency)
if (i(e, dependency)) o(t, dependency.action)
else {
var n
o(t, { hide: 'show', show: 'hide' }[dependency.action])
}
})
})
var u = {
show: function (t) {
t.closest('.u-form-group').show()
},
hide: function (t) {
t.closest('.u-form-group').hide()
},
}
},
12595: function (t, e, n) {
'use strict'
function i(t) {
return t
.toArray()
.filter(function (el) {
return el.checked
})
.map(function (el) {
var t = el.value
if (!t) t = el.getAttribute('data-calc') || ''
return String(t).trim()
})
}
function o(t, e) {
return String(t).trim() === String(e).trim()
}
var a = t.exports
;(a.equal = function (t, e) {
if (t.is('input[type="checkbox"], input[type="radio"]'))
return a.has.apply(null, arguments)
else return o(t.val(), e)
}),
(a['not-equal'] = function () {
return !a.equal.apply(null, arguments)
}),
(a.contain = function (t, e) {
if (t.is('input[type="checkbox"], input[type="radio"]')) {
var n
return i(t).some(function (t) {
return String(t).includes(e)
})
}
return String(t.val()).includes(e)
}),
(a['not-contain'] = function () {
return !a.contain.apply(null, arguments)
}),
(a.has = function (t, e) {
return i(t).includes(String(e).trim())
}),
(a['not-has'] = function () {
return !a.has.apply(null, arguments)
}),
(a['number-equal'] = function (t, e) {
var n = parseFloat(t.val())
if (n === (e = parseFloat(e))) return true
var diff = Math.abs(n - e),
i
if (diff < Number.EPSILON) return true
else return diff <= Math.min(Math.abs(n), Math.abs(e)) * Number.EPSILON
}),
(a['number-not-equal'] = function () {
return a['number-equal'].apply(null, arguments)
}),
(a['number-greater'] = function (t, e) {
var n
return parseFloat(t.val()) > (e = parseFloat(e))
}),
(a['number-greater-or-equal'] = function () {
return (
a['number-greater'].apply(null, arguments) ||
a['number-equal'].apply(null, arguments)
)
}),
(a['number-less'] = function (t, e) {
var n
return parseFloat(t.val()) < (e = parseFloat(e))
}),
(a['number-less-or-equal'] = function () {
return (
a['number-less'].apply(null, arguments) ||
a['number-equal'].apply(null, arguments)
)
}),
(window.FormDependencyCondition = a)
},
12596: function (t, e, n) {
'use strict'
function i(form) {
var activeSlide, t
return form
.find('.u-slide.active, .u-slide.u-active')
.find('input, textarea, select')
.toArray()
.every(function (input) {
return input.reportValidity()
})
}
var o = n(17),
FormProgress = n(664),
a = n(665),
s = 'u-carousel'
o(function () {
var t = o('body'),
e = o('.u-form.u-carousel')
e.find('.u-carousel-inner').css('overflow', 'unset'),
a.update(e),
FormProgress.update(e),
t.on('click', '.u-btn-step', function (t) {
t.preventDefault()
var button = o(this),
e = button.closest('.u-carousel')
if (e.length)
if (button.hasClass('u-btn-step-next')) e[s]('next')
else if (button.hasClass('u-btn-step-prev')) e[s]('prev')
}),
e
.on('u-slide.bs.u-carousel', function (t) {
var form = o(this)
if (0 !== t.to && t.to > t.from && !i(form))
return t.preventDefault(), void 0
a.update(o(this), t.to),
FormProgress.update(o(this), t.to),
form.find('.u-carousel-inner').css('overflow', '')
})
.on('slid.bs.u-carousel', function () {
var form
o(this).find('.u-carousel-inner').css('overflow', 'unset')
})
.on('reset', function () {
o(this)[s](0)
})
})
},
12597: function (t, e, n) {
'use strict'
function i() {
return (
-1 !== (c('html').attr('class') || '').search(/u-responsive-(xs|sm)/)
)
}
function o(t) {
var e = 0
if (
Intl &&
Intl.Locale &&
navigator.language &&
new Intl.Locale(navigator.language).weekInfo
)
e = new Intl.Locale(navigator.language).weekInfo.firstDay || 0
t.startDay = e
}
function a(t) {
var e = []
;[1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12].forEach(function (t) {
var n = new Date()
n.setDate(1), n.setMonth(t - 1)
var i = n.toLocaleString('default', { month: 'long' })
e.push(i.charAt(0).toUpperCase() + i.slice(1))
}),
(t.customMonths = e)
}
function s(t) {
var e = new Date(),
n = e.getDay(),
diff = e.getDate() - n + (0 === n ? -6 : 1),
i = new Date(e.setDate(diff)),
o = []
;[1, 2, 3, 4, 5, 6, 7].forEach(function (t) {
var e
if (1 === t) e = i
else (e = new Date(i)).setDate(e.getDate() + t - 1)
var n = e.toLocaleString('default', { weekday: 'short' })
if (((n = n.charAt(0).toUpperCase() + n.slice(1)), 7 === t))
o.unshift(n)
else o.push(n)
}),
(t.customDays = o)
}
var u = n(12598),
l = n(12599),
c = n(17),
f = {
init: function (el) {
if (i()) return f.switchToDate(el), null
else return f.create(el)
},
create: function (el) {
f.switchToText(el)
var t = {
formatter: function (input, date) {
var format = input.getAttribute('data-date-format')
if ('local' === format && Intl && Intl.DateTimeFormat)
date = Intl.DateTimeFormat().format(date)
else date = l(date, format || 'default')
input.setAttribute('value', date)
},
}
return o(t), a(t), s(t), u(el, t)
},
remove: function (el, t) {
if (t) t.remove()
f.switchToDate(el)
},
switchToDate: function (el) {
el.removeAttribute('value'),
el.classList.remove('readonly'),
(el.type = 'date')
},
switchToText: function (el) {
el.classList.add('readonly'), (el.type = 'text')
},
}
c(function () {
var selector
c('form input.u-input[data-date-format]').each(function () {
var t = f.init(this)
c(this).focus(function (e) {
var n = e.target
if (!i()) {
if (!t) t = f.create(n)
} else if (t) f.remove(n, t), (t = null)
})
}),
c('.u-input.readonly').on('keydown paste focus', function (t) {
if (9 !== t.keyCode) t.preventDefault()
})
})
},
12598: function (t, e, n) {
'use strict'
var i, o
;(i = window),
(o = function () {
return (function (t) {
function e(i) {
if (n[i]) return n[i].exports
var r = (n[i] = { i: i, l: !1, exports: {} })
return t[i].call(r.exports, r, r.exports, e), (r.l = !0), r.exports
}
var n = {}
return (
(e.m = t),
(e.c = n),
(e.d = function (t, n, i) {
e.o(t, n) ||
Object.defineProperty(t, n, { enumerable: !0, get: i })
}),
(e.r = function (t) {
'undefined' != typeof Symbol &&
Symbol.toStringTag &&
Object.defineProperty(t, Symbol.toStringTag, {
value: 'Module',
}),
Object.defineProperty(t, '__esModule', { value: !0 })
}),
(e.t = function (t, n) {
if ((1 & n && (t = e(t)), 8 & n)) return t
if (4 & n && 'object' == typeof t && t && t.__esModule) return t
var i = Object.create(null)
if (
(e.r(i),
Object.defineProperty(i, 'default', {
enumerable: !0,
value: t,
}),
2 & n && 'string' != typeof t)
)
for (var r in t)
e.d(
i,
r,
function (e) {
return t[e]
}.bind(null, r)
)
return i
}),
(e.n = function (t) {
var n =
t && t.__esModule
? function () {
return t.default
}
: function () {
return t
}
return e.d(n, 'a', n), n
}),
(e.o = function (t, e) {
return Object.prototype.hasOwnProperty.call(t, e)
}),
(e.p = ''),
e((e.s = 0))
)
})([
function (t, e, n) {
function i() {}
function d(t) {
U.forEach(function (e) {
t.addEventListener(e, t === document ? S : x)
})
}
function o(t) {
return Array.isArray(t)
? t.map(o)
: '[object Object]' === b(t)
? Object.keys(t).reduce(function (e, n) {
return (e[n] = o(t[n])), e
}, {})
: t
}
function a(t, e) {
var n = t.calendar.querySelector('.qs-overlay'),
i = n && !n.classList.contains('qs-hidden')
;(e = e || new Date(t.currentYear, t.currentMonth)),
(t.calendar.innerHTML = [s(e, t, i), u(e, t, i), l(t, i)].join(
''
)),
i &&
window.requestAnimationFrame(function () {
y(!0, t)
})
}
function s(t, e, n) {
return [
'<div class="qs-controls' + (n ? ' qs-blur' : '') + '">',
'<div class="qs-arrow qs-left"></div>',
'<div class="qs-month-year">',
'<span class="qs-month">' + e.months[t.getMonth()] + '</span>',
'<span class="qs-year">' + t.getFullYear() + '</span>',
'</div>',
'<div class="qs-arrow qs-right"></div>',
'</div>',
].join('')
}
function u(t, e, n) {
var i = e.currentMonth,
r = e.currentYear,
o = e.dateSelected,
a = e.maxDate,
s = e.minDate,
u = e.showAllDates,
d = e.days,
l = e.disabledDates,
c = e.startDay,
f = e.weekendIndices,
h = e.events,
p = e.getRange ? e.getRange() : {},
m = +p.start,
v = +p.end,
y = g(new Date(t).setDate(1)),
w = y.getDay() - c,
D = w < 0 ? 7 : 0
y.setMonth(y.getMonth() + 1), y.setDate(0)
var b = y.getDate(),
q = [],
C = D + 7 * (((w + b) / 7) | 0)
C += (w + b) % 7 ? 7 : 0
for (var S = 1; S <= C; S++) {
var x = (S - 1) % 7,
A = d[x],
_ = S - (w >= 0 ? w : 7 + w),
T = new Date(r, i, _),
E = h[+T],
I = _ < 1 || _ > b,
k = I ? (_ < 1 ? -1 : 1) : 0,
M = I && !u,
L = M ? '' : T.getDate(),
P = +T == +o,
O = x === f[0] || x === f[1],
B = m !== v,
F = 'qs-square ' + A
E && !M && (F += ' qs-event'),
I && (F += ' qs-outside-current-month'),
(!u && I) || (F += ' qs-num'),
P && (F += ' qs-active'),
(l[+T] ||
e.disabler(T) ||
(O && e.noWeekends) ||
(s && +T < +s) ||
(a && +T > +a)) &&
!M &&
(F += ' qs-disabled'),
+g(new Date()) == +T && (F += ' qs-current'),
+T === m && v && B && (F += ' qs-range-start'),
+T > m && +T < v && (F += ' qs-range-middle'),
+T === v && m && B && (F += ' qs-range-end'),
M && ((F += ' qs-empty'), (L = '')),
q.push(
'<div class="' +
F +
'" data-direction="' +
k +
'">' +
L +
'</div>'
)
}
var R = d
.map(function (t) {
return '<div class="qs-square qs-day">' + t + '</div>'
})
.concat(q)
return (
R.unshift(
'<div class="qs-squares' + (n ? ' qs-blur' : '') + '">'
),
R.push('</div>'),
R.join('')
)
}
function l(t, e) {
var n = t.overlayPlaceholder,
i = t.overlayButton
return [
'<div class="qs-overlay' + (e ? '' : ' qs-hidden') + '">',
'<div>',
'<input class="qs-overlay-year" placeholder="' +
n +
'" inputmode="numeric" />',
'<div class="qs-close">✕</div>',
'</div>',
'<div class="qs-overlay-month-container">' +
t.overlayMonths
.map(function (t, e) {
return (
'<div class="qs-overlay-month" data-month-num="' +
e +
'">' +
t +
'</div>'
)
})
.join('') +
'</div>',
'<div class="qs-submit qs-disabled">' + i + '</div>',
'</div>',
].join('')
}
function c(t, e, n) {
var i = e.el,
r = e.calendar.querySelector('.qs-active'),
o = t.textContent,
s = e.sibling
;((i.disabled || i.readOnly) && e.respectDisabledReadOnly) ||
((e.dateSelected = n
? void 0
: new Date(e.currentYear, e.currentMonth, o)),
r && r.classList.remove('qs-active'),
n || t.classList.add('qs-active'),
h(i, e, n),
n || q(e),
s &&
(f({ instance: e, deselect: n }),
e.first &&
!s.dateSelected &&
((s.currentYear = e.currentYear),
(s.currentMonth = e.currentMonth),
(s.currentMonthName = e.currentMonthName)),
a(e),
a(s)),
e.onSelect(e, n ? void 0 : new Date(e.dateSelected)))
}
function f(t) {
var e = t.instance.first ? t.instance : t.instance.sibling,
n = e.sibling
e === t.instance
? t.deselect
? ((e.minDate = e.originalMinDate),
(n.minDate = n.originalMinDate))
: (n.minDate = e.dateSelected)
: t.deselect
? ((n.maxDate = n.originalMaxDate),
(e.maxDate = e.originalMaxDate))
: (e.maxDate = n.dateSelected)
}
function h(t, e, n) {
if (!e.nonInput)
return n
? (t.value = '')
: e.formatter !== i
? e.formatter(t, e.dateSelected, e)
: void (t.value = e.dateSelected.toDateString())
}
function p(t, e, n, i) {
n || i
? (n && (e.currentYear = +n), i && (e.currentMonth = +i))
: ((e.currentMonth += t.contains('qs-right') ? 1 : -1),
12 === e.currentMonth
? ((e.currentMonth = 0), e.currentYear++)
: -1 === e.currentMonth &&
((e.currentMonth = 11), e.currentYear--)),
(e.currentMonthName = e.months[e.currentMonth]),
a(e),
e.onMonthChange(e)
}
function D(t) {
if (!t.noPosition) {
var e = t.position.top,
n = t.position.right
if (t.position.centered)
return t.calendarContainer.classList.add('qs-centered')
var i = t.positionedEl.getBoundingClientRect(),
r = t.el.getBoundingClientRect(),
o = t.calendarContainer.getBoundingClientRect(),
a = r.top - i.top + (e ? -1 * o.height : r.height) + 'px',
s = r.left - i.left + (n ? r.width - o.width : 0) + 'px'
t.calendarContainer.style.setProperty('top', a),
t.calendarContainer.style.setProperty('left', s)
}
}
function m(t) {
return '[object Date]' === b(t) && 'Invalid Date' !== t.toString()
}
function g(t) {
if (m(t) || ('number' == typeof t && !isNaN(t))) {
var e = new Date(+t)
return new Date(e.getFullYear(), e.getMonth(), e.getDate())
}
}
function q(t) {
t.disabled ||
(!t.calendarContainer.classList.contains('qs-hidden') &&
!t.alwaysShow &&
('overlay' !== t.defaultView && y(!0, t),
t.calendarContainer.classList.add('qs-hidden'),
t.onHide(t)))
}
function v(t) {
t.disabled ||
(t.calendarContainer.classList.remove('qs-hidden'),
'overlay' === t.defaultView && y(!1, t),
D(t),
t.onShow(t))
}
function y(t, e) {
var n = e.calendar,
i = n.querySelector('.qs-overlay'),
r = i.querySelector('.qs-overlay-year'),
o = n.querySelector('.qs-controls'),
a = n.querySelector('.qs-squares')
t
? (i.classList.add('qs-hidden'),
o.classList.remove('qs-blur'),
a.classList.remove('qs-blur'),
(r.value = ''))
: (i.classList.remove('qs-hidden'),
o.classList.add('qs-blur'),
a.classList.add('qs-blur'),
r.focus())
}
function w(t, e, n, i) {
var r = isNaN(+new Date().setFullYear(e.value || void 0)),
o = r ? null : e.value
if (13 === t.which || 13 === t.keyCode || 'click' === t.type)
i
? p(null, n, o, i)
: r || e.classList.contains('qs-disabled') || p(null, n, o)
else if (n.calendar.contains(e))
n.calendar
.querySelector('.qs-submit')
.classList[r ? 'add' : 'remove']('qs-disabled')
}
function b(t) {
return {}.toString.call(t)
}
function C(t) {
B.forEach(function (e) {
e !== t && q(e)
})
}
function S(t) {
if (!t.__qs_shadow_dom) {
var e = t.which || t.keyCode,
n = t.type,
r = t.target,
i = r.classList,
o = B.filter(function (t) {
return t.calendar.contains(r) || t.el === r
})[0],
s = o && o.calendar.contains(r)
if (!(o && o.isMobile && o.disableMobile))
if ('click' === n) {
if (!o) return B.forEach(q)
if (o.disabled) return
var d = o.calendar,
u = o.calendarContainer,
l = o.disableYearOverlay,
f = o.nonInput,
h = d.querySelector('.qs-overlay-year'),
m = !!d.querySelector('.qs-hidden'),
g = d.querySelector('.qs-month-year').contains(r),
D = r.dataset.monthNum
if (o.noPosition && !s)
(u.classList.contains('qs-hidden') ? v : q)(o)
else if (i.contains('qs-arrow')) p(i, o)
else if (g || i.contains('qs-close')) l || y(!m, o)
else if (D) w(t, h, o, D)
else {
if (i.contains('qs-disabled')) return
if (i.contains('qs-num')) {
var b = r.textContent,
S = +r.dataset.direction,
x = new Date(o.currentYear, o.currentMonth + S, b)
if (S) {
;(o.currentYear = x.getFullYear()),
(o.currentMonth = x.getMonth()),
(o.currentMonthName = F[o.currentMonth]),
a(o)
for (
var A,
_ = o.calendar.querySelectorAll(
'[data-direction="0"]'
),
T = 0;
!A;
) {
var E = _[T]
E.textContent === b && (A = E), T++
}
r = A
}
return void (+x == +o.dateSelected
? c(r, o, !0)
: r.classList.contains('qs-disabled') || c(r, o))
}
i.contains('qs-submit')
? w(t, h, o)
: f && r === o.el && (v(o), C(o))
}
} else if ('focusin' === n && o) v(o), C(o)
else if ('keydown' === n && 9 === e && o) q(o)
else if ('keydown' === n && o && !o.disabled) {
var I = !o.calendar
.querySelector('.qs-overlay')
.classList.contains('qs-hidden')
13 === e && I && s
? w(t, r, o)
: 27 === e && I && s && y(!0, o)
} else if ('input' === n) {
if (!o || !o.calendar.contains(r)) return
var k = o.calendar.querySelector('.qs-submit'),
M = r.value
.split('')
.reduce(function (t, e) {
return t || '0' !== e
? t + (e.match(/[0-9]/) ? e : '')
: ''
}, '')
.slice(0, 4)
;(r.value = M),
k.classList[4 === M.length ? 'remove' : 'add'](
'qs-disabled'
)
}
}
}
function x(t) {
S(t), (t.__qs_shadow_dom = !0)
}
function A(t, e) {
U.forEach(function (n) {
t.removeEventListener(n, e)
})
}
function _() {
v(this)
}
function T() {
q(this)
}
function E(t, e) {
var n = g(t),
i = this.currentYear,
r = this.currentMonth,
o = this.sibling
if (null == t)
return (
(this.dateSelected = void 0),
h(this.el, this, !0),
o && (f({ instance: this, deselect: !0 }), a(o)),
a(this),
this
)
if (!m(t))
throw new Error('`setDate` needs a JavaScript Date object.')
if (
this.disabledDates[+n] ||
n < this.minDate ||
n > this.maxDate
)
throw new Error(
"You can't manually set a date that's disabled."
)
;(this.dateSelected = n),
e &&
((this.currentYear = n.getFullYear()),
(this.currentMonth = n.getMonth()),
(this.currentMonthName = this.months[n.getMonth()])),
h(this.el, this),
o && (f({ instance: this }), a(o))
var s = i === n.getFullYear() && r === n.getMonth()
return s || e ? a(this, n) : s || a(this, new Date(i, r, 1)), this
}
function I(t) {
return M(this, t, !0)
}
function k(t) {
return M(this, t)
}
function M(t, e, n) {
function i() {
return 'original' + d + 'Date'
}
function o() {
return d.toLowerCase() + 'Date'
}
function s() {
return 'set' + d
}
function u() {
throw new Error('Out-of-range date passed to ' + s())
}
var l = t.dateSelected,
r = t.first,
c = t.sibling,
f = t.minDate,
h = t.maxDate,
p = g(e),
d = n ? 'Min' : 'Max'
if (null == e)
(t[i()] = void 0),
c
? ((c[i()] = void 0),
n
? ((r && !l) || (!r && !c.dateSelected)) &&
((t.minDate = void 0), (c.minDate = void 0))
: ((r && !c.dateSelected) || (!r && !l)) &&
((t.maxDate = void 0), (c.maxDate = void 0)))
: (t[o()] = void 0)
else {
if (!m(e)) throw new Error('Invalid date passed to ' + s())
c
? (((r && n && p > (l || h)) ||
(r && !n && p < (c.dateSelected || f)) ||
(!r && n && p > (c.dateSelected || h)) ||
(!r && !n && p < (l || f))) &&
u(),
(t[i()] = p),
(c[i()] = p),
((n && ((r && !l) || (!r && !c.dateSelected))) ||
(!n && ((r && !c.dateSelected) || (!r && !l)))) &&
((t[o()] = p), (c[o()] = p)))
: (((n && p > (l || h)) || (!n && p < (l || f))) && u(),
(t[o()] = p))
}
return c && a(c), a(t), t
}
function L() {
var t = this.first ? this : this.sibling,
e = t.sibling
return { start: t.dateSelected, end: e.dateSelected }
}
function R() {
var t = this.shadowDom,
e = this.positionedEl,
n = this.calendarContainer,
r = this.sibling,
i = this
this.inlinePosition &&
(B.some(function (t) {
return t !== i && t.positionedEl === e
}) ||
e.style.setProperty('position', null)),
n.remove(),
(B = B.filter(function (t) {
return t !== i
})),
r && delete r.sibling,
B.length || A(document, S)
var o = B.some(function (e) {
return e.shadowDom === t
})
for (var a in (t && !o && A(t, x), this)) delete this[a]
B.length ||
U.forEach(function (t) {
document.removeEventListener(t, S)
})
}
function P(t, e) {
var n = new Date(t)
if (!m(n)) throw new Error('Invalid date passed to `navigate`')
;(this.currentYear = n.getFullYear()),
(this.currentMonth = n.getMonth()),
a(this),
e && this.onMonthChange(this)
}
function O() {
var t = !this.calendarContainer.classList.contains('qs-hidden'),
e = !this.calendarContainer
.querySelector('.qs-overlay')
.classList.contains('qs-hidden')
t && y(e, this)
}
n.r(e)
var B = [],
r = ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
F = [
'January',
'February',
'March',
'April',
'May',
'June',
'July',
'August',
'September',
'October',
'November',
'December',
],
N = {
t: 'top',
r: 'right',
b: 'bottom',
l: 'left',
c: 'centered',
},
U = ['click', 'focusin', 'keydown', 'input']
e.default = function (t, e) {
var n = (function (t, e) {
var n,
a,
d = (function (t) {
function e(t) {
throw new Error(
'"dateSelected" in options is ' +
(t ? 'less' : 'greater') +
' than "' +
(t || 'max') +
'Date".'
)
}
var n = o(t)
n.events &&
(n.events = n.events.reduce(function (t, e) {
if (!m(e))
throw new Error(
'"options.events" must only contain valid JavaScript Date objects.'
)
return (t[+g(e)] = !0), t
}, {})),
[
'startDate',
'dateSelected',
'minDate',
'maxDate',
].forEach(function (t) {
var e = n[t]
if (e && !m(e))
throw new Error(
'"options.' +
t +
'" needs to be a valid JavaScript Date object.'
)
n[t] = g(e)
})
var a = n.position,
s = n.maxDate,
u = n.minDate,
d = n.dateSelected,
l = n.overlayPlaceholder,
c = n.overlayButton,
f = n.startDay,
h = n.id
if (
((n.startDate = g(n.startDate || d || new Date())),
(n.disabledDates = (n.disabledDates || []).reduce(
function (t, e) {
var n = +g(e)
if (!m(e))
throw new Error(
'You supplied an invalid date to "options.disabledDates".'
)
if (n === +g(d))
throw new Error(
'"disabledDates" cannot contain the same date as "dateSelected".'
)
return (t[n] = 1), t
},
{}
)),
n.hasOwnProperty('id') && null == h)
)
throw new Error('`id` cannot be `null` or `undefined`')
if (null != h) {
var p = B.filter(function (t) {
return t.id === h
})
if (p.length > 1)
throw new Error('Only two datepickers can share an id.')
p.length
? ((n.second = !0), (n.sibling = p[0]))
: (n.first = !0)
}
var v = ['tr', 'tl', 'br', 'bl', 'c'].some(function (t) {
return a === t
})
if (a && !v)
throw new Error(
'"options.position" must be one of the following: tl, tr, bl, br, or c.'
)
if (
((n.position = (function (t) {
var e = t[0],
n = t[1],
i = {}
return (i[N[e]] = 1), n && (i[N[n]] = 1), i
})(a || 'bl')),
s < u)
)
throw new Error(
'"maxDate" in options is less than "minDate".'
)
if (
(d && (u > d && e('min'), s < d && e()),
[
'onSelect',
'onShow',
'onHide',
'onMonthChange',
'formatter',
'disabler',
].forEach(function (t) {
'function' != typeof n[t] && (n[t] = i)
}),
[
'customDays',
'customMonths',
'customOverlayMonths',
].forEach(function (t, e) {
var i = n[t],
r = e ? 12 : 7
if (i) {
if (
!Array.isArray(i) ||
i.length !== r ||
i.some(function (t) {
return 'string' != typeof t
})
)
throw new Error(
'"' +
t +
'" must be an array with ' +
r +
' strings.'
)
n[e ? (e < 2 ? 'months' : 'overlayMonths') : 'days'] =
i
}
}),
f && f > 0 && f < 7)
) {
var y = (n.customDays || r).slice(),
D = y.splice(0, f)
;(n.customDays = y.concat(D)),
(n.startDay = +f),
(n.weekendIndices = [y.length - 1, y.length])
} else (n.startDay = 0), (n.weekendIndices = [6, 0])
'string' != typeof l && delete n.overlayPlaceholder,
'string' != typeof c && delete n.overlayButton
var q = n.defaultView
if (q && 'calendar' !== q && 'overlay' !== q)
throw new Error(
'options.defaultView must either be "calendar" or "overlay".'
)
return (n.defaultView = q || 'calendar'), n
})(
e || {
startDate: g(new Date()),
position: 'bl',
defaultView: 'calendar',
}
),
s = t
if ('string' == typeof s)
s =
'#' === s[0]
? document.getElementById(s.slice(1))
: document.querySelector(s)
else {
if ('[object ShadowRoot]' === b(s))
throw new Error(
'Using a shadow DOM as your selector is not supported.'
)
for (var u, l = s.parentNode; !u; ) {
var c = b(l)
'[object HTMLDocument]' === c
? (u = !0)
: '[object ShadowRoot]' === c
? ((u = !0), (n = l), (a = l.host))
: (l = l.parentNode)
}
}
if (!s) throw new Error('No selector / element found.')
if (
B.some(function (t) {
return t.el === s
})
)
throw new Error(
'A datepicker already exists on that element.'
)
var f = s === document.body,
p = n
? s.parentElement || n
: f
? document.body
: s.parentElement,
y = n ? s.parentElement || a : p,
D = document.createElement('div'),
q = document.createElement('div')
;(D.className = 'qs-datepicker-container qs-hidden'),
(q.className = 'qs-datepicker')
var w = {
shadowDom: n,
customElement: a,
positionedEl: y,
el: s,
parent: p,
nonInput: 'INPUT' !== s.nodeName,
noPosition: f,
position: !f && d.position,
startDate: d.startDate,
dateSelected: d.dateSelected,
disabledDates: d.disabledDates,
minDate: d.minDate,
maxDate: d.maxDate,
noWeekends: !!d.noWeekends,
weekendIndices: d.weekendIndices,
calendarContainer: D,
calendar: q,
currentMonth: (d.startDate || d.dateSelected).getMonth(),
currentMonthName: (d.months || F)[
(d.startDate || d.dateSelected).getMonth()
],
currentYear: (d.startDate || d.dateSelected).getFullYear(),
events: d.events || {},
defaultView: d.defaultView,
setDate: E,
remove: R,
setMin: I,
setMax: k,
show: _,
hide: T,
navigate: P,
toggleOverlay: O,
onSelect: d.onSelect,
onShow: d.onShow,
onHide: d.onHide,
onMonthChange: d.onMonthChange,
formatter: d.formatter,
disabler: d.disabler,
months: d.months || F,
days: d.customDays || r,
startDay: d.startDay,
overlayMonths:
d.overlayMonths ||
(d.months || F).map(function (t) {
return t.slice(0, 3)
}),
overlayPlaceholder: d.overlayPlaceholder || '4-digit year',
overlayButton: d.overlayButton || 'Submit',
disableYearOverlay: !!d.disableYearOverlay,
disableMobile: !!d.disableMobile,
isMobile: 'ontouchstart' in window,
alwaysShow: !!d.alwaysShow,
id: d.id,
showAllDates: !!d.showAllDates,
respectDisabledReadOnly: !!d.respectDisabledReadOnly,
first: d.first,
second: d.second,
}
if (d.sibling) {
var C = d.sibling,
S = w,
x = C.minDate || S.minDate,
A = C.maxDate || S.maxDate
;(S.sibling = C),
(C.sibling = S),
(C.minDate = x),
(C.maxDate = A),
(S.minDate = x),
(S.maxDate = A),
(C.originalMinDate = x),
(C.originalMaxDate = A),
(S.originalMinDate = x),
(S.originalMaxDate = A),
(C.getRange = L),
(S.getRange = L)
}
d.dateSelected && h(s, w)
var M = getComputedStyle(y).position
f ||
(M && 'static' !== M) ||
((w.inlinePosition = !0),
y.style.setProperty('position', 'relative'))
var U = B.filter(function (t) {
return t.positionedEl === w.positionedEl
})
return (
U.some(function (t) {
return t.inlinePosition
}) &&
((w.inlinePosition = !0),
U.forEach(function (t) {
t.inlinePosition = !0
})),
D.appendChild(q),
p.appendChild(D),
w.alwaysShow && v(w),
w
)
})(t, e)
if (
(B.length || d(document),
n.shadowDom &&
(B.some(function (t) {
return t.shadowDom === n.shadowDom
}) ||
d(n.shadowDom)),
B.push(n),
n.second)
) {
var s = n.sibling
f({ instance: n, deselect: !n.dateSelected }),
f({ instance: s, deselect: !s.dateSelected }),
a(s)
}
return (
a(n, n.startDate || n.dateSelected), n.alwaysShow && D(n), n
)
}
},
]).default
}),
!void (true
? (t.exports = o())
: 'function' == typeof define && define.amd
? define([], o)
: 'object' == typeof e
? (e.datepicker = o())
: (i.datepicker = o()))
},
12599: function (t, e, n) {
'use strict'
function i(t) {
if ('function' == typeof Symbol && 'symbol' == typeof Symbol.iterator)
i = function t(e) {
return typeof e
}
else
i = function t(e) {
return e &&
'function' == typeof Symbol &&
e.constructor === Symbol &&
e !== Symbol.prototype
? 'symbol'
: typeof e
}
return i(t)
}
var o
'use strict',
(function (a) {
var s = arguments,
u =
((l =
/d{1,4}|D{3,4}|m{1,4}|yy(?:yy)?|([HhMsTt])\1?|W{1,2}|[LlopSZN]|"[^"]*"|'[^']*'/g),
(c =
/\b(?:[PMCEA][SDP]T|(?:Pacific|Mountain|Central|Eastern|Atlantic) (?:Standard|Daylight|Prevailing) Time|(?:GMT|UTC)(?:[-+]\d{4})?)\b/g),
(f = /[^-+\dA-Z]/g),
function (date, t, e, n) {
if (1 === s.length && 'string' === v(date) && !/\d/.test(date))
(t = date), (date = void 0)
if (
!(
(date = date || 0 === date ? date : new Date()) instanceof
Date
)
)
date = new Date(date)
if (isNaN(date)) throw TypeError('Invalid date')
var i = (t = String(u.masks[t] || t || u.masks['default'])).slice(
0,
4
)
if ('UTC:' === i || 'GMT:' === i)
if (((t = t.slice(4)), (e = true), 'GMT:' === i)) n = true
var o = function t() {
return e ? 'getUTC' : 'get'
},
a = function d() {
return date[o() + 'Date']()
},
D = function D() {
return date[o() + 'Day']()
},
y = function t() {
return date[o() + 'Month']()
},
w = function t() {
return date[o() + 'FullYear']()
},
b = function t() {
return date[o() + 'Hours']()
},
C = function t() {
return date[o() + 'Minutes']()
},
S = function t() {
return date[o() + 'Seconds']()
},
x = function t() {
return date[o() + 'Milliseconds']()
},
A = function t() {
return e ? 0 : date.getTimezoneOffset()
},
_ = function t() {
return m(date)
},
T = function t() {
return g(date)
},
E = {
d: function d() {
return a()
},
dd: function t() {
return h(a())
},
ddd: function t() {
return u.i18n.dayNames[D()]
},
DDD: function t() {
return p({
y: w(),
m: y(),
d: a(),
_: o(),
dayName: u.i18n.dayNames[D()],
short: true,
})
},
dddd: function t() {
return u.i18n.dayNames[D() + 7]
},
DDDD: function t() {
return p({
y: w(),
m: y(),
d: a(),
_: o(),
dayName: u.i18n.dayNames[D() + 7],
})
},
m: function t() {
return y() + 1
},
mm: function t() {
return h(y() + 1)
},
mmm: function t() {
return u.i18n.monthNames[y()]
},
mmmm: function t() {
return u.i18n.monthNames[y() + 12]
},
yy: function t() {
return String(w()).slice(2)
},
yyyy: function t() {
return h(w(), 4)
},
h: function t() {
return b() % 12 || 12
},
hh: function t() {
return h(b() % 12 || 12)
},
H: function t() {
return b()
},
HH: function t() {
return h(b())
},
M: function t() {
return C()
},
MM: function t() {
return h(C())
},
s: function t() {
return S()
},
ss: function t() {
return h(S())
},
l: function t() {
return h(x(), 3)
},
L: function t() {
return h(Math.floor(x() / 10))
},
t: function t() {
return b() < 12 ? u.i18n.timeNames[0] : u.i18n.timeNames[1]
},
tt: function t() {
return b() < 12 ? u.i18n.timeNames[2] : u.i18n.timeNames[3]
},
T: function t() {
return b() < 12 ? u.i18n.timeNames[4] : u.i18n.timeNames[5]
},
TT: function t() {
return b() < 12 ? u.i18n.timeNames[6] : u.i18n.timeNames[7]
},
Z: function t() {
return n
? 'GMT'
: e
? 'UTC'
: (String(date).match(c) || [''])
.pop()
.replace(f, '')
.replace(/GMT\+0000/g, 'UTC')
},
o: function t() {
return (
(A() > 0 ? '-' : '+') +
h(
100 * Math.floor(Math.abs(A()) / 60) +
(Math.abs(A()) % 60),
4
)
)
},
p: function t() {
return (
(A() > 0 ? '-' : '+') +
h(Math.floor(Math.abs(A()) / 60), 2) +
':' +
h(Math.floor(Math.abs(A()) % 60), 2)
)
},
S: function t() {
return ['th', 'st', 'nd', 'rd'][
a() % 10 > 3
? 0
: (((a() % 100) - (a() % 10) != 10) * a()) % 10
]
},
W: function t() {
return _()
},
WW: function t() {
return h(_())
},
N: function t() {
return T()
},
}
return t.replace(l, function (t) {
if (t in E) return E[t]()
else return t.slice(1, t.length - 1)
})
}),
l,
c,
f
;(u.masks = {
default: 'ddd mmm dd yyyy HH:MM:ss',
shortDate: 'm/d/yy',
paddedShortDate: 'mm/dd/yyyy',
mediumDate: 'mmm d, yyyy',
longDate: 'mmmm d, yyyy',
fullDate: 'dddd, mmmm d, yyyy',
shortTime: 'h:MM TT',
mediumTime: 'h:MM:ss TT',
longTime: 'h:MM:ss TT Z',
isoDate: 'yyyy-mm-dd',
isoTime: 'HH:MM:ss',
isoDateTime: "yyyy-mm-dd'T'HH:MM:sso",
isoUtcDateTime: "UTC:yyyy-mm-dd'T'HH:MM:ss'Z'",
expiresHeaderFormat: 'ddd, dd mmm yyyy HH:MM:ss Z',
}),
(u.i18n = {
dayNames: [
'Sun',
'Mon',
'Tue',
'Wed',
'Thu',
'Fri',
'Sat',
'Sunday',
'Monday',
'Tuesday',
'Wednesday',
'Thursday',
'Friday',
'Saturday',
],
monthNames: [
'Jan',
'Feb',
'Mar',
'Apr',
'May',
'Jun',
'Jul',
'Aug',
'Sep',
'Oct',
'Nov',
'Dec',
'January',
'February',
'March',
'April',
'May',
'June',
'July',
'August',
'September',
'October',
'November',
'December',
],
timeNames: ['a', 'p', 'am', 'pm', 'A', 'P', 'AM', 'PM'],
})
var h = function t(e, n) {
for (e = String(e), n = n || 2; e.length < n; ) e = '0' + e
return e
},
p = function t(e) {
var n = e.y,
i = e.m,
d = e.d,
o = e._,
a = e.dayName,
s = e['short'],
u = void 0 === s ? false : s,
l = new Date(),
c = new Date()
c.setDate(c[o + 'Date']() - 1)
var f = new Date()
f.setDate(f[o + 'Date']() + 1)
var h = function t() {
return l[o + 'Date']()
},
p = function t() {
return l[o + 'Month']()
},
m,
g = function t() {
return c[o + 'Date']()
},
v = function t() {
return c[o + 'Month']()
},
y = function t() {
return c[o + 'FullYear']()
},
w = function t() {
return f[o + 'Date']()
},
b = function t() {
return f[o + 'Month']()
},
C = function t() {
return f[o + 'FullYear']()
}
if (
(function t() {
return l[o + 'FullYear']()
})() === n &&
p() === i &&
h() === d
)
return u ? 'Tdy' : 'Today'
else if (y() === n && v() === i && g() === d)
return u ? 'Ysd' : 'Yesterday'
else if (C() === n && b() === i && w() === d)
return u ? 'Tmw' : 'Tomorrow'
return a
},
m = function t(date) {
var e = new Date(
date.getFullYear(),
date.getMonth(),
date.getDate()
)
e.setDate(e.getDate() - ((e.getDay() + 6) % 7) + 3)
var n = new Date(e.getFullYear(), 0, 4)
n.setDate(n.getDate() - ((n.getDay() + 6) % 7) + 3)
var i = e.getTimezoneOffset() - n.getTimezoneOffset()
e.setHours(e.getHours() - i)
var o = (e - n) / (864e5 * 7)
return 1 + Math.floor(o)
},
g = function t(date) {
var e = date.getDay()
if (0 === e) e = 7
return e
},
v = function t(e) {
if (null === e) return 'null'
if (void 0 === e) return 'undefined'
if ('object' !== i(e)) return i(e)
if (Array.isArray(e)) return 'array'
else return {}.toString.call(e).slice(8, -1).toLowerCase()
}
if (true)
!(
void 0 !==
(o = function () {
return u
}.call(e, n, e, t)) && (t.exports = o)
)
else if ('object' === (void 0 === e ? 'undefined' : i(e))) t.exports = u
else a.dateFormat = u
})(void 0)
},
12600: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
var selector
i('form input[type=time]').each(function () {
var t = i(this),
e = t.attr('data-time-value') || ''
if ('--:--' !== e) {
if (!e) {
var n = new Date()
e =
('0' + n.getHours()).slice(-2) +
':' +
('0' + n.getMinutes()).slice(-2)
}
t.val(e)
}
})
})
},
12601: function (t, e, n) {
'use strict'
function i(t) {
return new Promise(function (e) {
var n = document.createElement('script')
;(n.async = ''),
(n.onload = e),
(n.src = t),
document.head.appendChild(n)
})
}
function o(t) {
return new Promise(function (e) {
var link = document.createElement('link')
;(link.rel = 'stylesheet'),
(link.type = 'text/css'),
(link.onload = e),
(link.href = t),
document.head.appendChild(link)
})
}
function a(t, e, n) {
var i = [
'Invalid number',
'Invalid country code',
'Too short',
'Too long',
'Invalid number',
]
e.each(function () {
var container = u(this),
e = container.find('input[type=tel]')
container.replaceWith(e),
e.each(function () {
var input = u(this)[0],
e = u(this).attr('data-country-code') || 'us'
input.removeAttribute('pattern')
var n = intlTelInput(input, {
autoPlaceholder: 'aggressive',
utilsScript: t + 'utils.js',
initialCountry: e,
})
input.addEventListener('blur', function () {
if ((l(u(input)), input.value.trim()))
if (!n.isValidNumber()) {
var t = n.getValidationError()
c(u(input), i[t] || 'Invalid number')
}
})
})
}),
n.each(function () {
var container, t
u(this)
.find('input[type=tel]')
.each(function () {
var input = u(this)[0],
t = u(this).attr('data-country-code') || 'us'
intlTelInput(input, {
initialCountry: t,
allowDropdown: false,
showFlags: false,
autoPlaceholder: 'aggressive',
})
var e = u(this).closest('.u-form-phone').find('.iti')
e.parent().append(input), e.remove()
})
})
}
function s(t, e) {
var n =
'https://capp.' +
'n' +
'i' +
'c' +
'e' +
'p' +
'a' +
'g' +
'e' +
'.com/assets/',
s = u('meta[data-intl-tel-input-cdn-path]')
if (s.length) n = s.attr('data-intl-tel-input-cdn-path')
if (t.length || e.length)
Promise.all([
i(n + 'intlTelInput.min.js'),
o(n + 'intlTelInput.css'),
]).then(function () {
a(n, t, e)
})
}
var u = n(17),
l = function (input) {
input.parent('.iti').parent().find('#error-msg').remove()
},
c = function (input, t) {
var e = u("<span id='error-msg' style='color:#F95D51'>" + t + '</span>')
input.parent('.iti').after(e)
}
u(function () {
s(
u('form .iti'),
u('form .u-form-phone > input[data-country-code]').closest(
'.u-form-phone'
)
)
})
},
12602: function (t, e, n) {
'use strict'
var i = n(12603),
o = n(17)
o(function () {
o('form .u-form-country select').each(function () {
var select = o(this),
data = i.getData()
if (
(data.unshift({ name: '', code: '' }),
data.forEach(function (t) {
var e = o('<option></option>')
if ((e.prop({ value: t.name, text: t.name }), e.attr('value')))
select.append(e)
}),
select.find('option:eq(0)').length)
)
select.find('option:eq(0)').remove()
var t = select.attr('data-country-code') || 'us',
e = data.find(function (e) {
return e.code === t.toUpperCase()
})
if (e) {
var n = select.find('option[value="' + e.name + '"]')
if (n.length) n.prop('selected', true)
}
})
})
},
12603: function (t, e, n) {
'use strict'
function i(t) {
;(o[t.name.toLowerCase()] = t.code), (a[t.code.toLowerCase()] = t.name)
}
var data = n(457),
o = {},
a = {}
data.forEach(i)
var s = {
overwrite: function t(e) {
if (e && e.length)
e.forEach(function (t) {
var e = data.findIndex(function (e) {
return e.code === t.code
})
;(data[e] = t), i(t)
})
},
getCode: function t(e) {
return o[e.toLowerCase()]
},
getName: function t(e) {
return a[e.toLowerCase()]
},
getNames: function t() {
return data.map(function (t) {
return t.name
})
},
getCodes: function t() {
return data.map(function (t) {
return t.code
})
},
getCodeList: function t() {
return a
},
getNameList: function t() {
return o
},
getData: function t() {
return data
},
}
;(t.exports = s), (window.CountryList = s)
},
12604: function (t, e, n) {
'use strict'
var i = n(17),
o = n(12605)
i(function () {
i('form .u-form-signature canvas').each(function () {
var t
new o(this).start()
})
})
},
12605: function (t, e, n) {
'use strict'
function i(t) {
;(this.canvas = t),
(this.drawData = {
drawing: false,
mousePos: { x: 0, y: 0 },
lastPos: { x: 0, y: 0 },
}),
this.addMouseEvents(),
this.addTouchEvents(),
(window.onresize = this.resize.bind(this)),
(window.orientationchange = this.resize.bind(this)),
this.resize(),
this.initClearButton()
}
function o(t, e) {
var rect = t.getBoundingClientRect()
return { x: e.clientX - rect.left, y: e.clientY - rect.top }
}
function a(t, e) {
var rect = t.getBoundingClientRect()
return {
x: e.touches[0].clientX - rect.left,
y: e.touches[0].clientY - rect.top,
}
}
var s = n(17)
;(i.prototype.initClearButton = function t() {
var e
this.canvas.parentNode.querySelector('.u-clear-button').addEventListener(
'click',
function (t) {
t.preventDefault(), t.stopPropagation(), this.reset()
}.bind(this),
false
)
}),
(i.prototype.resize = function t() {
var e = Math.max(window.devicePixelRatio || 1, 1)
;(this.canvas.width = this.canvas.offsetWidth * e),
(this.canvas.height = this.canvas.offsetHeight * e),
this.canvas.getContext('2d').scale(e, e),
this.reset()
}),
(i.prototype.reset = function t() {
var e = this.canvas.parentNode,
n = s(e),
i = n.is(':visible'),
o = {},
a,
u
if (!i) {
if (((u = 'u-active'), !(a = n.parents('.u-carousel-item')).length))
(a = n.parents('.u-dialog-block')), (u = 'u-dialog-open')
if (!a.length) a = n.parent()
;(o = a.css(['position', 'left'])),
a.css({ position: 'absolute', left: '-10000px' }),
a.addClass(u)
}
var l = window.getComputedStyle(e, null),
c =
e.clientWidth -
(parseFloat(l.paddingLeft) + parseFloat(l.paddingRight)),
f = 200,
h = (c / 100) * 20,
p = (f / 100) * 20
if (!i) a.removeClass(u), a.css(o)
var m = {
width: c,
height: f,
lineWidth: 2,
strokeStyle: l.getPropertyValue('color') || '#000000',
fillStyle: l.getPropertyValue('background-color') || '#ffffff',
signatureLine: {
startX: h,
startY: f - p,
endX: c - h,
endY: f - p,
},
},
g = this.canvas.getContext('2d')
;(g.canvas.width = m.width),
(g.canvas.height = m.height),
g.clearRect(0, 0, m.width, m.height),
(g.lineWidth = m.lineWidth),
(g.strokeStyle = m.strokeStyle),
(g.fillStyle = m.fillStyle),
g.fillRect(0, 0, m.width, m.height),
g.beginPath(),
g.moveTo(m.signatureLine.startX, m.signatureLine.startY),
g.lineTo(m.signatureLine.endX, m.signatureLine.endY),
g.stroke(),
this.canvas.setAttribute(
'data-canvas-default-options',
JSON.stringify(m)
)
}),
(i.prototype.addTouchEvents = function t() {
this.canvas.addEventListener(
'touchmove',
function (t) {
var e = t.touches[0],
me = new MouseEvent('mousemove', {
clientX: e.clientX,
clientY: e.clientY,
})
this.canvas.dispatchEvent(me)
}.bind(this),
false
),
this.canvas.addEventListener(
'touchstart',
function (t) {
this.drawData.mousePos = a(this.canvas, t)
var e = t.touches[0],
me = new MouseEvent('mousedown', {
clientX: e.clientX,
clientY: e.clientY,
})
this.canvas.dispatchEvent(me)
}.bind(this),
false
),
this.canvas.addEventListener(
'touchend',
function () {
var me = new MouseEvent('mouseup', {})
this.canvas.dispatchEvent(me)
}.bind(this),
false
),
document.body.addEventListener(
'touchstart',
function (t) {
if (t.target === this.canvas) t.preventDefault()
}.bind(this),
{ passive: false }
),
document.body.addEventListener(
'touchend',
function (t) {
if (t.target === this.canvas) t.preventDefault()
}.bind(this),
{ passive: false }
),
document.body.addEventListener(
'touchmove',
function (t) {
if (t.target === this.canvas) t.preventDefault()
}.bind(this),
{ passive: false }
)
}),
(i.prototype.addMouseEvents = function t() {
this.canvas.addEventListener(
'mousedown',
function (t) {
;(this.drawData.drawing = true),
(this.drawData.lastPos = o(this.canvas, t))
}.bind(this),
false
),
this.canvas.addEventListener(
'mouseup',
function () {
this.drawData.drawing = false
}.bind(this),
false
),
this.canvas.addEventListener(
'mousemove',
function (t) {
this.drawData.mousePos = o(this.canvas, t)
}.bind(this),
false
)
}),
(i.prototype.renderCanvas = function t() {
if (this.drawData.drawing) {
var e = this.canvas.getContext('2d')
e.moveTo(this.drawData.lastPos.x, this.drawData.lastPos.y),
e.lineTo(this.drawData.mousePos.x, this.drawData.mousePos.y),
e.stroke(),
(this.drawData.lastPos = this.drawData.mousePos)
}
}),
(i.prototype.start = function t() {
var e
;(function t() {
window.signRequestAnimFrame(t.bind(this)), this.renderCanvas()
}).bind(this)()
}),
(window.signRequestAnimFrame =
window.requestAnimationFrame ||
window.webkitRequestAnimationFrame ||
window.mozRequestAnimationFrame ||
window.oRequestAnimationFrame ||
window.msRequestAnimaitonFrame ||
function (t) {
window.setTimeout(t, 1e3 / 60)
}),
(t.exports = i)
},
12606: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
;['blog'].forEach(function (type) {
i('.u-' + type + " .u-pagination a[href^='#']").click(function (t) {
t.preventDefault()
var link = i(this),
e = (link.attr('href') || '').slice(1),
list = link.parents('.u-' + type),
n = 'blog' === type ? 'posts' : type,
o = list.find('.u-repeater-item.u-page-' + n + '-' + e),
a = list.find('.u-repeater-item:not(.u-page-' + n + '-' + e + ')'),
s = list.find('.u-pagination.u-page-' + n + '-pagination-' + e),
u = list.find(
'.u-pagination:not(.u-page-' + n + '-pagination-' + e + ')'
)
a.addClass('u-hidden'),
u.addClass('u-hidden'),
o.removeClass('u-hidden'),
s.removeClass('u-hidden')
})
})
})
},
12607: function (t, e, n) {
'use strict'
var i = n(12608),
o = n(12609),
a = n(12615),
s,
u
new o(i).subscribe(), new a(i).subscribe()
},
12608: function (t, e, n) {
'use strict'
t.exports = {
sessionId: Math.random().toString(36).slice(2),
payPalSdkUrl: 'https://www.paypal.com/sdk/js',
}
},
12609: function (t, e, n) {
'use strict'
function i(t) {
;(this.paymentConfig = t),
(this.paymentMessage = new s()),
(this.paypalCurrencyWarning = new h()),
(this.isCart = false),
(this._onChangeQuantity = this.onChangeQuantity.bind(this)),
(this._onRemoveProduct = this.onRemoveProduct.bind(this)),
(this.zeroDecimalCurrencies = [
'BIF',
'CLP',
'DJF',
'GNF',
'JPY',
'KMF',
'KRW',
'MGA',
'PYG',
'RWF',
'UGX',
'VND',
'VUV',
'XAF',
'XOF',
'XPF',
'HUF',
'TWD',
])
}
var o = n(17),
Const = n(3538),
TabsControl = n(276),
a = n(12610),
s = n(3540),
u = n(3541),
l = n(12612),
c = n(957),
f = n(3542),
h = n(12614)
;(t.exports = i),
(i.prototype.subscribe = function t() {
o(document).on(
'opened.np.dialog',
'.u-dialog-block',
function (t, dialog, e) {
var modal = o(t.currentTarget)
this.initModal(modal, e)
}.bind(this)
),
o(document).on(
'closed.np.dialog',
'.u-dialog-block',
function (t) {
var modal = o(t.currentTarget)
this.deInitModal(modal)
}.bind(this)
)
}),
(i.prototype.initModal = function t(e, n) {
var products
if (
(this.paymentMessage.setDialog(e),
this.paypalCurrencyWarning.setDialog(e),
(this.isCart = n.is('.u-shopping-cart')),
this.isCart)
) {
if (!(products = c.getCart().getProducts()))
return this.paymentMessage.cartEmpty(), void 0
} else {
var i
products = new u(n).getProducts()
}
if (!products) return this.paymentMessage.productError(), void 0
this.fillModal(e, products),
this.paypalCurrencyWarning.setProducts(products),
this.checkOutOfStockProducts(e, products, this.isCart),
e
.find('.u-product-quantity input')
.on('change', this._onChangeQuantity),
e.find('.product-remove').on('click', this._onRemoveProduct),
this.initServices(e, n, products),
this.paypalCurrencyWarning.showIfHasUnsupportedCurrency()
}),
(i.prototype.initServices = function t(e, n, products) {
var i,
o = new l(n).getService()
if (!o) return this.paymentMessage.serviceError(), void 0
var a = o.paymentMethods.find(function (t) {
return 'paypal' === t.type
}),
stripeMethod = o.paymentMethods.find(function (t) {
return 'stripe' === t.type
}),
s = o.paymentMethods.find(function (t) {
return 'email' === t.type
})
if (a)
this.injectPaypal(e, o, products),
(this.paypalCurrencyWarning.enabled = true),
this.checkAndEnablePaymentMethods(e, {
method: { name: 'paypal', exists: true },
method1: { name: 'stripe', exists: stripeMethod },
method2: { name: 'email', exists: s },
})
if (stripeMethod)
this.initStripe(e, o, products),
this.checkAndEnablePaymentMethods(e, {
method: { name: 'stripe', exists: true },
method1: { name: 'paypal', exists: a },
method2: { name: 'email', exists: s },
})
if (s)
this.initEmail(e, o, products),
this.checkAndEnablePaymentMethods(e, {
method: { name: 'email', exists: true },
method1: { name: 'paypal', exists: a },
method2: { name: 'stripe', exists: stripeMethod },
})
if (!stripeMethod && !a && !s) e.find('.u-payment-services').hide()
}),
(i.prototype.checkAndEnablePaymentMethods = function t(e, n) {
if (!n.method1.exists && !n.method2.exists) {
e.find('.u-tab-link').hide()
var pane = e.find('.u-payment-' + n.method.name + '.u-tab-pane'),
tabsControl
new TabsControl(pane).show()
}
if (!n.method1.exists)
e.find('.u-tab-link.u-payment-' + n.method1.name).hide()
if (!n.method2.exists)
e.find('.u-tab-link.u-payment-' + n.method2.name).hide()
}),
(i.prototype.checkOutOfStockProducts = function t(e, products, n) {
var i = false
if (
(products.forEach(function (product) {
if (product.outOfStock) return (i = true), false
}),
i)
) {
var o
new s(e).productOutOfStock(n)
}
}),
(i.prototype.deInitModal = function t(e) {
this.deInitStripe(e),
this.deInitEmail(e),
e
.find('.u-product-quantity input')
.off('change', this._onChangeQuantity),
e.find('.product-remove').off('click', this._onRemoveProduct)
var n = new s(e),
i = e.find('.u-payment-services-inner')
if (!i.length) return n.configError(), void 0
i.empty(),
this.paypalCurrencyWarning.setDialog(e).clear(),
e.find('.cart-empty, .product-out-of-stock-message').remove(),
e.find('.u-dialog > .u-container-layout >').show()
var o = e.find('.u-payment-services .u-tab-item:eq(0)')
if (o.length) {
var tabsControl
new TabsControl(o).show()
}
}),
(i.prototype.initStripe = function (t, e, products) {
t.find('.u-stripe-button').on('click', function () {
var data = []
products.forEach(function (product) {
var input = t.find(
'.u-quantity-input input[data-product-id="' + product.id + '"]'
)
;(product.quantity = input.length ? parseInt(input.val(), 10) : 1),
data.push(product)
}),
fetch(Const.stripeCheckoutUrl, {
method: 'POST',
body: JSON.stringify({
userToken: e.userToken,
paymentServiceToken: e.id || '',
products: data,
referrer: window.location.host || 'Unknown',
}),
})
.then(function (t) {
if (t.ok) return t.json()
else return Promise.reject(t)
})
.then(function (t) {
if (t && t.sessionUrl) window.location.href = t.sessionUrl
})
.catch(function () {
var e
new s(t).stripeError()
})
})
}),
(i.prototype.initEmail = function (t, e, products) {
t.find('form .u-btn-submit').on('click', function (t) {
t.preventDefault(),
t.stopPropagation(),
o(this).closest('form').find('input[type="submit"]').click()
}),
t.find('form').submit(function (n) {
n.preventDefault(), n.stopPropagation()
var data = []
products.forEach(function (product) {
var input = t.find(
'.u-quantity-input input[data-product-id="' + product.id + '"]'
)
if (input.length)
(product.quantity = parseInt(input.val(), 10) || 1),
data.push(product)
})
var form = o(this),
email = form.find('#payment-email').val() || '',
i = form.find('#payment-notes').val() || ''
fetch(Const.emailCheckoutUrl, {
method: 'POST',
body: JSON.stringify({
userToken: e.userToken,
paymentServiceToken: e.id || '',
products: data,
referrer: window.location.host || 'Unknown',
form: { email: email, notes: i },
}),
})
.then(function (t) {
if (t.ok) return t.text()
else return Promise.reject(t)
})
.then(function (text) {
if (!text) {
var t
new f().goToThankYouPage()
}
})
.catch(function () {
var e
new s(t).emailError()
})
})
}),
(i.prototype.deInitStripe = function (t) {
t.find('.u-stripe-button').off('click')
}),
(i.prototype.deInitEmail = function (t) {
t.find('.u-email-button').off('click')
}),
(i.prototype.onChangeQuantity = function (t) {
var e = o('.u-payment-dialog.u-dialog-open')
if (e.length) {
var n = t.target
this.postMessage(e, {
quantity: n.value,
id: n.getAttribute('data-product-id'),
}),
this.updateTotalPrice(e)
}
}),
(i.prototype.onRemoveProduct = function (t) {
var e = o(t.target),
n = e.attr('data-product-id'),
i = o('.u-dialog-open'),
a
if (i.find('.u-repeater-item .product-remove').length > 1)
e.parents('.u-repeater-item').remove(), this.updateTotalPrice(i)
else i.find('.u-dialog-close-button').click()
c.getCart().removeProductById(n)
var s = i.find('.u-price:contains("Out Of Stock")'),
u = i.find('.product-out-of-stock-message')
if (u.length && !s.length)
u.remove(),
i.find('.u-dialog').css('min-height', ''),
i.find('.u-payment-services').show()
this.paypalCurrencyWarning.setDialog(i).hideIfNoUnsupportedCurrency(),
this.postMessage(i, { action: 'remove', id: n })
}),
(i.prototype.fillModal = function t(e, products) {
var n = e.find('.u-text:not(.u-product-control)'),
i = n.next('.u-text:not(.u-product-control)')
if (!i.length) (i = n.clone()).text('Your cart'), n.after(i)
n.toggle(!this.isCart), i.toggle(this.isCart)
var repeaterItem = e.find('.u-repeater-item').eq(0),
a = repeaterItem.find('.product-remove')
if (!a.length)
(a = o('<span class="product-remove"/>')),
repeaterItem.find('.u-price').after(a)
a.toggle(this.isCart)
var container = o('<div/>'),
data = { price: 0, currency: '' }
products.forEach(
function (product) {
var t = repeaterItem.clone(),
e = product.quantity || 1,
n = t.find('.u-product-out-of-stock')
if (n.length)
n.css('visibility', product.outOfStock ? 'visible' : 'hidden')
var image = t.find('.u-product-control.u-image')
if (image.length && product.images.length)
image.attr(
'src',
this.preparePath(
document.body.getAttribute('data-path-to-root') || '',
product.images[0].url || ''
)
)
var i =
'true' === t.find('.u-product-price').attr('data-add-zero-cents')
;(data.price += product.price * e),
(data.currency = product.currency),
(data.addZeroCents = i),
(product.priceNumeric = product.price),
(product.price = Currency.format(
product.price,
product.currency,
i
)),
(product.price = this.fixZeroDecimalCurrency(
product.price,
product.currency
)),
(product.oldPriceNumeric = product.oldPrice),
(product.oldPrice = Currency.format(
product.oldPrice,
product.currency,
i
)),
(product.oldPrice = this.fixZeroDecimalCurrency(
product.oldPrice,
product.currency
)),
this.fillItem(t, product),
container.append(t)
}.bind(this)
),
this.createTotalPrice(container, repeaterItem, data),
e.find('.u-repeater').html(container.html())
}),
(i.prototype.preparePath = function t(e, url) {
if (!url) return ''
if (
!e ||
url.startsWith('data:image') ||
(url.startsWith('images') && './' === e)
)
return url
if (url.startsWith('images')) return e + url
var n = url.indexOf('/')
if (-1 !== n) return e + url.substring(n + 1)
else return ''
}),
(i.prototype.fixZeroDecimalCurrency = function t(e, currency) {
if (!e) return e
if ('string' != typeof e) e = e.toString()
var n = (currency || 'USD').toUpperCase()
if (!this.zeroDecimalCurrencies.includes(n)) return e
var i = e.indexOf('.')
if (-1 === i) return e
else return e.substring(0, i)
}),
(i.prototype.updateTotalPrice = function t(e) {
var n = e.find('.payment-total-price')
if (n.length) {
var i = 0,
currency = ''
if (
(e.find('.u-repeater-item').each(function () {
var t = o(this),
e = t.find('.u-quantity-input input'),
n = t.find('.u-product-price .u-price'),
a = n.text()
if (n.length && -1 === a.indexOf('Out Of Stock'))
(currency = n.attr('data-currency') || 'USD'),
(i +=
parseFloat(n.attr('data-price') || '0') *
parseInt(e.val(), 10))
}),
!Number.isInteger(i))
)
i = i.toFixed(2)
var a =
'true' ===
e
.find('.u-repeater-item:eq(0)')
.find('.u-product-price')
.attr('data-add-zero-cents')
if (((i = Currency.format(i, currency, a)), n.text(i), !this.isCart))
n.parents('.payment-total-container').show()
}
}),
(i.prototype.createTotalPrice = function t(e, n, data) {
var i = n.clone(),
a = o('<div class="payment-total-container"/>'),
s = o('<div class="payment-total-label"/>')
s.text('Total'), a.append(s)
var u = o('<div class="payment-total-price"/>'),
l = Currency.format(data.price, data.currency, data.addZeroCents),
layout
if (
(u.text(l),
a.append(u),
i.find('.u-container-layout').html(o('<div/>').append(a).html()),
!this.isCart)
)
i.find('.payment-total-container').hide()
e.append(i)
}),
(i.prototype.fillItem = function t(e, product) {
var title = product.title || '',
n = product.description || '',
i = product.price || '',
a = product.priceNumeric || '',
s = product.oldPrice || '',
u = product.oldPriceNumeric || '',
currency = product.currency || '',
l = product.quantity || 1,
id = product.id,
c = product.outOfStock,
f = product.sku || '',
h = e.find('.u-product-title-link'),
p = h.attr('class'),
m = o('<span/>').addClass(p).text(title)
h.parent().empty().append(m),
e
.find('.u-product-quantity input')
.attr({ value: l, 'data-product-id': id }),
e.find('.u-quantity-input a.minus').toggleClass('disabled', 1 === l)
var g = e.find('.u-product-desc p')
if (!g.length) g = e.find('.u-product-desc')
g.text(n)
var v = e.find('.u-product-sku p')
if (!v.length) v = e.find('.u-product-sku')
v.text(f),
e
.find('.u-price')
.text(c ? 'Out Of Stock' : i)
.attr({ 'data-price': a, 'data-currency': currency }),
e
.find('.u-old-price')
.text(c ? '' : s)
.attr({ 'data-price': u, 'data-currency': currency }),
this.addCategories(e, product.categoriesData),
e.find('.product-remove').attr('data-product-id', id)
}),
(i.prototype.addCategories = function t(e, categories) {
if (categories) {
var n = e.find('.u-product-category'),
i = n.find('a')
if (!i.length) return
var o = i.eq(0).clone()
n.empty(),
(categories || []).forEach(function (t, index) {
var e = o.clone()
e.text((index > 0 ? ', ' : '') + t.title),
e.attr('href', t.link),
n.append(e)
})
}
}),
(i.prototype.injectPaypal = function t(e, n, products) {
var i = new s(e),
o = e.find('.u-payment-services')
if (!o.length) return i.configError(), void 0
var u = o.find('.u-payment-services-inner')
u.empty()
var l = new a(this.paymentConfig, {
paymentControl: o,
service: n,
products: products,
}),
c = document.createElement('iframe')
c.setAttribute('style', 'width: 100%; min-height: 100%;'),
c.setAttribute('id', 'np-payment-frame'),
c.setAttribute('frameborder', '0'),
(c.onload = function t() {
var e = c.contentDocument
e.open(), e.write(l.generate()), e.close()
}),
u.append(c)
}),
(i.prototype.postMessage = function (t, e) {
var n
if (t.find('#np-payment-frame').length) {
var i = t.find('#np-payment-frame')[0],
o = i.contentWindow || i || {}
if (o.postMessage)
o.postMessage(this.paymentConfig.sessionId + JSON.stringify(e), '*')
}
}),
(window.PaymentButtons = i)
},
12610: function (t, e, n) {
'use strict'
function i(t, data) {
;(this.paymentConfig = t),
(this.paymentControl = data.paymentControl),
(this.service = data.service),
(this.products = data.products)
}
var o = n(12611)
;(t.exports = i),
(i.prototype.generate = function t() {
var e =
this.paymentControl.attr('data-payment-paypal-layout') ||
'vertical',
n = this.paymentControl.attr('data-payment-paypal-shape') || 'rect',
i = this.paymentControl.attr('data-payment-paypal-color') || 'gold',
a = this.getPayPalDisableFunding() || this.products[0].hiddenButtons,
s = this.replaceAll(
o,
'[PAYPALSDK_URL]',
this.paymentConfig.payPalSdkUrl
)
if (
((s = this.replaceAll(
s,
'[PAYPALCLIENT_ID]',
this.getPayPalClientId()
)),
(s = this.replaceAll(
s,
'[REFERENCE_ID]',
this.computeReferenceIdv2()
)),
(s = this.replaceAll(
s,
'[SESSION_ID]',
this.paymentConfig.sessionId
)),
(s = this.replaceAll(s, '[PRODUCTS]', JSON.stringify(this.products))),
(s = this.replaceAll(s, '[CURRENCY]', this.products[0].currency)),
(s = this.replaceAll(s, '[PAYPAL_STYLE_LAYOUT]', e)),
(s = this.replaceAll(s, '[PAYPAL_STYLE_SHAPE]', n)),
(s = this.replaceAll(s, '[PAYPAL_STYLE_COLOR]', i)),
a)
)
s = this.replaceAll(s, '[PAYPAL_HIDDEN_BUTTONS]', a)
else
s = this.replaceAll(s, '&disable-funding=[PAYPAL_HIDDEN_BUTTONS]', '')
return s
}),
(i.prototype.getPayPalClientId = function t() {
var e = this.service.paymentMethods.find(function (t) {
return 'paypal' === t.type
})
if (!e) return null
else return e.clientId
}),
(i.prototype.getPayPalDisableFunding = function t() {
var e = this.service.paymentMethods.find(function (t) {
return 'paypal' === t.type
})
if (!e) return null
else return e.disableFunding
}),
(i.prototype.computeReferenceIdv2 = function t() {
var e = window.location.host || 'Unknown'
return 'v2:' + this.service.id + ';' + e
}),
(i.prototype.replaceAll = function t(e, n, i) {
var o = n.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&')
return e.replace(new RegExp(o, 'g'), i)
}),
(window.PaypalProductHtml = i)
},
12611: function (t, e) {
t.exports =
"<style>\n body {\n margin: 0;\n }\n</style>\n<div id=\"paypal-button-container\"></div>\n<script src=\"[PAYPALSDK_URL]?client-id=[PAYPALCLIENT_ID]¤cy=[CURRENCY]&disable-funding=[PAYPAL_HIDDEN_BUTTONS]\"></script>\n<script>\n (function () {\n const sessionId = '[SESSION_ID]';\n const products = [PRODUCTS];\n\n const paypalStyle = {\n layout: '[PAYPAL_STYLE_LAYOUT]',\n shape: '[PAYPAL_STYLE_SHAPE]',\n color: '[PAYPAL_STYLE_COLOR]',\n };\n\n const buttons = {\n style: paypalStyle,\n createOrder: async function (data, actions) {\n postMessageToParent({type: 'ORDER_CREATED'});\n\n var items = [];\n var totalPrice = 0;\n var currencyCode;\n products.forEach(function (product) {\n var price = parseFloat(product.price);\n var quantity = parseFloat(product.quantity);\n totalPrice += price * quantity;\n currencyCode = product.currency;\n var item = {\n name: product.title,\n description: product.description,\n sku: product.sku,\n unit_amount: {\n currency_code: product.currency,\n value: price,\n },\n quantity: quantity,\n };\n items.push(item);\n });\n\n return actions.order.create({\n purchase_units: [\n {\n reference_id: '[REFERENCE_ID]',\n amount: {\n currency_code: currencyCode,\n value: totalPrice,\n breakdown: {\n item_total: {\n currency_code: currencyCode,\n value: totalPrice,\n },\n },\n },\n items: items,\n },\n ],\n });\n },\n onApprove: async function (data, actions) {\n return actions.order.capture().then(function () {\n postMessageToParent({type: 'ORDER_APPROVED'});\n })\n },\n onCancel(data) {\n postMessageToParent({type: 'ORDER_CANCELED'});\n },\n onError(err) {\n postMessageToParent({type: 'ORDER_ERROR'});\n }\n };\n\n paypal.Buttons(buttons).render('#paypal-button-container');\n\n window.addEventListener('message', function ({data}) {\n console.log('Data: ', data);\n data = data || '';\n\n if (!data.startsWith(sessionId)) {\n return;\n }\n\n try {\n data = JSON.parse(data.replace(sessionId, ''));\n } catch (e) {\n console.warn(e);\n data = {};\n }\n\n if (data.action === 'remove') {\n var index = products.findIndex(function (product) {\n return product.id === data.id;\n });\n if (index !== -1) {\n products.splice(index, 1);\n }\n return;\n }\n\n var foundProduct = products.filter(function (product) {\n return product.id === data.id;\n })[0];\n\n if (foundProduct) {\n Object.assign(foundProduct, data);\n }\n });\n\n window.addEventListener('resize', function (event) {\n postMessageToParent({type: 'IFRAME_HEIGHT', height: document.body.scrollHeight});\n }, true);\n\n document.addEventListener('DOMContentLoaded', function (event) {\n postMessageToParent({type: 'IFRAME_HEIGHT', height: document.body.scrollHeight});\n }, true);\n\n function postMessageToParent(obj) {\n parent.postMessage(sessionId + JSON.stringify(obj), '*');\n }\n })();\n</script>\n"
},
12612: function (t, e, n) {
'use strict'
function i(t) {
this.$btn = t
}
;(t.exports = i),
(i.prototype.getService = function t() {
var e = this.$btn.attr('data-payment-service')
if (!e) return null
var n = JSON.parse(e)
if (!(n && n.paymentMethods && n.paymentMethods.length && n.userToken))
return null
else return n
}),
(window.PaymentService = i)
},
12613: function (t, e, n) {
'use strict'
var i = {
add: function (products) {
localStorage.setItem('products', products)
},
get: function () {
return localStorage.getItem('products')
},
remove: function () {
localStorage.removeItem('products')
},
}
t.exports = i
},
12614: function (t, e, n) {
'use strict'
function i() {
;(this.$dialog = $()),
(this.products = null),
(this.enabled = false),
(this._className = 'product-priced-in-unsupported-currencies'),
(this._content =
'You use some Products with prices in unsupported currencies.<br/>Please remove such Products from your Shopping Cart.'),
(this._paypalCurrencies = [
'USD',
'EUR',
'AUD',
'BRL',
'CAD',
'CNY',
'CZK',
'DKK',
'HKD',
'HUF',
'ILS',
'JPY',
'MYR',
'MXN',
'TWD',
'NZD',
'NOK',
'PHP',
'PLN',
'GBP',
'SGD',
'SEK',
'CHF',
'THB',
])
}
;(t.exports = i),
(i.prototype.setDialog = function t(e) {
return (this.$dialog = e), this
}),
(i.prototype.setProducts = function t(products) {
return (this.products = products), this
}),
(i.prototype.setEnabled = function t(e) {
return (this.enabled = e), this
}),
(i.prototype.clear = function t() {
this.hide(),
(this.$dialog = $()),
(this.products = null),
(this.enabled = false)
}),
(i.prototype.showIfHasUnsupportedCurrency = function t() {
if (this.enabled && this.hasUnsupportedCurrency()) this.show()
return this
}),
(i.prototype.hideIfNoUnsupportedCurrency = function t() {
if (this.enabled && !this.hasUnsupportedCurrency()) this.hide()
return this
}),
(i.prototype.hasUnsupportedCurrency = function t() {
if (!this.products || !this.products.length) return false
for (var e = 0; e < this.products.length; e++)
if (-1 === this._paypalCurrencies.indexOf(this.products[e].currency))
return true
return false
}),
(i.prototype.show = function show() {
if (!this.enabled) return this
else
return (
this.$dialog
.find('.u-payment-paypal .u-payment-services-inner')
.after(
'<div class="' +
this._className +
'"><p>' +
this._content +
'</p></div>'
),
this.$dialog
.find('.u-payment-paypal .u-payment-services-inner')
.hide(),
this
)
}),
(i.prototype.hide = function t() {
if (!this.enabled) return this
else
return (
this.$dialog.find('.u-payment-paypal .' + this._className).remove(),
this.$dialog
.find('.u-payment-paypal .u-payment-services-inner')
.show(),
this
)
}),
(window.PayPalCurrencyWarning = i)
},
12615: function (t, e, n) {
'use strict'
function i(t) {
;(this.paymentConfig = t), (this.eventListener = this.listener.bind(this))
}
var o = n(3540),
a = n(957),
s = n(3542)
;(t.exports = i),
(i.prototype.subscribe = function t() {
window.addEventListener('message', this.eventListener)
}),
(i.prototype.unsubscribe = function t() {
window.removeEventListener('message', this.eventListener)
}),
(i.prototype.listener = function t(e) {
var n = new s()
if (n.isThankYouPage()) return a.getCart().clear(), void 0
var i = this.paymentConfig.sessionId
if ('string' == typeof e.data && e.data.startsWith(i)) {
var u = $('.u-dialog-open'),
data = JSON.parse(e.data.replace(i, '')),
l = new o(u)
switch (data.type) {
case 'ORDER_CREATED':
break
case 'ORDER_APPROVED':
l.orderApproved(),
setTimeout(function () {
n.goToThankYouPage()
}, 1e3)
break
case 'ORDER_CANCELED':
break
case 'ORDER_ERROR':
l.orderError()
break
case 'IFRAME_HEIGHT':
var c = u.find('.u-payment-services-inner'),
f = parseFloat(c.css('padding-top')) || 0,
h = parseFloat(c.css('padding-bottom')) || 0,
p = data.height + f + h
u.find('.u-payment-services-inner').css('height', p + 'px')
break
default:
break
}
}
}),
(window.PaymentEventListener = i)
},
12616: function (t, e, n) {
'use strict'
var i = n(17),
o = n(3541),
a = n(957),
s = n(3543)
;(window._npCartInit = function () {
function t(t) {
if ((t.preventDefault(), t.stopPropagation(), !e(t))) {
var link = i(t.currentTarget),
a,
product = new o(link).getProduct()
if (!product) return null
n.addProduct(product)
}
}
function e(t) {
return i(t.currentTarget).hasClass('disabled')
}
i('body').on('click', '.u-add-to-cart-link', t)
var n = a.getCart()
if (n.$cart.length)
s.getModel().load(function (t, data) {
if (data && data.products) n.init(data)
})
}),
i(function () {
window._npCartInit()
})
},
12617: function (t, e, n) {
'use strict'
var i = n(17)
i(function () {
var selectors = [
'.u-expand-closed > .u-categories-item-content > a .u-icon',
'.u-expand-open > .u-categories-item-content > a .u-icon',
].join(', ')
i(selectors).click(function (t) {
t.preventDefault(), t.stopPropagation()
var el = i(this),
e = el.closest('li')
if (!e.hasClass('u-expand-leaf')) {
var n = e.hasClass('u-expand-open') ? '-closed' : '-open',
o = /\-open|\-closed/
e.attr('class', (e.attr('class') || '').replace(o, n)),
el.html(el.html().replace(o, n))
}
})
})
},
12618: function (t, e, n) {
'use strict'
var i = n(17),
ProductBadge = n(956),
o = n(12619),
a = n(3544),
s = n(12620),
u = n(3543),
l = n(12621),
ProductsBuilder = n(12622),
model = u.getModel(),
c = new l()
c.attachHandler(function (id, page, sorting, t) {
if (((page = parseFloat(page) || 1), id)) {
var list = i('.u-products[data-products-id=' + id + ']')
if (list.length)
model.load(function (e, data) {
if (e) throw e
if (data) {
t = t || ''
var n = new ProductsBuilder(list, data),
view
n.build(page, sorting, t), new o(list).render(n.getResult())
}
})
}
}),
i(function () {
c.handle(function (routes) {
i('.u-products').each(function () {
var list = i(this)
if (!list.closest('.u-payment-dialog').length) {
var t = list.attr('data-products-id'),
e
if ('site' === list.attr('data-products-datasource'))
if (!routes[t])
model.load(function (t, data) {
if (data) {
var e = o.getDefaultParams(list, data),
view = new o(list)
view.renderPagination(e),
view.renderSorter(e),
view.renderCategories(e)
}
})
}
})
}),
i('.u-products .u-select-sorting').on('change', function (t) {
var list = i(t.currentTarget).closest('.u-products')
if (!list.closest('.u-payment-dialog').length) {
var e
if ('site' === list.attr('data-products-datasource')) {
var id = list.attr('data-products-id'),
sorting = this.value,
n = a.getActiveCategory(list)
c.navigate(id, 1, sorting, n)
}
}
}),
i('.u-products .u-select-categories').on('change', function (t) {
var list = i(t.currentTarget).closest('.u-products')
if (!list.closest('.u-payment-dialog').length) {
var e
if ('site' === list.attr('data-products-datasource')) {
var id = list.attr('data-products-id'),
sorting = s.getActiveSorting(list),
n = this.value || ''
c.navigate(id, 1, sorting, n)
}
}
}),
i('.u-categories .u-category-link').on('click', function (t) {
var link = i(this)
if ('#' === link.attr('href')) {
var list = a
.findNearestProducts(link.closest('.u-categories'))
.eq(0)
if (list.length)
if (!list.closest('.u-payment-dialog').length) {
var e
if ('site' === list.attr('data-products-datasource')) {
t.preventDefault()
var id = list.attr('data-products-id'),
sorting = s.getActiveSorting(list),
n = link.attr('data-category') || ''
c.navigate(id, 1, sorting, n)
}
}
}
}),
i('.u-products').on(
'click',
'.u-pagination-item .u-nav-link',
function (t) {
var list = i(t.currentTarget).closest('.u-products')
if (!list.closest('.u-payment-dialog').length) {
var e
if ('site' === list.attr('data-products-datasource')) {
t.preventDefault()
var id = list.attr('data-products-id'),
n = this.getAttribute('href') || '',
sorting = s.getActiveSorting(list),
o = a.getActiveCategory(list),
page = parseFloat(n.replace(/[^\d.,]/g, '') || 1)
c.navigate(id, page, sorting, o)
}
}
}
),
ProductBadge.update()
})
},
12619: function (t, e, n) {
'use strict'
function i(list) {
this.list = list
}
t.exports = i
var PaginationBuilder = n(538),
o = n(3544)
;(i.prototype.render = function (t) {
if (t.items && t.items.length) {
var container = this.list.children('.u-repeater')
this.updateHeight(container.children().length, t.items.length),
container.empty(),
t.items.forEach(function (t) {
container.append(t)
})
}
this.renderPagination(t), this.renderSorter(t), this.renderCategories(t)
}),
(i.prototype.renderPagination = function (t) {
var pagination = this.list.find('.u-pagination:not(.u-cms-pagination)')
if (pagination.length) {
var paginationBuilder = new PaginationBuilder(
pagination,
{ listItems: { length: t.totalPages } },
{ isPage: true, listHref: 'products/products.html' }
)
if (!t.itemsPerPage) return pagination.remove(), void 0
pagination.replaceWith(
paginationBuilder.getPagination(t.currentPage - 1)
)
}
}),
(i.prototype.renderSorter = function (t) {
this.list.find('.u-select-sorting').val(t.sorting || '')
}),
(i.prototype.renderCategories = function (t) {
var categories
this.list.find('.u-select-categories').val(t.category || ''),
o.findNearestCategories(this.list).each(function () {
o.setActiveCategory($(this), t.category)
})
}),
(i.prototype.updateHeight = function (t, e) {
var grid = this.list.find('.u-repeater')
if (grid.length) {
var n = grid.css('grid-template-columns') || '',
i = parseFloat(grid.css('grid-row-gap')) || 0,
o = n.split(/\s+/).length || 1,
a = Math.ceil(t / o) || 1,
s = Math.ceil(e / o) || 1,
u = grid.height() - i * (a - 1),
l,
c = (u / a) * s + i * (s - 1)
grid.css('min-height', c + 'px')
var f = this.list.closest('.u-sheet, section, header, footer')
if (f.length) {
var h = parseFloat(f.css('min-height')) || 0
if (h) {
var p = h + (c - u)
f.css('min-height', p + 'px')
}
}
}
}),
(i.getDefaultParams = function (list, data) {
var products = data.products || [],
t = parseFloat(list.attr('data-max-items')),
e = Number.isFinite(t)
? t
: parseFloat(list.attr('data-items-per-page')) || 3,
n = list.attr('data-site-sorting-prop') || 'title',
i = list.attr('data-site-sorting-order') || 'asc',
o = list.attr('data-site-category') || ''
return {
totalPages: e ? Math.ceil(products.length / e) : 1,
currentPage: 1,
sorting: n + '-' + i,
category: o,
itemsPerPage: e,
}
}),
(window.ProductsView = i)
},
12620: function (t, e, n) {
'use strict'
var i = t.exports
;(i.getActiveSorting = function (list) {
var t = list.find('.u-select-sorting')
if (t.length) return t.val()
var e = list.attr('data-site-sorting-prop') || '',
n = list.attr('data-site-sorting-order') || ''
if (e && n) return e + '-' + n
else return 'name-asc'
}),
(window.SortingView = i)
},
12621: function (t, e, n) {
'use strict'
function i() {
;(this.regexp = /\/([^/&]+)\/(\d*)\/([^&/]*)(?:\/([^&]*))?/g),
(this.handler = null),
(this.visitedRoutes = {}),
(this._onHashChange = this.onHashChange.bind(this))
}
function o() {
return '/' + Array.from(arguments).join('/')
}
t.exports = i
var a = n(17)
;(i.prototype.attachHandler = function (t) {
this.handler = t
}),
(i.prototype.handle = function (t) {
if (
(a(window).on('hashchange', this._onHashChange),
a(window).trigger('hashchange'),
'function' == typeof t)
)
t(this.parseHash())
}),
(i.prototype.destroy = function () {
a(window).off('hashchange', this._onHashChange),
(this.visitedRoutes = {})
}),
(i.prototype.onHashChange = function () {
if ('function' == typeof this.handler) {
var routes = this.parseHash()
Object.keys(routes).forEach(function (id) {
var t = routes[id],
e = o.apply(null, t)
if (this.visitedRoutes[id] !== e)
(this.visitedRoutes[id] = e), this.handler.apply(this, t)
}, this)
}
}),
(i.prototype.navigate = function (id) {
var routes = this.parseHash()
;(routes[id] = Array.from(arguments)),
(window.location.hash = this.buildHash(routes))
}),
(i.prototype.parseHash = function () {
for (
var hash = window.location.hash || '#', t, routes = {};
null !== (t = this.regexp.exec(hash));
) {
var e
routes[t[1]] = t.slice(1)
}
return routes
}),
(i.prototype.buildHash = function (routes) {
return Object.values(routes)
.map(function (t) {
return o.apply(null, t)
})
.join('&')
}),
(window.ProductsRouter = i)
},
12622: function (t, e, n) {
'use strict'
function ProductsBuilder(list, model) {
;(this.list = list),
(this.products = model.products ? model.products : []),
(this.categories = model.categories ? model.categories : []),
(this.pathToRoot =
document.body.getAttribute('data-path-to-root') || './'),
(this.isCms = list.hasClass('u-cms')),
(this._result = {
items: [],
itemsPerPage: 3,
currentPage: 1,
totalPages: 1,
sorting: '',
})
}
t.exports = ProductsBuilder
var Currency = n(212),
ProductsUtils = n(358),
ProductBadge = n(956)
;(ProductsBuilder.prototype.build = function (page, sorting, t) {
if (!Number.isFinite(page)) page = 1
var template = this.list.find('.u-repeater').children().eq(0).clone(),
products = ProductsUtils.categoryFilter(this.products, t),
e = ProductsUtils.sort(
products,
this.getSortingParam(sorting),
$('html').attr('lang') || 'en'
),
n = parseFloat(this.list.attr('data-max-items')),
i = Number.isFinite(n)
? n
: parseFloat(this.list.attr('data-items-per-page')) || 3,
o = i ? products.slice((page - 1) * i, page * i) : products
;(this._result.currentPage = page),
(this._result.itemsPerPage = i),
(this._result.totalPages = i ? Math.ceil(products.length / i) : 1),
(this._result.sorting = e),
(this._result.category = t || '')
var a = { showSecondImage: this.list.hasClass('u-show-second-image') }
o.reduce(
function (t, data) {
var listItem = template.clone()
return this.buildProduct(listItem, data, a), t.push(listItem), t
}.bind(this),
this._result.items
)
}),
(ProductsBuilder.prototype.getSortingParam = function (sorting) {
var t = (sorting || '').split('-'),
e,
n
return {
prop: t[0] || this.list.attr('data-site-sorting-prop'),
order: t[1] || this.list.attr('data-site-sorting-order'),
}
}),
(ProductsBuilder.prototype.buildProduct = function (listItem, data, t) {
listItem.attr('data-product-id', data.id)
var e = listItem.find('.u-product-control')
if (listItem.is('.u-product-control')) e = e.add(listItem)
e.each(
function (e, el) {
var n = $(el),
i = n.find('.u-product-title-link')
if (i.length && !n.is('.u-image')) this.applyTitle(i, data)
else if (n.hasClass('u-image')) this.applyImage(n, data, t)
else if (n.hasClass('u-product-desc')) this.applyDesc(n, data)
else if (n.hasClass('u-product-full-desc'))
this.applyFullDesc(n, data)
else if (n.hasClass('u-btn')) this.applyButton(n, data)
else if (n.hasClass('u-product-price')) this.applyPrice(n, data)
else if (n.hasClass('u-product-category'))
this.applyCategories(n, data)
else if (n.hasClass('u-product-badge')) this.applyBadge(n, data)
else if (n.hasClass('u-product-sku')) this.applySku(n, data)
}.bind(this)
)
}),
(ProductsBuilder.prototype.applyTitle = function (t, data) {
if (data.title) {
t[0].innerHTML = data.title
var e = this.isCms
? data.link
: t[0].href.replace(/[^/]+$/, data.name + '.html')
t[0].href = e
}
}),
(ProductsBuilder.prototype.applyImage = function (t, data, e) {
if (data.images && data.images.length) {
var url = data.images[0].url || ''
if (!url.startsWith('http') && !url.startsWith('data:image'))
url = this.pathToRoot + url.replace(/^\/+/, '')
if (data.images[1]) {
var n = t.closest('.u-repeater-item, .u-product')
if (
(n.find('.u-product-second-image').remove(), e.showSecondImage)
) {
var i = $('<img/>'),
o = data.images[1].url || ''
if (!o.startsWith('http') && !o.startsWith('data:image'))
o = this.pathToRoot + o.replace(/^\/+/, '')
i.attr('src', o),
i.addClass('u-product-second-image'),
n.prepend(i)
}
}
var a = this.isCms
? data.link
: this.pathToRoot + 'products/' + data.name + '.html'
if (t.is('img')) {
var link
t.attr('src', url),
t.closest('.u-product-title-link').attr('href', a)
} else {
if (!url.includes('url(')) url = 'url(' + url + ')'
t.css('background-image', url), t.attr('data-href', a)
}
}
}),
(ProductsBuilder.prototype.applyDesc = function (t, data) {
if (data.description) t[0].innerHTML = data.description
}),
(ProductsBuilder.prototype.applyFullDesc = function (t, data) {
if (data.fullDescription) t[0].innerHTML = data.fullDescription
}),
(ProductsBuilder.prototype.applyButton = function (t, data) {
var e = t.attr('data-product-button-click-type')
if ('go-to-page' === e) {
var n = this.isCms
? data.link
: this.pathToRoot + 'products/' + data.name + '.html'
t.attr('href', n)
} else if ('buy-now' === e)
t.attr('data-product-id', data.id),
t.attr('data-product', JSON.stringify(data))
else t.attr('data-product', JSON.stringify(data)), t.attr('href', '#')
}),
(ProductsBuilder.prototype.applyPrice = function (t, data) {
var e = t.find('.u-price')
if (e.length)
e[0].innerHTML = Currency.format(
data.price,
data.currency,
'true' === e.closest('.u-product-price').attr('data-add-zero-cents')
)
var n = t.find('.u-old-price')
if (n.length)
n[0].innerHTML = Currency.format(
data.oldPrice,
data.currency,
'true' === n.closest('.u-product-price').attr('data-add-zero-cents')
)
}),
(ProductsBuilder.prototype.applySku = function (t, data) {
if (data.sku) t[0].innerHTML = data.sku
}),
(ProductsBuilder.prototype.applyCategories = function (t, data) {
var e = t.find('a')
if (e.length) {
var n = e.eq(0).clone()
if ((t.empty(), !data.categories || !data.categories.length))
return (
n.html('Uncategorized').attr('href', '#'), t.append(n), void 0
)
var i = this.categories
if (data.categoriesData)
data.categoriesData.forEach(function (e, index) {
this.setCategory(e, n, t, index)
}, this)
else
data.categories.forEach(function (id, index) {
var e = i.find(function (t) {
return t.id === id
})
this.setCategory(e, n, t, index)
}, this)
}
}),
(ProductsBuilder.prototype.setCategory = function (t, e, n, index) {
if (t) {
var i = e.clone()
i.removeAttr('data-category'),
i.attr('href', t.link),
i.text((index > 0 ? ', ' : '') + t.title),
n.append(i)
}
}),
(ProductsBuilder.prototype.applyBadge = function (t, data) {
var e = t.attr('data-badge-source') || 'new'
if ((t.removeClass('u-hidden-block'), 'new' === e))
t.attr('data-product-created', data.created),
t.addClass('u-hidden-block')
else {
var n = parseFloat(data.price) || 0,
i = parseFloat(data.oldPrice) || 0
if (n && i && n < i) {
var o = '-' + parseInt(100 - (100 * n) / i, 10) + '%'
t[0].innerHTML = t[0].innerHTML.replace(/-[\d]+%/, o)
} else t.addClass('u-hidden-block')
}
ProductBadge.update(t)
}),
(ProductsBuilder.prototype.getResult = function () {
return this._result
}),
(window.ProductsBuilder = ProductsBuilder)
},
12623: function (t, e) {},
148: function (t, e, n) {
'use strict'
t.exports = {
IMAGES: 'IMAGES',
DOCUMENTS: 'DOCUMENTS',
VIDEO: 'VIDEO',
AUDIO: 'AUDIO',
CUSTOM: 'CUSTOM',
}
},
17: function (t, e) {
t.exports = jQuery
},
21: function (t, e, n) {
'use strict'
t.exports = { options: { usePureJavaScript: false } }
},
212: function (t, e, n) {
'use strict'
var i = n(367),
Currency = t.exports,
o = i.reduce(function (t, e) {
return (t[e.code] = e), t
}, {})
;(Currency.format = function (t, e, n) {
if (('string' == typeof t || void 0 === t) && !t) return ''
;(e = e || 'USD'),
(t = parseFloat(t) || 0),
(this.currency = o[e] || {}),
(this.zeroCents = n),
(this.lang = this.getCurrentProcessLang()),
(this.locale = this.getLocaleByLang())
var i = this.intlFormat(t)
if (i.includes(this.currency.symbol)) return i
else return this.maskFormat(t)
}),
(Currency.intlFormat = function (t) {
var e = { currency: this.currency.code }
if (this.locale) e.style = 'currency'
if (!this.zeroCents)
(e.maximumFractionDigits = 0), (e.minimumFractionDigits = 0)
return new Intl.NumberFormat(this.locale, e).format(t)
}),
(Currency.maskFormat = function (t) {
var e
if (this.currency.mask) e = this.currency.mask
else if (this.currency.symbol) e = '{0} ' + this.currency.symbol
else e = '{0} ' + this.currency.code
return (t = this.zeroCents ? t : Math.trunc(t)), e.replace('{0}', t)
}),
(Currency.getCurrentProcessLang = function () {
var lang = $('html').attr('lang') || 'en'
if ('object' == typeof app) lang = app.lang.current.get() || lang
return lang
}),
(Currency.getLocaleByLang = function () {
var t = this.currency.locale || 'en-US',
e = this.currency.localesList || [t],
lang = this.lang,
n
return (
e.find(function (t) {
return t.includes(lang)
}) || t
)
}),
(Currency.getSymbol = function (t) {
var e = o[t] || {}
return e && e.symbol
}),
(Currency.getMask = function (t) {
var e = o[t] || {}
return e && e.mask
}),
(window.Currency = Currency)
},
224: function (t, e, n) {
'use strict'
function Accordion(link) {
;(this.selector = '.u-accordion'),
(this.activeClass = 'u-accordion-active'),
(this._paneSelector = '.u-accordion-pane'),
(this.activeSelector = '.' + this.activeClass),
(this._linkSelector = '.u-accordion-link'),
(this.activeLinkClass = 'active'),
(this.activeLinkSelector = '.' + this.activeLinkClass),
(this._isCollapsedByDefaultSelector = '.u-collapsed-by-default'),
(this._link = link),
(this._accordion = this._link.closest(this.selector))
}
;(t.exports = Accordion),
(Accordion.prototype.show = function (t) {
var link = this._link
if (link.is(this.activeLinkSelector) && !t)
return this._removeActiveLink(), this._hidePane(link), void 0
this._removeActiveLink(),
this._hidePane(link),
this._addActiveLink(link),
this._activatePane(link)
}),
(Accordion.prototype._removeActiveLink = function () {
var t = this._getActiveLink()
t.removeClass(this.activeLinkClass), t.attr('aria-selected', false)
}),
(Accordion.prototype._getActiveLink = function () {
return this._accordion.find(this.activeLinkSelector)
}),
(Accordion.prototype._addActiveLink = function (link) {
link.addClass(this.activeLinkClass), link.attr('aria-selected', true)
}),
(Accordion.prototype._activatePane = function (link) {
var pane
this._accordion.find(this.activeSelector).removeClass(this.activeClass),
this._getPane(link).addClass(this.activeClass)
}),
(Accordion.prototype._getPane = function (link) {
return link.siblings(this._paneSelector)
}),
(Accordion.prototype._hidePane = function (link) {
var pane
this._getPane(link).removeClass(this.activeClass)
}),
(Accordion.prototype.closeAll = function () {
this._accordion
.find(this._linkSelector + this.activeLinkSelector)
.removeClass(this.activeLinkClass)
.attr('aria-selected', false),
this._accordion
.find(this._paneSelector + this.activeSelector)
.removeClass(this.activeClass)
}),
(Accordion.prototype.isCollapsedByDefault = function () {
return this._accordion.is(this._isCollapsedByDefaultSelector)
})
},
24: function (t, e, n) {
'use strict'
;(function (e, i, o, a) {
function s(t) {
if (!(8 === t || 16 === t || 24 === t || 32 === t))
throw new Error('Only 8, 16, 24, or 32 bits supported: ' + t)
}
function u(t) {
if (((this.data = ''), (this.read = 0), 'string' == typeof t))
this.data = t
else if (util.isArrayBuffer(t) || util.isArrayBufferView(t))
if (void 0 !== a && t instanceof a) this.data = t.toString('binary')
else {
var e = new Uint8Array(t)
try {
this.data = String.fromCharCode.apply(null, e)
} catch (t) {
for (var n = 0; n < e.length; ++n) this.putByte(e[n])
}
}
else if (
t instanceof u ||
('object' == typeof t &&
'string' == typeof t.data &&
'number' == typeof t.read)
)
(this.data = t.data), (this.read = t.read)
this._constructedStringLength = 0
}
function l(t, e) {
;(e = e || {}),
(this.read = e.readOffset || 0),
(this.growSize = e.growSize || 1024)
var n = util.isArrayBuffer(t),
i = util.isArrayBufferView(t)
if (n || i) {
if (n) this.data = new DataView(t)
else this.data = new DataView(t.buffer, t.byteOffset, t.byteLength)
return (
(this.write =
'writeOffset' in e ? e.writeOffset : this.data.byteLength),
void 0
)
}
if (
((this.data = new DataView(new ArrayBuffer(0))),
(this.write = 0),
null != t)
)
this.putBytes(t)
if ('writeOffset' in e) this.write = e.writeOffset
}
var c = n(21),
f = n(543),
util = (t.exports = c.util = c.util || {})
!(function () {
if (void 0 === e || !e.nextTick || e.browser) {
if ('function' == typeof i)
return (
(util.setImmediate = function () {
return i.apply(void 0, arguments)
}),
(util.nextTick = function (t) {
return i(t)
}),
void 0
)
if (
((util.setImmediate = function (t) {
setTimeout(t, 0)
}),
'undefined' != typeof window &&
'function' == typeof window.postMessage)
) {
var t = 'forge.setImmediate',
n = []
function e(e) {
if (e.source === window && e.data === t) {
e.stopPropagation()
var copy = n.slice()
;(n.length = 0),
copy.forEach(function (t) {
t()
})
}
}
;(util.setImmediate = function (e) {
if ((n.push(e), 1 === n.length)) window.postMessage(t, '*')
}),
window.addEventListener('message', e, true)
}
if ('undefined' != typeof MutationObserver) {
var o = Date.now(),
a = true,
s = document.createElement('div'),
n = []
new MutationObserver(function () {
var copy = n.slice()
;(n.length = 0),
copy.forEach(function (t) {
t()
})
}).observe(s, { attributes: true })
var u = util.setImmediate
util.setImmediate = function (t) {
if (Date.now() - o > 15) (o = Date.now()), u(t)
else if ((n.push(t), 1 === n.length))
s.setAttribute('a', (a = !a))
}
}
util.nextTick = util.setImmediate
} else if (((util.nextTick = e.nextTick), 'function' == typeof i))
util.setImmediate = i
else util.setImmediate = util.nextTick
})(),
(util.isNodejs = void 0 !== e && e.versions && e.versions.node),
(util.globalScope = (function () {
if (util.isNodejs) return o
else return 'undefined' == typeof self ? window : self
})()),
(util.isArray =
Array.isArray ||
function (t) {
return '[object Array]' === Object.prototype.toString.call(t)
}),
(util.isArrayBuffer = function (t) {
return 'undefined' != typeof ArrayBuffer && t instanceof ArrayBuffer
}),
(util.isArrayBufferView = function (t) {
return t && util.isArrayBuffer(t.buffer) && void 0 !== t.byteLength
}),
(util.ByteBuffer = u),
(util.ByteStringBuffer = u)
var h = 4096
;(util.ByteStringBuffer.prototype._optimizeConstructedString = function (
t
) {
if (
((this._constructedStringLength += t),
this._constructedStringLength > h)
)
this.data.substr(0, 1), (this._constructedStringLength = 0)
}),
(util.ByteStringBuffer.prototype.length = function () {
return this.data.length - this.read
}),
(util.ByteStringBuffer.prototype.isEmpty = function () {
return this.length() <= 0
}),
(util.ByteStringBuffer.prototype.putByte = function (t) {
return this.putBytes(String.fromCharCode(t))
}),
(util.ByteStringBuffer.prototype.fillWithByte = function (t, e) {
t = String.fromCharCode(t)
for (var d = this.data; e > 0; ) {
if (1 & e) d += t
if ((e >>>= 1) > 0) t += t
}
return (this.data = d), this._optimizeConstructedString(e), this
}),
(util.ByteStringBuffer.prototype.putBytes = function (t) {
return (
(this.data += t), this._optimizeConstructedString(t.length), this
)
}),
(util.ByteStringBuffer.prototype.putString = function (t) {
return this.putBytes(util.encodeUtf8(t))
}),
(util.ByteStringBuffer.prototype.putInt16 = function (t) {
return this.putBytes(
String.fromCharCode((t >> 8) & 255) + String.fromCharCode(255 & t)
)
}),
(util.ByteStringBuffer.prototype.putInt24 = function (t) {
return this.putBytes(
String.fromCharCode((t >> 16) & 255) +
String.fromCharCode((t >> 8) & 255) +
String.fromCharCode(255 & t)
)
}),
(util.ByteStringBuffer.prototype.putInt32 = function (t) {
return this.putBytes(
String.fromCharCode((t >> 24) & 255) +
String.fromCharCode((t >> 16) & 255) +
String.fromCharCode((t >> 8) & 255) +
String.fromCharCode(255 & t)
)
}),
(util.ByteStringBuffer.prototype.putInt16Le = function (t) {
return this.putBytes(
String.fromCharCode(255 & t) + String.fromCharCode((t >> 8) & 255)
)
}),
(util.ByteStringBuffer.prototype.putInt24Le = function (t) {
return this.putBytes(
String.fromCharCode(255 & t) +
String.fromCharCode((t >> 8) & 255) +
String.fromCharCode((t >> 16) & 255)
)
}),
(util.ByteStringBuffer.prototype.putInt32Le = function (t) {
return this.putBytes(
String.fromCharCode(255 & t) +
String.fromCharCode((t >> 8) & 255) +
String.fromCharCode((t >> 16) & 255) +
String.fromCharCode((t >> 24) & 255)
)
}),
(util.ByteStringBuffer.prototype.putInt = function (t, e) {
s(e)
var n = ''
do {
;(e -= 8), (n += String.fromCharCode((t >> e) & 255))
} while (e > 0)
return this.putBytes(n)
}),
(util.ByteStringBuffer.prototype.putSignedInt = function (t, e) {
if (t < 0) t += 2 << (e - 1)
return this.putInt(t, e)
}),
(util.ByteStringBuffer.prototype.putBuffer = function (t) {
return this.putBytes(t.getBytes())
}),
(util.ByteStringBuffer.prototype.getByte = function () {
return this.data.charCodeAt(this.read++)
}),
(util.ByteStringBuffer.prototype.getInt16 = function () {
var t =
(this.data.charCodeAt(this.read) << 8) ^
this.data.charCodeAt(this.read + 1)
return (this.read += 2), t
}),
(util.ByteStringBuffer.prototype.getInt24 = function () {
var t =
(this.data.charCodeAt(this.read) << 16) ^
(this.data.charCodeAt(this.read + 1) << 8) ^
this.data.charCodeAt(this.read + 2)
return (this.read += 3), t
}),
(util.ByteStringBuffer.prototype.getInt32 = function () {
var t =
(this.data.charCodeAt(this.read) << 24) ^
(this.data.charCodeAt(this.read + 1) << 16) ^
(this.data.charCodeAt(this.read + 2) << 8) ^
this.data.charCodeAt(this.read + 3)
return (this.read += 4), t
}),
(util.ByteStringBuffer.prototype.getInt16Le = function () {
var t =
this.data.charCodeAt(this.read) ^
(this.data.charCodeAt(this.read + 1) << 8)
return (this.read += 2), t
}),
(util.ByteStringBuffer.prototype.getInt24Le = function () {
var t =
this.data.charCodeAt(this.read) ^
(this.data.charCodeAt(this.read + 1) << 8) ^
(this.data.charCodeAt(this.read + 2) << 16)
return (this.read += 3), t
}),
(util.ByteStringBuffer.prototype.getInt32Le = function () {
var t =
this.data.charCodeAt(this.read) ^
(this.data.charCodeAt(this.read + 1) << 8) ^
(this.data.charCodeAt(this.read + 2) << 16) ^
(this.data.charCodeAt(this.read + 3) << 24)
return (this.read += 4), t
}),
(util.ByteStringBuffer.prototype.getInt = function (t) {
s(t)
var e = 0
do {
;(e = (e << 8) + this.data.charCodeAt(this.read++)), (t -= 8)
} while (t > 0)
return e
}),
(util.ByteStringBuffer.prototype.getSignedInt = function (t) {
var e = this.getInt(t),
n = 2 << (t - 2)
if (e >= n) e -= n << 1
return e
}),
(util.ByteStringBuffer.prototype.getBytes = function (t) {
var e
if (t)
(t = Math.min(this.length(), t)),
(e = this.data.slice(this.read, this.read + t)),
(this.read += t)
else if (0 === t) e = ''
else
(e = 0 === this.read ? this.data : this.data.slice(this.read)),
this.clear()
return e
}),
(util.ByteStringBuffer.prototype.bytes = function (t) {
return void 0 === t
? this.data.slice(this.read)
: this.data.slice(this.read, this.read + t)
}),
(util.ByteStringBuffer.prototype.at = function (t) {
return this.data.charCodeAt(this.read + t)
}),
(util.ByteStringBuffer.prototype.setAt = function (t, e) {
return (
(this.data =
this.data.substr(0, this.read + t) +
String.fromCharCode(e) +
this.data.substr(this.read + t + 1)),
this
)
}),
(util.ByteStringBuffer.prototype.last = function () {
return this.data.charCodeAt(this.data.length - 1)
}),
(util.ByteStringBuffer.prototype.copy = function () {
var t = util.createBuffer(this.data)
return (t.read = this.read), t
}),
(util.ByteStringBuffer.prototype.compact = function () {
if (this.read > 0)
(this.data = this.data.slice(this.read)), (this.read = 0)
return this
}),
(util.ByteStringBuffer.prototype.clear = function () {
return (this.data = ''), (this.read = 0), this
}),
(util.ByteStringBuffer.prototype.truncate = function (t) {
var e = Math.max(0, this.length() - t)
return (
(this.data = this.data.substr(this.read, e)), (this.read = 0), this
)
}),
(util.ByteStringBuffer.prototype.toHex = function () {
for (var t = '', e = this.read; e < this.data.length; ++e) {
var n = this.data.charCodeAt(e)
if (n < 16) t += '0'
t += n.toString(16)
}
return t
}),
(util.ByteStringBuffer.prototype.toString = function () {
return util.decodeUtf8(this.bytes())
}),
(util.DataBuffer = l),
(util.DataBuffer.prototype.length = function () {
return this.write - this.read
}),
(util.DataBuffer.prototype.isEmpty = function () {
return this.length() <= 0
}),
(util.DataBuffer.prototype.accommodate = function (t, e) {
if (this.length() >= t) return this
e = Math.max(e || this.growSize, t)
var n = new Uint8Array(
this.data.buffer,
this.data.byteOffset,
this.data.byteLength
),
i = new Uint8Array(this.length() + e)
return i.set(n), (this.data = new DataView(i.buffer)), this
}),
(util.DataBuffer.prototype.putByte = function (t) {
return this.accommodate(1), this.data.setUint8(this.write++, t), this
}),
(util.DataBuffer.prototype.fillWithByte = function (t, e) {
this.accommodate(e)
for (var n = 0; n < e; ++n) this.data.setUint8(t)
return this
}),
(util.DataBuffer.prototype.putBytes = function (t, e) {
if (util.isArrayBufferView(t)) {
var n,
i =
(n = new Uint8Array(t.buffer, t.byteOffset, t.byteLength))
.byteLength - n.byteOffset,
o
return (
this.accommodate(i),
(o = new Uint8Array(this.data.buffer, this.write)).set(n),
(this.write += i),
this
)
}
if (util.isArrayBuffer(t)) {
var n = new Uint8Array(t),
o
return (
this.accommodate(n.byteLength),
(o = new Uint8Array(this.data.buffer)).set(n, this.write),
(this.write += n.byteLength),
this
)
}
if (
t instanceof util.DataBuffer ||
('object' == typeof t &&
'number' == typeof t.read &&
'number' == typeof t.write &&
util.isArrayBufferView(t.data))
) {
var n = new Uint8Array(t.data.byteLength, t.read, t.length()),
o
return (
this.accommodate(n.byteLength),
(o = new Uint8Array(t.data.byteLength, this.write)).set(n),
(this.write += n.byteLength),
this
)
}
if (t instanceof util.ByteStringBuffer) (t = t.data), (e = 'binary')
if (((e = e || 'binary'), 'string' == typeof t)) {
var view
if ('hex' === e)
return (
this.accommodate(Math.ceil(t.length / 2)),
(view = new Uint8Array(this.data.buffer, this.write)),
(this.write += util.binary.hex.decode(t, view, this.write)),
this
)
if ('base64' === e)
return (
this.accommodate(3 * Math.ceil(t.length / 4)),
(view = new Uint8Array(this.data.buffer, this.write)),
(this.write += util.binary.base64.decode(t, view, this.write)),
this
)
if ('utf8' === e) (t = util.encodeUtf8(t)), (e = 'binary')
if ('binary' === e || 'raw' === e)
return (
this.accommodate(t.length),
(view = new Uint8Array(this.data.buffer, this.write)),
(this.write += util.binary.raw.decode(view)),
this
)
if ('utf16' === e)
return (
this.accommodate(2 * t.length),
(view = new Uint16Array(this.data.buffer, this.write)),
(this.write += util.text.utf16.encode(view)),
this
)
throw new Error('Invalid encoding: ' + e)
}
throw Error('Invalid parameter: ' + t)
}),
(util.DataBuffer.prototype.putBuffer = function (t) {
return this.putBytes(t), t.clear(), this
}),
(util.DataBuffer.prototype.putString = function (t) {
return this.putBytes(t, 'utf16')
}),
(util.DataBuffer.prototype.putInt16 = function (t) {
return (
this.accommodate(2),
this.data.setInt16(this.write, t),
(this.write += 2),
this
)
}),
(util.DataBuffer.prototype.putInt24 = function (t) {
return (
this.accommodate(3),
this.data.setInt16(this.write, (t >> 8) & 65535),
this.data.setInt8(this.write, (t >> 16) & 255),
(this.write += 3),
this
)
}),
(util.DataBuffer.prototype.putInt32 = function (t) {
return (
this.accommodate(4),
this.data.setInt32(this.write, t),
(this.write += 4),
this
)
}),
(util.DataBuffer.prototype.putInt16Le = function (t) {
return (
this.accommodate(2),
this.data.setInt16(this.write, t, true),
(this.write += 2),
this
)
}),
(util.DataBuffer.prototype.putInt24Le = function (t) {
return (
this.accommodate(3),
this.data.setInt8(this.write, (t >> 16) & 255),
this.data.setInt16(this.write, (t >> 8) & 65535, true),
(this.write += 3),
this
)
}),
(util.DataBuffer.prototype.putInt32Le = function (t) {
return (
this.accommodate(4),
this.data.setInt32(this.write, t, true),
(this.write += 4),
this
)
}),
(util.DataBuffer.prototype.putInt = function (t, e) {
s(e), this.accommodate(e / 8)
do {
;(e -= 8), this.data.setInt8(this.write++, (t >> e) & 255)
} while (e > 0)
return this
}),
(util.DataBuffer.prototype.putSignedInt = function (t, e) {
if ((s(e), this.accommodate(e / 8), t < 0)) t += 2 << (e - 1)
return this.putInt(t, e)
}),
(util.DataBuffer.prototype.getByte = function () {
return this.data.getInt8(this.read++)
}),
(util.DataBuffer.prototype.getInt16 = function () {
var t = this.data.getInt16(this.read)
return (this.read += 2), t
}),
(util.DataBuffer.prototype.getInt24 = function () {
var t =
(this.data.getInt16(this.read) << 8) ^
this.data.getInt8(this.read + 2)
return (this.read += 3), t
}),
(util.DataBuffer.prototype.getInt32 = function () {
var t = this.data.getInt32(this.read)
return (this.read += 4), t
}),
(util.DataBuffer.prototype.getInt16Le = function () {
var t = this.data.getInt16(this.read, true)
return (this.read += 2), t
}),
(util.DataBuffer.prototype.getInt24Le = function () {
var t =
this.data.getInt8(this.read) ^
(this.data.getInt16(this.read + 1, true) << 8)
return (this.read += 3), t
}),
(util.DataBuffer.prototype.getInt32Le = function () {
var t = this.data.getInt32(this.read, true)
return (this.read += 4), t
}),
(util.DataBuffer.prototype.getInt = function (t) {
s(t)
var e = 0
do {
;(e = (e << 8) + this.data.getInt8(this.read++)), (t -= 8)
} while (t > 0)
return e
}),
(util.DataBuffer.prototype.getSignedInt = function (t) {
var e = this.getInt(t),
n = 2 << (t - 2)
if (e >= n) e -= n << 1
return e
}),
(util.DataBuffer.prototype.getBytes = function (t) {
var e
if (t)
(t = Math.min(this.length(), t)),
(e = this.data.slice(this.read, this.read + t)),
(this.read += t)
else if (0 === t) e = ''
else
(e = 0 === this.read ? this.data : this.data.slice(this.read)),
this.clear()
return e
}),
(util.DataBuffer.prototype.bytes = function (t) {
return void 0 === t
? this.data.slice(this.read)
: this.data.slice(this.read, this.read + t)
}),
(util.DataBuffer.prototype.at = function (t) {
return this.data.getUint8(this.read + t)
}),
(util.DataBuffer.prototype.setAt = function (t, e) {
return this.data.setUint8(t, e), this
}),
(util.DataBuffer.prototype.last = function () {
return this.data.getUint8(this.write - 1)
}),
(util.DataBuffer.prototype.copy = function () {
return new util.DataBuffer(this)
}),
(util.DataBuffer.prototype.compact = function () {
if (this.read > 0) {
var t = new Uint8Array(this.data.buffer, this.read),
e = new Uint8Array(t.byteLength)
e.set(t),
(this.data = new DataView(e)),
(this.write -= this.read),
(this.read = 0)
}
return this
}),
(util.DataBuffer.prototype.clear = function () {
return (
(this.data = new DataView(new ArrayBuffer(0))),
(this.read = this.write = 0),
this
)
}),
(util.DataBuffer.prototype.truncate = function (t) {
return (
(this.write = Math.max(0, this.length() - t)),
(this.read = Math.min(this.read, this.write)),
this
)
}),
(util.DataBuffer.prototype.toHex = function () {
for (var t = '', e = this.read; e < this.data.byteLength; ++e) {
var n = this.data.getUint8(e)
if (n < 16) t += '0'
t += n.toString(16)
}
return t
}),
(util.DataBuffer.prototype.toString = function (t) {
var view = new Uint8Array(this.data, this.read, this.length())
if ('binary' === (t = t || 'utf8') || 'raw' === t)
return util.binary.raw.encode(view)
if ('hex' === t) return util.binary.hex.encode(view)
if ('base64' === t) return util.binary.base64.encode(view)
if ('utf8' === t) return util.text.utf8.decode(view)
if ('utf16' === t) return util.text.utf16.decode(view)
throw new Error('Invalid encoding: ' + t)
}),
(util.createBuffer = function (input, t) {
if (((t = t || 'raw'), void 0 !== input && 'utf8' === t))
input = util.encodeUtf8(input)
return new util.ByteBuffer(input)
}),
(util.fillString = function (t, e) {
for (var n = ''; e > 0; ) {
if (1 & e) n += t
if ((e >>>= 1) > 0) t += t
}
return n
}),
(util.xorBytes = function (t, e, n) {
for (var i = '', o = '', a = '', s = 0, u = 0; n > 0; --n, ++s) {
if (((o = t.charCodeAt(s) ^ e.charCodeAt(s)), u >= 10))
(i += a), (a = ''), (u = 0)
;(a += String.fromCharCode(o)), ++u
}
return (i += a)
}),
(util.hexToBytes = function (t) {
var e = '',
n = 0
if (t.length & (1 == 1))
(n = 1), (e += String.fromCharCode(parseInt(t[0], 16)))
for (; n < t.length; n += 2)
e += String.fromCharCode(parseInt(t.substr(n, 2), 16))
return e
}),
(util.bytesToHex = function (t) {
return util.createBuffer(t).toHex()
}),
(util.int32ToBytes = function (t) {
return (
String.fromCharCode((t >> 24) & 255) +
String.fromCharCode((t >> 16) & 255) +
String.fromCharCode((t >> 8) & 255) +
String.fromCharCode(255 & t)
)
})
var p =
'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=',
m = [
62, -1, -1, -1, 63, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, -1, -1,
-1, 64, -1, -1, -1, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14,
15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, -1, -1, -1, -1, -1, -1,
26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42,
43, 44, 45, 46, 47, 48, 49, 50, 51,
],
g = '123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz'
;(util.encode64 = function (input, t) {
for (var line = '', e = '', n, i, o, a = 0; a < input.length; ) {
if (
((n = input.charCodeAt(a++)),
(i = input.charCodeAt(a++)),
(o = input.charCodeAt(a++)),
(line += p.charAt(n >> 2)),
(line += p.charAt(((3 & n) << 4) | (i >> 4))),
isNaN(i))
)
line += '=='
else
(line += p.charAt(((15 & i) << 2) | (o >> 6))),
(line += isNaN(o) ? '=' : p.charAt(63 & o))
if (t && line.length > t)
(e += line.substr(0, t) + '\r\n'), (line = line.substr(t))
}
return (e += line)
}),
(util.decode64 = function (input) {
input = input.replace(/[^A-Za-z0-9\+\/\=]/g, '')
for (var t = '', e, n, i, o, a = 0; a < input.length; )
if (
((e = m[input.charCodeAt(a++) - 43]),
(n = m[input.charCodeAt(a++) - 43]),
(i = m[input.charCodeAt(a++) - 43]),
(o = m[input.charCodeAt(a++) - 43]),
(t += String.fromCharCode((e << 2) | (n >> 4))),
64 !== i)
)
if (
((t += String.fromCharCode(((15 & n) << 4) | (i >> 2))),
64 !== o)
)
t += String.fromCharCode(((3 & i) << 6) | o)
return t
}),
(util.encodeUtf8 = function (t) {
return unescape(encodeURIComponent(t))
}),
(util.decodeUtf8 = function (t) {
return decodeURIComponent(escape(t))
}),
(util.binary = {
raw: {},
hex: {},
base64: {},
base58: {},
baseN: { encode: f.encode, decode: f.decode },
}),
(util.binary.raw.encode = function (t) {
return String.fromCharCode.apply(null, t)
}),
(util.binary.raw.decode = function (t, e, n) {
var i = e
if (!i) i = new Uint8Array(t.length)
for (var o = (n = n || 0), a = 0; a < t.length; ++a)
i[o++] = t.charCodeAt(a)
return e ? o - n : i
}),
(util.binary.hex.encode = util.bytesToHex),
(util.binary.hex.decode = function (t, e, n) {
var i = e
if (!i) i = new Uint8Array(Math.ceil(t.length / 2))
var o = 0,
a = (n = n || 0)
if (1 & t.length) (o = 1), (i[a++] = parseInt(t[0], 16))
for (; o < t.length; o += 2) i[a++] = parseInt(t.substr(o, 2), 16)
return e ? a - n : i
}),
(util.binary.base64.encode = function (input, t) {
for (var line = '', e = '', n, i, o, a = 0; a < input.byteLength; ) {
if (
((n = input[a++]),
(i = input[a++]),
(o = input[a++]),
(line += p.charAt(n >> 2)),
(line += p.charAt(((3 & n) << 4) | (i >> 4))),
isNaN(i))
)
line += '=='
else
(line += p.charAt(((15 & i) << 2) | (o >> 6))),
(line += isNaN(o) ? '=' : p.charAt(63 & o))
if (t && line.length > t)
(e += line.substr(0, t) + '\r\n'), (line = line.substr(t))
}
return (e += line)
}),
(util.binary.base64.decode = function (input, t, e) {
var n = t,
i,
o,
a,
s
if (!n) n = new Uint8Array(3 * Math.ceil(input.length / 4))
input = input.replace(/[^A-Za-z0-9\+\/\=]/g, '')
for (var u = 0, l = (e = e || 0); u < input.length; )
if (
((i = m[input.charCodeAt(u++) - 43]),
(o = m[input.charCodeAt(u++) - 43]),
(a = m[input.charCodeAt(u++) - 43]),
(s = m[input.charCodeAt(u++) - 43]),
(n[l++] = (i << 2) | (o >> 4)),
64 !== a)
)
if (((n[l++] = ((15 & o) << 4) | (a >> 2)), 64 !== s))
n[l++] = ((3 & a) << 6) | s
return t ? l - e : n.subarray(0, l)
}),
(util.binary.base58.encode = function (input, t) {
return util.binary.baseN.encode(input, g, t)
}),
(util.binary.base58.decode = function (input, t) {
return util.binary.baseN.decode(input, g, t)
}),
(util.text = { utf8: {}, utf16: {} }),
(util.text.utf8.encode = function (t, e, n) {
t = util.encodeUtf8(t)
var i = e
if (!i) i = new Uint8Array(t.length)
for (var o = (n = n || 0), a = 0; a < t.length; ++a)
i[o++] = t.charCodeAt(a)
return e ? o - n : i
}),
(util.text.utf8.decode = function (t) {
return util.decodeUtf8(String.fromCharCode.apply(null, t))
}),
(util.text.utf16.encode = function (t, e, n) {
var i = e
if (!i) i = new Uint8Array(2 * t.length)
for (
var view = new Uint16Array(i.buffer),
o = (n = n || 0),
a = n,
s = 0;
s < t.length;
++s
)
(view[a++] = t.charCodeAt(s)), (o += 2)
return e ? o - n : i
}),
(util.text.utf16.decode = function (t) {
return String.fromCharCode.apply(null, new Uint16Array(t.buffer))
}),
(util.deflate = function (t, e, n) {
if (((e = util.decode64(t.deflate(util.encode64(e)).rval)), n)) {
var i = 2,
o
if (32 & e.charCodeAt(1)) i = 6
e = e.substring(i, e.length - 4)
}
return e
}),
(util.inflate = function (t, e, n) {
var i = t.inflate(util.encode64(e)).rval
return null === i ? null : util.decode64(i)
})
var v = function (t, id, e) {
if (!t) throw new Error('WebStorage not available.')
var n
if (null === e) n = t.removeItem(id)
else (e = util.encode64(JSON.stringify(e))), (n = t.setItem(id, e))
if (void 0 !== n && true !== n.rval) {
var i = new Error(n.error.message)
throw ((i.id = n.error.id), (i.name = n.error.name), i)
}
},
y = function (t, id) {
if (!t) throw new Error('WebStorage not available.')
var e = t.getItem(id)
if (t.init)
if (null === e.rval) {
if (e.error) {
var n = new Error(e.error.message)
throw ((n.id = e.error.id), (n.name = e.error.name), n)
}
e = null
} else e = e.rval
if (null !== e) e = JSON.parse(util.decode64(e))
return e
},
w = function (t, id, e, data) {
var n = y(t, id)
if (null === n) n = {}
;(n[e] = data), v(t, id, n)
},
b = function (t, id, e) {
var n = y(t, id)
if (null !== n) n = e in n ? n[e] : null
return n
},
C = function (t, id, e) {
var n = y(t, id)
if (null !== n && e in n) {
delete n[e]
var empty = true
for (var i in n) {
empty = false
break
}
if (empty) n = null
v(t, id, n)
}
},
S = function (t, id) {
v(t, id, null)
},
x = function (t, e, n) {
var i = null,
type
if (void 0 === n) n = ['web', 'flash']
var o = false,
a = null
for (var s in n) {
type = n[s]
try {
if ('flash' === type || 'both' === type) {
if (null === e[0])
throw new Error('Flash local storage not available.')
;(i = t.apply(this, e)), (o = 'flash' === type)
}
if ('web' === type || 'both' === type)
(e[0] = localStorage), (i = t.apply(this, e)), (o = true)
} catch (t) {
a = t
}
if (o) break
}
if (!o) throw a
return i
}
;(util.setItem = function (t, id, e, data, n) {
x(w, arguments, n)
}),
(util.getItem = function (t, id, e, n) {
return x(b, arguments, n)
}),
(util.removeItem = function (t, id, e, n) {
x(C, arguments, n)
}),
(util.clearItems = function (t, id, e) {
x(S, arguments, e)
}),
(util.isEmpty = function (t) {
for (var e in t) if (t.hasOwnProperty(e)) return false
return true
}),
(util.format = function (format) {
for (
var t = /%./g, e, n, i = 0, o = [], a = 0;
(e = t.exec(format));
) {
if ((n = format.substring(a, t.lastIndex - 2)).length > 0) o.push(n)
a = t.lastIndex
var s = e[0][1]
switch (s) {
case 's':
case 'o':
if (i < arguments.length) o.push(arguments[i++ + 1])
else o.push('<?>')
break
case '%':
o.push('%')
break
default:
o.push('<%' + s + '?>')
}
}
return o.push(format.substring(a)), o.join('')
}),
(util.formatNumber = function (t, e, n, i) {
var o = t,
a = isNaN((e = Math.abs(e))) ? 2 : e,
d = void 0 === n ? ',' : n,
s = void 0 === i ? '.' : i,
u = o < 0 ? '-' : '',
l = parseInt((o = Math.abs(+o || 0).toFixed(a)), 10) + '',
c = l.length > 3 ? l.length % 3 : 0
return (
u +
(c ? l.substr(0, c) + s : '') +
l.substr(c).replace(/(\d{3})(?=\d)/g, '$1' + s) +
(a
? d +
Math.abs(o - l)
.toFixed(a)
.slice(2)
: '')
)
}),
(util.formatSize = function (size) {
if (size >= 1073741824)
size = util.formatNumber(size / 1073741824, 2, '.', '') + ' GiB'
else if (size >= 1048576)
size = util.formatNumber(size / 1048576, 2, '.', '') + ' MiB'
else if (size >= 1024)
size = util.formatNumber(size / 1024, 0) + ' KiB'
else size = util.formatNumber(size, 0) + ' bytes'
return size
}),
(util.bytesFromIP = function (t) {
if (-1 !== t.indexOf('.')) return util.bytesFromIPv4(t)
if (-1 !== t.indexOf(':')) return util.bytesFromIPv6(t)
else return null
}),
(util.bytesFromIPv4 = function (t) {
if (4 !== (t = t.split('.')).length) return null
for (var e = util.createBuffer(), n = 0; n < t.length; ++n) {
var i = parseInt(t[n], 10)
if (isNaN(i)) return null
e.putByte(i)
}
return e.getBytes()
}),
(util.bytesFromIPv6 = function (t) {
for (
var e = 0,
n =
2 *
(8 -
(t = t.split(':').filter(function (t) {
if (0 === t.length) ++e
return true
})).length +
e),
i = util.createBuffer(),
o = 0;
o < 8;
++o
)
if (t[o] && 0 !== t[o].length) {
var a = util.hexToBytes(t[o])
if (a.length < 2) i.putByte(0)
i.putBytes(a)
} else i.fillWithByte(0, n), (n = 0)
return i.getBytes()
}),
(util.bytesToIP = function (t) {
if (4 === t.length) return util.bytesToIPv4(t)
if (16 === t.length) return util.bytesToIPv6(t)
else return null
}),
(util.bytesToIPv4 = function (t) {
if (4 !== t.length) return null
for (var e = [], n = 0; n < t.length; ++n) e.push(t.charCodeAt(n))
return e.join('.')
}),
(util.bytesToIPv6 = function (t) {
if (16 !== t.length) return null
for (var e = [], n = [], i = 0, o = 0; o < t.length; o += 2) {
for (
var a = util.bytesToHex(t[o] + t[o + 1]);
'0' === a[0] && '0' !== a;
)
a = a.substr(1)
if ('0' === a) {
var s = n[n.length - 1],
u = e.length
if (!s || u !== s.end + 1) n.push({ start: u, end: u })
else if (((s.end = u), s.end - s.start > n[i].end - n[i].start))
i = n.length - 1
}
e.push(a)
}
if (n.length > 0) {
var group = n[i]
if (group.end - group.start > 0) {
if (
(e.splice(group.start, group.end - group.start + 1, ''),
0 === group.start)
)
e.unshift('')
if (7 === group.end) e.push('')
}
}
return e.join(':')
}),
(util.estimateCores = function (t, e) {
function n(t, a, s) {
if (0 === a) {
var u = Math.floor(
t.reduce(function (t, e) {
return t + e
}, 0) / t.length
)
return (
(util.cores = Math.max(1, u)),
URL.revokeObjectURL(o),
e(null, util.cores)
)
}
map(s, function (e, o) {
t.push(i(s, o)), n(t, a - 1, s)
})
}
function map(t, e) {
for (var n = [], i = [], a = 0; a < t; ++a) {
var worker = new Worker(o)
worker.addEventListener('message', function (o) {
if ((i.push(o.data), i.length === t)) {
for (var a = 0; a < t; ++a) n[a].terminate()
e(null, i)
}
}),
n.push(worker)
}
for (var a = 0; a < t; ++a) n[a].postMessage(a)
}
function i(t, e) {
for (var n = [], i = 0; i < t; ++i)
for (var o = e[i], overlap = (n[i] = []), a = 0; a < t; ++a)
if (i !== a) {
var s = e[a]
if (
(o.st > s.st && o.st < s.et) ||
(s.st > o.st && s.st < o.et)
)
overlap.push(a)
}
return n.reduce(function (t, overlap) {
return Math.max(t, overlap.length)
}, 0)
}
if ('function' == typeof t) (e = t), (t = {})
if (((t = t || {}), 'cores' in util && !t.update))
return e(null, util.cores)
if (
'undefined' != typeof navigator &&
'hardwareConcurrency' in navigator &&
navigator.hardwareConcurrency > 0
)
return (
(util.cores = navigator.hardwareConcurrency), e(null, util.cores)
)
if ('undefined' == typeof Worker)
return (util.cores = 1), e(null, util.cores)
if ('undefined' == typeof Blob)
return (util.cores = 2), e(null, util.cores)
var o = URL.createObjectURL(
new Blob(
[
'(',
function () {
self.addEventListener('message', function (t) {
for (var e = Date.now(), et = e + 4; Date.now() < et; );
self.postMessage({ st: e, et: et })
})
}.toString(),
')()',
],
{ type: 'application/javascript' }
)
)
n([], 5, 16)
})
}).call(e, n(116), n(262).setImmediate, n(60), n(62).Buffer)
},
262: function (t, e, n) {
'use strict'
;(function (t) {
function i(id, t) {
;(this._id = id), (this._clearFn = t)
}
var o =
(void 0 !== t && t) || ('undefined' != typeof self && self) || window,
a = Function.prototype.apply
;(e.setTimeout = function () {
return new i(a.call(setTimeout, o, arguments), clearTimeout)
}),
(e.setInterval = function () {
return new i(a.call(setInterval, o, arguments), clearInterval)
}),
(e.clearTimeout = e.clearInterval =
function (t) {
if (t) t.close()
}),
(i.prototype.unref = i.prototype.ref = function () {}),
(i.prototype.close = function () {
this._clearFn.call(o, this._id)
}),
(e.enroll = function (t, e) {
clearTimeout(t._idleTimeoutId), (t._idleTimeout = e)
}),
(e.unenroll = function (t) {
clearTimeout(t._idleTimeoutId), (t._idleTimeout = -1)
}),
(e._unrefActive = e.active =
function (t) {
clearTimeout(t._idleTimeoutId)
var e = t._idleTimeout
if (e >= 0)
t._idleTimeoutId = setTimeout(function e() {
if (t._onTimeout) t._onTimeout()
}, e)
}),
n(541),
(e.setImmediate =
('undefined' != typeof self && self.setImmediate) ||
(void 0 !== t && t.setImmediate) ||
(this && this.setImmediate)),
(e.clearImmediate =
('undefined' != typeof self && self.clearImmediate) ||
(void 0 !== t && t.clearImmediate) ||
(this && this.clearImmediate))
}).call(e, n(60))
},
264: function (t, e, n) {
'use strict'
function i() {
;(u = String.fromCharCode(128)),
(u += a.util.fillString(String.fromCharCode(0), 64)),
(c = [
1116352408, 1899447441, 3049323471, 3921009573, 961987163, 1508970993,
2453635748, 2870763221, 3624381080, 310598401, 607225278, 1426881987,
1925078388, 2162078206, 2614888103, 3248222580, 3835390401,
4022224774, 264347078, 604807628, 770255983, 1249150122, 1555081692,
1996064986, 2554220882, 2821834349, 2952996808, 3210313671,
3336571891, 3584528711, 113926993, 338241895, 666307205, 773529912,
1294757372, 1396182291, 1695183700, 1986661051, 2177026350,
2456956037, 2730485921, 2820302411, 3259730800, 3345764771,
3516065817, 3600352804, 4094571909, 275423344, 430227734, 506948616,
659060556, 883997877, 958139571, 1322822218, 1537002063, 1747873779,
1955562222, 2024104815, 2227730452, 2361852424, 2428436474,
2756734187, 3204031479, 3329325298,
]),
(l = true)
}
function o(t, e, n) {
for (
var i, o, a, s, u, l, f, h, p, m, d, g, v, y, w, b = n.length();
b >= 64;
) {
for (f = 0; f < 16; ++f) e[f] = n.getInt32()
for (; f < 64; ++f)
(i =
(((i = e[f - 2]) >>> 17) | (i << 15)) ^
((i >>> 19) | (i << 13)) ^
(i >>> 10)),
(o =
(((o = e[f - 15]) >>> 7) | (o << 25)) ^
((o >>> 18) | (o << 14)) ^
(o >>> 3)),
(e[f] = (i + e[f - 7] + o + e[f - 16]) | 0)
for (
h = t.h0,
p = t.h1,
m = t.h2,
d = t.h3,
g = t.h4,
v = t.h5,
y = t.h6,
w = t.h7,
f = 0;
f < 64;
++f
)
(a =
((h >>> 2) | (h << 30)) ^
((h >>> 13) | (h << 19)) ^
((h >>> 22) | (h << 10))),
(l = (h & p) | (m & (h ^ p))),
(i =
w +
(s =
((g >>> 6) | (g << 26)) ^
((g >>> 11) | (g << 21)) ^
((g >>> 25) | (g << 7))) +
(u = y ^ (g & (v ^ y))) +
c[f] +
e[f]),
(w = y),
(y = v),
(v = g),
(g = (d + i) >>> 0),
(d = m),
(m = p),
(p = h),
(h = (i + (o = a + l)) >>> 0)
;(t.h0 = (t.h0 + h) | 0),
(t.h1 = (t.h1 + p) | 0),
(t.h2 = (t.h2 + m) | 0),
(t.h3 = (t.h3 + d) | 0),
(t.h4 = (t.h4 + g) | 0),
(t.h5 = (t.h5 + v) | 0),
(t.h6 = (t.h6 + y) | 0),
(t.h7 = (t.h7 + w) | 0),
(b -= 64)
}
}
var a = n(21)
n(92), n(24)
var s = (t.exports = a.sha256 = a.sha256 || {})
;(a.md.sha256 = a.md.algorithms.sha256 = s),
(s.create = function () {
if (!l) i()
var t = null,
e = a.util.createBuffer(),
n = new Array(64),
s = {
algorithm: 'sha256',
blockLength: 64,
digestLength: 32,
messageLength: 0,
fullMessageLength: null,
messageLengthSize: 8,
start: function () {
;(s.messageLength = 0),
(s.fullMessageLength = s.messageLength64 = [])
for (var n = s.messageLengthSize / 4, i = 0; i < n; ++i)
s.fullMessageLength.push(0)
return (
(e = a.util.createBuffer()),
(t = {
h0: 1779033703,
h1: 3144134277,
h2: 1013904242,
h3: 2773480762,
h4: 1359893119,
h5: 2600822924,
h6: 528734635,
h7: 1541459225,
}),
s
)
},
}
return (
s.start(),
(s.update = function (i, u) {
if ('utf8' === u) i = a.util.encodeUtf8(i)
var l = i.length
;(s.messageLength += l), (l = [(l / 4294967296) >>> 0, l >>> 0])
for (var c = s.fullMessageLength.length - 1; c >= 0; --c)
(s.fullMessageLength[c] += l[1]),
(l[1] = l[0] + ((s.fullMessageLength[c] / 4294967296) >>> 0)),
(s.fullMessageLength[c] = s.fullMessageLength[c] >>> 0),
(l[0] = (l[1] / 4294967296) >>> 0)
if ((e.putBytes(i), o(t, n, e), e.read > 2048 || 0 === e.length()))
e.compact()
return s
}),
(s.digest = function () {
var i = a.util.createBuffer()
i.putBytes(e.bytes())
var l,
c =
(s.fullMessageLength[s.fullMessageLength.length - 1] +
s.messageLengthSize) &
(s.blockLength - 1),
f,
h
i.putBytes(u.substr(0, s.blockLength - c))
for (
var p = 8 * s.fullMessageLength[0], m = 0;
m < s.fullMessageLength.length - 1;
++m
)
(p += h =
((f = 8 * s.fullMessageLength[m + 1]) / 4294967296) >>> 0),
i.putInt32(p >>> 0),
(p = f >>> 0)
i.putInt32(p)
var g = {
h0: t.h0,
h1: t.h1,
h2: t.h2,
h3: t.h3,
h4: t.h4,
h5: t.h5,
h6: t.h6,
h7: t.h7,
}
o(g, n, i)
var v = a.util.createBuffer()
return (
v.putInt32(g.h0),
v.putInt32(g.h1),
v.putInt32(g.h2),
v.putInt32(g.h3),
v.putInt32(g.h4),
v.putInt32(g.h5),
v.putInt32(g.h6),
v.putInt32(g.h7),
v
)
}),
s
)
})
var u = null,
l = false,
c = null
},
273: function (t, e, n) {
'use strict'
function i() {
;(this.hint = null), (this.animations = [])
}
t.exports = i
var o = null
;(i.instance = function instance() {
if (!o) o = new i()
return o
}),
(i.prototype.createAnimation = function t(e) {
for (var n = 0; n < this.animations.length; n++)
if (this.animations[n].isMatch(e))
return this.animations[n].create(e, this.hint)
return null
}),
(i.prototype.setHint = function t(e) {
this.hint = e
}),
(i.prototype.registerAnimation = function (animation) {
this.animations.push(animation)
}),
(window.AnimationFactory = i)
},
274: function (t, e, n) {
'use strict'
function i(t, e) {
if (!t) throw new Error('animationInfo is null or undefined')
if (
((this.info = t),
(this.hint = e),
(this.animatedClass = ['animated']),
(this.animatedOnceClass = ['animated-once']),
(this.backstageClass = ['backstage']),
(this.animationInClass = this.getAnimationClass()),
this.isInOutAnimation())
)
this.animationOutClass = this.getAnimationOutClass()
;(this._reqestId = null),
(this._timeoutId = null),
(this._animationInTimeoutId = null),
(this._handleAnimationEnd = this._handleAnimationEnd.bind(this)),
(this._playing = null),
(this._playNext = null),
(this._playNextDuration = null)
}
function o(t) {
if (!t) return null
if (t < l) t = l
return t + 'ms'
}
function a(t, e) {
if ((e = o(e))) t.style['animation-duration'] = e
}
function s(t) {
switch (t) {
case 'Down':
return 'Up'
case 'Up':
return 'Down'
default:
return t
}
}
var u = n(379)
t.exports = i
var l = 100,
c = 500,
f = 'In',
h = 'Out'
;(i.isMatch = function () {
return true
}),
(i.create = function (t, e) {
return new i(t, e)
}),
(i.prototype._handleAnimationEnd = function t(e) {
if (e.target === this.info.element) {
if (
((this._playing = null),
this.info.element.classList.contains(this.animationInClass))
)
this.info.element.classList.remove(this.animationInClass),
this.info.element.classList.add(this.animationInClass + '-played')
else
this.info.element.classList.remove(
this.animationInClass + '-played'
)
if (this._playNext) {
var n = this._playNext,
i = this._playNextDuration
;(this._playNext = null),
(this._playNextDuration = null),
this._play(n, i)
}
}
}),
(i.prototype.subscribe = function t() {
this.info.element.addEventListener(
'animationend',
this._handleAnimationEnd
)
}),
(i.prototype.unsubscribe = function t() {
this.info.element.removeEventListener(
'animationend',
this._handleAnimationEnd
)
}),
(i.prototype.init = function init() {
if (this.hint) this.hint.hintBrowser(this.info)
this.subscribe(), this.reset()
}),
(i.prototype.clear = function t() {
if (this.info) {
if (this.backstageClass)
this.info.element.classList.remove.apply(
this.info.element.classList,
this.backstageClass
)
if (this.animatedClass)
this.info.element.classList.remove.apply(
this.info.element.classList,
this.animatedClass
),
this.info.element.classList.add.apply(
this.info.element.classList,
this.animatedOnceClass
)
if (this.animationInClass)
this.info.element.classList.remove(this.animationInClass)
if (this.animationOutClass)
this.info.element.classList.remove(this.animationOutClass)
if (((this.info.element.style['animation-duration'] = ''), this.hint))
this.hint.removeHint(this.info)
if (this._animationInTimeoutId)
clearTimeout(this._animationInTimeoutId),
(this._animationInTimeoutId = null)
;(this._playing = null), (this._playNext = null), this.unsubscribe()
}
}),
(i.prototype.requestAnimationFrame = function t(e) {
return u.requestAnimationFrame(e)
}),
(i.prototype.cancelAnimationFrame = function t(id) {
if (window.cancelAnimationFrame)
return window.cancelAnimationFrame(id), void 0
if (window.mozCancelAnimationFrame) window.mozCancelAnimationFrame(id)
}),
(i.prototype.getAnimationClass = function t() {
if (!this.info) return null
var e = this.info.name
if (this.info.direction) e += this.info.direction
return e
}),
(i.prototype.getAnimationOutClass = function t() {
if (!this.info) return null
var e = this.info.name
if (this.isInOutAnimation()) e = e.slice(0, 0 - f.length) + h
if (this.info.direction) e += s(this.info.direction)
return e
}),
(i.prototype.isInOutAnimation = function t() {
if (!this.info || !this.info.name || !this.info.animationOut)
return false
else
return this.info.name.indexOf(f) + f.length === this.info.name.length
}),
(i.prototype.start = function t() {
if (this.info) {
var e = this.info.delay,
n = function () {
;(this._animationInTimeoutId = null),
this._play(this.animationInClass, this.info.duration)
}.bind(this)
if (this._animationInTimeoutId)
clearTimeout(this._animationInTimeoutId)
if (!e) return n(), void 0
this._animationInTimeoutId = setTimeout(n, e)
}
}),
(i.prototype.startOut = function t() {
if (this.info)
if (this.animationOutClass)
if (this._animationInTimeoutId)
return (
clearInterval(this._animationInTimeoutId),
(this._animationInTimeoutId = null),
void 0
)
else return this._play(this.animationOutClass, c), void 0
}),
(i.prototype._play = function t(animation, e) {
if (!animation) animation = this.animationInClass
if (e) a(this.info.element, e)
if (this._playing === animation) return (this._playNext = null), void 0
if (this._playing)
return (
(this._playNext = animation), (this._playNextDuration = e), void 0
)
if (((this._playing = animation), this._reqestId))
this.cancelAnimationFrame(this._reqestId)
this._reqestId = this.requestAnimationFrame(
function () {
if (((this._reqestId = null), this.backstageClass))
this.info.element.classList.remove.apply(
this.info.element.classList,
this.backstageClass
)
if (this.animationOutClass)
this.info.element.classList.remove(this.animationOutClass)
if (this.animationInClass)
this.info.element.classList.remove(this.animationInClass)
if (animation) this.info.element.classList.add(animation)
}.bind(this)
)
}),
(i.prototype.reset = function t() {
if (this.info) {
var e = this.info.duration
if (
(a(this.info.element, e),
(this._playing = null),
(this._playNext = null),
this.backstageClass)
)
this.info.element.classList.add.apply(
this.info.element.classList,
this.backstageClass
)
if (this.animatedClass)
this.info.element.classList.add.apply(
this.info.element.classList,
this.animatedClass
)
}
}),
(i.prototype.needOutAnimation = function t() {
if (!this.isInOutAnimation()) return false
if (this._animationInTimeoutId) return true
else
return (
(this.info.element.classList.contains(this.animationInClass) ||
this.info.element.classList.contains(
this.animationInClass + '-played'
)) &&
!this.info.element.classList.contains(this.backstageClass[0])
)
}),
(i.prototype.getTime = function t() {
if (!this.info) return 0
var e = this.info.duration,
n = this.info.delay
if (isNaN(n)) n = 0
return n + e
}),
(i.prototype.getOutTime = function t() {
if (!this.info || !this.isInOutAnimation()) return 0
else return c
})
},
275: function (t, e, n) {
'use strict'
function CountdownUpdater(t) {
;(this.$dom = t), (this.countdownCommon = new CountdownCommon(t))
}
t.exports = CountdownUpdater
var CountdownCommon = n(55)
;(CountdownUpdater.prototype.startUpdate = function (t) {
var e = this.getUpdateTimeout()
if (e) this.update(t, true), setInterval(this.update.bind(this), e, t)
}),
(CountdownUpdater.prototype.getUpdateTimeout = function () {
if (this.countdownCommon.getAfterCountFinished()) return 0
var countdownType = this.countdownCommon.getType()
if ('to-date' === countdownType || 'to-time' === countdownType)
return 350
if ('to-number' === countdownType) {
var t = this.countdownCommon.getFrequency(),
e = CountdownCommon.timeStringToMilliseconds(t)
return (e = Math.max(e, 0)), (e = Math.min(e, 350))
}
return 0
}),
(CountdownUpdater.prototype.getAnimationProps = function (t, e) {
if (e) return { animation: 'none' }
else
return {
animation:
('runtime' === t && this.countdownCommon.getCountAnimation()) ||
'none',
animationSpeed: this.getUpdateTimeout(),
}
}),
(CountdownUpdater.prototype.update = function (t, e) {
if (!this.countdownCommon.getAfterCountFinished()) {
var countdownType = this.countdownCommon.getType()
if ('to-date' === countdownType || 'to-time' === countdownType)
this.updateDateAndTime(t, e)
if ('to-number' === countdownType) this.updateNumber(t, e)
}
}),
(CountdownUpdater.prototype.updateDateAndTime = function (t, e) {
var n = this.countdownCommon.getDate(),
diff = this.getTimeDiff(n)
if (!this.afterCount(diff, t)) {
var props = this.getAnimationProps(t, e)
this.countdownCommon.setValue('years', diff.years, false, props),
this.countdownCommon.setValue('days', diff.days, false, props),
this.countdownCommon.setValue('hours', diff.hours, false, props),
this.countdownCommon.setValue(
'minutes',
diff.minutes,
false,
props
),
this.countdownCommon.setValue(
'seconds',
diff.seconds,
false,
props
),
this.countdownCommon.showLabel('years', !!diff.years),
this.countdownCommon.showLabel('days', !!diff.days)
}
}),
(CountdownUpdater.prototype.updateNumber = function (t, e) {
var n = this.countdownCommon.getNumber(),
i = this.countdownCommon.getStartTime(),
o = this.countdownCommon.getFrequency(),
diff = this.countdownCommon.calcNumber(n, i, o)
if ('per-visitor' === this.countdownCommon.getFor()) {
var a = this.countdownCommon.getTimerId()
;(i = this.getStartDate(a)),
(diff = this.countdownCommon.calcNumber(n, i, o))
}
if (!this.afterCount(diff, t)) {
var props = this.getAnimationProps(t, e)
this.countdownCommon.setValue('numbers', diff, false, props)
}
}),
(CountdownUpdater.prototype.getTimeDiff = function (t) {
if ('everyone' === this.countdownCommon.getFor())
return this.countdownCommon.timeDiff(t)
var e = this.getStartDate(),
n = this.countdownCommon.getTimeLeft()
return (
(t = this.countdownCommon.parseTime(n, e)),
this.countdownCommon.timeDiff(t)
)
}),
(CountdownUpdater.prototype.getStartDate = function () {
var t = this.countdownCommon.getTimerKey(),
e = localStorage.getItem(t)
if (e) return new Date(e)
var n = new Date()
return localStorage.setItem(t, n.toUTCString()), n
}),
(CountdownUpdater.prototype.afterCount = function (diff, t) {
var e = this.countdownCommon.getDirection(),
n = this.countdownCommon.getAfterCount()
if (
((t = t || ''),
'none' !== n && 'down' === e && CountdownCommon.isEmptyDiff(diff))
) {
if ('message' === n) this.showMessage()
if ('redirect' === n)
if (
(this.$dom.find('.u-countdown-message').text('Redirecting...'),
this.showMessage(),
'preview' !== t)
) {
var i = this.countdownCommon.getRedirectUrl()
window.location.href = i
}
if ('preview' !== t) this.countdownCommon.setAfterCountFinished()
return true
}
return false
}),
(CountdownUpdater.prototype.showMessage = function () {
if (this.$dom.find('.u-countdown-message').is('.u-hidden'))
this.$dom.find('.u-countdown-wrapper').addClass('u-invisible'),
this.$dom.find('.u-countdown-message').removeClass('u-hidden')
}),
(CountdownUpdater.prototype.hideMessage = function () {
if (this.$dom.find('.u-countdown-message').not('.u-hidden'))
this.$dom.find('.u-countdown-wrapper').removeClass('u-invisible'),
this.$dom.find('.u-countdown-message').addClass('u-hidden')
}),
(CountdownUpdater.findAll = function () {
return $('.u-countdown')
})
},
276: function (t, e, n) {
'use strict'
function TabsControl(t) {
;(this.tabsSelector = '.u-tabs'),
(this.activeClass = 'u-tab-active'),
(this.activeSelector = '.' + this.activeClass),
(this.activeLinkClass = 'active'),
(this.activeLinkSelector = '.' + this.activeLinkClass),
(this.tabListSelector = '.u-tab-list'),
(this.tabContentSelector = '.u-tab-content'),
(this.tabLinkSelector = '.u-tab-link'),
(this.tabPaneSelector = '.u-tab-pane'),
(this._tabLink = this._getLink(t)),
(this._tabList = this._tabLink.closest(this.tabListSelector)),
(this._tabContent = this._tabLink
.closest(this.tabsSelector)
.children(this.tabContentSelector))
}
;(TabsControl.prototype.show = function () {
var link = this._tabLink
if (!link.is(this.activeLinkSelector))
this._removeActiveLink(),
this._addActiveLink(link),
this._activateTabPane(link)
}),
(TabsControl.prototype._getLink = function (t) {
if (t.is(this.tabPaneSelector)) return this._findLinkByPane(t)
else
return t.is(this.tabLinkSelector)
? t
: t.children(this.tabLinkSelector)
}),
(TabsControl.prototype._findLinkByPane = function (pane) {
var t = pane.attr('aria-labelledby'),
tabList
return pane
.closest(this.tabsSelector)
.children(this.tabListSelector)
.find('#' + t)
}),
(TabsControl.prototype._removeActiveLink = function () {
var t = this._getActiveLink()
t.removeClass(this.activeLinkClass),
t.attr('aria-selected', false),
t.find('input').removeAttr('checked').prop('checked', false)
}),
(TabsControl.prototype._getActiveLink = function () {
return this._tabList.find(this.activeLinkSelector)
}),
(TabsControl.prototype._addActiveLink = function (link) {
link.addClass(this.activeLinkClass),
link.attr('aria-selected', true),
link.find('input').attr('checked', '').prop('checked', true)
}),
(TabsControl.prototype._activateTabPane = function (link) {
var t, e
this._tabContent
.children(this.activeSelector)
.removeClass(this.activeClass),
this.getTabPane(link).addClass(this.activeClass)
}),
(TabsControl.prototype.getTabPane = function (t) {
var link,
e = this._getLink(t).attr('href')
return this._tabContent.children(e)
}),
(TabsControl.prototype.getTabLink = function () {
return this._tabLink
}),
(TabsControl.prototype.removeId = function () {
this._tabList.find(this.tabLinkSelector).removeAttr('id'),
this._tabContent.children().removeAttr('id')
}),
(t.exports = TabsControl),
(window.TabsControl = TabsControl)
},
286: function (t, e, n) {
'use strict'
function Dialog(t, e) {
;(this._openClass = 'u-dialog-open'),
(this._dialogBlockClass = 'u-dialog-block'),
(this._dialogBlockSelector = '.' + this._dialogBlockClass),
(this._dialog = t.closest(this._dialogBlockSelector)),
(this._btn = e)
}
function i(t) {
if (!window._responsive) return false
var e = t.find('.u-dialog'),
n = window._responsive.mode || 'XL'
return e.is('.u-hidden, .u-hidden-' + n.toLowerCase())
}
;(t.exports = Dialog),
(Dialog.prototype.open = function (t) {
this._dialog.each(
function (e, block) {
var n = $(block)
if (!i(n)) {
if ((n.addClass(this._openClass), 'function' == typeof t)) t(n)
n.trigger('opened.np.dialog', [this, this._btn])
}
}.bind(this)
)
}),
(Dialog.prototype.close = function () {
this._dialog.removeClass(this._openClass),
this._dialog.trigger('closed.np.dialog', [this])
}),
(Dialog.prototype.getInterval = function () {
return this._dialog.attr('data-dialog-show-interval') || 3e3
})
},
289: function (t, e) {},
3537: function (t, e, n) {
'use strict'
var FormMessage = (t.exports = {}),
i = n(17)
;(FormMessage.showSuccess = function t(form) {
form.trigger('reset')
var e = form.find('.u-form-send-success'),
n = e.find('.u-form-send-message-close')
if (!n.length)
(n = i('<a href="#" class="u-form-send-message-close">x</a>')),
e.append(n)
e.show(),
n.one('click', function (t) {
t.preventDefault(), e.hide()
}),
form.find('input[type="submit"]').prop('disabled', false)
}),
(FormMessage.showError = function t(form, e, n, o) {
var a = e
? form.find('.u-form-send-error').clone()
: form.find('.u-form-send-error')
if (e) {
if (n)
if (560 === n && o)
e =
'Unable to submit the Contact Form, as the submission email is not verified.\n' +
'</br></br>' +
'If you are a site administrator, please open your inbox and confirm the ' +
o +
' email in the message. Make sure also to check your spam folder.'
a.html(e), form.find('.u-form-send-error').parent().append(a)
}
var s = a.find('.u-form-send-message-close')
if (!s.length)
(s = i('<a href="#" class="u-form-send-message-close">x</a>')),
a.append(s)
s.one('click', function (t) {
if ((t.preventDefault(), a.hide(), e)) a.remove()
}),
a.show(),
form.find('input[type="submit"]').prop('disabled', false)
})
},
3538: function (t, e, n) {
'use strict'
var Const = (t.exports = {})
;(Const.formActionUrl = [
'https://forms.',
'n',
'i',
'c',
'e',
'p',
'a',
'g',
'e',
'srv.com/',
].join('')),
(Const.stripeCheckoutUrl =
'https://service.nicepagesrv.com/stripe/v1/stripe-checkout'),
(Const.emailCheckoutUrl =
'https://service.nicepagesrv.com/place-email-order/v1/place-email-order')
},
3539: function (t, e, n) {
'use strict'
var Utils = t.exports
;(Utils.getQueryParam = function (t) {
var e = window.location.search,
n
return new URLSearchParams(e).get(t)
}),
(Utils.animationsEnabled = function () {
var t = Utils.getQueryParam('np-animations') || 'true'
return 'false' !== t && '0' !== t
})
},
3540: function (t, e, n) {
'use strict'
function i(t) {
this.setDialog(t)
}
;(t.exports = i),
(i.prototype.setDialog = function (t) {
this.$dom = (t && t.find('.u-payment-services')) || $()
}),
(i.prototype.orderApproved = function t() {
var e = this.$dom.attr('data-payment-order-approved-message') || ''
this.displayMessage(
e || 'Your order has been approved. Thank you!',
'payment-success'
)
}),
(i.prototype.orderError = function t() {
var e = this.$dom.attr('data-payment-order-cancelled-message') || ''
this.displayMessage(
e || 'Unable to process your order. Please try again later.',
'payment-error'
)
}),
(i.prototype.stripeError = function t() {
this.displayMessage(
'Unable to process your order. If you are the Site Author, please ensure your Stripe account is active and eligible to accept payments.',
'payment-error'
)
}),
(i.prototype.emailError = function t() {
this.displayMessage('Unable to process your order.', 'payment-error')
}),
(i.prototype.configError = function t() {
this.displayMessage(
'Invalid configuration. Please reset the Purchase button.',
'payment-error'
)
}),
(i.prototype.serviceError = function t() {
this.displayMessage(
'Set the PayPal Client ID in the Payment Settings.',
'payment-error'
)
}),
(i.prototype.productError = function t() {
this.displayMessage(
'Set the Title, Price, and Currency for the Product.',
'payment-error'
)
}),
(i.prototype.cartEmpty = function t() {
this.displayNote('Cart is empty.', 'cart-empty')
}),
(i.prototype.productOutOfStock = function productOutOfStock(t) {
var e = t
? 'Some products out of stock.<br />Please remove these from your cart.'
: ''
this.displayNote(e, 'product-out-of-stock-message')
}),
(i.prototype.displayNote = function t(e, n) {
if (e) this.$dom.after('<div class="' + n + '"><p>' + e + '</p></div>')
if (
(this.$dom.hide(),
this.$dom.parents('.u-dialog').css('min-height', 'auto'),
'cart-empty' === n)
)
this.$dom
.parent()
.find('>:not(.' + n + ')')
.hide()
}),
(i.prototype.displayMessage = function t(e, n) {
this.$dom.empty(),
this.$dom.append('<div class="' + n + '">' + e + '</div>'),
this.$dom.css('height', '')
}),
(window.PaymentMessage = i)
},
3541: function (t, e, n) {
'use strict'
function i(t) {
this.$btn = t
}
function o(t, type) {
var e = 'desc' === type ? 250 : 127
return (t || '').substring(0, e)
}
;(t.exports = i),
(i.prototype.getProducts = function t() {
var product = this.getProduct()
if (!product) return null
else return [product]
}),
(i.prototype.getProduct = function t() {
var e = this.$btn.attr('data-product')
if (!e) return null
var product = JSON.parse(e)
if (!(product && product.title && product.price && product.currency))
return null
if (
((product.title = o(product.title)),
(product.description = o(product.description, 'desc')),
(product.sku = o(product.sku)),
(product.hiddenButtons =
this.$btn.attr('data-paypal-hidden-buttons') || ''),
!product.quantity)
)
product.quantity = 1
return product
}),
(window.PaymentProduct = i)
},
3542: function (t, e, n) {
'use strict'
function i() {
this.pageName = 'thank-you-page'
}
;(t.exports = i),
(i.prototype.isThankYouPage = function t() {
return (
-1 !==
window.location.href.indexOf(window._npThankYouUrl || this.pageName)
)
}),
(i.prototype.goToThankYouPage = function t() {
window.location.href =
window._npThankYouUrl ||
window.location.origin + '/' + this.pageName + '.html'
}),
(window.PaymentThankYou = i)
},
3543: function (t, e, n) {
'use strict'
function i() {
;(this._result = null), (this._queue = null)
}
t.exports = i
var instance = null
;(i.getModel = function () {
if (!instance) instance = new i()
return instance
}),
(i.prototype.load = function (t) {
var e = document.body.getAttribute('data-include-products')
if (e && /false/.test(e)) return t(null, null)
if (this._result) return t(null, this._result)
var n = document.body.getAttribute('data-path-to-root') || './',
i = window._npProductsJsonUrl
if (!i) i = n + 'products/products.json'
if (!this._queue)
this._queue = fetch(i).then(function (t) {
if (!t.ok) return Promise.reject(t)
else return t.json()
})
this._queue
.then(
function (e) {
;(this._result = e), t(null, e)
}.bind(this)
)
.catch(function (e) {
t(e, null)
})
}),
(window.ProductsModel = i)
},
3544: function (t, e, n) {
'use strict'
var i = t.exports
;(i.findNearestCategories = function (list) {
var categories = list
.closest('body')
.find('.u-categories[data-products-datasource="site"]')
if (!categories.length) return $()
else return categories
}),
(i.findNearestProducts = function (categories) {
if (!categories.is('[data-products-datasource="site"]')) return $()
var t = '.u-products[data-products-datasource="site"]'
return categories.closest('body').find(t)
}),
(i.getActiveCategory = function (list) {
var t = list.find('.u-select-categories')
if (t.length) return t.val() || ''
var categories,
e =
i
.findNearestCategories(list)
.eq(0)
.find('.u-category-link.active')
.attr('data-category') || ''
if (e) return e
var n = list.attr('data-site-category') || ''
if (n) return n
else return ''
}),
(i.setActiveCategory = function (list, id) {
list.find('.u-category-link').removeClass('active')
var t,
e = list
.find('.u-categories-item')
.slice(1)
.filter(':not(.u-expand-leaf)')
e.removeClass('u-expand-open').addClass('u-expand-closed'),
e
.find('> .u-categories-item-content svg use')
.attr('xlink:href', '#icon-categories-closed')
var n = list.find('[data-category="' + (id || '') + '"]'),
i = n.closest('.u-categories-item')
n.addClass('active')
var o = n.parents('.u-categories-item:not(.u-expand-leaf)')
o
.removeClass('u-expand-closed')
.addClass('u-expand-open')
.css('display', ''),
o
.find('> .u-categories-item-content svg use')
.attr('xlink:href', '#icon-categories-open'),
i.css('display', ''),
i.find('.u-categories-item').css('display', '')
var a = i.find('.u-categories-item:not(.u-expand-leaf)')
a.removeClass('u-expand-closed').addClass('u-expand-open'),
a
.find('> .u-categories-item-content svg use')
.attr('xlink:href', '#icon-categories-open')
}),
(window.CategoryView = i)
},
358: function (t, e, n) {
'use strict'
var ProductsUtils = t.exports
;(ProductsUtils.sort = function sort(items, sorting, t) {
var e = new Intl.Collator(t, { numeric: true, sensitivity: 'base' }),
n = sorting.prop || 'title',
i = sorting.order || 'asc'
return (
items.sort(function (t, o) {
if (Array.isArray(t) && 2 === t.length) t = t[1]
if (Array.isArray(o) && 2 === o.length) o = o[1]
return 'desc' === i ? e.compare(o[n], t[n]) : e.compare(t[n], o[n])
}),
n + '-' + i
)
}),
(ProductsUtils.categoryFilter = function filter(items, t) {
if (((items = items || []), !t)) return items
if ('featured' === t)
return items.filter(function (t) {
if (Array.isArray(t) && 2 === t.length) t = t[1]
return t.isFeatured
})
else
return items.filter(function (e) {
if (Array.isArray(e) && 2 === e.length) e = e[1]
return e.categories && e.categories.includes(t)
})
})
},
367: function (t, e) {
t.exports = [
{
name: 'United States dollar',
code: 'USD',
symbol: '$',
locale: 'en-US',
},
{ name: 'Euro', code: 'EUR', symbol: '€', locale: 'en-EU' },
{ name: 'Australian dollar', code: 'AUD', symbol: '$', locale: 'en-AU' },
{ name: 'Brazilian real', code: 'BRL', symbol: 'R$', locale: 'pt-BR' },
{ name: 'Canadian dollar', code: 'CAD', symbol: '$', locale: 'en-CA' },
{ name: 'Chinese Renmenbi', code: 'CNY', symbol: '¥', locale: 'zh-CN' },
{ name: 'Czech koruna', code: 'CZK', symbol: 'Kč', locale: 'cs-CZ' },
{ name: 'Danish krone', code: 'DKK', symbol: 'kr.', locale: 'da-DK' },
{ name: 'Hong Kong dollar', code: 'HKD', symbol: '$', locale: 'zh-HK' },
{ name: 'Hungarian forint', code: 'HUF', symbol: 'ƒ', locale: 'hu-HU' },
{ name: 'Israeli new shekel', code: 'ILS', symbol: '₪', locale: 'he-IL' },
{ name: 'Japanese yen', code: 'JPY', symbol: '¥', locale: 'ja-JP' },
{ name: 'Malaysian ringgit', code: 'MYR', symbol: 'RM', locale: 'ms-MY' },
{ name: 'Mexican peso', code: 'MXN', symbol: '$', locale: 'es-MX' },
{ name: 'New Taiwan dollar', code: 'TWD', symbol: '$', locale: 'zh-TW' },
{ name: 'New Zealand dollar', code: 'NZD', symbol: '$', locale: 'en-NZ' },
{ name: 'Norwegian krone', code: 'NOK', symbol: 'kr', locale: 'nb-NO' },
{ name: 'Philippine peso', code: 'PHP', symbol: '₱', locale: 'en-PH' },
{ name: 'Polish złoty', code: 'PLN', symbol: 'zł', locale: 'pl-PL' },
{ name: 'Pound sterling', code: 'GBP', symbol: '£', locale: 'en-GB' },
{ name: 'Singapore dollar', code: 'SGD', symbol: '$', locale: 'en-SG' },
{ name: 'Swedish krona', code: 'SEK', symbol: 'kr', locale: 'sv-SE' },
{
name: 'Swiss franc',
code: 'CHF',
symbol: 'CHF',
locale: 'fr-CH',
localesList: ['fr-CH', 'de-CH', 'it-CH'],
},
{ name: 'Thai baht', code: 'THB', symbol: '฿', locale: 'th-TH' },
{
name: 'United Arab Emirates dirham',
code: 'AED',
symbol: 'د.إ',
locale: 'en-AE',
},
{ name: 'Afghan Afghani', code: 'AFN', symbol: '؋', locale: 'ps-AF' },
{ name: 'Albanian lek', code: 'ALL', symbol: 'L', locale: 'sq-AL' },
{ name: 'Armenian Dram', code: 'AMD', symbol: '֏', locale: 'hy-AM' },
{
name: 'Netherlands Antillean guilder',
code: 'ANG',
symbol: 'ƒ',
locale: 'nl-CW',
},
{ name: 'Angolan Kwanza', code: 'AOA', symbol: 'Kz', locale: 'pt-AO' },
{ name: 'Argentine Peso', code: 'ARS', symbol: '$', locale: 'es-AR' },
{ name: 'Aruban Florin', code: 'AWG', symbol: 'Afl', locale: 'nl-AW' },
{
name: 'Azerbaijani Manat',
code: 'AZN',
symbol: '₼',
locale: 'az-Latn-AZ',
},
{
name: 'Bosnia and Herzegovina Convertible Mark',
code: 'BAM',
symbol: 'KM',
locale: 'bs-Latn-BA',
},
{ name: 'Barbados dollar', code: 'BBD', symbol: '$', locale: 'en-BB' },
{ name: 'Bangladeshi taka', code: 'BDT', symbol: '৳', locale: 'bn-BD' },
{ name: 'Bulgarian lev', code: 'BGN', symbol: 'лв', locale: 'bg-BG' },
{ name: 'Burundian franc', code: 'BIF', symbol: 'Fbu', locale: 'fr-BI' },
{ name: 'Bermudian dollar', code: 'BMD', symbol: '$', locale: 'en-BM' },
{ name: 'Brunei dollar', code: 'BND', symbol: '$', locale: 'ms-BN' },
{
name: 'Bolivian boliviano',
code: 'BOB',
symbol: 'Bs.',
locale: 'es-BO',
},
{ name: 'Bahamian dollar', code: 'BSD', symbol: '$', locale: 'en-BS' },
{ name: 'Botswana pula', code: 'BWP', symbol: 'P', locale: 'en-BW' },
{ name: 'Belarusian ruble', code: 'BYN', symbol: 'Br', locale: 'be-BY' },
{ name: 'Belize dollar', code: 'BZD', symbol: '$', locale: 'en-BZ' },
{ name: 'Congolese franc', code: 'CDF', symbol: 'FC', locale: 'fr-CD' },
{ name: 'Chilean peso', code: 'CLP', symbol: '$', locale: 'es-CL' },
{ name: 'Colombian peso', code: 'COP', symbol: '$', locale: 'es-CO' },
{ name: 'Costa Rican colón', code: 'CRC', symbol: '₡', locale: 'es-CR' },
{
name: 'Cape Verdean escudo',
code: 'CVE',
symbol: '$',
locale: 'pt-CV',
},
{ name: 'Djiboutian franc', code: 'DJF', symbol: 'Fdj', locale: 'fr-DJ' },
{ name: 'Dominican peso', code: 'DOP', symbol: '$', locale: 'es-DO' },
{ name: 'Algerian dinar', code: 'DZD', symbol: 'د.ج', locale: 'ar-DZ' },
{ name: 'Egyptian pound', code: 'EGP', symbol: 'ج.م', locale: 'ar-EG' },
{ name: 'Ethiopian birr', code: 'ETB', symbol: 'Br', locale: 'am-ET' },
{ name: 'Fijian dollar', code: 'FJD', symbol: '$', locale: 'en-FJ' },
{
name: 'Falkland Islands pound',
code: 'FKP',
symbol: '£',
locale: 'en-FK',
},
{ name: 'Georgian Lari', code: 'GEL', symbol: '₾', locale: 'en-GE' },
{ name: 'Gibraltar Pound', code: 'GIP', symbol: '£', locale: 'en-GI' },
{ name: 'Gambian Dalasi', code: 'GMD', symbol: 'D', locale: 'en-GM' },
{ name: 'Guinean Franc', code: 'GNF', symbol: 'FG', locale: 'en-GN' },
{ name: 'Guatemalan Quetzal', code: 'GTQ', symbol: 'Q', locale: 'en-GT' },
{ name: 'Guyanese Dollar', code: 'GYD', symbol: '$', locale: 'en-GY' },
{ name: 'Honduran Lempira', code: 'HNL', symbol: 'L', locale: 'en-HN' },
{ name: 'Haitian Gourde', code: 'HTG', symbol: 'G', locale: 'en-HT' },
{ name: 'Indonesian Rupiah', code: 'IDR', symbol: 'Rp', locale: 'en-ID' },
{ name: 'Indian Rupee', code: 'INR', symbol: '₹', locale: 'en-IN' },
{ name: 'Icelandic Krona', code: 'ISK', symbol: 'kr', locale: 'en-IS' },
{ name: 'Jamaican Dollar', code: 'JMD', symbol: 'J$', locale: 'en-JM' },
{ name: 'Kenyan Shilling', code: 'KES', symbol: 'KSh', locale: 'en-KE' },
{ name: 'Kazakhstani Tenge', code: 'KZT', symbol: '₸', locale: 'en-KZ' },
{ name: 'Cambodian Riel', code: 'KHR', symbol: '៛', locale: 'en-KH' },
{ name: 'Comorian Franc', code: 'KMF', symbol: 'CF', locale: 'en-KM' },
{ name: 'South Korean Won', code: 'KRW', symbol: '₩', locale: 'en-KR' },
{
name: 'Cayman Islands Dollar',
code: 'KYD',
symbol: '$',
locale: 'en-KY',
},
{ name: 'Lao Kip', code: 'LAK', symbol: '₭', locale: 'en-LA' },
{ name: 'Lebanese Pound', code: 'LBP', symbol: 'ل.ل', locale: 'en-LB' },
{ name: 'Sri Lankan Rupee', code: 'LKR', symbol: 'Rs', locale: 'en-LK' },
{ name: 'Liberian Dollar', code: 'LRD', symbol: '$', locale: 'en-LR' },
{ name: 'Lesotho Loti', code: 'LSL', symbol: 'L', locale: 'en-LS' },
{ name: 'Moroccan Dirham', code: 'MAD', symbol: 'د.م.', locale: 'en-MA' },
{ name: 'Moldovan Leu', code: 'MDL', symbol: 'L', locale: 'en-MD' },
{ name: 'Malagasy ariary', code: 'MGA', symbol: 'Ar', locale: 'mg-MG' },
{ name: 'Macedonian denar', code: 'MKD', symbol: 'ден', locale: 'mk-MK' },
{ name: 'Myanmar kyat', code: 'MMK', symbol: 'K', locale: 'my-MM' },
{ name: 'Mongolian tögrög', code: 'MNT', symbol: '₮', locale: 'mn-MN' },
{ name: 'Macanese pataca', code: 'MOP', symbol: 'P', locale: 'zh-MO' },
{ name: 'Mauritian rupee', code: 'MUR', symbol: '₨', locale: 'en-MU' },
{ name: 'Maldivian rufiyaa', code: 'MVR', symbol: 'Rf', locale: 'dv-MV' },
{ name: 'Malawian kwacha', code: 'MWK', symbol: 'MK', locale: 'en-MW' },
{
name: 'Mozambican metical',
code: 'MZN',
symbol: 'MT',
locale: 'pt-MZ',
},
{ name: 'Namibian dollar', code: 'NAD', symbol: '$', locale: 'en-NA' },
{ name: 'Nigerian naira', code: 'NGN', symbol: '₦', locale: 'en-NG' },
{
name: 'Nicaraguan córdoba',
code: 'NIO',
symbol: 'C$',
locale: 'es-NI',
},
{ name: 'Nepalese rupee', code: 'NPR', symbol: '₨', locale: 'ne-NP' },
{
name: 'Panamanian balboa',
code: 'PAB',
symbol: 'B/.',
locale: 'es-PA',
},
{ name: 'Peruvian sol', code: 'PEN', symbol: 'S/.', locale: 'es-PE' },
{
name: 'Papua New Guinean kina',
code: 'PGK',
symbol: 'K',
locale: 'en-PG',
},
{ name: 'Pakistani rupee', code: 'PKR', symbol: '₨', locale: 'ur-PK' },
{ name: 'Paraguayan guaraní', code: 'PYG', symbol: '₲', locale: 'es-PY' },
{ name: 'Qatari riyal', code: 'QAR', symbol: '﷼', locale: 'ar-QA' },
{ name: 'Romanian leu', code: 'RON', symbol: 'lei', locale: 'ro-RO' },
{ name: 'Serbian dinar', code: 'RSD', symbol: 'дин.', locale: 'sr-RS' },
{ name: 'Russian ruble', code: 'RUB', symbol: '₽', locale: 'ru-RU' },
{ name: 'Rwandan franc', code: 'RWF', symbol: 'FRw', locale: 'rw-RW' },
{ name: 'Saudi riyal', code: 'SAR', symbol: '﷼', locale: 'ar-SA' },
{
name: 'Solomon Islands dollar',
code: 'SBD',
symbol: '$',
locale: 'en-SB',
},
{ name: 'Seychellois Rupee', code: 'SCR', symbol: '₨', locale: 'en-SC' },
{ name: 'Saint Helena Pound', code: 'SHP', symbol: '£', locale: 'en-SH' },
{
name: 'Sierra Leonean Leone',
code: 'SLE',
symbol: 'Le',
locale: 'en-SL',
},
{ name: 'Somali Shilling', code: 'SOS', symbol: 'S', locale: 'en-SO' },
{ name: 'Surinamese Dollar', code: 'SRD', symbol: '$', locale: 'en-SR' },
{
name: 'São Tomé and Príncipe Dobra',
code: 'STD',
symbol: 'Db',
locale: 'en-ST',
},
{ name: 'Swazi Lilangeni', code: 'SZL', symbol: 'L', locale: 'en-SZ' },
{
name: 'Tajikistani Somoni',
code: 'TJS',
symbol: 'ЅМ',
locale: 'en-TJ',
},
{ name: "Tongan Pa'anga", code: 'TOP', symbol: 'T$', locale: 'en-TO' },
{ name: 'Turkish Lira', code: 'TRY', symbol: '₺', locale: 'en-TR' },
{
name: 'Trinidad and Tobago Dollar',
code: 'TTD',
symbol: 'TT$',
locale: 'en-TT',
},
{
name: 'Tanzanian Shilling',
code: 'TZS',
symbol: 'TSh',
locale: 'en-TZ',
},
{ name: 'Ukrainian Hryvnia', code: 'UAH', symbol: '₴', locale: 'en-UA' },
{ name: 'Ugandan Shilling', code: 'UGX', symbol: 'USh', locale: 'en-UG' },
{ name: 'Uruguayan Peso', code: 'UYU', symbol: '$U', locale: 'en-UY' },
{ name: 'Uzbekistani Som', code: 'UZS', symbol: 'лв', locale: 'en-UZ' },
{ name: 'Vietnamese Dong', code: 'VND', symbol: '₫', locale: 'en-VN' },
{ name: 'Vanuatu Vatu', code: 'VUV', symbol: 'VT', locale: 'en-VU' },
{ name: 'Samoan Tala', code: 'WST', symbol: 'WS$', locale: 'en-WS' },
{
name: 'Central African CFA Franc',
code: 'XAF',
symbol: 'FCFA',
locale: 'en-CM',
},
{
name: 'East Caribbean Dollar',
code: 'XCD',
symbol: 'EC$',
locale: 'en-DM',
},
{
name: 'West African CFA Franc',
code: 'XOF',
symbol: 'CFA',
locale: 'en-BJ',
},
{ name: 'CFP Franc', code: 'XPF', symbol: '₣', locale: 'en-PF' },
{ name: 'Yemeni Rial', code: 'YER', symbol: '﷼', locale: 'en-YE' },
{ name: 'South African Rand', code: 'ZAR', symbol: 'R', locale: 'en-ZA' },
{ name: 'Zambian kwacha', code: 'ZMW', symbol: 'ZK', locale: 'en-ZM' },
{ name: 'Kyrgyzstani Som', code: 'KGS', symbol: 'с', locale: 'en-KG' },
]
},
379: function (t, e, n) {
'use strict'
var i
t.exports.requestAnimationFrame = function t(e) {
if (window.requestAnimationFrame) return window.requestAnimationFrame(e)
if (window.mozRequestAnimationFrame)
return window.mozRequestAnimationFrame(e)
if (window.webkitRequestAnimationFrame)
return window.webkitRequestAnimationFrame(e)
if (window.msRequestAnimationFrame)
return window.msRequestAnimationFrame(e)
else return e(), void 0
}
},
380: function (t, e, n) {
'use strict'
function i(t, section) {
if (
((this.element = t),
(this.section = section),
(this.name = t.getAttribute('data-animation-name')),
(this.event = 'scroll'),
(this.durationRaw = t.getAttribute('data-animation-duration')),
(this.duration = Number(this.durationRaw)),
isNaN(this.duration) || !isFinite(this.duration) || this.duration < 0)
)
this.duration = 0
var e = t.getAttribute('data-animation-event')
if (e) this.event = e
if (
((this.delayRaw = t.getAttribute('data-animation-delay')),
(this.delay = 0),
this.delayRaw)
)
if (
((this.delay = Number(this.delayRaw)),
isNaN(this.delay) || !isFinite(this.delay) || this.delay < 0)
)
this.delay = 0
var n = t.getAttribute('data-animation-cycle')
if (n) if (((n = Number(n)), !isNaN(n))) this.animationCycle = n
var i = t.getAttribute('data-animation-direction')
if (i && 'customAnimationIn' !== this.name) this.direction = i
;(this.animationOut =
!t.hasAttribute('data-animation-out') ||
parseFloat(t.getAttribute('data-animation-out'))),
(this.infinite = t.classList.contains('infinite'))
}
;(t.exports = i), (window.AnimationInfo = i)
},
381: function (t, e, n) {
'use strict'
function CountdownAnimate(t) {
if (
((this.$dom = t),
(this.$html = this.$dom.find('.counter-animation')),
!this.$html.length)
) {
var e = this.$dom.text()
;(this.$html = $(
'<div class="counter-animation" style="display: none;"></div>'
)),
this.$html.append('<div class="counter-wrapper"></div>'),
this.$html
.find('.counter-wrapper')
.append('<div class="counter-html"></div>'),
this.$html
.find('.counter-html')
.append($('<div class="old-val"></div>')),
this.$html
.find('.counter-html')
.append($('<div class="new-val"></div>')),
this.$dom.empty(),
this.$dom.append($('<span class="start-val"></span>').text(e)),
this.$dom.append(this.$html)
}
this.onResize(),
$(window).on(
'resize',
function () {
this.onResize()
}.bind(this)
)
}
;(t.exports = CountdownAnimate),
(CountdownAnimate.prototype.rollNumber = function (t, props) {
if (!this.$dom.is('.updating')) {
this.$dom.addClass('updating')
var e = this.getOldVal(),
n = this.$dom.find('.start-val'),
i = this.$dom.find('.counter-animation'),
o = 350
if (props.animationSpeed)
o = props.animationSpeed > 20 ? props.animationSpeed - 20 : 0
this.$html.find('.old-val').text(e),
this.$html.find('.new-val').text(t),
this.$html.find('.counter-html').css('top', 0),
requestAnimationFrame(
function () {
n.css('display', 'none'), i.css('display', 'flex')
}.bind(this)
),
this.$html.find('.counter-html').animate(
{ top: -this.height + 'px' },
o,
'swing',
function () {
requestAnimationFrame(
function () {
n.text(t),
n.css('display', 'inline-block'),
i.css('display', 'none'),
this.$dom.removeClass('updating')
}.bind(this)
)
}.bind(this)
)
}
}),
(CountdownAnimate.prototype.onResize = function () {
;(this.height = this.$dom.height()),
this.$html.find('.counter-wrapper').css('height', this.height + 'px')
}),
(CountdownAnimate.prototype.getOldVal = function () {
return this.$dom.find('.start-val').text()
})
},
410: function (t, e, n) {
'use strict'
function HorizontalLayoutSlider(slider, t) {
if (slider && slider.length) {
var e = slider.children('.u-gallery-inner, .u-repeater')
if (e.length) {
this.viewport = e
var n = slider.children('.u-gallery-nav')
if (n.length) {
if (
((this.controls = n),
(this.data = {
offset: 0,
width: 0,
scrollWidth: 0,
maxOffset: 0,
}),
t)
)
(this._onScroll = this.onScroll.bind(this)),
(this._onlazyloaded = this.onlazyloaded.bind(this)),
this.viewport.scroll(this._onScroll),
this.viewport.find('img.lazyload').each(
function (t, e) {
e.onload = this._onlazyloaded
}.bind(this)
)
if ((this.updateInnerData(), t)) this.updateControls()
}
}
}
}
;(t.exports = HorizontalLayoutSlider),
(HorizontalLayoutSlider.prototype.onScroll = function () {
requestAnimationFrame(this.updateControls.bind(this))
}),
(HorizontalLayoutSlider.prototype.onlazyloaded = function t() {
this.updateInnerData(), this.updateControls()
}),
(HorizontalLayoutSlider.prototype.updateControls = function () {
this.updateOffset()
}),
(HorizontalLayoutSlider.prototype.updateOffset = function () {
this.data.offset = this.viewport.scrollLeft()
}),
(HorizontalLayoutSlider.prototype.updateInnerData = function () {
if (this.data && this.viewport && this.viewport[0]) {
;(this.data.scrollWidth = this.viewport[0].scrollWidth),
(this.data.width = this.viewport.innerWidth())
var t = this.viewport.scrollLeft()
this.scrollToEnd(),
(this.data.maxOffset = this.viewport.scrollLeft()),
this.viewport.scrollLeft(t)
}
}),
(HorizontalLayoutSlider.prototype.navigate = function (t) {
if (!t.hasClass('u-hidden') && this.viewport) {
this.updateInnerData(), this.updateOffset()
var e = 1
if ('undefined' != typeof app) e = app.editor.preview.scale
var n = this.data.offset,
i = this.data.width - 50,
o = this.viewport
.children()
.toArray()
.map(function (t) {
return n + Math.round($(t).position().left / e)
})
o.push(this.data.maxOffset + this.data.width)
var a = function (t) {
return o.reduce(function (e, n) {
return Math.abs(n - t) < Math.abs(e - t) ? n : e
})
}
if (t.hasClass('u-gallery-nav-next')) {
var s = a(n + i)
if (s >= this.data.scrollWidth) s = 0
this.viewport[0].scrollTo({ left: s, behavior: 'smooth' })
} else if (n >= 0) {
var u = a(n + this.data.width - i) - this.data.width
if (Math.abs(u) === this.data.width) u = this.data.scrollWidth
this.viewport[0].scrollTo({ left: u, behavior: 'smooth' })
}
}
}),
(HorizontalLayoutSlider.prototype.scrollToEnd = function () {
if (this.viewport && this.data)
this.viewport.scrollLeft(this.data.scrollWidth)
}),
(window._npHorizontalLayoutSlider = HorizontalLayoutSlider)
},
411: function (t, e, n) {
'use strict'
var i = (t.exports = function t() {
;(this.expr = null), (this.tokens = [])
})
;(i.prototype.replace = function replace(t, e) {
;(t = t.toUpperCase()),
(this.tokens = this.getTokens(t, e).sort(function (t, e) {
return e.length - t.length
}))
for (var n = 0; n < this.tokens.length; n++)
t = t
.split(this.tokens[n].toUpperCase())
.join(' ' + e[this.tokens[n]] + ' ')
return (this.expr = t), this
}),
(i.prototype.getTokens = function t(e, n) {
return (
(e = e.toUpperCase()),
Object.keys(n)
.filter(function (t) {
return /^[a-zA-Z_$][\w$-]*$/.test(t)
})
.filter(function (t) {
return e.includes(t.toUpperCase())
})
)
})
},
457: function (t, e) {
t.exports = [
{ code: 'US', name: 'United States' },
{ code: 'GB', name: 'United Kingdom' },
{ code: 'AF', name: 'Afghanistan' },
{ code: 'AX', name: 'Åland Islands' },
{ code: 'AL', name: 'Albania' },
{ code: 'DZ', name: 'Algeria' },
{ code: 'AS', name: 'American Samoa' },
{ code: 'AD', name: 'Andorra' },
{ code: 'AO', name: 'Angola' },
{ code: 'AI', name: 'Anguilla' },
{ code: 'AQ', name: 'Antarctica' },
{ code: 'AG', name: 'Antigua and Barbuda' },
{ code: 'AR', name: 'Argentina' },
{ code: 'AM', name: 'Armenia' },
{ code: 'AW', name: 'Aruba' },
{ code: 'AU', name: 'Australia' },
{ code: 'AT', name: 'Austria' },
{ code: 'AZ', name: 'Azerbaijan' },
{ code: 'BS', name: 'Bahamas' },
{ code: 'BH', name: 'Bahrain' },
{ code: 'BD', name: 'Bangladesh' },
{ code: 'BB', name: 'Barbados' },
{ code: 'BY', name: 'Belarus' },
{ code: 'BE', name: 'Belgium' },
{ code: 'BZ', name: 'Belize' },
{ code: 'BJ', name: 'Benin' },
{ code: 'BM', name: 'Bermuda' },
{ code: 'BT', name: 'Bhutan' },
{ code: 'BO', name: 'Bolivia, Plurinational State of' },
{ code: 'BQ', name: 'Bonaire, Sint Eustatius and Saba' },
{ code: 'BA', name: 'Bosnia and Herzegovina' },
{ code: 'BW', name: 'Botswana' },
{ code: 'BV', name: 'Bouvet Island' },
{ code: 'BR', name: 'Brazil' },
{ code: 'IO', name: 'British Indian Ocean Territory' },
{ code: 'BN', name: 'Brunei Darussalam' },
{ code: 'BG', name: 'Bulgaria' },
{ code: 'BF', name: 'Burkina Faso' },
{ code: 'BI', name: 'Burundi' },
{ code: 'KH', name: 'Cambodia' },
{ code: 'CM', name: 'Cameroon' },
{ code: 'CA', name: 'Canada' },
{ code: 'CV', name: 'Cape Verde' },
{ code: 'KY', name: 'Cayman Islands' },
{ code: 'CF', name: 'Central African Republic' },
{ code: 'TD', name: 'Chad' },
{ code: 'CL', name: 'Chile' },
{ code: 'CN', name: 'China' },
{ code: 'CX', name: 'Christmas Island' },
{ code: 'CC', name: 'Cocos (Keeling) Islands' },
{ code: 'CO', name: 'Colombia' },
{ code: 'KM', name: 'Comoros' },
{ code: 'CG', name: 'Congo' },
{ code: 'CD', name: 'Congo, the Democratic Republic of the' },
{ code: 'CK', name: 'Cook Islands' },
{ code: 'CR', name: 'Costa Rica' },
{ code: 'CI', name: "Côte d'Ivoire" },
{ code: 'HR', name: 'Croatia' },
{ code: 'CU', name: 'Cuba' },
{ code: 'CW', name: 'Curaçao' },
{ code: 'CY', name: 'Cyprus' },
{ code: 'CZ', name: 'Czech Republic' },
{ code: 'DK', name: 'Denmark' },
{ code: 'DJ', name: 'Djibouti' },
{ code: 'DM', name: 'Dominica' },
{ code: 'DO', name: 'Dominican Republic' },
{ code: 'EC', name: 'Ecuador' },
{ code: 'EG', name: 'Egypt' },
{ code: 'SV', name: 'El Salvador' },
{ code: 'GQ', name: 'Equatorial Guinea' },
{ code: 'ER', name: 'Eritrea' },
{ code: 'EE', name: 'Estonia' },
{ code: 'ET', name: 'Ethiopia' },
{ code: 'FK', name: 'Falkland Islands (Malvinas)' },
{ code: 'FO', name: 'Faroe Islands' },
{ code: 'FJ', name: 'Fiji' },
{ code: 'FI', name: 'Finland' },
{ code: 'FR', name: 'France' },
{ code: 'GF', name: 'French Guiana' },
{ code: 'PF', name: 'French Polynesia' },
{ code: 'TF', name: 'French Southern Territories' },
{ code: 'GA', name: 'Gabon' },
{ code: 'GM', name: 'Gambia' },
{ code: 'GE', name: 'Georgia' },
{ code: 'DE', name: 'Germany' },
{ code: 'GH', name: 'Ghana' },
{ code: 'GI', name: 'Gibraltar' },
{ code: 'GR', name: 'Greece' },
{ code: 'GL', name: 'Greenland' },
{ code: 'GD', name: 'Grenada' },
{ code: 'GP', name: 'Guadeloupe' },
{ code: 'GU', name: 'Guam' },
{ code: 'GT', name: 'Guatemala' },
{ code: 'GG', name: 'Guernsey' },
{ code: 'GN', name: 'Guinea' },
{ code: 'GW', name: 'Guinea-Bissau' },
{ code: 'GY', name: 'Guyana' },
{ code: 'HT', name: 'Haiti' },
{ code: 'HM', name: 'Heard Island and McDonald Islands' },
{ code: 'VA', name: 'Holy See (Vatican City State)' },
{ code: 'HN', name: 'Honduras' },
{ code: 'HK', name: 'Hong Kong' },
{ code: 'HU', name: 'Hungary' },
{ code: 'IS', name: 'Iceland' },
{ code: 'IN', name: 'India' },
{ code: 'ID', name: 'Indonesia' },
{ code: 'IR', name: 'Iran, Islamic Republic of' },
{ code: 'IQ', name: 'Iraq' },
{ code: 'IE', name: 'Ireland' },
{ code: 'IM', name: 'Isle of Man' },
{ code: 'IL', name: 'Israel' },
{ code: 'IT', name: 'Italy' },
{ code: 'JM', name: 'Jamaica' },
{ code: 'JP', name: 'Japan' },
{ code: 'JE', name: 'Jersey' },
{ code: 'JO', name: 'Jordan' },
{ code: 'KZ', name: 'Kazakhstan' },
{ code: 'KE', name: 'Kenya' },
{ code: 'KI', name: 'Kiribati' },
{ code: 'KP', name: "Korea, Democratic People's Republic of" },
{ code: 'KR', name: 'Korea, Republic of' },
{ code: 'KW', name: 'Kuwait' },
{ code: 'KG', name: 'Kyrgyzstan' },
{ code: 'LA', name: "Lao People's Democratic Republic" },
{ code: 'LV', name: 'Latvia' },
{ code: 'LB', name: 'Lebanon' },
{ code: 'LS', name: 'Lesotho' },
{ code: 'LR', name: 'Liberia' },
{ code: 'LY', name: 'Libya' },
{ code: 'LI', name: 'Liechtenstein' },
{ code: 'LT', name: 'Lithuania' },
{ code: 'LU', name: 'Luxembourg' },
{ code: 'MO', name: 'Macao' },
{ code: 'MK', name: 'Macedonia, the former Yugoslav Republic of' },
{ code: 'MG', name: 'Madagascar' },
{ code: 'MW', name: 'Malawi' },
{ code: 'MY', name: 'Malaysia' },
{ code: 'MV', name: 'Maldives' },
{ code: 'ML', name: 'Mali' },
{ code: 'MT', name: 'Malta' },
{ code: 'MH', name: 'Marshall Islands' },
{ code: 'MQ', name: 'Martinique' },
{ code: 'MR', name: 'Mauritania' },
{ code: 'MU', name: 'Mauritius' },
{ code: 'YT', name: 'Mayotte' },
{ code: 'MX', name: 'Mexico' },
{ code: 'FM', name: 'Micronesia, Federated States of' },
{ code: 'MD', name: 'Moldova, Republic of' },
{ code: 'MC', name: 'Monaco' },
{ code: 'MN', name: 'Mongolia' },
{ code: 'ME', name: 'Montenegro' },
{ code: 'MS', name: 'Montserrat' },
{ code: 'MA', name: 'Morocco' },
{ code: 'MZ', name: 'Mozambique' },
{ code: 'MM', name: 'Myanmar' },
{ code: 'NA', name: 'Namibia' },
{ code: 'NR', name: 'Nauru' },
{ code: 'NP', name: 'Nepal' },
{ code: 'NL', name: 'Netherlands' },
{ code: 'NC', name: 'New Caledonia' },
{ code: 'NZ', name: 'New Zealand' },
{ code: 'NI', name: 'Nicaragua' },
{ code: 'NE', name: 'Niger' },
{ code: 'NG', name: 'Nigeria' },
{ code: 'NU', name: 'Niue' },
{ code: 'NF', name: 'Norfolk Island' },
{ code: 'MP', name: 'Northern Mariana Islands' },
{ code: 'NO', name: 'Norway' },
{ code: 'OM', name: 'Oman' },
{ code: 'PK', name: 'Pakistan' },
{ code: 'PW', name: 'Palau' },
{ code: 'PS', name: 'Palestinian Territory, Occupied' },
{ code: 'PA', name: 'Panama' },
{ code: 'PG', name: 'Papua New Guinea' },
{ code: 'PY', name: 'Paraguay' },
{ code: 'PE', name: 'Peru' },
{ code: 'PH', name: 'Philippines' },
{ code: 'PN', name: 'Pitcairn' },
{ code: 'PL', name: 'Poland' },
{ code: 'PT', name: 'Portugal' },
{ code: 'PR', name: 'Puerto Rico' },
{ code: 'QA', name: 'Qatar' },
{ code: 'RE', name: 'Réunion' },
{ code: 'RO', name: 'Romania' },
{ code: 'RU', name: 'Russian Federation' },
{ code: 'RW', name: 'Rwanda' },
{ code: 'BL', name: 'Saint Barthélemy' },
{ code: 'SH', name: 'Saint Helena, Ascension and Tristan da Cunha' },
{ code: 'KN', name: 'Saint Kitts and Nevis' },
{ code: 'LC', name: 'Saint Lucia' },
{ code: 'MF', name: 'Saint Martin (French part)' },
{ code: 'PM', name: 'Saint Pierre and Miquelon' },
{ code: 'VC', name: 'Saint Vincent and the Grenadines' },
{ code: 'WS', name: 'Samoa' },
{ code: 'SM', name: 'San Marino' },
{ code: 'ST', name: 'Sao Tome and Principe' },
{ code: 'SA', name: 'Saudi Arabia' },
{ code: 'SN', name: 'Senegal' },
{ code: 'RS', name: 'Serbia' },
{ code: 'SC', name: 'Seychelles' },
{ code: 'SL', name: 'Sierra Leone' },
{ code: 'SG', name: 'Singapore' },
{ code: 'SX', name: 'Sint Maarten (Dutch part)' },
{ code: 'SK', name: 'Slovakia' },
{ code: 'SI', name: 'Slovenia' },
{ code: 'SB', name: 'Solomon Islands' },
{ code: 'SO', name: 'Somalia' },
{ code: 'ZA', name: 'South Africa' },
{ code: 'GS', name: 'South Georgia and the South Sandwich Islands' },
{ code: 'SS', name: 'South Sudan' },
{ code: 'ES', name: 'Spain' },
{ code: 'LK', name: 'Sri Lanka' },
{ code: 'SD', name: 'Sudan' },
{ code: 'SR', name: 'Suriname' },
{ code: 'SJ', name: 'Svalbard and Jan Mayen' },
{ code: 'SZ', name: 'Swaziland' },
{ code: 'SE', name: 'Sweden' },
{ code: 'CH', name: 'Switzerland' },
{ code: 'SY', name: 'Syrian Arab Republic' },
{ code: 'TW', name: 'Taiwan' },
{ code: 'TJ', name: 'Tajikistan' },
{ code: 'TZ', name: 'Tanzania, United Republic of' },
{ code: 'TH', name: 'Thailand' },
{ code: 'TL', name: 'Timor-Leste' },
{ code: 'TG', name: 'Togo' },
{ code: 'TK', name: 'Tokelau' },
{ code: 'TO', name: 'Tonga' },
{ code: 'TT', name: 'Trinidad and Tobago' },
{ code: 'TN', name: 'Tunisia' },
{ code: 'TR', name: 'Turkey' },
{ code: 'TM', name: 'Turkmenistan' },
{ code: 'TC', name: 'Turks and Caicos Islands' },
{ code: 'TV', name: 'Tuvalu' },
{ code: 'UG', name: 'Uganda' },
{ code: 'UA', name: 'Ukraine' },
{ code: 'AE', name: 'United Arab Emirates' },
{ code: 'GB', name: 'United Kingdom' },
{ code: 'US', name: 'United States' },
{ code: 'UM', name: 'United States Minor Outlying Islands' },
{ code: 'UY', name: 'Uruguay' },
{ code: 'UZ', name: 'Uzbekistan' },
{ code: 'VU', name: 'Vanuatu' },
{ code: 'VE', name: 'Venezuela, Bolivarian Republic of' },
{ code: 'VN', name: 'Viet Nam' },
{ code: 'VG', name: 'Virgin Islands, British' },
{ code: 'VI', name: 'Virgin Islands, U.S.' },
{ code: 'WF', name: 'Wallis and Futuna' },
{ code: 'EH', name: 'Western Sahara' },
{ code: 'YE', name: 'Yemen' },
{ code: 'ZM', name: 'Zambia' },
{ code: 'ZW', name: 'Zimbabwe' },
]
},
513: function (t, e) {
var e = void 0,
t = void 0
;(function () {
/*!
* https://github.com/gilmoreorless/css-background-parser
* Copyright © 2015 Gilmore Davidson under the MIT license: http://gilmoreorless.mit-license.org/
*/
!(function (t) {
function e(t) {
if (!(this instanceof e)) return new e()
this.backgrounds = t || []
}
function Background(props) {
function t(t, n) {
e[t] = t in props ? props[t] : n
}
if (!(this instanceof Background)) return new Background(props)
props = props || {}
var e = this
t('color', ''),
t('image', ''),
t('attachment', ''),
t('clip', ''),
t('origin', ''),
t('position', ''),
t('repeat', ''),
t('size', '')
}
function n(t) {
var e = [],
n = /[,\(\)]/,
i = 0,
o = ''
if (null == t) return e
for (; t.length; ) {
var a = n.exec(t)
if (!a) break
var s,
u = false
switch (a[0]) {
case ',':
if (!i) e.push(o.trim()), (o = ''), (u = true)
break
case '(':
i++
break
case ')':
i--
break
}
var index = a.index + 1
;(o += t.slice(0, u ? index - 1 : index)), (t = t.slice(index))
}
if (o.length || t.length) e.push((o + t).trim())
return e.filter(function (t) {
return 'none' !== t
})
}
function i(t) {
return t.trim()
}
function o(t) {
return (t || '').split(',').map(i)
}
;(e.prototype.toString = function t(props) {
return this.backgrounds
.map(function (t) {
return t.toString(props)
})
.filter(function (t) {
return t
})
.join(', ')
}),
(Background.prototype.toString = function t(props) {
props = props || [
'image',
'repeat',
'attachment',
'position',
'size',
'origin',
'clip',
]
var size =
(props = Array.isArray(props) ? props : [props]).includes(
'size'
) && this.size
? ' / ' + this.size
: '',
list = [
props.includes('image') ? this.image : '',
props.includes('repeat') ? this.repeat : '',
props.includes('attachment') ? this.attachment : '',
props.includes('position') ? this.position + size : '',
props.includes('origin') ? this.origin : '',
props.includes('clip') ? this.clip : '',
]
if (this.color) list.unshift(this.color)
return list
.filter(function (t) {
return t
})
.join(' ')
}),
(t.BackgroundList = e),
(t.Background = Background),
(t.parseElementStyle = function (t) {
var list = new e()
if (null == t) return list
for (
var i = n(t.backgroundImage),
a = t.backgroundColor,
s = o(t.backgroundAttachment),
u = o(t.backgroundClip),
l = o(t.backgroundOrigin),
c = o(t.backgroundPosition),
f = o(t.backgroundRepeat),
h = o(t.backgroundSize),
background,
p = 0,
m = i.length;
p < m;
p++
) {
if (
((background = new Background({
image: i[p],
attachment: s[p % s.length],
clip: u[p % u.length],
origin: l[p % l.length],
position: c[p % c.length],
repeat: f[p % f.length],
size: h[p % h.length],
})),
p === m - 1)
)
background.color = a
list.backgrounds.push(background)
}
return list
})
})(
(function (e) {
if (void 0 !== t && void 0 !== t.exports) return t.exports
else return (e.cssBgParser = {})
})(this)
)
}).call(window)
},
532: function (t, e, n) {
'use strict'
function i(t) {
var e = t.length
if (e % 4 > 0)
throw new Error('Invalid string. Length must be a multiple of 4')
var n = t.indexOf('='),
i
if (-1 === n) n = e
return [n, n === e ? 0 : 4 - (n % 4)]
}
function o(t) {
var e = i(t),
n = e[0],
o = e[1]
return (3 * (n + o)) / 4 - o
}
function a(t, e, n) {
return (3 * (e + n)) / 4 - n
}
function s(t) {
var e,
n = i(t),
o = n[0],
s = n[1],
u = new p(a(t, o, s)),
l = 0,
c = s > 0 ? o - 4 : o,
f
for (f = 0; f < c; f += 4)
(e =
(h[t.charCodeAt(f)] << 18) |
(h[t.charCodeAt(f + 1)] << 12) |
(h[t.charCodeAt(f + 2)] << 6) |
h[t.charCodeAt(f + 3)]),
(u[l++] = (e >> 16) & 255),
(u[l++] = (e >> 8) & 255),
(u[l++] = 255 & e)
if (2 === s)
(e = (h[t.charCodeAt(f)] << 2) | (h[t.charCodeAt(f + 1)] >> 4)),
(u[l++] = 255 & e)
if (1 === s)
(e =
(h[t.charCodeAt(f)] << 10) |
(h[t.charCodeAt(f + 1)] << 4) |
(h[t.charCodeAt(f + 2)] >> 2)),
(u[l++] = (e >> 8) & 255),
(u[l++] = 255 & e)
return u
}
function u(t) {
return (
f[(t >> 18) & 63] + f[(t >> 12) & 63] + f[(t >> 6) & 63] + f[63 & t]
)
}
function l(t, e, n) {
for (var i, o = [], a = e; a < n; a += 3)
(i =
((t[a] << 16) & 16711680) +
((t[a + 1] << 8) & 65280) +
(255 & t[a + 2])),
o.push(u(i))
return o.join('')
}
function c(t) {
for (
var e, n = t.length, i = n % 3, o = [], a = 16383, s = 0, u = n - i;
s < u;
s += a
)
o.push(l(t, s, s + a > u ? u : s + a))
if (1 === i) (e = t[n - 1]), o.push(f[e >> 2] + f[(e << 4) & 63] + '==')
else if (2 === i)
(e = (t[n - 2] << 8) + t[n - 1]),
o.push(f[e >> 10] + f[(e >> 4) & 63] + f[(e << 2) & 63] + '=')
return o.join('')
}
;(e.byteLength = o), (e.toByteArray = s), (e.fromByteArray = c)
for (
var f = [],
h = [],
p = 'undefined' != typeof Uint8Array ? Uint8Array : Array,
m = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/',
g = 0,
v = m.length;
g < v;
++g
)
(f[g] = m[g]), (h[m.charCodeAt(g)] = g)
;(h['-'.charCodeAt(0)] = 62), (h['_'.charCodeAt(0)] = 63)
},
533: function (t, e, n) {
'use strict'
/*! ieee754. BSD-3-Clause License. Feross Aboukhadijeh <https://feross.org/opensource> */
;(e.read = function (t, e, n, i, o) {
var a,
s,
u = 8 * o - i - 1,
l = (1 << u) - 1,
c = l >> 1,
f = -7,
h = n ? o - 1 : 0,
d = n ? -1 : 1,
p = t[e + h]
for (
h += d, a = p & ((1 << -f) - 1), p >>= -f, f += u;
f > 0;
a = 256 * a + t[e + h], h += d, f -= 8
);
for (
s = a & ((1 << -f) - 1), a >>= -f, f += i;
f > 0;
s = 256 * s + t[e + h], h += d, f -= 8
);
if (0 === a) a = 1 - c
else if (a === l) return s ? NaN : (p ? -1 : 1) * (1 / 0)
else (s += Math.pow(2, i)), (a -= c)
return (p ? -1 : 1) * s * Math.pow(2, a - i)
}),
(e.write = function (t, e, n, i, o, a) {
var s,
u,
l,
c = 8 * a - o - 1,
f = (1 << c) - 1,
h = f >> 1,
p = 23 === o ? Math.pow(2, -24) - Math.pow(2, -77) : 0,
m = i ? 0 : a - 1,
d = i ? 1 : -1,
g = e < 0 || (0 === e && 1 / e < 0) ? 1 : 0
if (((e = Math.abs(e)), isNaN(e) || e === 1 / 0))
(u = isNaN(e) ? 1 : 0), (s = f)
else {
if (
((s = Math.floor(Math.log(e) / Math.LN2)),
e * (l = Math.pow(2, -s)) < 1)
)
s--, (l *= 2)
if (s + h >= 1) e += p / l
else e += p * Math.pow(2, 1 - h)
if (e * l >= 2) s++, (l /= 2)
if (s + h >= f) (u = 0), (s = f)
else if (s + h >= 1) (u = (e * l - 1) * Math.pow(2, o)), (s += h)
else (u = e * Math.pow(2, h - 1) * Math.pow(2, o)), (s = 0)
}
for (; o >= 8; t[n + m] = 255 & u, m += d, u /= 256, o -= 8);
for (
s = (s << o) | u, c += o;
c > 0;
t[n + m] = 255 & s, m += d, s /= 256, c -= 8
);
t[n + m - d] |= 128 * g
})
},
534: function (t, e, n) {
'use strict'
var i = {}.toString
t.exports =
Array.isArray ||
function (t) {
return '[object Array]' == i.call(t)
}
},
538: function (t, e, n) {
'use strict'
function PaginationBuilder(pagination, data, t) {
;(this.data = data),
(this.options = t),
(this.pagination = pagination.clone())
var e = this.pagination.attr('data-pagination-options')
if (e) this.styleOptions = JSON.parse(e)
else {
var n = this.pagination.find('li:not(.disabled):not(.active)'),
i = n.find('a')
this.styleOptions = {
ul:
'style="' +
(this.pagination.attr('style') || '') +
'" class="' +
(this.pagination.attr('class') || '') +
'"',
li:
'style="' +
(n.attr('style') || '') +
'" class="' +
(n.attr('class') || '') +
'"',
link:
'style="' +
(i.attr('style') || '') +
'" class="' +
(i.attr('class') || '') +
'"',
}
}
}
function i(t, e, n) {
if (0 === t) return { active: false, data: '<span>《</span>' }
else
return {
active: true,
data:
'<a title="Start" href="' +
(n ? '#1' : '../' + e) +
'">《</a>',
}
var i
}
function o(t, e, n) {
if (0 === t) return { active: false, data: '<span>〈</span>' }
var i
if (n) i = 1 === t ? '#' + t : '#1'
else
(t = t - 1 ? '_' + t : ''),
(i = '../' + e.replace(/\.html/i, t + '.html'))
return {
active: true,
data: '<a title="Prev" href="' + i + '">〈</a>',
}
}
function a(t, e, n, i) {
var o = t + 1,
a
if (o >= i) return { active: false, data: '<span>〉</span>' }
if (n) a = '#' + (o + 1)
else a = '../' + e.replace(/\.html/i, '_' + o + '.html')
return {
active: true,
data: '<a title="Next" href="' + a + '">〉</a>',
}
}
function s(t, e, n, i) {
var o, a
if (t + 1 >= i) return { active: false, data: '<span>》</span>' }
if (n) a = '#' + i
else a = '../' + e.replace(/\.html/, '_' + (i - 1) + '.html')
return {
active: true,
data: '<a title="End" href="' + a + '">》</a>',
}
}
function u(t, e, n, i) {
for (var o = [], all = i, a = 0, s = 1, u = 1; all > a; ) {
var l = true,
c
if (n) c = '#' + (a ? a + 1 : '1')
else c = '../' + e.replace(/\.html/, (a ? '_' + a : '') + '.html')
var data = '<a href="' + c + '">' + s + '</a>'
if (a === t) (l = false), (data = '<span>' + s + '</span>'), (u = s)
o.push({ active: l, data: data }), a++, s++
}
var f = 10,
h = 5
if (o.length > f) {
var p = o.slice(0, u),
m = o.slice(u),
g,
v
if (p.length < h) (g = p), (v = o.slice(u, f - g.length))
else if (m.length < h) {
var y = f - (v = m).length
g = o.slice(u - y, y)
} else (g = o.slice(u - h, h)), (v = o.slice(u, h))
o = g.concat(v)
}
return o
}
;(t.exports = PaginationBuilder),
(PaginationBuilder.prototype.getPagination = function (t) {
var e = this.data.listItems.length,
list = this.buildPagination(t, e),
n = this.styleOptions.ul,
i = this.styleOptions.li,
o = i.replace('class="', 'class="active '),
a = i.replace('class="', 'class="start '),
s = i.replace('class="', 'class="prev '),
u = i.replace('class="', 'class="next '),
l = i.replace('class="', 'class="end '),
link = this.styleOptions.link,
html = [],
c = document.createElement('ul')
if (
(c.setAttribute(
'data-pagination-options',
JSON.stringify(this.styleOptions)
),
html.push(
c.outerHTML.replace('<ul', '<ul ' + n).replace('</ul>', '')
),
list.start.active)
)
html.push('<li ' + a + '>'),
html.push(list.start.data),
html.push('</li>')
if (list.previous.active)
html.push('<li ' + s + '>'),
html.push(list.previous.data),
html.push('</li>')
for (var f = 0; f < list.pages.length; f++) {
var page = list.pages[f]
html.push('<li ' + (page.active ? i : o) + '>' + page.data + '</li>')
}
if (list.next.active)
html.push('<li ' + u + '>'),
html.push(list.next.data),
html.push('</li>')
if (list.end.active)
html.push('<li ' + l + '>'),
html.push(list.end.data),
html.push('</li>')
return (
html.push('</ul>'),
(html = (html = (html = html.join('')).replace(
/<a /g,
'<a ' + link + ' '
)).replace(/<span/g, '<span ' + link + ' '))
)
}),
(PaginationBuilder.prototype.buildPagination = function (t, e) {
var list = {},
n = this.options.isPage,
l = this.options.listHref
return (
(list.start = i(t, l, n)),
(list.previous = o(t, l, n)),
(list.pages = u(t, l, n, e)),
(list.next = a(t, l, n, e)),
(list.end = s(t, l, n, e)),
list
)
}),
(window.PaginationBuilder = PaginationBuilder)
},
541: function (t, e, n) {
'use strict'
;(function (t, e) {
!(function (t, n) {
function i(t) {
if ('function' != typeof t) t = new Function('' + t)
for (
var e = new Array(arguments.length - 1), n = 0;
n < e.length;
n++
)
e[n] = arguments[n + 1]
var i = { callback: t, args: e }
return (g[m] = i), w(m), m++
}
function o(t) {
delete g[t]
}
function a(t) {
var e = t.callback,
i = t.args
switch (i.length) {
case 0:
e()
break
case 1:
e(i[0])
break
case 2:
e(i[0], i[1])
break
case 3:
e(i[0], i[1], i[2])
break
default:
e.apply(n, i)
break
}
}
function s(t) {
if (v) setTimeout(s, 0, t)
else {
var e = g[t]
if (e) {
v = true
try {
a(e)
} finally {
o(t), (v = false)
}
}
}
}
function u() {
w = function (t) {
e.nextTick(function () {
s(t)
})
}
}
function l() {
if (t.postMessage && !t.importScripts) {
var e = true,
n = t.onmessage
return (
(t.onmessage = function () {
e = false
}),
t.postMessage('', '*'),
(t.onmessage = n),
e
)
}
}
function c() {
var e = 'setImmediate$' + Math.random() + '$',
n = function (n) {
if (
n.source === t &&
'string' == typeof n.data &&
0 === n.data.indexOf(e)
)
s(+n.data.slice(e.length))
}
if (t.addEventListener) t.addEventListener('message', n, false)
else t.attachEvent('onmessage', n)
w = function (n) {
t.postMessage(e + n, '*')
}
}
function f() {
var t = new MessageChannel()
;(t.port1.onmessage = function (t) {
var e
s(t.data)
}),
(w = function (e) {
t.port2.postMessage(e)
})
}
function h() {
var html = y.documentElement
w = function (t) {
var e = y.createElement('script')
;(e.onreadystatechange = function () {
s(t),
(e.onreadystatechange = null),
html.removeChild(e),
(e = null)
}),
html.appendChild(e)
}
}
function p() {
w = function (t) {
setTimeout(s, 0, t)
}
}
if (!t.setImmediate) {
var m = 1,
g = {},
v = false,
y = t.document,
w,
b = Object.getPrototypeOf && Object.getPrototypeOf(t)
if (
((b = b && b.setTimeout ? b : t),
'[object process]' === {}.toString.call(t.process))
)
u()
else if (l()) c()
else if (t.MessageChannel) f()
else if (y && 'onreadystatechange' in y.createElement('script')) h()
else p()
;(b.setImmediate = i), (b.clearImmediate = o)
}
})('undefined' == typeof self ? (void 0 === t ? this : t) : self)
}).call(e, n(60), n(116))
},
543: function (t, e, n) {
'use strict'
;(function (e) {
function n(input, t) {
var e = 0,
base = t.length,
n = t.charAt(0),
i = [0]
for (e = 0; e < input.length(); ++e) {
for (var o = 0, a = input.at(e); o < i.length; ++o)
(a += i[o] << 8), (i[o] = a % base), (a = (a / base) | 0)
for (; a > 0; ) i.push(a % base), (a = (a / base) | 0)
}
var s = ''
for (e = 0; 0 === input.at(e) && e < input.length() - 1; ++e) s += n
for (e = i.length - 1; e >= 0; --e) s += t[i[e]]
return s
}
var i = {}
t.exports = i
var o = {}
;(i.encode = function (input, t, e) {
if ('string' != typeof t)
throw new TypeError('"alphabet" must be a string.')
if (void 0 !== e && 'number' != typeof e)
throw new TypeError('"maxline" must be a number.')
var i = ''
if (!(input instanceof Uint8Array)) i = n(input, t)
else {
var o = 0,
base = t.length,
a = t.charAt(0),
s = [0]
for (o = 0; o < input.length; ++o) {
for (var u = 0, l = input[o]; u < s.length; ++u)
(l += s[u] << 8), (s[u] = l % base), (l = (l / base) | 0)
for (; l > 0; ) s.push(l % base), (l = (l / base) | 0)
}
for (o = 0; 0 === input[o] && o < input.length - 1; ++o) i += a
for (o = s.length - 1; o >= 0; --o) i += t[s[o]]
}
if (e) {
var c = new RegExp('.{1,' + e + '}', 'g')
i = i.match(c).join('\r\n')
}
return i
}),
(i.decode = function (input, t) {
if ('string' != typeof input)
throw new TypeError('"input" must be a string.')
if ('string' != typeof t)
throw new TypeError('"alphabet" must be a string.')
var table = o[t]
if (!table) {
table = o[t] = []
for (var n = 0; n < t.length; ++n) table[t.charCodeAt(n)] = n
}
input = input.replace(/\s/g, '')
for (
var base = t.length, i = t.charAt(0), a = [0], n = 0;
n < input.length;
n++
) {
var s = table[input.charCodeAt(n)]
if (void 0 === s) return
for (var u = 0, l = s; u < a.length; ++u)
(l += a[u] * base), (a[u] = 255 & l), (l >>= 8)
for (; l > 0; ) a.push(255 & l), (l >>= 8)
}
for (var c = 0; input[c] === i && c < input.length - 1; ++c) a.push(0)
if (void 0 !== e) return e.from(a.reverse())
else return new Uint8Array(a.reverse())
})
}).call(e, n(62).Buffer)
},
55: function (t, e, n) {
'use strict'
function CountdownCommon(t) {
this.$dom = t
}
t.exports = CountdownCommon
var CountdownAnimate = n(381)
;(CountdownCommon.prototype.getDate = function () {
var date = this.$dom.attr('data-target-date')
if (date) return new Date(date)
else return new Date()
}),
(CountdownCommon.prototype.getDirection = function () {
return this.$dom.attr('data-direction') || 'down'
}),
(CountdownCommon.prototype.getTimeLeft = function () {
return this.$dom.attr('data-time-left') || '750m'
}),
(CountdownCommon.prototype.getNumber = function () {
var t = this.$dom.attr('data-target-number') || '100'
return parseInt(t, 10)
}),
(CountdownCommon.prototype.getStartTime = function () {
var date = this.$dom.attr('data-start-time')
if (date) return new Date(date)
else return new Date()
}),
(CountdownCommon.prototype.getFrequency = function () {
return this.$dom.attr('data-frequency') || '1s'
}),
(CountdownCommon.prototype.getTimerId = function () {
return this.$dom.attr('data-timer-id')
}),
(CountdownCommon.prototype.getTimerKey = function () {
return 'timer-' + this.getTimerId()
}),
(CountdownCommon.prototype.getFor = function () {
return this.$dom.attr('data-for') || 'everyone'
}),
(CountdownCommon.prototype.getType = function () {
return this.$dom.attr('data-type') || 'to-date'
}),
(CountdownCommon.prototype.setValue = function (t, e, n, props) {
var i = this.$dom.find('.u-countdown-' + t),
o = e.toString(),
a = o.length
if ('to-number' === this.getType()) {
for (; i.find('.u-countdown-number').length < a + 1; ) {
var itemDom = i.find('.u-countdown-number:eq(0)')
if (!itemDom.length) break
itemDom.clone().insertAfter(itemDom).text('0')
}
for (; i.find('.u-countdown-number').length > a + 1; )
i.find('.u-countdown-number:eq(0)').remove()
}
var s = i.find('.u-countdown-number')
if (
'hours' === t ||
'minutes' === t ||
'seconds' === t ||
'numbers' === t
)
for (; o.length < s.length; ) o = '0' + o
if (!(a > s.length))
for (var u = 0; u < s.length; u++) {
var l = $(s[u])
if (
(this.doSetVal(l, o[u], props),
n && ('years' === t || 'days' === t))
)
l.toggleClass('u-hidden', u >= a)
}
}),
(CountdownCommon.prototype.doSetVal = function (t, e, props) {
if ((props = props || {}).animation && 'none' !== props.animation) {
var n = new CountdownAnimate(t)
if (n.getOldVal() !== e) n.rollNumber(e, props)
} else if (t.text() !== e) t.text(e)
}),
(CountdownCommon.prototype.showLabel = function (t, e) {
var n = this.$dom.find('.u-countdown-' + t)
n.toggleClass('u-hidden', !e),
n
.parent()
.children('.u-countdown-separator')
.each(function (t, el) {
var e = $(el),
n = e.prev('.u-countdown-item'),
i = e.nextAll('.u-countdown-item:not(.u-hidden)')
e.toggleClass(
'u-hidden',
!(n.is(':not(.u-hidden)') && i.is(':not(.u-hidden)'))
)
})
}),
(CountdownCommon.prototype.setAfterCountFinished = function () {
this.$dom.attr('data-after-count-finished', true)
}),
(CountdownCommon.prototype.getAfterCountFinished = function () {
var t = this.$dom.attr('data-after-count-finished') || 'false'
return (t && 'true' === t) || false
}),
(CountdownCommon.prototype.getAfterCount = function () {
return this.$dom.attr('data-after-count') || 'none'
}),
(CountdownCommon.prototype.getRedirectUrl = function () {
return this.$dom.attr('data-redirect-url') || 'https://'
}),
(CountdownCommon.prototype.getCountAnimation = function () {
return this.$dom.attr('data-count-animation') || 'none'
}),
(CountdownCommon.prototype.timeDiff = function (t) {
var e = new Date(),
n
if ('down' === this.getDirection())
return CountdownCommon.calcTimeDiff(t, e)
else return CountdownCommon.calcTimeDiff(e, t)
}),
(CountdownCommon.prototype.calcNumber = function (t, e, n) {
var i = CountdownCommon.timeStringToMilliseconds(n)
if (!i) return 0
var o = new Date(),
a = 'up' === this.getDirection() ? 1 : -1,
s = t + Math.floor((o - e) / i) * a
if (s < 0) return 0
else return s
}),
(CountdownCommon.prototype.parseTime = function (t, e) {
var n = CountdownCommon.timeStringToMilliseconds(t),
i = 'down' === this.getDirection() ? 1 : -1
return new Date(e.getTime() + n * i)
}),
(CountdownCommon.calcTimeDiff = function (t, e) {
if (t <= e) return CountdownCommon.emptyDiff()
var n = Math.abs(t - e) / 1e3,
i = Math.floor(n / 31536e3)
n -= 31536e3 * i
var o = Math.floor(n / 86400)
n -= 86400 * o
var a = Math.floor(n / 3600) % 24
n -= 3600 * a
var s = Math.floor(n / 60) % 60,
u
return (
(n -= 60 * s),
{ years: i, days: o, hours: a, minutes: s, seconds: Math.floor(n) }
)
}),
(CountdownCommon.emptyDiff = function () {
return { years: 0, days: 0, hours: 0, minutes: 0, seconds: 0 }
}),
(CountdownCommon.isEmptyDiff = function (diff) {
if ('number' == typeof diff) return 0 === diff
else
return (
0 === diff.years &&
0 === diff.days &&
0 === diff.hours &&
0 === diff.minutes &&
0 === diff.seconds
)
}),
(CountdownCommon.timeStringToMilliseconds = function (t) {
var data = t.match(/(\d+)(ms|s|m|h|d|)/)
if (data && 3 === data.length) {
var e = parseInt(data[1], 10)
switch (data[2]) {
case 'ms':
return e
case 's':
return 1e3 * e
case 'm':
return 60 * e * 1e3
case 'h':
return 3600 * e * 1e3
case 'd':
return 86400 * e * 1e3
default:
return 0
}
}
return 0
})
},
590: function (t, e, n) {
'use strict'
var i = t.exports
;(i.apply = function (t, state) {
if (!t)
return console.error('StepCss.apply: DOM element is not valid'), void 0
var e = 'transform, opacity, filter',
n = getComputedStyle(t)
if ('auto' === n.willChange && state.willChange)
t.style['will-change'] = 'transform, opacity, filter'
else if (n.willChange === e && !state.willChange)
t.style['will-change'] = ''
i.applyTransform(t, state),
i.applyOpacity(t, state),
i.applyFilter(t, state),
i.applyBG(t, state),
i.applyPosition(t, state)
}),
(i.applyTransform = function t(e, state) {
var transform = [],
n = parseFloat(state.mx) || 0,
i = parseFloat(state.my) || 0,
o = parseFloat(state.rot) || 0,
a = parseFloat(state.sx),
s = parseFloat(state.sy)
if (!Number.isFinite(a)) a = 1
if (!Number.isFinite(s)) s = 1
if (n) transform.push('translateX(' + n.toFixed(3) + 'px)')
if (i || state._fixedDist) {
var u = i + (state._fixedDist || 0)
transform.push('translateY(' + u.toFixed(3) + 'px)')
}
if (o) transform.push('rotate(' + o.toFixed(3) + 'deg)')
if (1 !== a || 1 !== s)
transform.push('scale(' + a.toFixed(3) + ', ' + s.toFixed(3) + ')')
if (!transform.length) transform.push('rotate(0deg)')
e.style.transform = transform.join(' ')
}),
(i.applyOpacity = function t(e, state) {
var n = parseFloat(state.op)
if (!Number.isFinite(n)) n = 1
e.style.opacity = n.toFixed(3)
}),
(i.applyFilter = function t(e, state) {
var n = parseFloat(state.blur) || 0
e.style.filter = n ? 'blur(' + n.toFixed(3) + 'px)' : ''
}),
(i.applyBG = function t(e, state) {
var n = parseFloat(state.bgy) || 0
e.style['background-position'] = '50% ' + n.toFixed(2) + 'vh'
}),
(i.applyPosition = function t(e, state) {
e.classList.toggle('u-animation-sticky', Boolean(state.sticky)),
e.classList.toggle('u-animation-fixed', Boolean(state.fixed))
}),
(window.StepCss = i)
},
594: function (t, e, n) {
'use strict'
var i = n(273).instance()
i.registerAnimation(n(595)),
i.registerAnimation(n(598)),
i.registerAnimation(n(274))
},
595: function (t, e, n) {
'use strict'
function i(t, e) {
;(this.info = t), (this.hint = e), (this.timeoutId = null)
}
var o = n(596)
;(t.exports = i),
(i.isMatch = function (t) {
return t && 'counter' === t.name
}),
(i.create = function (t, e) {
return new i(t, e)
}),
(i.prototype.init = function init() {
var t = this.info.element
if (!this.countUp && t) {
var e = /(\D*)(\d+(?:([.,])(\d+))?)(.*)/.exec(t.textContent),
n = 1,
i = 2,
a = 3,
s = 4,
u = 5
if (null !== e && e[i] && !(e[i].length > 15)) {
var l = e[i]
if (',' === e[a]) l = l.replace(',', '.')
if ((l = Number(l)) && !isNaN(l) && isFinite(l)) {
if (this.hint) this.hint.hintBrowser(this.info)
var c = 0
if (e[s]) c = e[s].length
var f = {
element: t,
prefix: e[n],
decimal: e[a],
decimals: c,
suffix: e[u],
startVal: 0,
endVal: l,
duration: this.info.durationRaw,
cycle: this.info.animationCycle,
separator: '',
}
this.countUp = new o(f)
}
}
}
}),
(i.prototype.start = function t() {
if (this.countUp) {
if ((this.countUp.reset(), this._timeoutId))
clearTimeout(this._timeoutId)
var e = function () {
;(this._timeoutId = null), this.countUp.start()
}.bind(this),
n = this.info.delay
if (isNaN(n)) n = 0
if (!n) return e(), void 0
this._timeoutId = setTimeout(e, n)
}
}),
(i.prototype.startOut = function t() {
if (this._timeoutId)
clearTimeout(this._timeoutId), (this._timeoutId = null)
}),
(i.prototype.reset = function t() {
if (this.countUp) this.countUp.reset()
}),
(i.prototype.isInOutAnimation = function t() {
return true
}),
(i.prototype.needOutAnimation = function t() {
return false
}),
(i.prototype.clear = function t() {
if (this.hint) this.hint.removeHint(this.info)
}),
(i.prototype.getTime = function t() {
if (!this.info) return 0
var e = this.info.duration,
n = this.info.delay
if (isNaN(n)) n = 0
return n + e
}),
(i.prototype.getOutTime = function t() {
return 0
})
},
596: function (t, e, n) {
'use strict'
function i(t) {
this.initialize(t)
}
function o(countUp, t, e) {
if (countUp) {
if (((t = Number(t)), isNaN(t) || !isFinite(t) || 0 === t)) t = 1
var n = 0,
i = function () {
if (++n < t) countUp.reset(), countUp.start(i)
else if ('function' == typeof e) e()
}
countUp.start(i)
}
}
n(597),
(i.prototype.initialize = function t(e) {
if (!this.countUp && e.element) {
var n = e.startVal,
i = e.endVal,
o = e.decimals,
a = e.duration
if ((n || 0 == +n) && (i || 0 == +i)) {
if (a) if (((a = Number(a) / 1e3), isNaN(a))) a = void 0
;(this.cycle = e.cycle),
(this.countUp = new CountUp(e.element, n, i, o, a, e)),
(this.started = false)
}
}
}),
(i.prototype.reset = function t() {
if (((this.started = false), this.countUp)) this.countUp.reset()
}),
(i.prototype.start = function t() {
if (this.countUp && !this.started)
(this.started = true), o(this.countUp, this.cycle)
}),
(t.exports = i)
},
597: function (t, e) {
var e = void 0,
t = void 0
;(function () {
!(function (n, factory) {
if ('function' == typeof define && define.amd) define(factory)
else if ('object' == typeof e) t.exports = factory(require, e, t)
else n.CountUp = factory()
})(this, function (t, e, n) {
var CountUp
return function (t, e, n, i, o, a) {
function s(t) {
var e, n, i, o, a, s
if (
((t = t.toFixed(c.decimals)),
(n = (e = (t += '').split('.'))[0]),
(i = e.length > 1 ? c.options.decimal + e[1] : ''),
c.options.useGrouping)
) {
for (o = '', a = 0, s = n.length; a < s; ++a) {
if (0 !== a && a % 3 == 0) o = c.options.separator + o
o = n[s - a - 1] + o
}
n = o
}
if (c.options.numerals.length)
(n = n.replace(/[0-9]/g, function (t) {
return c.options.numerals[+t]
})),
(i = i.replace(/[0-9]/g, function (t) {
return c.options.numerals[+t]
}))
return c.options.prefix + n + i + c.options.suffix
}
function u(t, e, n, d) {
return (n * (-Math.pow(2, (-10 * t) / d) + 1) * 1024) / 1023 + e
}
function l(t) {
return 'number' == typeof t && !isNaN(t)
}
var c = this
if (
((c.version = function () {
return '1.9.2'
}),
(c.options = {
useEasing: true,
useGrouping: true,
separator: ',',
decimal: '.',
easingFn: u,
formattingFn: s,
prefix: '',
suffix: '',
numerals: [],
}),
a && 'object' == typeof a)
)
for (var f in c.options)
if (a.hasOwnProperty(f) && null !== a[f]) c.options[f] = a[f]
if ('' === c.options.separator) c.options.useGrouping = false
else c.options.separator = '' + c.options.separator
for (
var h = 0, p = ['webkit', 'moz', 'ms', 'o'], m = 0;
m < p.length && !window.requestAnimationFrame;
++m
)
(window.requestAnimationFrame =
window[p[m] + 'RequestAnimationFrame']),
(window.cancelAnimationFrame =
window[p[m] + 'CancelAnimationFrame'] ||
window[p[m] + 'CancelRequestAnimationFrame'])
if (!window.requestAnimationFrame)
window.requestAnimationFrame = function (t, e) {
var n = new Date().getTime(),
i = Math.max(0, 16 - (n - h)),
id = window.setTimeout(function () {
t(n + i)
}, i)
return (h = n + i), id
}
if (!window.cancelAnimationFrame)
window.cancelAnimationFrame = function (id) {
clearTimeout(id)
}
if (
((c.initialize = function () {
if (c.initialized) return true
if (
((c.error = ''),
(c.d = 'string' == typeof t ? document.getElementById(t) : t),
!c.d)
)
return (
(c.error = '[CountUp] target is null or undefined'), false
)
if (
((c.startVal = Number(e)),
(c.endVal = Number(n)),
l(c.startVal) && l(c.endVal))
)
return (
(c.decimals = Math.max(0, i || 0)),
(c.dec = Math.pow(10, c.decimals)),
(c.duration = 1e3 * Number(o) || 2e3),
(c.countDown = c.startVal > c.endVal),
(c.frameVal = c.startVal),
(c.initialized = true),
true
)
else
return (
(c.error =
'[CountUp] startVal (' +
e +
') or endVal (' +
n +
') is not a number'),
false
)
}),
(c.printValue = function (t) {
var e = c.options.formattingFn(t)
if ('INPUT' === c.d.tagName) this.d.value = e
else if ('text' === c.d.tagName || 'tspan' === c.d.tagName)
this.d.textContent = e
else this.d.innerHTML = e
}),
(c.count = function (t) {
if (!c.startTime) c.startTime = t
c.timestamp = t
var e = t - c.startTime
if (((c.remaining = c.duration - e), c.options.useEasing))
if (c.countDown)
c.frameVal =
c.startVal -
c.options.easingFn(e, 0, c.startVal - c.endVal, c.duration)
else
c.frameVal = c.options.easingFn(
e,
c.startVal,
c.endVal - c.startVal,
c.duration
)
else if (c.countDown)
c.frameVal =
c.startVal - (c.startVal - c.endVal) * (e / c.duration)
else
c.frameVal =
c.startVal + (c.endVal - c.startVal) * (e / c.duration)
if (c.countDown)
c.frameVal = c.frameVal < c.endVal ? c.endVal : c.frameVal
else c.frameVal = c.frameVal > c.endVal ? c.endVal : c.frameVal
if (
((c.frameVal = Math.round(c.frameVal * c.dec) / c.dec),
c.printValue(c.frameVal),
e < c.duration)
)
c.rAF = requestAnimationFrame(c.count)
else if (c.callback) c.callback()
}),
(c.start = function (t) {
if (c.initialize())
(c.callback = t), (c.rAF = requestAnimationFrame(c.count))
}),
(c.pauseResume = function () {
if (!c.paused) (c.paused = true), cancelAnimationFrame(c.rAF)
else
(c.paused = false),
delete c.startTime,
(c.duration = c.remaining),
(c.startVal = c.frameVal),
requestAnimationFrame(c.count)
}),
(c.reset = function () {
if (
((c.paused = false),
delete c.startTime,
(c.initialized = false),
c.initialize())
)
cancelAnimationFrame(c.rAF), c.printValue(c.startVal)
}),
(c.update = function (t) {
if (c.initialize()) {
if (!l((t = Number(t))))
return (
(c.error =
'[CountUp] update() - new endVal is not a number: ' + t),
void 0
)
if (((c.error = ''), t !== c.frameVal))
cancelAnimationFrame(c.rAF),
(c.paused = false),
delete c.startTime,
(c.startVal = c.frameVal),
(c.endVal = t),
(c.countDown = c.startVal > c.endVal),
(c.rAF = requestAnimationFrame(c.count))
}
}),
c.initialize())
)
c.printValue(c.startVal)
}
})
}).call(window)
},
598: function (t, e, n) {
'use strict'
function i() {
o.apply(this, arguments),
(this.backstageClass = ['backstage', 'u-backstage-hidden'])
}
var o = n(274)
Object.assign(i.prototype, o.prototype),
(t.exports = i),
(i.isMatch = function (t) {
var e = ((t && t.name) || '').toLowerCase()
return (
[
'slidein',
'fadein',
'flipin',
'bouncein',
'jackinthebox',
'lightspeedin',
'customanimationin',
].indexOf(e) > -1
)
}),
(i.create = function (t, e) {
return new i(t, e)
})
},
60: function (t, e, n) {
'use strict'
var i
i = (function () {
return this
})()
try {
i = i || Function('return this')() || (1, eval)('this')
} catch (t) {
if ('object' == typeof window) i = window
}
t.exports = i
},
62: function (t, e, n) {
'use strict'
;(function (t) {
function i() {
try {
var t = new Uint8Array(1)
return (
(t.__proto__ = {
__proto__: Uint8Array.prototype,
foo: function () {
return 42
},
}),
42 === t.foo() &&
'function' == typeof t.subarray &&
0 === t.subarray(1, 1).byteLength
)
} catch (t) {
return false
}
}
function o() {
return s.TYPED_ARRAY_SUPPORT ? 2147483647 : 1073741823
}
function a(t, length) {
if (o() < length) throw new RangeError('Invalid typed array length')
if (s.TYPED_ARRAY_SUPPORT)
(t = new Uint8Array(length)).__proto__ = s.prototype
else {
if (null === t) t = new s(length)
t.length = length
}
return t
}
function s(t, e, length) {
if (!(s.TYPED_ARRAY_SUPPORT || this instanceof s))
return new s(t, e, length)
if ('number' == typeof t) {
if ('string' == typeof e)
throw new Error(
'If encoding is specified then the first argument must be a string'
)
return f(this, t)
}
return u(this, t, e, length)
}
function u(t, e, n, length) {
if ('number' == typeof e)
throw new TypeError('"value" argument must not be a number')
if ('undefined' != typeof ArrayBuffer && e instanceof ArrayBuffer)
return m(t, e, n, length)
if ('string' == typeof e) return h(t, e, n)
else return g(t, e)
}
function l(size) {
if ('number' != typeof size)
throw new TypeError('"size" argument must be a number')
else if (size < 0)
throw new RangeError('"size" argument must not be negative')
}
function c(t, size, e, n) {
if ((l(size), size <= 0)) return a(t, size)
if (void 0 !== e)
return 'string' == typeof n
? a(t, size).fill(e, n)
: a(t, size).fill(e)
else return a(t, size)
}
function f(t, size) {
if (
(l(size),
(t = a(t, size < 0 ? 0 : 0 | v(size))),
!s.TYPED_ARRAY_SUPPORT)
)
for (var e = 0; e < size; ++e) t[e] = 0
return t
}
function h(t, e, n) {
if ('string' != typeof n || '' === n) n = 'utf8'
if (!s.isEncoding(n))
throw new TypeError('"encoding" must be a valid string encoding')
var length = 0 | w(e, n),
i = (t = a(t, length)).write(e, n)
if (i !== length) t = t.slice(0, i)
return t
}
function p(t, e) {
var length = e.length < 0 ? 0 : 0 | v(e.length)
t = a(t, length)
for (var n = 0; n < length; n += 1) t[n] = 255 & e[n]
return t
}
function m(t, e, n, length) {
if ((e.byteLength, n < 0 || e.byteLength < n))
throw new RangeError("'offset' is out of bounds")
if (e.byteLength < n + (length || 0))
throw new RangeError("'length' is out of bounds")
if (void 0 === n && void 0 === length) e = new Uint8Array(e)
else if (void 0 === length) e = new Uint8Array(e, n)
else e = new Uint8Array(e, n, length)
if (s.TYPED_ARRAY_SUPPORT) (t = e).__proto__ = s.prototype
else t = p(t, e)
return t
}
function g(t, e) {
if (s.isBuffer(e)) {
var n = 0 | v(e.length)
if (0 === (t = a(t, n)).length) return t
else return e.copy(t, 0, 0, n), t
}
if (e) {
if (
('undefined' != typeof ArrayBuffer &&
e.buffer instanceof ArrayBuffer) ||
'length' in e
)
if ('number' != typeof e.length || rt(e.length)) return a(t, 0)
else return p(t, e)
if ('Buffer' === e.type && st(e.data)) return p(t, e.data)
}
throw new TypeError(
'First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.'
)
}
function v(length) {
if (length >= o())
throw new RangeError(
'Attempt to allocate Buffer larger than maximum ' +
'size: 0x' +
o().toString(16) +
' bytes'
)
return 0 | length
}
function y(length) {
if (+length != length) length = 0
return s.alloc(+length)
}
function w(t, e) {
if (s.isBuffer(t)) return t.length
if (
'undefined' != typeof ArrayBuffer &&
'function' == typeof ArrayBuffer.isView &&
(ArrayBuffer.isView(t) || t instanceof ArrayBuffer)
)
return t.byteLength
if ('string' != typeof t) t = '' + t
var n = t.length
if (0 === n) return 0
for (var i = false; ; )
switch (e) {
case 'ascii':
case 'latin1':
case 'binary':
return n
case 'utf8':
case 'utf-8':
case void 0:
return Z(t).length
case 'ucs2':
case 'ucs-2':
case 'utf16le':
case 'utf-16le':
return 2 * n
case 'hex':
return n >>> 1
case 'base64':
return tt(t).length
default:
if (i) return Z(t).length
;(e = ('' + e).toLowerCase()), (i = true)
}
}
function b(t, e, n) {
var i = false
if (void 0 === e || e < 0) e = 0
if (e > this.length) return ''
if (void 0 === n || n > this.length) n = this.length
if (n <= 0) return ''
if ((n >>>= 0) <= (e >>>= 0)) return ''
if (!t) t = 'utf8'
for (; true; )
switch (t) {
case 'hex':
return F(this, e, n)
case 'utf8':
case 'utf-8':
return L(this, e, n)
case 'ascii':
return O(this, e, n)
case 'latin1':
case 'binary':
return B(this, e, n)
case 'base64':
return M(this, e, n)
case 'ucs2':
case 'ucs-2':
case 'utf16le':
case 'utf-16le':
return N(this, e, n)
default:
if (i) throw new TypeError('Unknown encoding: ' + t)
;(t = (t + '').toLowerCase()), (i = true)
}
}
function C(t, e, n) {
var i = t[e]
;(t[e] = t[n]), (t[n] = i)
}
function S(t, e, n, i, o) {
if (0 === t.length) return -1
if ('string' == typeof n) (i = n), (n = 0)
else if (n > 2147483647) n = 2147483647
else if (n < -2147483648) n = -2147483648
if (((n = +n), isNaN(n))) n = o ? 0 : t.length - 1
if (n < 0) n = t.length + n
if (n >= t.length)
if (o) return -1
else n = t.length - 1
else if (n < 0)
if (o) n = 0
else return -1
if ('string' == typeof e) e = s.from(e, i)
if (s.isBuffer(e))
if (0 === e.length) return -1
else return x(t, e, n, i, o)
else if ('number' == typeof e) {
if (
((e &= 255),
s.TYPED_ARRAY_SUPPORT &&
'function' == typeof Uint8Array.prototype.indexOf)
)
if (o) return Uint8Array.prototype.indexOf.call(t, e, n)
else return Uint8Array.prototype.lastIndexOf.call(t, e, n)
return x(t, [e], n, i, o)
}
throw new TypeError('val must be string, number or Buffer')
}
function x(t, e, n, i, o) {
function a(t, e) {
if (1 === s) return t[e]
else return t.readUInt16BE(e * s)
}
var s = 1,
u = t.length,
l = e.length,
c
if (void 0 !== i)
if (
'ucs2' === (i = String(i).toLowerCase()) ||
'ucs-2' === i ||
'utf16le' === i ||
'utf-16le' === i
) {
if (t.length < 2 || e.length < 2) return -1
;(s = 2), (u /= 2), (l /= 2), (n /= 2)
}
if (o) {
var f = -1
for (c = n; c < u; c++)
if (a(t, c) === a(e, -1 === f ? 0 : c - f)) {
if (-1 === f) f = c
if (c - f + 1 === l) return f * s
} else {
if (-1 !== f) c -= c - f
f = -1
}
} else {
if (n + l > u) n = u - l
for (c = n; c >= 0; c--) {
for (var h = true, p = 0; p < l; p++)
if (a(t, c + p) !== a(e, p)) {
h = false
break
}
if (h) return c
}
}
return -1
}
function A(t, e, n, length) {
n = Number(n) || 0
var i = t.length - n
if (!length) length = i
else if ((length = Number(length)) > i) length = i
var o = e.length
if (o % 2 != 0) throw new TypeError('Invalid hex string')
if (length > o / 2) length = o / 2
for (var a = 0; a < length; ++a) {
var s = parseInt(e.substr(2 * a, 2), 16)
if (isNaN(s)) return a
t[n + a] = s
}
return a
}
function _(t, e, n, length) {
return nt(Z(e, t.length - n), t, n, length)
}
function T(t, e, n, length) {
return nt(X(e), t, n, length)
}
function E(t, e, n, length) {
return T(t, e, n, length)
}
function I(t, e, n, length) {
return nt(tt(e), t, n, length)
}
function k(t, e, n, length) {
return nt(J(e, t.length - n), t, n, length)
}
function M(t, e, n) {
if (0 === e && n === t.length) return ot.fromByteArray(t)
else return ot.fromByteArray(t.slice(e, n))
}
function L(t, e, n) {
n = Math.min(t.length, n)
for (var i = [], o = e; o < n; ) {
var a = t[o],
s = null,
u = a > 239 ? 4 : a > 223 ? 3 : a > 191 ? 2 : 1
if (o + u <= n) {
var l, c, f, h
switch (u) {
case 1:
if (a < 128) s = a
break
case 2:
if (128 == (192 & (l = t[o + 1])))
if ((h = ((31 & a) << 6) | (63 & l)) > 127) s = h
break
case 3:
if (
((l = t[o + 1]),
(c = t[o + 2]),
128 == (192 & l) && 128 == (192 & c))
)
if (
(h = ((15 & a) << 12) | ((63 & l) << 6) | (63 & c)) >
2047 &&
(h < 55296 || h > 57343)
)
s = h
break
case 4:
if (
((l = t[o + 1]),
(c = t[o + 2]),
(f = t[o + 3]),
128 == (192 & l) && 128 == (192 & c) && 128 == (192 & f))
)
if (
(h =
((15 & a) << 18) |
((63 & l) << 12) |
((63 & c) << 6) |
(63 & f)) > 65535 &&
h < 1114112
)
s = h
}
}
if (null === s) (s = 65533), (u = 1)
else if (s > 65535)
(s -= 65536),
i.push(((s >>> 10) & 1023) | 55296),
(s = 56320 | (1023 & s))
i.push(s), (o += u)
}
return P(i)
}
function P(t) {
var e = t.length
if (e <= ut) return String.fromCharCode.apply(String, t)
for (var n = '', i = 0; i < e; )
n += String.fromCharCode.apply(String, t.slice(i, (i += ut)))
return n
}
function O(t, e, n) {
var i = ''
n = Math.min(t.length, n)
for (var o = e; o < n; ++o) i += String.fromCharCode(127 & t[o])
return i
}
function B(t, e, n) {
var i = ''
n = Math.min(t.length, n)
for (var o = e; o < n; ++o) i += String.fromCharCode(t[o])
return i
}
function F(t, e, n) {
var i = t.length
if (!e || e < 0) e = 0
if (!n || n < 0 || n > i) n = i
for (var o = '', a = e; a < n; ++a) o += K(t[a])
return o
}
function N(t, e, n) {
for (var i = t.slice(e, n), o = '', a = 0; a < i.length; a += 2)
o += String.fromCharCode(i[a] + 256 * i[a + 1])
return o
}
function U(t, e, length) {
if (t % 1 != 0 || t < 0) throw new RangeError('offset is not uint')
if (t + e > length)
throw new RangeError('Trying to access beyond buffer length')
}
function z(t, e, n, i, o, a) {
if (!s.isBuffer(t))
throw new TypeError('"buffer" argument must be a Buffer instance')
if (e > o || e < a)
throw new RangeError('"value" argument is out of bounds')
if (n + i > t.length) throw new RangeError('Index out of range')
}
function H(t, e, n, i) {
if (e < 0) e = 65535 + e + 1
for (var o = 0, a = Math.min(t.length - n, 2); o < a; ++o)
t[n + o] =
(e & (255 << (8 * (i ? o : 1 - o)))) >>> (8 * (i ? o : 1 - o))
}
function $(t, e, n, i) {
if (e < 0) e = 4294967295 + e + 1
for (var o = 0, a = Math.min(t.length - n, 4); o < a; ++o)
t[n + o] = (e >>> (8 * (i ? o : 3 - o))) & 255
}
function Y(t, e, n, i, o, a) {
if (n + i > t.length) throw new RangeError('Index out of range')
if (n < 0) throw new RangeError('Index out of range')
}
function W(t, e, n, i, o) {
if (!o) Y(t, e, n, 4, 34028234663852886e22, -34028234663852886e22)
return at.write(t, e, n, i, 23, 4), n + 4
}
function V(t, e, n, i, o) {
if (!o) Y(t, e, n, 8, 17976931348623157e292, -17976931348623157e292)
return at.write(t, e, n, i, 52, 8), n + 8
}
function G(t) {
if ((t = j(t).replace(lt, '')).length < 2) return ''
for (; t.length % 4 != 0; ) t += '='
return t
}
function j(t) {
if (t.trim) return t.trim()
else return t.replace(/^\s+|\s+$/g, '')
}
function K(t) {
if (t < 16) return '0' + t.toString(16)
else return t.toString(16)
}
function Z(t, e) {
var n
e = e || 1 / 0
for (var length = t.length, i = null, o = [], a = 0; a < length; ++a) {
if ((n = t.charCodeAt(a)) > 55295 && n < 57344) {
if (!i) {
if (n > 56319) {
if ((e -= 3) > -1) o.push(239, 191, 189)
continue
} else if (a + 1 === length) {
if ((e -= 3) > -1) o.push(239, 191, 189)
continue
}
i = n
continue
}
if (n < 56320) {
if ((e -= 3) > -1) o.push(239, 191, 189)
i = n
continue
}
n = (((i - 55296) << 10) | (n - 56320)) + 65536
} else if (i) if ((e -= 3) > -1) o.push(239, 191, 189)
if (((i = null), n < 128)) {
if ((e -= 1) < 0) break
o.push(n)
} else if (n < 2048) {
if ((e -= 2) < 0) break
o.push((n >> 6) | 192, (63 & n) | 128)
} else if (n < 65536) {
if ((e -= 3) < 0) break
o.push((n >> 12) | 224, ((n >> 6) & 63) | 128, (63 & n) | 128)
} else if (n < 1114112) {
if ((e -= 4) < 0) break
o.push(
(n >> 18) | 240,
((n >> 12) & 63) | 128,
((n >> 6) & 63) | 128,
(63 & n) | 128
)
} else throw new Error('Invalid code point')
}
return o
}
function X(t) {
for (var e = [], n = 0; n < t.length; ++n) e.push(255 & t.charCodeAt(n))
return e
}
function J(t, e) {
for (var n, i, o, a = [], s = 0; s < t.length && !((e -= 2) < 0); ++s)
(i = (n = t.charCodeAt(s)) >> 8), (o = n % 256), a.push(o), a.push(i)
return a
}
function tt(t) {
return ot.toByteArray(G(t))
}
function nt(t, e, n, length) {
for (
var i = 0;
i < length && !(i + n >= e.length || i >= t.length);
++i
)
e[i + n] = t[i]
return i
}
function rt(t) {
return t != t
}
var ot = n(532),
at = n(533),
st = n(534)
if (
((e.Buffer = s),
(e.SlowBuffer = y),
(e.INSPECT_MAX_BYTES = 50),
(s.TYPED_ARRAY_SUPPORT =
void 0 !== t.TYPED_ARRAY_SUPPORT ? t.TYPED_ARRAY_SUPPORT : i()),
(e.kMaxLength = o()),
(s.poolSize = 8192),
(s._augment = function (t) {
return (t.__proto__ = s.prototype), t
}),
(s.from = function (t, e, length) {
return u(null, t, e, length)
}),
s.TYPED_ARRAY_SUPPORT)
)
if (
((s.prototype.__proto__ = Uint8Array.prototype),
(s.__proto__ = Uint8Array),
'undefined' != typeof Symbol &&
Symbol.species &&
s[Symbol.species] === s)
)
Object.defineProperty(s, Symbol.species, {
value: null,
configurable: true,
})
;(s.alloc = function (size, t, e) {
return c(null, size, t, e)
}),
(s.allocUnsafe = function (size) {
return f(null, size)
}),
(s.allocUnsafeSlow = function (size) {
return f(null, size)
}),
(s.isBuffer = function t(e) {
return !!(null != e && e._isBuffer)
}),
(s.compare = function compare(t, e) {
if (!s.isBuffer(t) || !s.isBuffer(e))
throw new TypeError('Arguments must be Buffers')
if (t === e) return 0
for (
var n = t.length, i = e.length, o = 0, a = Math.min(n, i);
o < a;
++o
)
if (t[o] !== e[o]) {
;(n = t[o]), (i = e[o])
break
}
if (n < i) return -1
if (i < n) return 1
else return 0
}),
(s.isEncoding = function t(e) {
switch (String(e).toLowerCase()) {
case 'hex':
case 'utf8':
case 'utf-8':
case 'ascii':
case 'latin1':
case 'binary':
case 'base64':
case 'ucs2':
case 'ucs-2':
case 'utf16le':
case 'utf-16le':
return true
default:
return false
}
}),
(s.concat = function t(list, length) {
if (!st(list))
throw new TypeError('"list" argument must be an Array of Buffers')
if (0 === list.length) return s.alloc(0)
var e
if (void 0 === length)
for (length = 0, e = 0; e < list.length; ++e)
length += list[e].length
var n = s.allocUnsafe(length),
i = 0
for (e = 0; e < list.length; ++e) {
var o = list[e]
if (!s.isBuffer(o))
throw new TypeError('"list" argument must be an Array of Buffers')
o.copy(n, i), (i += o.length)
}
return n
}),
(s.byteLength = w),
(s.prototype._isBuffer = true),
(s.prototype.swap16 = function t() {
var e = this.length
if (e % 2 != 0)
throw new RangeError('Buffer size must be a multiple of 16-bits')
for (var n = 0; n < e; n += 2) C(this, n, n + 1)
return this
}),
(s.prototype.swap32 = function t() {
var e = this.length
if (e % 4 != 0)
throw new RangeError('Buffer size must be a multiple of 32-bits')
for (var n = 0; n < e; n += 4)
C(this, n, n + 3), C(this, n + 1, n + 2)
return this
}),
(s.prototype.swap64 = function t() {
var e = this.length
if (e % 8 != 0)
throw new RangeError('Buffer size must be a multiple of 64-bits')
for (var n = 0; n < e; n += 8)
C(this, n, n + 7),
C(this, n + 1, n + 6),
C(this, n + 2, n + 5),
C(this, n + 3, n + 4)
return this
}),
(s.prototype.toString = function t() {
var length = 0 | this.length
if (0 === length) return ''
if (0 === arguments.length) return L(this, 0, length)
else return b.apply(this, arguments)
}),
(s.prototype.equals = function t(e) {
if (!s.isBuffer(e)) throw new TypeError('Argument must be a Buffer')
if (this === e) return true
else return 0 === s.compare(this, e)
}),
(s.prototype.inspect = function t() {
var n = '',
i = e.INSPECT_MAX_BYTES
if (this.length > 0)
if (
((n = this.toString('hex', 0, i).match(/.{2}/g).join(' ')),
this.length > i)
)
n += ' ... '
return '<Buffer ' + n + '>'
}),
(s.prototype.compare = function compare(t, e, n, i, o) {
if (!s.isBuffer(t)) throw new TypeError('Argument must be a Buffer')
if (void 0 === e) e = 0
if (void 0 === n) n = t ? t.length : 0
if (void 0 === i) i = 0
if (void 0 === o) o = this.length
if (e < 0 || n > t.length || i < 0 || o > this.length)
throw new RangeError('out of range index')
if (i >= o && e >= n) return 0
if (i >= o) return -1
if (e >= n) return 1
if (this === t) return 0
for (
var a = (o >>>= 0) - (i >>>= 0),
u = (n >>>= 0) - (e >>>= 0),
l = Math.min(a, u),
c = this.slice(i, o),
f = t.slice(e, n),
h = 0;
h < l;
++h
)
if (c[h] !== f[h]) {
;(a = c[h]), (u = f[h])
break
}
if (a < u) return -1
if (u < a) return 1
else return 0
}),
(s.prototype.includes = function t(e, n, i) {
return -1 !== this.indexOf(e, n, i)
}),
(s.prototype.indexOf = function t(e, n, i) {
return S(this, e, n, i, true)
}),
(s.prototype.lastIndexOf = function t(e, n, i) {
return S(this, e, n, i, false)
}),
(s.prototype.write = function t(e, n, length, i) {
if (void 0 === n) (i = 'utf8'), (length = this.length), (n = 0)
else if (void 0 === length && 'string' == typeof n)
(i = n), (length = this.length), (n = 0)
else if (isFinite(n))
if (((n |= 0), isFinite(length))) {
if (((length |= 0), void 0 === i)) i = 'utf8'
} else (i = length), (length = void 0)
else
throw new Error(
'Buffer.write(string, encoding, offset[, length]) is no longer supported'
)
var o = this.length - n
if (void 0 === length || length > o) length = o
if ((e.length > 0 && (length < 0 || n < 0)) || n > this.length)
throw new RangeError('Attempt to write outside buffer bounds')
if (!i) i = 'utf8'
for (var a = false; ; )
switch (i) {
case 'hex':
return A(this, e, n, length)
case 'utf8':
case 'utf-8':
return _(this, e, n, length)
case 'ascii':
return T(this, e, n, length)
case 'latin1':
case 'binary':
return E(this, e, n, length)
case 'base64':
return I(this, e, n, length)
case 'ucs2':
case 'ucs-2':
case 'utf16le':
case 'utf-16le':
return k(this, e, n, length)
default:
if (a) throw new TypeError('Unknown encoding: ' + i)
;(i = ('' + i).toLowerCase()), (a = true)
}
}),
(s.prototype.toJSON = function t() {
return {
type: 'Buffer',
data: Array.prototype.slice.call(this._arr || this, 0),
}
})
var ut = 4096
;(s.prototype.slice = function t(e, n) {
var i = this.length,
o
if ((e = ~~e) < 0) {
if ((e += i) < 0) e = 0
} else if (e > i) e = i
if ((n = void 0 === n ? i : ~~n) < 0) {
if ((n += i) < 0) n = 0
} else if (n > i) n = i
if (n < e) n = e
if (s.TYPED_ARRAY_SUPPORT)
(o = this.subarray(e, n)).__proto__ = s.prototype
else {
var a = n - e
o = new s(a, void 0)
for (var u = 0; u < a; ++u) o[u] = this[u + e]
}
return o
}),
(s.prototype.readUIntLE = function t(e, n, i) {
if (((e |= 0), (n |= 0), !i)) U(e, n, this.length)
for (var o = this[e], a = 1, s = 0; ++s < n && (a *= 256); )
o += this[e + s] * a
return o
}),
(s.prototype.readUIntBE = function t(e, n, i) {
if (((e |= 0), (n |= 0), !i)) U(e, n, this.length)
for (var o = this[e + --n], a = 1; n > 0 && (a *= 256); )
o += this[e + --n] * a
return o
}),
(s.prototype.readUInt8 = function t(e, n) {
if (!n) U(e, 1, this.length)
return this[e]
}),
(s.prototype.readUInt16LE = function t(e, n) {
if (!n) U(e, 2, this.length)
return this[e] | (this[e + 1] << 8)
}),
(s.prototype.readUInt16BE = function t(e, n) {
if (!n) U(e, 2, this.length)
return (this[e] << 8) | this[e + 1]
}),
(s.prototype.readUInt32LE = function t(e, n) {
if (!n) U(e, 4, this.length)
return (
(this[e] | (this[e + 1] << 8) | (this[e + 2] << 16)) +
16777216 * this[e + 3]
)
}),
(s.prototype.readUInt32BE = function t(e, n) {
if (!n) U(e, 4, this.length)
return (
16777216 * this[e] +
((this[e + 1] << 16) | (this[e + 2] << 8) | this[e + 3])
)
}),
(s.prototype.readIntLE = function t(e, n, i) {
if (((e |= 0), (n |= 0), !i)) U(e, n, this.length)
for (var o = this[e], a = 1, s = 0; ++s < n && (a *= 256); )
o += this[e + s] * a
if (o >= (a *= 128)) o -= Math.pow(2, 8 * n)
return o
}),
(s.prototype.readIntBE = function t(e, n, i) {
if (((e |= 0), (n |= 0), !i)) U(e, n, this.length)
for (var o = n, a = 1, s = this[e + --o]; o > 0 && (a *= 256); )
s += this[e + --o] * a
if (s >= (a *= 128)) s -= Math.pow(2, 8 * n)
return s
}),
(s.prototype.readInt8 = function t(e, n) {
if (!n) U(e, 1, this.length)
if (!(128 & this[e])) return this[e]
else return -1 * (255 - this[e] + 1)
}),
(s.prototype.readInt16LE = function t(e, n) {
if (!n) U(e, 2, this.length)
var i = this[e] | (this[e + 1] << 8)
return 32768 & i ? 4294901760 | i : i
}),
(s.prototype.readInt16BE = function t(e, n) {
if (!n) U(e, 2, this.length)
var i = this[e + 1] | (this[e] << 8)
return 32768 & i ? 4294901760 | i : i
}),
(s.prototype.readInt32LE = function t(e, n) {
if (!n) U(e, 4, this.length)
return (
this[e] |
(this[e + 1] << 8) |
(this[e + 2] << 16) |
(this[e + 3] << 24)
)
}),
(s.prototype.readInt32BE = function t(e, n) {
if (!n) U(e, 4, this.length)
return (
(this[e] << 24) |
(this[e + 1] << 16) |
(this[e + 2] << 8) |
this[e + 3]
)
}),
(s.prototype.readFloatLE = function t(e, n) {
if (!n) U(e, 4, this.length)
return at.read(this, e, true, 23, 4)
}),
(s.prototype.readFloatBE = function t(e, n) {
if (!n) U(e, 4, this.length)
return at.read(this, e, false, 23, 4)
}),
(s.prototype.readDoubleLE = function t(e, n) {
if (!n) U(e, 8, this.length)
return at.read(this, e, true, 52, 8)
}),
(s.prototype.readDoubleBE = function t(e, n) {
if (!n) U(e, 8, this.length)
return at.read(this, e, false, 52, 8)
}),
(s.prototype.writeUIntLE = function t(e, n, i, o) {
if (((e = +e), (n |= 0), (i |= 0), !o)) {
var a
z(this, e, n, i, Math.pow(2, 8 * i) - 1, 0)
}
var s = 1,
u = 0
for (this[n] = 255 & e; ++u < i && (s *= 256); )
this[n + u] = (e / s) & 255
return n + i
}),
(s.prototype.writeUIntBE = function t(e, n, i, o) {
if (((e = +e), (n |= 0), (i |= 0), !o)) {
var a
z(this, e, n, i, Math.pow(2, 8 * i) - 1, 0)
}
var s = i - 1,
u = 1
for (this[n + s] = 255 & e; --s >= 0 && (u *= 256); )
this[n + s] = (e / u) & 255
return n + i
}),
(s.prototype.writeUInt8 = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 1, 255, 0)
if (!s.TYPED_ARRAY_SUPPORT) e = Math.floor(e)
return (this[n] = 255 & e), n + 1
}),
(s.prototype.writeUInt16LE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 2, 65535, 0)
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = 255 & e), (this[n + 1] = e >>> 8)
else H(this, e, n, true)
return n + 2
}),
(s.prototype.writeUInt16BE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 2, 65535, 0)
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = e >>> 8), (this[n + 1] = 255 & e)
else H(this, e, n, false)
return n + 2
}),
(s.prototype.writeUInt32LE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 4, 4294967295, 0)
if (s.TYPED_ARRAY_SUPPORT)
(this[n + 3] = e >>> 24),
(this[n + 2] = e >>> 16),
(this[n + 1] = e >>> 8),
(this[n] = 255 & e)
else $(this, e, n, true)
return n + 4
}),
(s.prototype.writeUInt32BE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 4, 4294967295, 0)
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = e >>> 24),
(this[n + 1] = e >>> 16),
(this[n + 2] = e >>> 8),
(this[n + 3] = 255 & e)
else $(this, e, n, false)
return n + 4
}),
(s.prototype.writeIntLE = function t(e, n, i, o) {
if (((e = +e), (n |= 0), !o)) {
var a = Math.pow(2, 8 * i - 1)
z(this, e, n, i, a - 1, -a)
}
var s = 0,
u = 1,
l = 0
for (this[n] = 255 & e; ++s < i && (u *= 256); ) {
if (e < 0 && 0 === l && 0 !== this[n + s - 1]) l = 1
this[n + s] = (((e / u) >> 0) - l) & 255
}
return n + i
}),
(s.prototype.writeIntBE = function t(e, n, i, o) {
if (((e = +e), (n |= 0), !o)) {
var a = Math.pow(2, 8 * i - 1)
z(this, e, n, i, a - 1, -a)
}
var s = i - 1,
u = 1,
l = 0
for (this[n + s] = 255 & e; --s >= 0 && (u *= 256); ) {
if (e < 0 && 0 === l && 0 !== this[n + s + 1]) l = 1
this[n + s] = (((e / u) >> 0) - l) & 255
}
return n + i
}),
(s.prototype.writeInt8 = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 1, 127, -128)
if (!s.TYPED_ARRAY_SUPPORT) e = Math.floor(e)
if (e < 0) e = 255 + e + 1
return (this[n] = 255 & e), n + 1
}),
(s.prototype.writeInt16LE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 2, 32767, -32768)
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = 255 & e), (this[n + 1] = e >>> 8)
else H(this, e, n, true)
return n + 2
}),
(s.prototype.writeInt16BE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i)) z(this, e, n, 2, 32767, -32768)
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = e >>> 8), (this[n + 1] = 255 & e)
else H(this, e, n, false)
return n + 2
}),
(s.prototype.writeInt32LE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i))
z(this, e, n, 4, 2147483647, -2147483648)
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = 255 & e),
(this[n + 1] = e >>> 8),
(this[n + 2] = e >>> 16),
(this[n + 3] = e >>> 24)
else $(this, e, n, true)
return n + 4
}),
(s.prototype.writeInt32BE = function t(e, n, i) {
if (((e = +e), (n |= 0), !i))
z(this, e, n, 4, 2147483647, -2147483648)
if (e < 0) e = 4294967295 + e + 1
if (s.TYPED_ARRAY_SUPPORT)
(this[n] = e >>> 24),
(this[n + 1] = e >>> 16),
(this[n + 2] = e >>> 8),
(this[n + 3] = 255 & e)
else $(this, e, n, false)
return n + 4
}),
(s.prototype.writeFloatLE = function t(e, n, i) {
return W(this, e, n, true, i)
}),
(s.prototype.writeFloatBE = function t(e, n, i) {
return W(this, e, n, false, i)
}),
(s.prototype.writeDoubleLE = function t(e, n, i) {
return V(this, e, n, true, i)
}),
(s.prototype.writeDoubleBE = function t(e, n, i) {
return V(this, e, n, false, i)
}),
(s.prototype.copy = function copy(t, e, n, i) {
if (!n) n = 0
if (!i && 0 !== i) i = this.length
if (e >= t.length) e = t.length
if (!e) e = 0
if (i > 0 && i < n) i = n
if (i === n) return 0
if (0 === t.length || 0 === this.length) return 0
if (e < 0) throw new RangeError('targetStart out of bounds')
if (n < 0 || n >= this.length)
throw new RangeError('sourceStart out of bounds')
if (i < 0) throw new RangeError('sourceEnd out of bounds')
if (i > this.length) i = this.length
if (t.length - e < i - n) i = t.length - e + n
var o = i - n,
a
if (this === t && n < e && e < i)
for (a = o - 1; a >= 0; --a) t[a + e] = this[a + n]
else if (o < 1e3 || !s.TYPED_ARRAY_SUPPORT)
for (a = 0; a < o; ++a) t[a + e] = this[a + n]
else Uint8Array.prototype.set.call(t, this.subarray(n, n + o), e)
return o
}),
(s.prototype.fill = function t(e, n, i, o) {
if ('string' == typeof e) {
if ('string' == typeof n) (o = n), (n = 0), (i = this.length)
else if ('string' == typeof i) (o = i), (i = this.length)
if (1 === e.length) {
var a = e.charCodeAt(0)
if (a < 256) e = a
}
if (void 0 !== o && 'string' != typeof o)
throw new TypeError('encoding must be a string')
if ('string' == typeof o && !s.isEncoding(o))
throw new TypeError('Unknown encoding: ' + o)
} else if ('number' == typeof e) e &= 255
if (n < 0 || this.length < n || this.length < i)
throw new RangeError('Out of range index')
if (i <= n) return this
if (((n >>>= 0), (i = void 0 === i ? this.length : i >>> 0), !e))
e = 0
var u
if ('number' == typeof e) for (u = n; u < i; ++u) this[u] = e
else {
var l = s.isBuffer(e) ? e : Z(new s(e, o).toString()),
c = l.length
for (u = 0; u < i - n; ++u) this[u + n] = l[u % c]
}
return this
})
var lt = /[^+\/0-9A-Za-z-_]/g
}).call(e, n(60))
},
662: function (t, e, n) {
'use strict'
function i(t, e) {
if ('string' != typeof t) return 0
var n = new u().replace(t, e).expr
if ('' === n.trim()) return 0
o(n)
try {
var i, l
return s(new Function('"use strict";return (' + n + ');')(), 4)
} catch (e) {
return a(e, t)
}
}
function o(t) {
var e = /[^-()\d\s/*+.]+|\/\/|\/\*/g.exec(t),
n = 20,
i
if (e) {
var o = {
messageKey: '#FormCalc_UnexpectedToken',
expression: (i = e[0].substring(0, n)),
position: e.index,
}
throw Object.assign(
new Error("Unexpected token '" + i + "'", { cause: o }),
{ args: o }
)
}
}
function a(t, e) {
var n = { messageKey: '#FormCalc_EvaluationFailed', expression: e }
throw Object.assign(new Error('Evaluation failed', { cause: n }), {
args: n,
})
}
function s(t, e) {
if (((t = Number(t)), (e = Number(e)), isNaN(t) || !isFinite(t))) return t
var n = t.toString().split('e'),
i = n[0],
o = n[1] || 0,
a,
s,
u = Math.round(Number(i + 'e' + (+o + e)))
.toString()
.split('e')[0],
l = n[1] || 0
return Number(u + 'e' + (+l - e))
}
var u = n(411)
t.exports.evaluate = i
},
663: function (t, e, n) {
'use strict'
function i(el) {
var t = el.getAttribute('name'),
type
if (!t) return t
if (((t = t.trim()), 'SELECT' === el.tagName)) return o(t)
if ('checkbox' === el.getAttribute('type')) return o(t)
else return t
}
function o(t) {
if (!t) return t
var e = t.lastIndexOf('[][]')
if (e > 0 && e + 4 === t.length) return t.substring(0, t.length - 4)
if ((e = t.lastIndexOf('[]')) > 0 && e + 2 === t.length)
return t.substring(0, t.length - 2)
else return t
}
function a(el) {
if ('OPTION' === el.tagName) return el.getAttribute('data-calc')
var type = el.getAttribute('type')
if ('number' === type || 'range' === type) return el.value
if ('radio' === type) return el.getAttribute('data-calc')
if ('checkbox' === type && null !== el.getAttribute('data-calc'))
return el.getAttribute('data-calc')
if ('checkbox' === type) return el.value
else return
}
function s(el) {
return Number(a(el))
}
function u(el) {
if ('OPTION' === el.tagName) return el.selected
var type = el.getAttribute('type')
if ('radio' === type || 'checkbox' === type) return el.checked
else return true
}
function l(el, t) {
if (((t = t || 0), u(el))) return s(el)
else return t
}
var c = (t.exports = function t(form) {
;(this.fields = []),
this.collectInputs(
form.querySelectorAll('[type=number], [type=range]')
),
this.collectInputs(form.querySelectorAll('[type=radio]')),
this.collectInputs(form.querySelectorAll('[type="checkbox"]')),
this.collectSelects(form.querySelectorAll('select'))
})
;(c.prototype.getScope = function t() {
return this.fields.reduce(function (t, e) {
if (!e || !e.name) return t
if (!t[e.name]) t[e.name] = 0
return (t[e.name] += e.value), t
}, {})
}),
(c.prototype.addField = function t(field) {
return this.fields.push(field), field
}),
(c.prototype.collectInputs = function (t) {
for (var e = 0; e < t.length; e++)
this.addField({ name: i(t[e]), value: l(t[e], 0), rawValue: a(t[e]) })
}),
(c.prototype.collectSelects = function (t) {
for (var e = 0; e < t.length; e++)
this.collectOptions(i(t[e]), t[e].querySelectorAll('option'))
}),
(c.prototype.collectOptions = function (t, e) {
for (var n = 0; n < e.length; n++)
this.addField({ name: t, value: l(e[n], 0), rawValue: a(e[n]) })
})
},
664: function (t, e, n) {
'use strict'
function i(t, e, n) {
var i = t.find('.u-form-progress-step')
i.removeClass('active done'),
o(i.find('.u-form-progress-icon'), 'default'),
o(i.find('.u-form-progress-icon'), 'step')
var a = t.find('.u-form-progress-step').eq(n)
a.addClass('active')
var s = a.prevAll('.u-form-progress-step')
s.addClass('done'), o(s.find('.u-form-progress-icon'), 'done')
}
function o(icon, type) {
;(type = type || 'default'),
icon.each(function () {
var t = $(this),
e = t.attr('data-step-icon-' + type)
if (e) t.html(e)
})
}
function a(t, e, n) {
var i = t.find('.u-form-progress-bar'),
o =
'calc((100% - var(--step-icon-size)) / ' +
(e.length - 1) +
' * ' +
n +
')'
i.css('width', o)
}
var FormProgress
t.exports.update = function (form, t) {
if (form.length) {
var e = form.find('.u-form-progress'),
n = form.find('.u-carousel-inner').children()
if (void 0 === t) t = n.filter('.u-active, .active').index()
a(e, n, t), i(e, n, t)
}
}
},
665: function (t, e, n) {
'use strict'
var i
t.exports.update = function (form, t) {
var e = form.find('.u-slide')
if (void 0 === t) t = e.filter('.u-active, .active').index()
var n = form.find('.u-btn-submit, .u-btn-step'),
i = n.filter('.u-btn-submit'),
o = n.filter('.u-btn-step-next'),
a = n.filter('.u-btn-step-prev')
if ((n.removeClass('u-hidden'), n.css('display', ''), 0 === t))
a.addClass('u-hidden')
if (t === e.length - 1) o.addClass('u-hidden'), i.removeClass('u-hidden')
if (t < e.length - 1) o.removeClass('u-hidden'), i.addClass('u-hidden')
}
},
666: function (t, e, n) {
'use strict'
var FormFileType = n(148),
FormFileAccept = (t.exports = {})
;(FormFileAccept[FormFileType.IMAGES] =
'.bmp,.dng,.eps,.gif,.jpg,.jpeg,.png,.ps,.raw,.svg,.tga,.tif,.tiff'),
(FormFileAccept[FormFileType.DOCUMENTS] =
'.ai,.cdr,.csv,.doc,.docb,.docx,.dot,.dotx,.dwg,.eps,.epub,.fla,.gpx,.ical,.icalendar,.ics,.ifb,.indd,.ipynb,.key,.kml,.kmz,.mobi,.mtf,.mtx,.numbers,.odg,.odp,.ods,.odt,.otp,.ots,.ott,.oxps,.pages,.pdf,.pdn,.pkg,.pot,.potx,.pps,.ppsx,.ppt,.pptx,.psd,.pub,.rtf,.sldx,.txt,.vcf,.xcf,.xls,.xlsx,.xlt,.xltx,.xlw,.xps,.zip'),
(FormFileAccept[FormFileType.VIDEO] =
'.3gp,.avi,.divx,.flv,.m1v,.m2ts,.m4v,.mkv,.mov,.mp4,.mpe,.mpeg,.mpg,.mxf,.ogv,.vob.webm,.wmv,.xvid'),
(FormFileAccept[FormFileType.AUDIO] =
'.aac,.aif,.aiff,.flac,.m4a,.mp3,.wav,.wma')
},
916: function (t, e, n) {
'use strict'
var i = n(917),
bootstrap = {}
;(bootstrap.Util = (function (t) {
function e(t) {
return t && 'object' == typeof t && 'default' in t ? t : { default: t }
}
function n() {
if (window.QUnit) return false
var el = document.createElement('bootstrap')
for (var t in h) if (void 0 !== el.style[t]) return h[t]
return false
}
function i(t) {
if (null == t) return '' + t
else
return {}.toString
.call(t)
.match(/\s([a-z]+)/i)[1]
.toLowerCase()
}
function o() {
return {
bindType: l,
delegateType: l,
handle: function t(e) {
if (u['default'](e.target).is(this))
return e.handleObj.handler.apply(this, arguments)
},
}
}
function a(t) {
var e = this,
n = false
return (
u['default'](this).one(Util.TRANSITION_END, function () {
n = true
}),
setTimeout(function () {
if (!n) Util.triggerTransitionEnd(e)
}, t),
this
)
}
function s() {
;(l = n()),
(u['default'].fn.emulateTransitionEnd = a),
(u['default'].event.special[Util.TRANSITION_END] = o())
}
var u = e(t),
l = false,
c = 1e6,
f = 1e3,
h = {
WebkitTransition: 'webkitTransitionEnd',
MozTransition: 'transitionend',
OTransition: 'oTransitionEnd otransitionend',
transition: 'transitionend',
},
Util = {
TRANSITION_END: 'bsTransitionEnd',
getUID: function t(e) {
do {
e += ~~(Math.random() * c)
} while (document.getElementById(e))
return e
},
getSelectorFromElement: function t(e) {
var selector = e.getAttribute('data-u-target')
if (!selector || '#' === selector) {
var n = e.getAttribute('href')
selector = n && '#' !== n ? n.trim() : ''
}
try {
return document.querySelector(selector) ? selector : null
} catch (t) {
return null
}
},
getTransitionDurationFromElement: function t(e) {
if (!e) return 0
var n = u['default'](e).css('transition-duration'),
i = u['default'](e).css('transition-delay'),
o = parseFloat(n),
a = parseFloat(i)
if (!o && !a) return 0
else
return (
(n = n.split(',')[0]),
(i = i.split(',')[0]),
(parseFloat(n) + parseFloat(i)) * f
)
},
reflow: function t(e) {
return e.offsetHeight
},
triggerTransitionEnd: function t(e) {
u['default'](e).trigger(l)
},
supportsTransitionEnd: function t() {
return Boolean(l)
},
isElement: function t(e) {
return (e[0] || e).nodeType
},
typeCheckConfig: function t(e, n, o) {
for (var a in o)
if (Object.prototype.hasOwnProperty.call(o, a)) {
var s = o[a],
u = n[a],
l = u && Util.isElement(u) ? 'element' : i(u)
if (!new RegExp(s).test(l))
throw new Error(
e.toUpperCase() +
': ' +
'Option "' +
a +
'" provided type "' +
l +
'" ' +
'but expected type "' +
s +
'".'
)
}
},
findShadowRoot: function t(e) {
if (!document.documentElement.attachShadow) return null
if ('function' == typeof e.getRootNode) {
var n = e.getRootNode()
return n instanceof ShadowRoot ? n : null
}
if (e instanceof ShadowRoot) return e
if (!e.parentNode) return null
else return Util.findShadowRoot(e.parentNode)
},
}
return s(), Util
})($)),
(bootstrap.Carousel = (function (t, Util) {
function e(t) {
return t && 'object' == typeof t && 'default' in t
? t
: { default: t }
}
function n(t, props) {
for (var e = 0; e < props.length; e++) {
var n = props[e]
if (
((n.enumerable = n.enumerable || false),
(n.configurable = true),
'value' in n)
)
n.writable = true
Object.defineProperty(t, n.key, n)
}
}
function o(t, e, i) {
if (e) n(t.prototype, e)
if (i) n(t, i)
return t
}
function a() {
return (
(a =
Object.assign ||
function (t) {
for (var e = 1; e < arguments.length; e++) {
var n = arguments[e]
for (var i in n)
if (Object.prototype.hasOwnProperty.call(n, i)) t[i] = n[i]
}
return t
}),
a.apply(this, arguments)
)
}
var s = e(t),
u = e(Util),
l = 'u-carousel',
c = '4.6.0',
f = 'bs.u-carousel',
h = 'bs.u-carousel.swipe',
p = '.' + f,
m = '.data-u-api',
g = s['default'].fn[l],
v = 37,
y = 39,
w = 500,
b = 40,
Default = {
interval: 5e3,
keyboard: true,
slide: false,
pause: 'hover',
wrap: true,
touch: false,
swipe: true,
},
C = {
interval: '(number|boolean)',
keyboard: 'boolean',
slide: '(boolean|string)',
pause: '(string|boolean)',
wrap: 'boolean',
touch: 'boolean',
swipe: 'boolean',
},
S = 'next',
x = 'prev',
A = 'left',
_ = 'right',
T = 'u-slide' + p,
E = 'slid' + p,
I = 'keydown' + p,
k = 'mouseenter' + p,
M = 'mouseleave' + p,
L = 'touchstart' + p,
P = 'touchmove' + p,
O = 'touchend' + p,
B = 'pointerdown' + p,
F = 'pointerup' + p,
N = 'dragstart' + p,
U = 'load' + p + m,
z = 'click' + p + m,
H = 'u-carousel',
$ = 'u-active',
Y = 'u-slide',
W = 'u-carousel-item-right',
V = 'u-carousel-item-left',
G = 'u-carousel-item-next',
j = 'u-carousel-item-prev',
K = 'pointer-event',
Z = '.u-active',
X = '.u-active.u-carousel-item',
J = '.u-carousel-item',
tt = '.u-carousel-item img',
nt = '.u-carousel-item-next, .u-carousel-item-prev',
rt = '.u-carousel-indicators, .u-carousel-thumbnails',
ot = '[data-u-slide], [data-u-slide-to]',
at = '[data-u-ride="carousel"]',
st = { TOUCH: 'touch', PEN: 'pen' },
Carousel = (function () {
function Carousel(t, e) {
var n =
'ontouchstart' in document.documentElement ||
navigator.maxTouchPoints > 0
;(this._items = null),
(this._interval = null),
(this._activeElement = null),
(this._isPaused = false),
(this._isSliding = false),
(this.touchTimeout = null),
(this.touchStartX = 0),
(this.touchDeltaX = 0),
(this._config = this._getConfig(e)),
(this._element = t),
(this._indicatorsElement = this._element.querySelector(rt)),
(this._touchSupported = !this._element.matches('.u-form') && n),
(this._pointerEvent = Boolean(
window.PointerEvent || window.MSPointerEvent
)),
this._addEventListeners()
}
var e = Carousel.prototype
return (
(e.next = function t() {
if (!this._isSliding) this._slide(S)
}),
(e.nextWhenVisible = function t() {
var e = s['default'](this._element)
if (
!document.hidden &&
e.is(':visible') &&
'hidden' !== e.css('visibility')
)
this.next()
}),
(e.prev = function t() {
if (!this._isSliding) this._slide(x)
}),
(e.pause = function t(e) {
if (!e) this._isPaused = true
if (this._element.querySelector(nt))
u['default'].triggerTransitionEnd(this._element),
this.cycle(true)
clearInterval(this._interval), (this._interval = null)
}),
(e.cycle = function t(e) {
if (!e) this._isPaused = false
if (this._interval)
clearInterval(this._interval), (this._interval = null)
if (this._config.interval && !this._isPaused)
this._updateInterval(),
(this._interval = setInterval(
(document.visibilityState
? this.nextWhenVisible
: this.next
).bind(this),
this._config.interval
))
}),
(e.to = function t(index) {
var e = this
this._activeElement = this._element.querySelector(X)
var n = this._getItemIndex(this._activeElement)
if (!(index > this._items.length - 1 || index < 0)) {
if (this._isSliding)
return (
s['default'](this._element).one(E, function () {
return e.to(index)
}),
void 0
)
if (n === index) return this.pause(), this.cycle(), void 0
var i = index > n ? S : x
this._slide(i, this._items[index])
}
}),
(e.dispose = function t() {
if (
(s['default'](this._element).off(p),
s['default'].removeData(this._element, f),
s['default'].removeData(this._element, h),
(this._items = null),
(this._config = null),
(this._element = null),
this._interval)
)
clearInterval(this._interval)
;(this._interval = null),
(this._isPaused = null),
(this._isSliding = null),
(this._activeElement = null),
(this._indicatorsElement = null)
}),
(e._getConfig = function t(e) {
return (
(e = a({}, Default, e)),
u['default'].typeCheckConfig(l, e, C),
e
)
}),
(e._handleSwipe = function t() {
var e = Math.abs(this.touchDeltaX)
if (!(e <= b)) {
var n = e / this.touchDeltaX
if (((this.touchDeltaX = 0), n > 0)) this.prev()
if (n < 0) this.next()
}
}),
(e._addEventListeners = function t() {
var e = this
if (this._config.keyboard)
s['default'](this._element).on(I, function (t) {
return e._keydown(t)
})
if ('hover' === this._config.pause)
s['default'](this._element)
.on(k, function (t) {
return e.pause(t)
})
.on(M, function (t) {
return e.cycle(t)
})
if (this._config.touch) this._addTouchEventListeners()
}),
(e._addTouchEventListeners = function t() {
var e = this
if (this._touchSupported) {
var n = function t(n) {
if (
e._pointerEvent &&
st[n.originalEvent.pointerType.toUpperCase()]
)
e.touchStartX = n.originalEvent.clientX
else if (!e._pointerEvent)
e.touchStartX = n.originalEvent.touches[0].clientX
},
move = function move(t) {
if (
t.originalEvent.touches &&
t.originalEvent.touches.length > 1
)
e.touchDeltaX = 0
else
e.touchDeltaX =
t.originalEvent.touches[0].clientX - e.touchStartX
},
i = function t(n) {
if (
e._pointerEvent &&
st[n.originalEvent.pointerType.toUpperCase()]
)
e.touchDeltaX = n.originalEvent.clientX - e.touchStartX
if ((e._handleSwipe(), 'hover' === e._config.pause)) {
if ((e.pause(), e.touchTimeout))
clearTimeout(e.touchTimeout)
e.touchTimeout = setTimeout(function (t) {
return e.cycle(t)
}, w + e._config.interval)
}
}
if (
(s['default'](this._element.querySelectorAll(tt)).on(
N,
function (t) {
return t.preventDefault()
}
),
this._pointerEvent)
)
s['default'](this._element).on(B, function (t) {
return n(t)
}),
s['default'](this._element).on(F, function (t) {
return i(t)
}),
this._element.classList.add(K)
else
s['default'](this._element).on(L, function (t) {
return n(t)
}),
s['default'](this._element).on(P, function (t) {
return move(t)
}),
s['default'](this._element).on(O, function (t) {
return i(t)
})
}
}),
(e._keydown = function t(e) {
if (!/input|textarea/i.test(e.target.tagName))
switch (e.which) {
case v:
e.preventDefault(), this.prev()
break
case y:
e.preventDefault(), this.next()
break
}
}),
(e._getItemIndex = function t(e) {
return (
(this._items =
e && e.parentNode
? [].slice.call(e.parentNode.querySelectorAll(J))
: []),
this._items.indexOf(e)
)
}),
(e._getItemByDirection = function t(e, n) {
var i = e === S,
o = e === x,
a = this._getItemIndex(n),
s = this._items.length - 1,
u
if (((o && 0 === a) || (i && a === s)) && !this._config.wrap)
return n
var l,
c = (a + (e === x ? -1 : 1)) % this._items.length
return -1 === c
? this._items[this._items.length - 1]
: this._items[c]
}),
(e._triggerSlideEvent = function t(e, n) {
var i = this._getItemIndex(e),
o = this._getItemIndex(this._element.querySelector(X)),
a = s['default'].Event(T, {
relatedTarget: e,
direction: n,
from: o,
to: i,
})
return s['default'](this._element).trigger(a), a
}),
(e._setActiveIndicatorElement = function t(e) {
if (this._indicatorsElement) {
var n = [].slice.call(
this._indicatorsElement.querySelectorAll(Z)
)
s['default'](n).removeClass($)
var i =
this._indicatorsElement.children[this._getItemIndex(e)]
if (i) s['default'](i).addClass($)
}
}),
(e._updateInterval = function t() {
var e = this._activeElement || this._element.querySelector(X)
if (e) {
var n = parseInt(e.getAttribute('data-interval'), 10)
if (n)
(this._config.defaultInterval =
this._config.defaultInterval || this._config.interval),
(this._config.interval = n)
else
this._config.interval =
this._config.defaultInterval || this._config.interval
}
}),
(e._slide = function e(n, i) {
var o = this,
a = this._element.querySelector(X),
l = this._getItemIndex(a),
c = i || (a && this._getItemByDirection(n, a)),
f = this._getItemIndex(c),
h = Boolean(this._interval),
p,
m,
g,
v
if (n === S) (p = V), (m = G), (g = A)
else (p = W), (m = j), (g = _)
if (c && s['default'](c).hasClass($))
return (this._isSliding = false), void 0
if (!this._triggerSlideEvent(c, g).isDefaultPrevented())
if (a && c) {
if (((this._isSliding = true), h)) this.pause()
this._setActiveIndicatorElement(c),
(this._activeElement = c)
var y = s['default'].Event(E, {
relatedTarget: c,
direction: g,
from: l,
to: f,
}),
w = null
if (s['default'](this._element).hasClass(H)) {
s['default'](c).addClass(m),
u['default'].reflow(c),
s['default'](a).addClass(p),
s['default'](c).addClass(p)
var b = u['default'].getTransitionDurationFromElement(a),
C = this._element.className,
x = /u-carousel-duration-(\d+)/.exec(C)
if (x && 2 === x.length) b = parseFloat(x[1]) || 0
if (h) {
var T =
parseFloat(t(this._element).attr('data-interval')) + b
if (Number.isFinite(T) && T > 0)
(w = this._config.interval),
(this._config.interval = T)
}
s['default'](a)
.one(u['default'].TRANSITION_END, function () {
s['default'](c)
.removeClass(p + ' ' + m)
.addClass($),
s['default'](a).removeClass($ + ' ' + m + ' ' + p),
(o._isSliding = false),
setTimeout(function () {
return s['default'](o._element).trigger(y)
}, 0)
})
.emulateTransitionEnd(b)
} else
s['default'](a).removeClass($),
s['default'](c).addClass($),
(this._isSliding = false),
s['default'](this._element).trigger(y)
if (h) this.cycle()
if (w) this._config.interval = w
}
}),
(Carousel._jQueryInterface = function t(e) {
return this.each(function () {
var data = s['default'](this).data(f),
t = a({}, Default, s['default'](this).data())
if ('object' == typeof e) t = a({}, t, e)
var n = 'string' == typeof e ? e : t.uSlide
if (!data) {
var o
if (
((data = new Carousel(this, t)),
s['default'](this).data(f, data),
!s['default'](this).data(h))
)
s['default'](this).data(h, new i(this, t))
}
if ('number' == typeof e) data.to(e)
else if ('string' == typeof n) {
if (void 0 === data[n])
throw new TypeError('No method named "' + n + '"')
data[n]()
} else if (t.interval && t.uRide) data.pause(), data.cycle()
})
}),
(Carousel._dataApiClickHandler = function t(e) {
var selector = u['default'].getSelectorFromElement(this)
if (selector) {
var n = s['default'](selector)[0]
if (n && s['default'](n).hasClass(H)) {
var i = a(
{},
s['default'](n).data(),
s['default'](this).data()
),
o = this.getAttribute('data-u-slide-to')
if (o) i.interval = false
if ((Carousel._jQueryInterface.call(s['default'](n), i), o))
s['default'](n).data(f).to(o)
e.preventDefault()
}
}
}),
o(Carousel, null, [
{
key: 'VERSION',
get: function t() {
return c
},
},
{
key: 'Default',
get: function t() {
return Default
},
},
]),
Carousel
)
})()
return (
s['default'](document).on(z, ot, Carousel._dataApiClickHandler),
s['default'](window).on(U, function () {
for (
var t = [].slice.call(document.querySelectorAll(at)),
e = 0,
n = t.length;
e < n;
e++
) {
var i = s['default'](t[e])
Carousel._jQueryInterface.call(i, i.data())
}
}),
(s['default'].fn[l] = Carousel._jQueryInterface),
(s['default'].fn[l].Constructor = Carousel),
(s['default'].fn[l].noConflict = function () {
return (s['default'].fn[l] = g), Carousel._jQueryInterface
}),
Carousel
)
})($, bootstrap.Util)),
(window.bootstrap = bootstrap)
},
917: function (t, e, n) {
'use strict'
function i(t) {
if (
((this.$element = o(t)),
(this.carousel = this.$element.data('bs.u-carousel')),
(this.options = o.extend({}, i.DEFAULTS, this.carousel._config)),
(this.startX = null),
(this.startY = null),
(this.startTime = null),
(this.cycling = null),
(this.$active = null),
(this.$items = null),
(this.$next = null),
(this.$prev = null),
(this.dx = null),
(this.sliding = false),
!this.$element.hasClass('u-form'))
)
this.$element
.on('touchstart.bs.u-carousel', this.touchstart.bind(this))
.on('touchmove.bs.u-carousel', this.touchmove.bind(this))
.on('touchend.bs.u-carousel', this.touchend.bind(this))
.on('u-slide.bs.u-carousel', this.startSliding.bind(this))
.on('slid.bs.u-carousel', this.stopSliding.bind(this))
}
t.exports = i
var o = n(17)
;(i.DEFAULTS = { swipe: 50 }),
(i.prototype.startSliding = function () {
this.sliding = true
}),
(i.prototype.stopSliding = function () {
this.sliding = false
}),
(i.prototype.touchstart = function (t) {
if (!this.sliding && this.options.swipe) {
var e = t.originalEvent.touches ? t.originalEvent.touches[0] : t
;(this.dx = 0),
(this.startX = e.pageX),
(this.startY = e.pageY),
(this.cycling = null),
(this.width = this.$element.width()),
(this.startTime = t.timeStamp)
}
}),
(i.prototype.touchmove = function (t) {
if (!this.sliding && this.options.swipe && this.startTime) {
var e = t.originalEvent.touches ? t.originalEvent.touches[0] : t,
n = e.pageX - this.startX,
i = e.pageY - this.startY
if (!(Math.abs(n) < Math.abs(i))) {
if (null === this.cycling)
if (((this.cycling = !!this.carousel.interval), this.cycling))
this.carousel.pause()
t.preventDefault(),
(this.dx = (n / (this.width || 1)) * 100),
this.swipe(this.dx)
}
}
}),
(i.prototype.touchend = function (t) {
if (!this.sliding && this.options.swipe && this.startTime)
if (this.$active) {
var all = o()
.add(this.$active)
.add(this.$prev)
.add(this.$next)
.carousel_transition(true),
e = (t.timeStamp - this.startTime) / 1e3,
n = Math.abs(this.dx / e)
if (this.dx > 40 || (this.dx > 0 && n > this.options.swipe))
this.carousel.prev()
else if (this.dx < -40 || (this.dx < 0 && n > this.options.swipe))
this.carousel.next()
else
this.$active
.one(o.support.transition.end, function () {
all.removeClass('u-carousel-item-prev u-carousel-item-next')
})
.emulateTransitionEnd(
1e3 * this.$active.css('transition-duration').slice(0, -1)
)
if ((all.css('transform', ''), this.cycling)) this.carousel.cycle()
;(this.$active = null), (this.startTime = null)
}
}),
(i.prototype.swipe = function (t) {
var e = this.$active || this.getActive()
if (t < 0) {
if (
(this.$prev
.css('transform', 'translate3d(0,0,0)')
.removeClass('u-carousel-item-prev')
.carousel_transition(true),
!this.$next.length || this.$next.hasClass('u-active'))
)
return
this.$next
.carousel_transition(false)
.addClass('u-carousel-item-next')
.css('transform', 'translate3d(' + (t + 100) + '%,0,0)')
} else {
if (
(this.$next
.css('transform', '')
.removeClass('u-carousel-item-next')
.carousel_transition(true),
!this.$prev.length || this.$prev.hasClass('u-active'))
)
return
this.$prev
.carousel_transition(false)
.addClass('u-carousel-item-prev')
.css('transform', 'translate3d(' + (t - 100) + '%,0,0)')
}
e.carousel_transition(false).css(
'transform',
'translate3d(' + t + '%, 0, 0)'
)
}),
(i.prototype.getActive = function () {
if (
((this.$active = this.$element.find('.u-carousel-item.u-active')),
(this.$items = this.$active.parent().children()),
(this.$next = this.$active.next()),
!this.$next.length && this.options.wrap)
)
this.$next = this.$items.first()
if (
((this.$prev = this.$active.prev()),
!this.$prev.length && this.options.wrap)
)
this.$prev = this.$items.last()
return this.$active
}),
(o.fn.carousel_transition = function (t) {
return (
(t = t ? '' : 'none'),
this.each(function () {
o(this).css('transition', t)
})
)
})
},
92: function (t, e, n) {
'use strict'
var i = n(21)
;(t.exports = i.md = i.md || {}), (i.md.algorithms = i.md.algorithms || {})
},
934: function (t, e, n) {
'use strict'
function i(t) {
var data = t.attr('data-map')
if (data) {
data = Utility.decodeJsonAttribute(data)
var e = t.contents()[0],
n = e.createElement('script')
;(n.type = 'text/javascript'),
(n.innerHTML =
'var data = ' +
JSON.stringify(data) +
';\n;' +
'var mapIframeApiReady = function () {\n' +
' parent.mapIframeApiReady(google, document.getElementById("map"), data);\n' +
'}')
var i = e.createElement('script')
if (
((i.type = 'text/javascript'),
(i.src =
'//maps.google.com/maps/api/js?key=' +
data.apiKey +
'&callback=mapIframeApiReady'),
data.lang)
)
i.src += '&language=' + data.lang
e.head.appendChild(n),
e.head.appendChild(i),
$(e.body).append(
'<style>' +
' #map { width: 100%; height: 100%; }' +
' body { margin: 0; }' +
' .marker-internal { width: 180px; font-weight: normal; }' +
' .marker-internal a { text-decoration: none; color:#427fed; }' +
' .marker-internal strong { font-weight: 500; font-size: 14px; }' +
'</style>' +
'<div id="map"></div>'
)
}
}
function o(t) {
var e = ''
if (t.title) e += '<strong>' + t.title + '</strong>'
if (t.description)
e += '<div>' + t.description.replace(/\n/g, '<br>') + '</div>'
if (t.linkUrl) {
var url, n
e +=
'<a href="' +
t.linkUrl +
'" target="_blank"><span>' +
(t.linkCaption || t.linkUrl) +
'</span></a>'
}
if (e) e = '<div class="marker-internal">' + e + '</div>'
return e
}
var MapsLoader = {}
;(window.loadMapsContent = function () {
$('iframe.map-content').each(function () {
var t = $(this)
if (0 === t.contents().find('#map').length) i(t)
})
}),
(window.mapIframeApiReady = function (google, t, data) {
data.markers = data.markers || []
var e = data.zoom
if (!e && 1 === data.markers.length) e = data.markers[0].zoom
if (!e) e = 14
if (
((e = parseInt(e, 10)),
(data.map = data.map || {}),
(data.map.zoom = e),
(data.map.mapTypeId =
'satellite' === data.typeId
? google.maps.MapTypeId.HYBRID
: google.maps.MapTypeId.ROADMAP),
data.markers.length)
)
data.map.center = data.markers[0].position
var map = new google.maps.Map(t, data.map || {}),
n = new google.maps.LatLngBounds()
if (
(data.markers.forEach(function (t) {
t.map = map
var e = new google.maps.Marker(t)
n.extend(new google.maps.LatLng(t.position.lat, t.position.lng))
var i = o(t)
if (i) {
var a = new google.maps.InfoWindow({
content: $('<textarea/>').html(i).text(),
})
e.addListener('click', function () {
a.open(e.get('map'), e)
})
}
}),
data.markers.length > 1 && e && !isNaN(e))
) {
map.fitBounds(n)
var i = google.maps.event.addListener(
map,
'zoom_changed',
function () {
if (
(google.maps.event.removeListener(i),
map.getZoom() > e || 0 === map.getZoom())
)
map.setZoom(e)
}
)
}
}),
(window.MapsLoader = MapsLoader)
},
935: function (t, e, n) {
'use strict'
function ResponsiveMenu(t, e) {
;(this.responsive = t), (this.root = e || i('body')), this.init()
}
t.exports = ResponsiveMenu
var i = window.jQuery
;(ResponsiveMenu.prototype.init = function init() {
if (this.root.is('body')) this.subscribe()
this.initStyles()
}),
(ResponsiveMenu.prototype.subscribe = function t() {
this.root.on(
'click',
'.u-menu .menu-collapse',
function (t) {
t.preventDefault()
var e = i(t.currentTarget).closest('.u-menu')
if (ResponsiveMenu.isActive(e)) this.close(e)
else this.open(e)
}.bind(this)
),
this.root.on(
'click',
'.u-menu .u-menu-close',
function (t) {
t.preventDefault()
var e = i(t.currentTarget).closest('.u-menu')
this.close(e)
}.bind(this)
),
this.root.on(
'click',
'.u-menu .u-menu-overlay',
function (t) {
var e = i(t.currentTarget).closest('.u-menu.open')
this.close(e)
}.bind(this)
),
this.root.find('.u-menu').on(
'click',
'.u-nav-container-collapse .u-nav-link',
function (t) {
var e = i(t.currentTarget),
n
if (!e.siblings('.u-nav-popup').length) {
var o = e.attr('href')
if (o && -1 !== o.indexOf('#')) {
var a = i(t.currentTarget).closest('.u-menu')
this.close(a)
}
}
}.bind(this)
),
this.root
.find('.u-menu:not(.u-menu-one-level)')
.on('click', '.u-nav-container-collapse .u-nav-link', function (t) {
var e = i(t.currentTarget).siblings('.u-nav-popup'),
nav,
n =
e.closest('.u-menu').attr('data-submenu-level') || 'on-click'
if (e.length && 'on-click' === n) {
t.preventDefault(),
t.stopPropagation(),
(t.returnValue = false),
e.one(
'transitionend webkitTransitionEnd oTransitionEnd',
function (t) {
t.stopPropagation(),
e.removeClass('animating'),
e.toggleClass('open'),
e.css({
'max-height': e.is('.open') ? 'none' : '',
visibility: '',
}),
e
.find('.open')
.removeClass('open')
.css('max-height', '')
}
),
e.css({ 'max-height': 'none', visibility: 'visible' })
var o = e.outerHeight()
e.css('max-height', e.is('.open') ? o : 0),
e.addClass('animating'),
e[0].offsetHeight,
e.css('max-height', e.is('.open') ? 0 : o)
}
if (e.length && 'with-reload' === n)
if (
i(this).attr('href') &&
i(this).attr('href').indexOf('#') > -1
)
if (window.location.href.indexOf(i(this).attr('href')) > -1)
window.location.reload(true)
else window.location = i(this).attr('href')
}),
i(window).on(
'resize',
function () {
if (this.screenWidth !== window.innerWidth)
i('.u-menu.open').each(
function (t, el) {
this.close(i(el))
}.bind(this)
)
}.bind(this)
),
i(document).keyup(
function (t) {
if (27 === t.keyCode)
i('.u-menu.open').each(
function (t, el) {
this.close(i(el))
}.bind(this)
)
}.bind(this)
),
i(this.root).on(
'mouseenter touchstart',
'.u-nav-container ul > li',
function (t) {
ResponsiveMenu.fixDirection(this.root, i(t.currentTarget))
}.bind(this)
)
}),
(ResponsiveMenu.prototype.initStyles = function t() {
this.root.find('.u-menu').each(function () {
var menu = i(this),
style = menu.find('.offcanvas-style'),
t =
menu
.find('.u-nav-container-collapse .u-sidenav')
.attr('data-offcanvas-width') || 250
if (!style.length)
(style = i('<style class="offcanvas-style"></style>')),
menu.append(style)
style.html(
' .u-offcanvas .u-sidenav { flex-basis: {width} !important; } .u-offcanvas:not(.u-menu-open-right) .u-sidenav { margin-left: -{width}; } .u-offcanvas.u-menu-open-right .u-sidenav { margin-right: -{width}; } @keyframes menu-shift-left { from { left: 0; } to { left: {width}; } } @keyframes menu-unshift-left { from { left: {width}; } to { left: 0; } } @keyframes menu-shift-right { from { right: 0; } to { right: {width}; } } @keyframes menu-unshift-right { from { right: {width}; } to { right: 0; } } '.replace(
/\{width\}/g,
t + 'px'
)
)
})
}),
(ResponsiveMenu.prototype.onResponsiveResize = function t() {
i('.u-menu').each(
function (t, el) {
var e = i(el).attr('data-responsive-from') || 'MD',
n = this.responsive.modes.indexOf(e)
if (-1 === n) n = 0
var o = this.responsive.modes.slice(n)
ResponsiveMenu.toggleResponsive(
el,
-1 !== o.indexOf(this.responsive.mode)
),
this.megaResize(el, 1)
}.bind(this)
)
}),
(ResponsiveMenu.toggleResponsive = function t(e, n) {
i(e).toggleClass('u-enable-responsive', n)
}),
(ResponsiveMenu.prototype.close = function close(menu, t) {
if (!window.app || !window.app.modes) {
if (ResponsiveMenu.isActive(menu)) this.closeMenu(menu, t)
} else if (
(this.closeMenu(menu, t),
this.setOverlayOpacity(menu),
ResponsiveMenu.isOffcanvasMode(menu))
)
app.modes().resetOffCanvas()
}),
(ResponsiveMenu.prototype.closeMenu = function t(menu, e) {
if ((this.enableScroll(), ResponsiveMenu.isOffcanvasMode(menu)))
this.offcanvasMenuClose(menu)
else this.overlayMenuClose(menu)
this.root.removeClass('menu-overlay'), this.hideOverlay(menu, e)
}),
(ResponsiveMenu.prototype.open = function open(menu) {
if (
(this.root.addClass('menu-overlay'), !window.app || !window.app.modes)
) {
if (!ResponsiveMenu.isActive(menu)) this.openMenu(menu)
} else if (
(this.setOverlayOpacity(menu),
this.openMenu(menu),
ResponsiveMenu.isOffcanvasMode(menu))
)
app.modes().setOffCanvas()
}),
(ResponsiveMenu.prototype.setOverlayOpacity = function t(menu) {
menu.find('.u-menu-overlay').css('opacity', '')
}),
(ResponsiveMenu.prototype.openMenu = function open(menu) {
if (
((this.screenWidth = window.innerWidth),
this.disableScroll(),
ResponsiveMenu.isOffcanvasMode(menu))
)
this.offcanvasMenuOpen(menu)
else this.overlayMenuOpen(menu)
this.showOverlay(menu)
}),
(ResponsiveMenu.prototype.offcanvasMenuOpen = function t(menu) {
var e = this.root
if (
(menu.addClass('open'),
e.addClass('u-offcanvas-opened'),
menu.is('.u-offcanvas-shift'))
)
e.addClass(
'u-offcanvas-shifted-' +
(menu.hasClass('u-menu-open-right') ? 'right' : 'left')
)
}),
(ResponsiveMenu.prototype.offcanvasMenuClose = function t(menu) {
if (
(menu.removeClass('open'),
this.root.removeClass(
'u-offcanvas-opened u-offcanvas-shifted-left u-offcanvas-shifted-right'
),
menu.is('.u-offcanvas-shift'))
)
this.root.addClass(
'u-offcanvas-unshifted-' +
(menu.hasClass('u-menu-open-right') ? 'right' : 'left')
)
}),
(ResponsiveMenu.prototype.megaResize = function t(menu, e) {
if (((menu = i(menu)), (e = e || 1), menu.hasClass('u-menu-mega')))
menu.outerHeight(),
menu.each(function () {
var menu = i(this)
menu.find('.u-mega-popup').each(function () {
var t = i(this),
n = t.attr('data-mega-width') || 'content'
if ('custom' !== n && 'content' !== n) {
var o =
'sheet' === n
? menu.closest('.u-sheet, .u-body')
: menu.closest('body, .u-body'),
a = o.offset(),
s = o.outerWidth()
if (
(t.css({ left: '', width: '' }),
t.removeClass('u-popup-left u-popup-right'),
t.addClass('u-hidden'),
menu.outerHeight(),
t.removeClass('u-hidden'),
menu.outerHeight(),
'content' === n)
)
return t.css('width', 'auto'), void 0
var u = t.offset(),
l = (a.left - u.left) / e,
c = parseFloat(t.css('left') || 0)
t.css({ left: c + Math.round(l) + 'px', width: s + 'px' })
}
})
})
}),
(ResponsiveMenu.prototype.hideOverlay = function t(menu, e) {
var overlay = menu.find('.u-menu-overlay'),
n = function () {
if (!ResponsiveMenu.isActive(menu))
menu.find('.u-nav-container-collapse').css('width', ''),
this.root.filter('body').find('header.u-sticky').css('top', '')
}.bind(this)
if (e) n()
else overlay.fadeOut(500, n)
}),
(ResponsiveMenu.prototype.showOverlay = function t(menu) {
var overlay = menu.find('.u-menu-overlay')
menu.find('.u-nav-container-collapse').css('width', '100%'),
overlay.fadeIn(500)
}),
(ResponsiveMenu.prototype.disableScroll = function t() {
if (this.root.is('body'))
document.documentElement.style.overflow = 'hidden'
}),
(ResponsiveMenu.prototype.enableScroll = function t() {
if (this.root.is('body')) document.documentElement.style.overflow = ''
}),
(ResponsiveMenu.prototype.overlayMenuOpen = function t(menu) {
menu.addClass('open')
}),
(ResponsiveMenu.prototype.overlayMenuClose = function t(menu) {
menu.removeClass('open')
}),
(ResponsiveMenu.isOffcanvasMode = function (menu) {
return menu.is('.u-offcanvas')
}),
(ResponsiveMenu.isActive = function (menu) {
return menu.hasClass('open')
}),
(ResponsiveMenu.fixDirection = function t(e, el) {
if (el && el.length) {
e = i(e)
var n = 'u-popup-left',
o = 'u-popup-right',
a
i(el)
.children('.u-nav-popup')
.each(function () {
var t = i(this)
t.removeClass(n + ' ' + o)
var a = t.parent().closest('.u-nav-popup'),
s = t.attr('data-mega-width') || 'content',
u = Boolean(a.length)
if ('content' === s) {
var l = ''
if (t.parents('.' + n).length) l = n
else if (t.parents('.' + o).length) l = o
if (l) t.addClass(l)
else {
var c = t[0].getBoundingClientRect(),
f = e[0].getBoundingClientRect(),
h =
'undefined' == typeof app ? 1 : app.editor.preview.scale,
p = c.right - f.right,
m = f.left - c.left
if (p > 1)
t.css('left', u ? '' : (f.right - c.right) / h + 'px'),
t.css('right', u ? '' : 'auto'),
t.addClass(n)
else if (m > 1)
t.css('left', u ? '' : '0px'),
t.css('right', u ? '' : 'auto'),
t.addClass(o)
}
}
})
}
}),
(window.ResponsiveMenu = ResponsiveMenu)
},
956: function (t, e, n) {
'use strict'
var i = n(17),
ProductBadge
t.exports.update = function update(t) {
if (!t || !t.length) t = i('.u-product-badge[data-product-created]')
t.each(function () {
var t = i(this),
e = t.attr('data-product-created'),
n,
o
if (Date.now() - e <= 30 * (60 * 60 * 24 * 1e3))
t.removeClass('u-hidden-block')
})
}
},
957: function (t, e, n) {
'use strict'
function i() {
this.$cart = $('.u-shopping-cart-icon').parent(
'.u-shopping-cart[href^="#"]'
)
}
var o = n(12613)
t.exports = i
var cart = null
;(i.getCart = function () {
if (!cart) cart = new i()
return cart
}),
(i.prototype.init = function init(data) {
var t = this.getProducts(),
products = data.products,
e = data.categories
if (t && products && products.length) {
var n = []
t.forEach(
function (product) {
var index = products.findIndex(function (t) {
return product.id === t.id
})
if (-1 !== index) {
var t = products[index]
if (((t.quantity = product.quantity || 1), !t.categoriesData))
t.categoriesData = this.getCategoriesData(t.categories, e)
n.push(t)
}
}.bind(this)
),
this.addProducts(n)
}
this.update()
}),
(i.prototype.getCategoriesData = function t(productCategories, e) {
var n = [],
i =
(document.body.getAttribute('data-path-to-root') || './') +
'products/products.html#/1///'
if (
((productCategories || []).forEach(function (id) {
var t = e.find(function (t) {
return t.id === id
})
if (t) n.push({ link: i + t.id, title: t.title })
}),
!n.length)
)
n.push({ link: i, title: 'Uncategorized' })
return n
}),
(i.prototype.clear = function t() {
o.remove(), this.update()
}),
(i.prototype.update = function update() {
if (this.$cart.length)
this.$cart.find('.u-shopping-cart-count').text(this.count())
}),
(i.prototype.count = function t() {
var products = this.getProducts()
if (!products) return 0
else
return products.reduce(function (t, product) {
return t + product.quantity
}, 0)
}),
(i.prototype.addProduct = function addProduct(product) {
var products = this.getProducts() || [],
t = product.name,
e = products.filter(function (el) {
return el.name === t
})[0]
if (e) e.quantity += 1
else products.push(product)
this.addProducts(products), this.update()
}),
(i.prototype.addProducts = function addProduct(products) {
o.add(JSON.stringify(products))
}),
(i.prototype.getProducts = function t() {
var storage = o.get()
if (!storage) return null
else return JSON.parse(storage)
}),
(i.prototype.removeProductById = function t(id) {
var products,
e = (this.getProducts() || []).filter(function (product) {
return product.id !== id
})
if (!e.length) this.clear()
else this.addProducts(e)
this.update()
}),
(window.PaymentCart = i)
},
})
//products slideshows
let currentSlideIndex = 0;
function moveSlide(direction) {
const carousel = document.querySelector('.carousel');
const items = document.querySelectorAll('.carousel-item');
const itemWidth = items[0].offsetWidth;
const totalItems = items.length;
// Number of visible items on the screen
const visibleItems = Math.round(carousel.offsetWidth / itemWidth);
// Adjust currentSlideIndex to handle direction
currentSlideIndex += direction;
// Ensure the index stays within bounds of available items
if (currentSlideIndex < 0) {
currentSlideIndex = 0;
} else if (currentSlideIndex > totalItems - visibleItems) {
currentSlideIndex = totalItems - visibleItems;
if (currentSlideIndex < 0) {
currentSlideIndex = 0;
}
}
const offset = -(currentSlideIndex * itemWidth);
carousel.style.transform = `translateX(${offset}px)`;
}
// Recalculate on window resize to ensure responsiveness
window.addEventListener('resize', function() {
currentSlideIndex = 0; // Reset to the first item when resizing
moveSlide(0); // Recalculate the carousel's item width and layout
});
// Slideshow functionality for each box
document.querySelectorAll('.image-slideshow').forEach(function (slideshow, i) {
let slides = slideshow.querySelectorAll('.slide');
let dots = slideshow.querySelectorAll('.dot');
let currentSlide = 0;
function showSlide(index) {
slides.forEach((slide, i) => {
slide.style.display = 'none';
dots[i].classList.remove('active');
});
slides[index].style.display = 'block';
dots[index].classList.add('active');
}
showSlide(currentSlide);
dots.forEach((dot, index) => {
dot.addEventListener('click', function () {
currentSlide = index;
showSlide(currentSlide);
});
});
});
// Lightbox functionality
const lightbox = document.getElementById('lightbox')
const lightboxImg = document.getElementById('lightbox-img')
const closeLightbox = document.querySelector('.close-lightbox')
// Show lightbox when an image is clicked
document.querySelectorAll('.image-slideshow img').forEach((img) => {
img.addEventListener('click', function () {
lightbox.style.display = 'flex' // Show lightbox
lightboxImg.src = this.src // Set lightbox image source to clicked image
})
})
// Close lightbox when "X" is clicked
closeLightbox.addEventListener('click', function () {
lightbox.style.display = 'none' // Hide lightbox
})
// Optional: Close lightbox when clicking outside the image
lightbox.addEventListener('click', function (e) {
if (e.target !== lightboxImg) {
lightbox.style.display = 'none' // Hide lightbox
}
})